[a6904c] | 1 | /**************************************** |
---|
| 2 | * Computer Algebra System SINGULAR * |
---|
| 3 | ****************************************/ |
---|
| 4 | /* $Id$ */ |
---|
| 5 | |
---|
| 6 | /* |
---|
| 7 | * ABSTRACT - the interpreter related ring operations |
---|
| 8 | */ |
---|
| 9 | |
---|
| 10 | /* includes */ |
---|
| 11 | #include <math.h> |
---|
[20b794] | 12 | |
---|
| 13 | #include <omalloc/omalloc.h> |
---|
[8e0bf8] | 14 | #include <misc/options.h> |
---|
[1745e5] | 15 | #include <misc/int64vec.h> |
---|
[7829fb] | 16 | |
---|
| 17 | #include <coeffs/numbers.h> |
---|
| 18 | #include <coeffs/coeffs.h> |
---|
| 19 | |
---|
[351a5f] | 20 | #include <polys/monomials/p_polys.h> |
---|
[7eb7b5] | 21 | #include <polys/simpleideals.h> |
---|
[20b794] | 22 | // #include <???/febase.h> |
---|
| 23 | // #include <???/intvec.h> |
---|
[7829fb] | 24 | // #include <coeffs/ffields.h> |
---|
[20b794] | 25 | #include <polys/monomials/ring.h> |
---|
[0cf29ee] | 26 | #include <polys/monomials/maps.h> |
---|
[20b794] | 27 | #include <polys/prCopy.h> |
---|
| 28 | // #include "../Singular/ipshell.h" |
---|
| 29 | #include <polys/templates/p_Procs.h> |
---|
[028192] | 30 | |
---|
| 31 | #include <polys/matpol.h> |
---|
| 32 | |
---|
[7829fb] | 33 | #include <polys/monomials/ring.h> |
---|
| 34 | |
---|
[a6904c] | 35 | #ifdef HAVE_PLURAL |
---|
[028192] | 36 | #include <polys/nc/nc.h> |
---|
| 37 | #include <polys/nc/sca.h> |
---|
[a6904c] | 38 | #endif |
---|
[6bec87] | 39 | // #include <???/maps.h> |
---|
| 40 | // #include <???/matpol.h> |
---|
[a6904c] | 41 | |
---|
[e82417] | 42 | |
---|
| 43 | #include "ext_fields/algext.h" |
---|
| 44 | #include "ext_fields/transext.h" |
---|
| 45 | |
---|
| 46 | |
---|
[a6904c] | 47 | #define BITS_PER_LONG 8*SIZEOF_LONG |
---|
| 48 | |
---|
[351a5f] | 49 | omBin sip_sring_bin = omGetSpecBin(sizeof(ip_sring)); |
---|
[a6904c] | 50 | |
---|
| 51 | static const char * const ringorder_name[] = |
---|
| 52 | { |
---|
| 53 | " ?", ///< ringorder_no = 0, |
---|
| 54 | "a", ///< ringorder_a, |
---|
| 55 | "A", ///< ringorder_a64, |
---|
| 56 | "c", ///< ringorder_c, |
---|
| 57 | "C", ///< ringorder_C, |
---|
| 58 | "M", ///< ringorder_M, |
---|
| 59 | "S", ///< ringorder_S, |
---|
| 60 | "s", ///< ringorder_s, |
---|
| 61 | "lp", ///< ringorder_lp, |
---|
| 62 | "dp", ///< ringorder_dp, |
---|
| 63 | "rp", ///< ringorder_rp, |
---|
| 64 | "Dp", ///< ringorder_Dp, |
---|
| 65 | "wp", ///< ringorder_wp, |
---|
| 66 | "Wp", ///< ringorder_Wp, |
---|
| 67 | "ls", ///< ringorder_ls, |
---|
| 68 | "ds", ///< ringorder_ds, |
---|
| 69 | "Ds", ///< ringorder_Ds, |
---|
| 70 | "ws", ///< ringorder_ws, |
---|
| 71 | "Ws", ///< ringorder_Ws, |
---|
| 72 | "L", ///< ringorder_L, |
---|
| 73 | "aa", ///< ringorder_aa |
---|
| 74 | "rs", ///< ringorder_rs, |
---|
| 75 | "IS", ///< ringorder_IS |
---|
| 76 | " _" ///< ringorder_unspec |
---|
| 77 | }; |
---|
| 78 | |
---|
[ee9101] | 79 | |
---|
[a6904c] | 80 | const char * rSimpleOrdStr(int ord) |
---|
| 81 | { |
---|
| 82 | return ringorder_name[ord]; |
---|
| 83 | } |
---|
| 84 | |
---|
| 85 | /// unconditionally deletes fields in r |
---|
| 86 | void rDelete(ring r); |
---|
| 87 | /// set r->VarL_Size, r->VarL_Offset, r->VarL_LowIndex |
---|
| 88 | static void rSetVarL(ring r); |
---|
| 89 | /// get r->divmask depending on bits per exponent |
---|
| 90 | static unsigned long rGetDivMask(int bits); |
---|
| 91 | /// right-adjust r->VarOffset |
---|
| 92 | static void rRightAdjustVarOffset(ring r); |
---|
| 93 | static void rOptimizeLDeg(ring r); |
---|
| 94 | |
---|
| 95 | /*0 implementation*/ |
---|
[dd012ca] | 96 | //BOOLEAN rField_is_R(ring r) |
---|
[a6904c] | 97 | //{ |
---|
[01c1d0] | 98 | // if (r->cf->ch== -1) |
---|
[a6904c] | 99 | // { |
---|
| 100 | // if (r->float_len==(short)0) return TRUE; |
---|
| 101 | // } |
---|
| 102 | // return FALSE; |
---|
| 103 | //} |
---|
| 104 | |
---|
[b388be] | 105 | /* |
---|
| 106 | |
---|
[a6904c] | 107 | /// internally changes the gloabl ring and resets the relevant |
---|
| 108 | /// global variables: |
---|
[b388be] | 109 | /// SHOULD BE DEPRECATED NOW...? |
---|
[a6904c] | 110 | void rChangeCurrRing(ring r) |
---|
| 111 | { |
---|
[4c6e420] | 112 | // if (!rMinpolyIsNULL(currRing)) |
---|
[a6904c] | 113 | // { |
---|
[01c1d0] | 114 | // omCheckAddr(currRing->cf->minpoly); |
---|
[a6904c] | 115 | // } |
---|
[b388be] | 116 | //------------ set global ring vars -------------------------------- |
---|
[351a5f] | 117 | //currRing = r; |
---|
| 118 | //currQuotient=NULL; |
---|
[a6904c] | 119 | if (r != NULL) |
---|
| 120 | { |
---|
| 121 | rTest(r); |
---|
[b388be] | 122 | //------------ set global ring vars -------------------------------- |
---|
[dd012ca] | 123 | //currQuotient=r->qideal; |
---|
[a6904c] | 124 | |
---|
[b388be] | 125 | //------------ global variables related to coefficients ------------ |
---|
[351a5f] | 126 | nSetChar(r->cf); |
---|
[a6904c] | 127 | |
---|
[b388be] | 128 | //------------ global variables related to polys ------------------- |
---|
[351a5f] | 129 | p_SetGlobals(r); |
---|
[b388be] | 130 | //------------ global variables related to factory ----------------- |
---|
[a6904c] | 131 | } |
---|
| 132 | } |
---|
[b388be] | 133 | */ |
---|
[a6904c] | 134 | |
---|
[17b0b05] | 135 | ring rDefault(const coeffs cf, int N, char **n,int ord_size, int *ord, int *block0, int *block1) |
---|
[a6904c] | 136 | { |
---|
[17e473] | 137 | assume( cf != NULL); |
---|
[a6904c] | 138 | ring r=(ring) omAlloc0Bin(sip_sring_bin); |
---|
| 139 | r->N = N; |
---|
[1ddd04] | 140 | r->cf = cf; |
---|
[01c1d0] | 141 | /*rPar(r) = 0; Alloc0 */ |
---|
[a6904c] | 142 | /*names*/ |
---|
[dd012ca] | 143 | r->names = (char **) omAlloc0(N * sizeof(char *)); |
---|
[a6904c] | 144 | int i; |
---|
| 145 | for(i=0;i<N;i++) |
---|
| 146 | { |
---|
| 147 | r->names[i] = omStrDup(n[i]); |
---|
| 148 | } |
---|
| 149 | /*weights: entries for 2 blocks: NULL*/ |
---|
[351a5f] | 150 | r->wvhdl = (int **)omAlloc0((ord_size+1) * sizeof(int *)); |
---|
[301c033] | 151 | r->order = ord; |
---|
| 152 | r->block0 = block0; |
---|
| 153 | r->block1 = block1; |
---|
[a6904c] | 154 | /*polynomial ring*/ |
---|
| 155 | r->OrdSgn = 1; |
---|
| 156 | |
---|
| 157 | /* complete ring intializations */ |
---|
| 158 | rComplete(r); |
---|
| 159 | return r; |
---|
| 160 | } |
---|
[1ddd04] | 161 | ring rDefault(int ch, int N, char **n,int ord_size, int *ord, int *block0, int *block1) |
---|
[301c033] | 162 | { |
---|
[1ddd04] | 163 | coeffs cf; |
---|
| 164 | if (ch==0) cf=nInitChar(n_Q,NULL); |
---|
| 165 | else cf=nInitChar(n_Zp,(void*)(long)ch); |
---|
[17e473] | 166 | assume( cf != NULL); |
---|
[1ddd04] | 167 | return rDefault(cf,N,n,ord_size,ord,block0,block1); |
---|
| 168 | } |
---|
[17b0b05] | 169 | ring rDefault(const coeffs cf, int N, char **n) |
---|
[f70f641] | 170 | { |
---|
[2c41bc] | 171 | assume( cf != NULL); |
---|
| 172 | /*order: lp,0*/ |
---|
| 173 | int *order = (int *) omAlloc(2* sizeof(int)); |
---|
| 174 | int *block0 = (int *)omAlloc0(2 * sizeof(int)); |
---|
| 175 | int *block1 = (int *)omAlloc0(2 * sizeof(int)); |
---|
| 176 | /* ringorder dp for the first block: var 1..N */ |
---|
| 177 | order[0] = ringorder_lp; |
---|
| 178 | block0[0] = 1; |
---|
| 179 | block1[0] = N; |
---|
| 180 | /* the last block: everything is 0 */ |
---|
| 181 | order[1] = 0; |
---|
| 182 | |
---|
| 183 | return rDefault(cf,N,n,2,order,block0,block1); |
---|
[1ddd04] | 184 | } |
---|
| 185 | |
---|
| 186 | ring rDefault(int ch, int N, char **n) |
---|
| 187 | { |
---|
| 188 | coeffs cf; |
---|
| 189 | if (ch==0) cf=nInitChar(n_Q,NULL); |
---|
| 190 | else cf=nInitChar(n_Zp,(void*)(long)ch); |
---|
[17e473] | 191 | assume( cf != NULL); |
---|
[1ddd04] | 192 | return rDefault(cf,N,n); |
---|
[301c033] | 193 | } |
---|
| 194 | |
---|
[a6904c] | 195 | /////////////////////////////////////////////////////////////////////////// |
---|
| 196 | // |
---|
| 197 | // rInit: define a new ring from sleftv's |
---|
| 198 | // |
---|
| 199 | //-> ipshell.cc |
---|
| 200 | |
---|
| 201 | ///////////////////////////// |
---|
| 202 | // Auxillary functions |
---|
| 203 | // |
---|
| 204 | |
---|
| 205 | // check intvec, describing the ordering |
---|
| 206 | BOOLEAN rCheckIV(intvec *iv) |
---|
| 207 | { |
---|
| 208 | if ((iv->length()!=2)&&(iv->length()!=3)) |
---|
| 209 | { |
---|
| 210 | WerrorS("weights only for orderings wp,ws,Wp,Ws,a,M"); |
---|
| 211 | return TRUE; |
---|
| 212 | } |
---|
| 213 | return FALSE; |
---|
| 214 | } |
---|
| 215 | |
---|
| 216 | int rTypeOfMatrixOrder(intvec * order) |
---|
| 217 | { |
---|
| 218 | int i=0,j,typ=1; |
---|
| 219 | int sz = (int)sqrt((double)(order->length()-2)); |
---|
| 220 | if ((sz*sz)!=(order->length()-2)) |
---|
| 221 | { |
---|
| 222 | WerrorS("Matrix order is not a square matrix"); |
---|
| 223 | typ=0; |
---|
| 224 | } |
---|
| 225 | while ((i<sz) && (typ==1)) |
---|
| 226 | { |
---|
| 227 | j=0; |
---|
| 228 | while ((j<sz) && ((*order)[j*sz+i+2]==0)) j++; |
---|
| 229 | if (j>=sz) |
---|
| 230 | { |
---|
| 231 | typ = 0; |
---|
| 232 | WerrorS("Matrix order not complete"); |
---|
| 233 | } |
---|
| 234 | else if ((*order)[j*sz+i+2]<0) |
---|
| 235 | typ = -1; |
---|
| 236 | else |
---|
| 237 | i++; |
---|
| 238 | } |
---|
| 239 | return typ; |
---|
| 240 | } |
---|
| 241 | |
---|
| 242 | /*2 |
---|
| 243 | * set a new ring from the data: |
---|
| 244 | s: name, chr: ch, varnames: rv, ordering: ord, typ: typ |
---|
| 245 | */ |
---|
| 246 | |
---|
| 247 | int r_IsRingVar(const char *n, ring r) |
---|
| 248 | { |
---|
| 249 | if ((r!=NULL) && (r->names!=NULL)) |
---|
| 250 | { |
---|
| 251 | for (int i=0; i<r->N; i++) |
---|
| 252 | { |
---|
| 253 | if (r->names[i]==NULL) return -1; |
---|
| 254 | if (strcmp(n,r->names[i]) == 0) return (int)i; |
---|
| 255 | } |
---|
| 256 | } |
---|
| 257 | return -1; |
---|
| 258 | } |
---|
| 259 | |
---|
| 260 | |
---|
| 261 | void rWrite(ring r) |
---|
| 262 | { |
---|
| 263 | if ((r==NULL)||(r->order==NULL)) |
---|
| 264 | return; /*to avoid printing after errors....*/ |
---|
| 265 | |
---|
| 266 | int nblocks=rBlocks(r); |
---|
| 267 | |
---|
| 268 | // omCheckAddrSize(r,sizeof(ip_sring)); |
---|
| 269 | omCheckAddrSize(r->order,nblocks*sizeof(int)); |
---|
| 270 | omCheckAddrSize(r->block0,nblocks*sizeof(int)); |
---|
| 271 | omCheckAddrSize(r->block1,nblocks*sizeof(int)); |
---|
[351a5f] | 272 | omCheckAddrSize(r->wvhdl,nblocks*sizeof(int *)); |
---|
[dd012ca] | 273 | omCheckAddrSize(r->names,r->N*sizeof(char *)); |
---|
[a6904c] | 274 | |
---|
| 275 | nblocks--; |
---|
| 276 | |
---|
[01c1d0] | 277 | n_CoeffWrite(r->cf); |
---|
| 278 | #if 0 |
---|
[a6904c] | 279 | { |
---|
| 280 | PrintS("// characteristic : "); |
---|
[4c6e420] | 281 | if (rParameter(r)!=NULL) |
---|
[a6904c] | 282 | { |
---|
| 283 | Print ("// %d parameter : ",rPar(r)); |
---|
[4c6e420] | 284 | char **sp= rParameter(r); |
---|
[a6904c] | 285 | int nop=0; |
---|
| 286 | while (nop<rPar(r)) |
---|
| 287 | { |
---|
| 288 | PrintS(*sp); |
---|
| 289 | PrintS(" "); |
---|
| 290 | sp++; nop++; |
---|
| 291 | } |
---|
| 292 | PrintS("\n// minpoly : "); |
---|
| 293 | if ( rField_is_long_C(r) ) |
---|
| 294 | { |
---|
| 295 | // i^2+1: |
---|
[4c6e420] | 296 | Print("(%s^2+1)\n",rParameter(r)[0]); |
---|
[a6904c] | 297 | } |
---|
[4c6e420] | 298 | else if (rMinpolyIsNULL(r)) |
---|
[a6904c] | 299 | { |
---|
| 300 | PrintS("0\n"); |
---|
| 301 | } |
---|
| 302 | else |
---|
| 303 | { |
---|
[01c1d0] | 304 | StringSetS(""); n_Write(r->cf->minpoly,r->cf); PrintS(StringAppendS("\n")); |
---|
[a6904c] | 305 | } |
---|
[1389a4] | 306 | //if (r->minideal!=NULL) |
---|
| 307 | //{ |
---|
| 308 | // iiWriteMatrix((matrix)r->minideal,"// minpolys",1,0); |
---|
| 309 | // PrintLn(); |
---|
| 310 | //} |
---|
[a6904c] | 311 | } |
---|
| 312 | } |
---|
[f70f641] | 313 | #endif |
---|
[a6904c] | 314 | Print("// number of vars : %d",r->N); |
---|
| 315 | |
---|
| 316 | //for (nblocks=0; r->order[nblocks]; nblocks++); |
---|
| 317 | nblocks=rBlocks(r)-1; |
---|
| 318 | |
---|
| 319 | for (int l=0, nlen=0 ; l<nblocks; l++) |
---|
| 320 | { |
---|
| 321 | int i; |
---|
| 322 | Print("\n// block %3d : ",l+1); |
---|
| 323 | |
---|
| 324 | Print("ordering %s", rSimpleOrdStr(r->order[l])); |
---|
| 325 | |
---|
| 326 | |
---|
| 327 | if (r->order[l] == ringorder_s) |
---|
| 328 | { |
---|
| 329 | assume( l == 0 ); |
---|
| 330 | #ifndef NDEBUG |
---|
| 331 | Print(" syzcomp at %d",r->typ[l].data.syz.limit); |
---|
| 332 | #endif |
---|
| 333 | continue; |
---|
| 334 | } |
---|
| 335 | else if (r->order[l] == ringorder_IS) |
---|
| 336 | { |
---|
[273fed] | 337 | assume( r->block0[l] == r->block1[l] ); |
---|
| 338 | const int s = r->block0[l]; |
---|
| 339 | assume( (-2 < s) && (s < 2) ); |
---|
| 340 | Print("(%d)", s); // 0 => prefix! +/-1 => suffix! |
---|
[a6904c] | 341 | continue; |
---|
| 342 | } |
---|
| 343 | else if ( |
---|
| 344 | ( (r->order[l] >= ringorder_lp) |
---|
| 345 | ||(r->order[l] == ringorder_M) |
---|
| 346 | ||(r->order[l] == ringorder_a) |
---|
| 347 | ||(r->order[l] == ringorder_a64) |
---|
| 348 | ||(r->order[l] == ringorder_aa) ) && (r->order[l] < ringorder_IS) ) |
---|
| 349 | { |
---|
| 350 | PrintS("\n// : names "); |
---|
| 351 | for (i = r->block0[l]-1; i<r->block1[l]; i++) |
---|
| 352 | { |
---|
| 353 | nlen = strlen(r->names[i]); |
---|
| 354 | Print(" %s",r->names[i]); |
---|
| 355 | } |
---|
| 356 | } |
---|
| 357 | |
---|
| 358 | if (r->wvhdl[l]!=NULL) |
---|
| 359 | { |
---|
| 360 | for (int j= 0; |
---|
| 361 | j<(r->block1[l]-r->block0[l]+1)*(r->block1[l]-r->block0[l]+1); |
---|
| 362 | j+=i) |
---|
| 363 | { |
---|
| 364 | PrintS("\n// : weights "); |
---|
| 365 | for (i = 0; i<=r->block1[l]-r->block0[l]; i++) |
---|
| 366 | { |
---|
| 367 | if (r->order[l] == ringorder_a64) |
---|
| 368 | { |
---|
| 369 | int64 *w=(int64 *)r->wvhdl[l]; |
---|
| 370 | #if SIZEOF_LONG == 4 |
---|
[bbcf1d2] | 371 | Print("%*lld " ,nlen,w[i+j]); |
---|
[a6904c] | 372 | #else |
---|
[bbcf1d2] | 373 | Print(" %*ld" ,nlen,w[i+j]); |
---|
[a6904c] | 374 | #endif |
---|
| 375 | } |
---|
| 376 | else |
---|
[bbcf1d2] | 377 | Print(" %*d" ,nlen,r->wvhdl[l][i+j]); |
---|
[a6904c] | 378 | } |
---|
| 379 | if (r->order[l]!=ringorder_M) break; |
---|
| 380 | } |
---|
| 381 | } |
---|
| 382 | } |
---|
| 383 | #ifdef HAVE_PLURAL |
---|
| 384 | if(rIsPluralRing(r)) |
---|
| 385 | { |
---|
| 386 | PrintS("\n// noncommutative relations:"); |
---|
[dd012ca] | 387 | poly pl=NULL; |
---|
| 388 | int nl; |
---|
| 389 | int i,j; |
---|
| 390 | for (i = 1; i<r->N; i++) |
---|
[a6904c] | 391 | { |
---|
[dd012ca] | 392 | for (j = i+1; j<=r->N; j++) |
---|
[a6904c] | 393 | { |
---|
[afa93a] | 394 | nl = n_IsOne(p_GetCoeff(MATELEM(r->GetNC()->C,i,j),r), r->cf); |
---|
[dd012ca] | 395 | if ( (MATELEM(r->GetNC()->D,i,j)!=NULL) || (!nl) ) |
---|
[a6904c] | 396 | { |
---|
[dd012ca] | 397 | Print("\n// %s%s=",r->names[j-1],r->names[i-1]); |
---|
| 398 | pl = MATELEM(r->GetNC()->MT[UPMATELEM(i,j,r->N)],1,1); |
---|
| 399 | p_Write0(pl, r, r); |
---|
[a6904c] | 400 | } |
---|
| 401 | } |
---|
| 402 | } |
---|
[8eda39] | 403 | #if 0 /*Singularg should not differ from Singular except in error case*/ |
---|
[a6904c] | 404 | Print("\n// noncommutative type:%d", (int)ncRingType(r)); |
---|
| 405 | Print("\n// is skew constant:%d",r->GetNC()->IsSkewConstant); |
---|
| 406 | if( rIsSCA(r) ) |
---|
| 407 | { |
---|
| 408 | Print("\n// alternating variables: [%d, %d]", scaFirstAltVar(r), scaLastAltVar(r)); |
---|
| 409 | const ideal Q = SCAQuotient(r); // resides within r! |
---|
| 410 | PrintS("\n// quotient of sca by ideal"); |
---|
| 411 | |
---|
| 412 | if (Q!=NULL) |
---|
| 413 | { |
---|
[b388be] | 414 | // if (r==currRing) |
---|
| 415 | // { |
---|
| 416 | // PrintLn(); |
---|
| 417 | // iiWriteMatrix((matrix)Q,"scaQ",1); |
---|
| 418 | // } |
---|
[f70f641] | 419 | // else |
---|
[b388be] | 420 | PrintS(" ..."); |
---|
[a6904c] | 421 | } |
---|
| 422 | else |
---|
| 423 | PrintS(" (NULL)"); |
---|
| 424 | } |
---|
| 425 | #endif |
---|
| 426 | } |
---|
| 427 | #endif |
---|
[1389a4] | 428 | //if (r->qideal!=NULL) |
---|
| 429 | //{ |
---|
| 430 | // PrintS("\n// quotient ring from ideal\n"); |
---|
| 431 | // iiWriteMatrix((matrix)r->qideal,"_",1); |
---|
| 432 | //} |
---|
[a6904c] | 433 | } |
---|
| 434 | |
---|
| 435 | void rDelete(ring r) |
---|
| 436 | { |
---|
| 437 | int i, j; |
---|
| 438 | |
---|
| 439 | if (r == NULL) return; |
---|
| 440 | |
---|
| 441 | #ifdef HAVE_PLURAL |
---|
| 442 | if (rIsPluralRing(r)) |
---|
| 443 | nc_rKill(r); |
---|
| 444 | #endif |
---|
| 445 | |
---|
[01c1d0] | 446 | nKillChar(r->cf); r->cf = NULL; |
---|
[a6904c] | 447 | rUnComplete(r); |
---|
| 448 | // delete order stuff |
---|
| 449 | if (r->order != NULL) |
---|
| 450 | { |
---|
| 451 | i=rBlocks(r); |
---|
| 452 | assume(r->block0 != NULL && r->block1 != NULL && r->wvhdl != NULL); |
---|
| 453 | // delete order |
---|
| 454 | omFreeSize((ADDRESS)r->order,i*sizeof(int)); |
---|
| 455 | omFreeSize((ADDRESS)r->block0,i*sizeof(int)); |
---|
| 456 | omFreeSize((ADDRESS)r->block1,i*sizeof(int)); |
---|
| 457 | // delete weights |
---|
| 458 | for (j=0; j<i; j++) |
---|
| 459 | { |
---|
| 460 | if (r->wvhdl[j]!=NULL) |
---|
| 461 | omFree(r->wvhdl[j]); |
---|
| 462 | } |
---|
| 463 | omFreeSize((ADDRESS)r->wvhdl,i*sizeof(int *)); |
---|
| 464 | } |
---|
| 465 | else |
---|
| 466 | { |
---|
| 467 | assume(r->block0 == NULL && r->block1 == NULL && r->wvhdl == NULL); |
---|
| 468 | } |
---|
| 469 | |
---|
| 470 | // delete varnames |
---|
| 471 | if(r->names!=NULL) |
---|
| 472 | { |
---|
| 473 | for (i=0; i<r->N; i++) |
---|
| 474 | { |
---|
| 475 | if (r->names[i] != NULL) omFree((ADDRESS)r->names[i]); |
---|
| 476 | } |
---|
[dd012ca] | 477 | omFreeSize((ADDRESS)r->names,r->N*sizeof(char *)); |
---|
[a6904c] | 478 | } |
---|
| 479 | |
---|
[95c1fa] | 480 | // // delete parameter |
---|
[4c6e420] | 481 | // if (rParameter(r)!=NULL) |
---|
[95c1fa] | 482 | // { |
---|
[4c6e420] | 483 | // char **s= rParameter(r); |
---|
[95c1fa] | 484 | // j = 0; |
---|
| 485 | // while (j < rPar(r)) |
---|
| 486 | // { |
---|
| 487 | // if (*s != NULL) omFree((ADDRESS)*s); |
---|
| 488 | // s++; |
---|
| 489 | // j++; |
---|
| 490 | // } |
---|
[4c6e420] | 491 | // omFreeSize((ADDRESS)rParameter(r),rPar(r)*sizeof(char *)); |
---|
[95c1fa] | 492 | // } |
---|
[a6904c] | 493 | omFreeBin(r, sip_sring_bin); |
---|
| 494 | } |
---|
| 495 | |
---|
| 496 | int rOrderName(char * ordername) |
---|
| 497 | { |
---|
| 498 | int order=ringorder_unspec; |
---|
| 499 | while (order!= 0) |
---|
| 500 | { |
---|
| 501 | if (strcmp(ordername,rSimpleOrdStr(order))==0) |
---|
| 502 | break; |
---|
| 503 | order--; |
---|
| 504 | } |
---|
| 505 | if (order==0) Werror("wrong ring order `%s`",ordername); |
---|
| 506 | omFree((ADDRESS)ordername); |
---|
| 507 | return order; |
---|
| 508 | } |
---|
| 509 | |
---|
| 510 | char * rOrdStr(ring r) |
---|
| 511 | { |
---|
| 512 | if ((r==NULL)||(r->order==NULL)) return omStrDup(""); |
---|
| 513 | int nblocks,l,i; |
---|
| 514 | |
---|
| 515 | for (nblocks=0; r->order[nblocks]; nblocks++); |
---|
| 516 | nblocks--; |
---|
| 517 | |
---|
| 518 | StringSetS(""); |
---|
| 519 | for (l=0; ; l++) |
---|
| 520 | { |
---|
| 521 | StringAppendS((char *)rSimpleOrdStr(r->order[l])); |
---|
[273fed] | 522 | if ( |
---|
| 523 | (r->order[l] != ringorder_c) |
---|
| 524 | && (r->order[l] != ringorder_C) |
---|
| 525 | && (r->order[l] != ringorder_s) |
---|
| 526 | && (r->order[l] != ringorder_S) |
---|
| 527 | && (r->order[l] != ringorder_IS) |
---|
| 528 | ) |
---|
[a6904c] | 529 | { |
---|
| 530 | if (r->wvhdl[l]!=NULL) |
---|
| 531 | { |
---|
| 532 | StringAppendS("("); |
---|
| 533 | for (int j= 0; |
---|
| 534 | j<(r->block1[l]-r->block0[l]+1)*(r->block1[l]-r->block0[l]+1); |
---|
| 535 | j+=i+1) |
---|
| 536 | { |
---|
| 537 | char c=','; |
---|
| 538 | if(r->order[l]==ringorder_a64) |
---|
| 539 | { |
---|
| 540 | int64 * w=(int64 *)r->wvhdl[l]; |
---|
| 541 | for (i = 0; i<r->block1[l]-r->block0[l]; i++) |
---|
| 542 | { |
---|
| 543 | StringAppend("%lld," ,w[i]); |
---|
| 544 | } |
---|
| 545 | StringAppend("%lld)" ,w[i]); |
---|
| 546 | break; |
---|
| 547 | } |
---|
| 548 | else |
---|
| 549 | { |
---|
| 550 | for (i = 0; i<r->block1[l]-r->block0[l]; i++) |
---|
| 551 | { |
---|
| 552 | StringAppend("%d," ,r->wvhdl[l][i+j]); |
---|
| 553 | } |
---|
| 554 | } |
---|
| 555 | if (r->order[l]!=ringorder_M) |
---|
| 556 | { |
---|
| 557 | StringAppend("%d)" ,r->wvhdl[l][i+j]); |
---|
| 558 | break; |
---|
| 559 | } |
---|
| 560 | if (j+i+1==(r->block1[l]-r->block0[l]+1)*(r->block1[l]-r->block0[l]+1)) |
---|
| 561 | c=')'; |
---|
| 562 | StringAppend("%d%c" ,r->wvhdl[l][i+j],c); |
---|
| 563 | } |
---|
| 564 | } |
---|
| 565 | else |
---|
| 566 | StringAppend("(%d)",r->block1[l]-r->block0[l]+1); |
---|
| 567 | } |
---|
[273fed] | 568 | else if (r->order[l] == ringorder_IS) |
---|
| 569 | { |
---|
| 570 | assume( r->block0[l] == r->block1[l] ); |
---|
| 571 | const int s = r->block0[l]; |
---|
| 572 | assume( (-2 < s) && (s < 2) ); |
---|
| 573 | |
---|
| 574 | StringAppend("(%d)", s); |
---|
| 575 | } |
---|
| 576 | |
---|
[a6904c] | 577 | if (l==nblocks) return omStrDup(StringAppendS("")); |
---|
| 578 | StringAppendS(","); |
---|
| 579 | } |
---|
| 580 | } |
---|
| 581 | |
---|
| 582 | char * rVarStr(ring r) |
---|
| 583 | { |
---|
| 584 | if ((r==NULL)||(r->names==NULL)) return omStrDup(""); |
---|
| 585 | int i; |
---|
| 586 | int l=2; |
---|
| 587 | char *s; |
---|
| 588 | |
---|
| 589 | for (i=0; i<r->N; i++) |
---|
| 590 | { |
---|
| 591 | l+=strlen(r->names[i])+1; |
---|
| 592 | } |
---|
| 593 | s=(char *)omAlloc((long)l); |
---|
| 594 | s[0]='\0'; |
---|
| 595 | for (i=0; i<r->N-1; i++) |
---|
| 596 | { |
---|
| 597 | strcat(s,r->names[i]); |
---|
| 598 | strcat(s,","); |
---|
| 599 | } |
---|
| 600 | strcat(s,r->names[i]); |
---|
| 601 | return s; |
---|
| 602 | } |
---|
| 603 | |
---|
| 604 | char * rCharStr(ring r) |
---|
| 605 | { |
---|
| 606 | char *s; |
---|
| 607 | int i; |
---|
| 608 | |
---|
| 609 | #ifdef HAVE_RINGS |
---|
| 610 | if (rField_is_Ring_Z(r)) |
---|
| 611 | { |
---|
[17e473] | 612 | s=omStrDup("integer"); // Z |
---|
[a6904c] | 613 | return s; |
---|
| 614 | } |
---|
| 615 | if(rField_is_Ring_2toM(r)) |
---|
| 616 | { |
---|
[c380cd] | 617 | char* s = (char*) omAlloc(7+10+2); |
---|
[03bf55] | 618 | sprintf(s,"integer,%lu",r->cf->modExponent); |
---|
[c380cd] | 619 | return s; |
---|
[a6904c] | 620 | } |
---|
| 621 | if(rField_is_Ring_ModN(r)) |
---|
| 622 | { |
---|
[03bf55] | 623 | long l = (long)mpz_sizeinbase(r->cf->modBase, 10) + 2+7; |
---|
[c380cd] | 624 | char* s = (char*) omAlloc(l); |
---|
[03bf55] | 625 | gmp_sprintf(s,"integer,%Zd",r->cf->modBase); |
---|
[c380cd] | 626 | return s; |
---|
[a6904c] | 627 | } |
---|
| 628 | if(rField_is_Ring_PtoM(r)) |
---|
| 629 | { |
---|
[03bf55] | 630 | long l = (long)mpz_sizeinbase(r->cf->modBase, 10) + 2+7+10; |
---|
[c380cd] | 631 | char* s = (char*) omAlloc(l); |
---|
[03bf55] | 632 | gmp_sprintf(s,"integer,%Zd^%lu",r->cf->modBase,r->cf->modExponent); |
---|
[c380cd] | 633 | return s; |
---|
[a6904c] | 634 | } |
---|
| 635 | #endif |
---|
[4c6e420] | 636 | if (rParameter(r)==NULL) |
---|
[a6904c] | 637 | { |
---|
[01c1d0] | 638 | i=r->cf->ch; |
---|
[a6904c] | 639 | if(i==-1) |
---|
| 640 | s=omStrDup("real"); /* R */ |
---|
| 641 | else |
---|
| 642 | { |
---|
| 643 | s=(char *)omAlloc(MAX_INT_LEN+1); |
---|
| 644 | sprintf(s,"%d",i); /* Q, Z/p */ |
---|
| 645 | } |
---|
| 646 | return s; |
---|
| 647 | } |
---|
| 648 | if (rField_is_long_C(r)) |
---|
| 649 | { |
---|
[4c6e420] | 650 | s=(char *)omAlloc(21+strlen(rParameter(r)[0])); |
---|
| 651 | sprintf(s,"complex,%d,%s",r->float_len,rParameter(r)[0]); /* C */ |
---|
[a6904c] | 652 | return s; |
---|
| 653 | } |
---|
| 654 | int l=0; |
---|
| 655 | for(i=0; i<rPar(r);i++) |
---|
| 656 | { |
---|
[4c6e420] | 657 | l+=(strlen(rParameter(r)[i])+1); |
---|
[a6904c] | 658 | } |
---|
| 659 | s=(char *)omAlloc((long)(l+MAX_INT_LEN+1)); |
---|
| 660 | s[0]='\0'; |
---|
[01c1d0] | 661 | if (r->cf->ch<0) sprintf(s,"%d",-r->cf->ch); /* Fp(a) */ |
---|
| 662 | else if (r->cf->ch==1) sprintf(s,"0"); /* Q(a) */ |
---|
[a6904c] | 663 | else |
---|
| 664 | { |
---|
[4c6e420] | 665 | sprintf(s,"%d,%s",r->cf->ch,rParameter(r)[0]); /* GF(q) */ |
---|
[a6904c] | 666 | return s; |
---|
| 667 | } |
---|
| 668 | char tt[2]; |
---|
| 669 | tt[0]=','; |
---|
| 670 | tt[1]='\0'; |
---|
| 671 | for(i=0; i<rPar(r);i++) |
---|
| 672 | { |
---|
| 673 | strcat(s,tt); |
---|
[4c6e420] | 674 | strcat(s,rParameter(r)[i]); |
---|
[a6904c] | 675 | } |
---|
| 676 | return s; |
---|
| 677 | } |
---|
| 678 | |
---|
| 679 | char * rParStr(ring r) |
---|
| 680 | { |
---|
[4c6e420] | 681 | if ((r==NULL)||(rParameter(r)==NULL)) return omStrDup(""); |
---|
[a6904c] | 682 | |
---|
| 683 | int i; |
---|
| 684 | int l=2; |
---|
| 685 | |
---|
| 686 | for (i=0; i<rPar(r); i++) |
---|
| 687 | { |
---|
[4c6e420] | 688 | l+=strlen(rParameter(r)[i])+1; |
---|
[a6904c] | 689 | } |
---|
| 690 | char *s=(char *)omAlloc((long)l); |
---|
| 691 | s[0]='\0'; |
---|
| 692 | for (i=0; i<rPar(r)-1; i++) |
---|
| 693 | { |
---|
[4c6e420] | 694 | strcat(s,rParameter(r)[i]); |
---|
[a6904c] | 695 | strcat(s,","); |
---|
| 696 | } |
---|
[4c6e420] | 697 | strcat(s,rParameter(r)[i]); |
---|
[a6904c] | 698 | return s; |
---|
| 699 | } |
---|
| 700 | |
---|
| 701 | char * rString(ring r) |
---|
| 702 | { |
---|
| 703 | char *ch=rCharStr(r); |
---|
| 704 | char *var=rVarStr(r); |
---|
| 705 | char *ord=rOrdStr(r); |
---|
| 706 | char *res=(char *)omAlloc(strlen(ch)+strlen(var)+strlen(ord)+9); |
---|
| 707 | sprintf(res,"(%s),(%s),(%s)",ch,var,ord); |
---|
| 708 | omFree((ADDRESS)ch); |
---|
| 709 | omFree((ADDRESS)var); |
---|
| 710 | omFree((ADDRESS)ord); |
---|
| 711 | return res; |
---|
| 712 | } |
---|
| 713 | |
---|
| 714 | |
---|
[df2551] | 715 | static int binaryPower (const int a, const int b) |
---|
[a6904c] | 716 | { |
---|
| 717 | /* computes a^b according to the binary representation of b, |
---|
| 718 | i.e., a^7 = a^4 * a^2 * a^1. This saves some multiplications. */ |
---|
| 719 | int result = 1; |
---|
| 720 | int factor = a; |
---|
| 721 | int bb = b; |
---|
| 722 | while (bb != 0) |
---|
| 723 | { |
---|
| 724 | if (bb % 2 != 0) result = result * factor; |
---|
| 725 | bb = bb / 2; |
---|
| 726 | factor = factor * factor; |
---|
| 727 | } |
---|
| 728 | return result; |
---|
| 729 | } |
---|
| 730 | |
---|
[488808e] | 731 | /* we keep this otherwise superfluous method for compatibility reasons |
---|
| 732 | towards the SINGULAR svn trunk */ |
---|
| 733 | int rChar(ring r) { return r->cf->ch; } |
---|
[a6904c] | 734 | |
---|
[48620a] | 735 | typedef char * char_ptr; |
---|
| 736 | omBin char_ptr_bin = omGetSpecBin(sizeof(char_ptr)); // deallocation? |
---|
| 737 | |
---|
[59f768a] | 738 | |
---|
[b388be] | 739 | // creates a commutative nc extension; "converts" comm.ring to a Plural ring |
---|
[59f768a] | 740 | #ifdef HAVE_PLURAL |
---|
[b388be] | 741 | ring nc_rCreateNCcomm_rCopy(ring r) |
---|
| 742 | { |
---|
| 743 | r = rCopy(r); |
---|
[f70f641] | 744 | if (rIsPluralRing(r)) |
---|
[b388be] | 745 | return r; |
---|
| 746 | |
---|
| 747 | matrix C = mpNew(r->N,r->N); // ring-independent!?! |
---|
| 748 | matrix D = mpNew(r->N,r->N); |
---|
| 749 | |
---|
| 750 | for(int i=1; i<r->N; i++) |
---|
| 751 | for(int j=i+1; j<=r->N; j++) |
---|
| 752 | MATELEM(C,i,j) = p_One( r); |
---|
| 753 | |
---|
| 754 | if (nc_CallPlural(C, D, NULL, NULL, r, false, true, false, r/*??currRing??*/, TRUE)) // TODO: what about quotient ideal? |
---|
| 755 | WarnS("Error initializing multiplication!"); // No reaction!??? |
---|
| 756 | |
---|
| 757 | return r; |
---|
| 758 | } |
---|
[59f768a] | 759 | #endif |
---|
| 760 | |
---|
[b388be] | 761 | |
---|
[a6904c] | 762 | /*2 |
---|
| 763 | *returns -1 for not compatible, (sum is undefined) |
---|
| 764 | * 1 for compatible (and sum) |
---|
| 765 | */ |
---|
[9ae29a] | 766 | /* vartest: test for variable/paramter names |
---|
[a6904c] | 767 | * dp_dp: for comm. rings: use block order dp + dp/ds/wp |
---|
| 768 | */ |
---|
[9ae29a] | 769 | int rSumInternal(ring r1, ring r2, ring &sum, BOOLEAN vartest, BOOLEAN dp_dp) |
---|
[a6904c] | 770 | { |
---|
[01c1d0] | 771 | |
---|
[a6904c] | 772 | ip_sring tmpR; |
---|
| 773 | memset(&tmpR,0,sizeof(tmpR)); |
---|
| 774 | /* check coeff. field =====================================================*/ |
---|
[01c1d0] | 775 | |
---|
[3dbe0bf] | 776 | if (r1->cf==r2->cf) |
---|
[a6904c] | 777 | { |
---|
[3dbe0bf] | 778 | tmpR.cf=r1->cf; |
---|
| 779 | r1->cf->ref++; |
---|
[a6904c] | 780 | } |
---|
[3dbe0bf] | 781 | else /* different type */ |
---|
[a6904c] | 782 | { |
---|
[f70f641] | 783 | if (getCoeffType(r1->cf)==n_Zp) |
---|
[a6904c] | 784 | { |
---|
[f70f641] | 785 | if (getCoeffType(r2->cf)==n_Q) |
---|
[a6904c] | 786 | { |
---|
[f70f641] | 787 | tmpR.cf=r1->cf; |
---|
| 788 | r1->cf->ref++; |
---|
[a6904c] | 789 | } |
---|
[f70f641] | 790 | else |
---|
[a6904c] | 791 | { |
---|
[f70f641] | 792 | WerrorS("Z/p+..."); |
---|
[a6904c] | 793 | return -1; |
---|
| 794 | } |
---|
| 795 | } |
---|
[f70f641] | 796 | else if (getCoeffType(r1->cf)==n_R) |
---|
[a6904c] | 797 | { |
---|
| 798 | WerrorS("R+.."); |
---|
| 799 | return -1; |
---|
| 800 | } |
---|
[f70f641] | 801 | else if (getCoeffType(r1->cf)==n_Q) |
---|
[a6904c] | 802 | { |
---|
[f70f641] | 803 | if (getCoeffType(r2->cf)==n_Zp) |
---|
[a6904c] | 804 | { |
---|
[f70f641] | 805 | tmpR.cf=r2->cf; |
---|
| 806 | r2->cf->ref++; |
---|
[a6904c] | 807 | } |
---|
| 808 | else |
---|
| 809 | { |
---|
[f70f641] | 810 | WerrorS("Q+..."); |
---|
[a6904c] | 811 | return -1; |
---|
| 812 | } |
---|
| 813 | } |
---|
[f70f641] | 814 | else |
---|
[a6904c] | 815 | { |
---|
[f70f641] | 816 | WerrorS("coeff sum not yet implemented"); |
---|
| 817 | return -1; |
---|
[a6904c] | 818 | } |
---|
| 819 | } |
---|
| 820 | /* variable names ========================================================*/ |
---|
| 821 | int i,j,k; |
---|
| 822 | int l=r1->N+r2->N; |
---|
[dd012ca] | 823 | char **names=(char **)omAlloc0(l*sizeof(char *)); |
---|
[a6904c] | 824 | k=0; |
---|
| 825 | |
---|
| 826 | // collect all varnames from r1, except those which are parameters |
---|
| 827 | // of r2, or those which are the empty string |
---|
| 828 | for (i=0;i<r1->N;i++) |
---|
| 829 | { |
---|
| 830 | BOOLEAN b=TRUE; |
---|
| 831 | |
---|
| 832 | if (*(r1->names[i]) == '\0') |
---|
| 833 | b = FALSE; |
---|
[4c6e420] | 834 | else if ((rParameter(r2)!=NULL) && (strlen(r1->names[i])==1)) |
---|
[9ae29a] | 835 | { |
---|
| 836 | if (vartest) |
---|
| 837 | { |
---|
| 838 | for(j=0;j<rPar(r2);j++) |
---|
| 839 | { |
---|
[4c6e420] | 840 | if (strcmp(r1->names[i],rParameter(r2)[j])==0) |
---|
[9ae29a] | 841 | { |
---|
| 842 | b=FALSE; |
---|
| 843 | break; |
---|
| 844 | } |
---|
| 845 | } |
---|
| 846 | } |
---|
| 847 | } |
---|
[a6904c] | 848 | |
---|
| 849 | if (b) |
---|
| 850 | { |
---|
| 851 | //Print("name : %d: %s\n",k,r1->names[i]); |
---|
| 852 | names[k]=omStrDup(r1->names[i]); |
---|
| 853 | k++; |
---|
| 854 | } |
---|
| 855 | //else |
---|
| 856 | // Print("no name (par1) %s\n",r1->names[i]); |
---|
| 857 | } |
---|
| 858 | // Add variables from r2, except those which are parameters of r1 |
---|
| 859 | // those which are empty strings, and those which equal a var of r1 |
---|
| 860 | for(i=0;i<r2->N;i++) |
---|
| 861 | { |
---|
| 862 | BOOLEAN b=TRUE; |
---|
| 863 | |
---|
| 864 | if (*(r2->names[i]) == '\0') |
---|
| 865 | b = FALSE; |
---|
[4c6e420] | 866 | else if ((rParameter(r1)!=NULL) && (strlen(r2->names[i])==1)) |
---|
[9ae29a] | 867 | { |
---|
| 868 | if (vartest) |
---|
| 869 | { |
---|
| 870 | for(j=0;j<rPar(r1);j++) |
---|
| 871 | { |
---|
[4c6e420] | 872 | if (strcmp(r2->names[i],rParameter(r1)[j])==0) |
---|
[9ae29a] | 873 | { |
---|
| 874 | b=FALSE; |
---|
| 875 | break; |
---|
| 876 | } |
---|
| 877 | } |
---|
| 878 | } |
---|
| 879 | } |
---|
[a6904c] | 880 | |
---|
| 881 | if (b) |
---|
| 882 | { |
---|
[9ae29a] | 883 | if (vartest) |
---|
| 884 | { |
---|
| 885 | for(j=0;j<r1->N;j++) |
---|
| 886 | { |
---|
| 887 | if (strcmp(r1->names[j],r2->names[i])==0) |
---|
| 888 | { |
---|
| 889 | b=FALSE; |
---|
| 890 | break; |
---|
| 891 | } |
---|
| 892 | } |
---|
| 893 | } |
---|
| 894 | if (b) |
---|
| 895 | { |
---|
| 896 | //Print("name : %d : %s\n",k,r2->names[i]); |
---|
| 897 | names[k]=omStrDup(r2->names[i]); |
---|
| 898 | k++; |
---|
| 899 | } |
---|
| 900 | //else |
---|
| 901 | // Print("no name (var): %s\n",r2->names[i]); |
---|
[a6904c] | 902 | } |
---|
| 903 | //else |
---|
| 904 | // Print("no name (par): %s\n",r2->names[i]); |
---|
| 905 | } |
---|
| 906 | // check whether we found any vars at all |
---|
| 907 | if (k == 0) |
---|
| 908 | { |
---|
| 909 | names[k]=omStrDup(""); |
---|
| 910 | k=1; |
---|
| 911 | } |
---|
| 912 | tmpR.N=k; |
---|
| 913 | tmpR.names=names; |
---|
| 914 | /* ordering *======================================================== */ |
---|
| 915 | tmpR.OrdSgn=1; |
---|
| 916 | if (dp_dp |
---|
| 917 | #ifdef HAVE_PLURAL |
---|
| 918 | && !rIsPluralRing(r1) && !rIsPluralRing(r2) |
---|
| 919 | #endif |
---|
| 920 | ) |
---|
| 921 | { |
---|
| 922 | tmpR.order=(int*)omAlloc(4*sizeof(int)); |
---|
| 923 | tmpR.block0=(int*)omAlloc0(4*sizeof(int)); |
---|
| 924 | tmpR.block1=(int*)omAlloc0(4*sizeof(int)); |
---|
[351a5f] | 925 | tmpR.wvhdl=(int**)omAlloc0(4*sizeof(int *)); |
---|
[a6904c] | 926 | tmpR.order[0]=ringorder_dp; |
---|
| 927 | tmpR.block0[0]=1; |
---|
| 928 | tmpR.block1[0]=rVar(r1); |
---|
| 929 | if (r2->OrdSgn==1) |
---|
| 930 | { |
---|
| 931 | if ((r2->block0[0]==1) |
---|
| 932 | && (r2->block1[0]==rVar(r2)) |
---|
| 933 | && ((r2->order[0]==ringorder_wp) |
---|
| 934 | || (r2->order[0]==ringorder_Wp) |
---|
| 935 | || (r2->order[0]==ringorder_Dp)) |
---|
| 936 | ) |
---|
| 937 | { |
---|
| 938 | tmpR.order[1]=r2->order[0]; |
---|
| 939 | if (r2->wvhdl[0]!=NULL) |
---|
| 940 | tmpR.wvhdl[1]=(int *)omMemDup(r2->wvhdl[0]); |
---|
| 941 | } |
---|
| 942 | else |
---|
| 943 | tmpR.order[1]=ringorder_dp; |
---|
| 944 | } |
---|
| 945 | else |
---|
| 946 | { |
---|
| 947 | tmpR.order[1]=ringorder_ds; |
---|
| 948 | tmpR.OrdSgn=-1; |
---|
| 949 | } |
---|
| 950 | tmpR.block0[1]=rVar(r1)+1; |
---|
| 951 | tmpR.block1[1]=rVar(r1)+rVar(r2); |
---|
| 952 | tmpR.order[2]=ringorder_C; |
---|
| 953 | tmpR.order[3]=0; |
---|
| 954 | } |
---|
| 955 | else |
---|
| 956 | { |
---|
| 957 | if ((r1->order[0]==ringorder_unspec) |
---|
| 958 | && (r2->order[0]==ringorder_unspec)) |
---|
| 959 | { |
---|
| 960 | tmpR.order=(int*)omAlloc(3*sizeof(int)); |
---|
| 961 | tmpR.block0=(int*)omAlloc(3*sizeof(int)); |
---|
| 962 | tmpR.block1=(int*)omAlloc(3*sizeof(int)); |
---|
[351a5f] | 963 | tmpR.wvhdl=(int**)omAlloc0(3*sizeof(int *)); |
---|
[a6904c] | 964 | tmpR.order[0]=ringorder_unspec; |
---|
| 965 | tmpR.order[1]=ringorder_C; |
---|
| 966 | tmpR.order[2]=0; |
---|
| 967 | tmpR.block0[0]=1; |
---|
| 968 | tmpR.block1[0]=tmpR.N; |
---|
| 969 | } |
---|
| 970 | else if (l==k) /* r3=r1+r2 */ |
---|
| 971 | { |
---|
| 972 | int b; |
---|
| 973 | ring rb; |
---|
| 974 | if (r1->order[0]==ringorder_unspec) |
---|
| 975 | { |
---|
| 976 | /* extend order of r2 to r3 */ |
---|
| 977 | b=rBlocks(r2); |
---|
| 978 | rb=r2; |
---|
| 979 | tmpR.OrdSgn=r2->OrdSgn; |
---|
| 980 | } |
---|
| 981 | else if (r2->order[0]==ringorder_unspec) |
---|
| 982 | { |
---|
| 983 | /* extend order of r1 to r3 */ |
---|
| 984 | b=rBlocks(r1); |
---|
| 985 | rb=r1; |
---|
| 986 | tmpR.OrdSgn=r1->OrdSgn; |
---|
| 987 | } |
---|
| 988 | else |
---|
| 989 | { |
---|
| 990 | b=rBlocks(r1)+rBlocks(r2)-2; /* for only one order C, only one 0 */ |
---|
| 991 | rb=NULL; |
---|
| 992 | } |
---|
| 993 | tmpR.order=(int*)omAlloc0(b*sizeof(int)); |
---|
| 994 | tmpR.block0=(int*)omAlloc0(b*sizeof(int)); |
---|
| 995 | tmpR.block1=(int*)omAlloc0(b*sizeof(int)); |
---|
[351a5f] | 996 | tmpR.wvhdl=(int**)omAlloc0(b*sizeof(int *)); |
---|
[a6904c] | 997 | /* weights not implemented yet ...*/ |
---|
| 998 | if (rb!=NULL) |
---|
| 999 | { |
---|
| 1000 | for (i=0;i<b;i++) |
---|
| 1001 | { |
---|
| 1002 | tmpR.order[i]=rb->order[i]; |
---|
| 1003 | tmpR.block0[i]=rb->block0[i]; |
---|
| 1004 | tmpR.block1[i]=rb->block1[i]; |
---|
| 1005 | if (rb->wvhdl[i]!=NULL) |
---|
| 1006 | WarnS("rSum: weights not implemented"); |
---|
| 1007 | } |
---|
| 1008 | tmpR.block0[0]=1; |
---|
| 1009 | } |
---|
| 1010 | else /* ring sum for complete rings */ |
---|
| 1011 | { |
---|
| 1012 | for (i=0;r1->order[i]!=0;i++) |
---|
| 1013 | { |
---|
| 1014 | tmpR.order[i]=r1->order[i]; |
---|
| 1015 | tmpR.block0[i]=r1->block0[i]; |
---|
| 1016 | tmpR.block1[i]=r1->block1[i]; |
---|
| 1017 | if (r1->wvhdl[i]!=NULL) |
---|
| 1018 | tmpR.wvhdl[i] = (int*) omMemDup(r1->wvhdl[i]); |
---|
| 1019 | } |
---|
| 1020 | j=i; |
---|
| 1021 | i--; |
---|
| 1022 | if ((r1->order[i]==ringorder_c) |
---|
| 1023 | ||(r1->order[i]==ringorder_C)) |
---|
| 1024 | { |
---|
| 1025 | j--; |
---|
| 1026 | tmpR.order[b-2]=r1->order[i]; |
---|
| 1027 | } |
---|
| 1028 | for (i=0;r2->order[i]!=0;i++) |
---|
| 1029 | { |
---|
| 1030 | if ((r2->order[i]!=ringorder_c) |
---|
| 1031 | &&(r2->order[i]!=ringorder_C)) |
---|
| 1032 | { |
---|
| 1033 | tmpR.order[j]=r2->order[i]; |
---|
| 1034 | tmpR.block0[j]=r2->block0[i]+rVar(r1); |
---|
| 1035 | tmpR.block1[j]=r2->block1[i]+rVar(r1); |
---|
| 1036 | if (r2->wvhdl[i]!=NULL) |
---|
| 1037 | { |
---|
| 1038 | tmpR.wvhdl[j] = (int*) omMemDup(r2->wvhdl[i]); |
---|
| 1039 | } |
---|
| 1040 | j++; |
---|
| 1041 | } |
---|
| 1042 | } |
---|
| 1043 | if((r1->OrdSgn==-1)||(r2->OrdSgn==-1)) |
---|
| 1044 | tmpR.OrdSgn=-1; |
---|
| 1045 | } |
---|
| 1046 | } |
---|
[07f2e1c] | 1047 | else if ((k==rVar(r1)) && (k==rVar(r2))) /* r1 and r2 are "quite" |
---|
| 1048 | the same ring */ |
---|
[a6904c] | 1049 | /* copy r1, because we have the variables from r1 */ |
---|
| 1050 | { |
---|
| 1051 | int b=rBlocks(r1); |
---|
| 1052 | |
---|
| 1053 | tmpR.order=(int*)omAlloc0(b*sizeof(int)); |
---|
| 1054 | tmpR.block0=(int*)omAlloc0(b*sizeof(int)); |
---|
| 1055 | tmpR.block1=(int*)omAlloc0(b*sizeof(int)); |
---|
[351a5f] | 1056 | tmpR.wvhdl=(int**)omAlloc0(b*sizeof(int *)); |
---|
[a6904c] | 1057 | /* weights not implemented yet ...*/ |
---|
| 1058 | for (i=0;i<b;i++) |
---|
| 1059 | { |
---|
| 1060 | tmpR.order[i]=r1->order[i]; |
---|
| 1061 | tmpR.block0[i]=r1->block0[i]; |
---|
| 1062 | tmpR.block1[i]=r1->block1[i]; |
---|
| 1063 | if (r1->wvhdl[i]!=NULL) |
---|
| 1064 | { |
---|
| 1065 | tmpR.wvhdl[i] = (int*) omMemDup(r1->wvhdl[i]); |
---|
| 1066 | } |
---|
| 1067 | } |
---|
| 1068 | tmpR.OrdSgn=r1->OrdSgn; |
---|
| 1069 | } |
---|
| 1070 | else |
---|
| 1071 | { |
---|
| 1072 | for(i=0;i<k;i++) omFree((ADDRESS)tmpR.names[i]); |
---|
[dd012ca] | 1073 | omFreeSize((ADDRESS)names,tmpR.N*sizeof(char *)); |
---|
[a6904c] | 1074 | Werror("difficulties with variables: %d,%d -> %d",rVar(r1),rVar(r2),k); |
---|
| 1075 | return -1; |
---|
| 1076 | } |
---|
| 1077 | } |
---|
| 1078 | sum=(ring)omAllocBin(sip_sring_bin); |
---|
| 1079 | memcpy(sum,&tmpR,sizeof(ip_sring)); |
---|
| 1080 | rComplete(sum); |
---|
| 1081 | |
---|
| 1082 | //#ifdef RDEBUG |
---|
| 1083 | // rDebugPrint(sum); |
---|
| 1084 | //#endif |
---|
| 1085 | |
---|
[b388be] | 1086 | |
---|
| 1087 | |
---|
[a6904c] | 1088 | #ifdef HAVE_PLURAL |
---|
| 1089 | if(1) |
---|
| 1090 | { |
---|
[b388be] | 1091 | // ring old_ring = currRing; |
---|
[a6904c] | 1092 | |
---|
| 1093 | BOOLEAN R1_is_nc = rIsPluralRing(r1); |
---|
| 1094 | BOOLEAN R2_is_nc = rIsPluralRing(r2); |
---|
| 1095 | |
---|
| 1096 | if ( (R1_is_nc) || (R2_is_nc)) |
---|
| 1097 | { |
---|
[b388be] | 1098 | ring R1 = nc_rCreateNCcomm_rCopy(r1); |
---|
| 1099 | assume( rIsPluralRing(R1) ); |
---|
[a6904c] | 1100 | |
---|
| 1101 | #if 0 |
---|
| 1102 | #ifdef RDEBUG |
---|
| 1103 | rWrite(R1); |
---|
| 1104 | rDebugPrint(R1); |
---|
| 1105 | #endif |
---|
| 1106 | #endif |
---|
[b388be] | 1107 | ring R2 = nc_rCreateNCcomm_rCopy(r2); |
---|
[a6904c] | 1108 | #if 0 |
---|
| 1109 | #ifdef RDEBUG |
---|
| 1110 | rWrite(R2); |
---|
| 1111 | rDebugPrint(R2); |
---|
| 1112 | #endif |
---|
| 1113 | #endif |
---|
| 1114 | |
---|
[b388be] | 1115 | // rChangeCurrRing(sum); // ? |
---|
[a6904c] | 1116 | |
---|
| 1117 | // Projections from R_i into Sum: |
---|
| 1118 | /* multiplication matrices business: */ |
---|
| 1119 | /* find permutations of vars and pars */ |
---|
| 1120 | int *perm1 = (int *)omAlloc0((rVar(R1)+1)*sizeof(int)); |
---|
| 1121 | int *par_perm1 = NULL; |
---|
| 1122 | if (rPar(R1)!=0) par_perm1=(int *)omAlloc0((rPar(R1)+1)*sizeof(int)); |
---|
| 1123 | |
---|
| 1124 | int *perm2 = (int *)omAlloc0((rVar(R2)+1)*sizeof(int)); |
---|
| 1125 | int *par_perm2 = NULL; |
---|
| 1126 | if (rPar(R2)!=0) par_perm2=(int *)omAlloc0((rPar(R2)+1)*sizeof(int)); |
---|
| 1127 | |
---|
[4c6e420] | 1128 | maFindPerm(R1->names, rVar(R1), rParameter(R1), rPar(R1), |
---|
| 1129 | sum->names, rVar(sum), rParameter(sum), rPar(sum), |
---|
[7ac612] | 1130 | perm1, par_perm1, sum->cf->type); |
---|
[a6904c] | 1131 | |
---|
[4c6e420] | 1132 | maFindPerm(R2->names, rVar(R2), rParameter(R2), rPar(R2), |
---|
| 1133 | sum->names, rVar(sum), rParameter(sum), rPar(sum), |
---|
[7ac612] | 1134 | perm2, par_perm2, sum->cf->type); |
---|
[a6904c] | 1135 | |
---|
| 1136 | |
---|
| 1137 | matrix C1 = R1->GetNC()->C, C2 = R2->GetNC()->C; |
---|
| 1138 | matrix D1 = R1->GetNC()->D, D2 = R2->GetNC()->D; |
---|
| 1139 | |
---|
| 1140 | // !!!! BUG? C1 and C2 might live in different baserings!!! |
---|
| 1141 | |
---|
| 1142 | int l = rVar(R1) + rVar(R2); |
---|
| 1143 | |
---|
| 1144 | matrix C = mpNew(l,l); |
---|
| 1145 | matrix D = mpNew(l,l); |
---|
| 1146 | |
---|
| 1147 | for (i = 1; i <= rVar(R1); i++) |
---|
| 1148 | for (j= rVar(R1)+1; j <= l; j++) |
---|
[b388be] | 1149 | MATELEM(C,i,j) = p_One(sum); // in 'sum' |
---|
[a6904c] | 1150 | |
---|
[32d07a5] | 1151 | id_Test((ideal)C, sum); |
---|
[a6904c] | 1152 | |
---|
[613174] | 1153 | nMapFunc nMap1 = n_SetMap(R1->cf,sum->cf); /* can change something global: not usable |
---|
| 1154 | after the next nSetMap call :( */ |
---|
[a6904c] | 1155 | // Create blocked C and D matrices: |
---|
| 1156 | for (i=1; i<= rVar(R1); i++) |
---|
| 1157 | for (j=i+1; j<=rVar(R1); j++) |
---|
| 1158 | { |
---|
| 1159 | assume(MATELEM(C1,i,j) != NULL); |
---|
[028192] | 1160 | MATELEM(C,i,j) = p_PermPoly(MATELEM(C1,i,j), perm1, R1, sum, nMap1, par_perm1, rPar(R1)); // need ADD + CMP ops. |
---|
[a6904c] | 1161 | |
---|
| 1162 | if (MATELEM(D1,i,j) != NULL) |
---|
[028192] | 1163 | MATELEM(D,i,j) = p_PermPoly(MATELEM(D1,i,j), perm1, R1, sum, nMap1, par_perm1, rPar(R1)); |
---|
[a6904c] | 1164 | } |
---|
| 1165 | |
---|
[32d07a5] | 1166 | id_Test((ideal)C, sum); |
---|
| 1167 | id_Test((ideal)D, sum); |
---|
[a6904c] | 1168 | |
---|
| 1169 | |
---|
[613174] | 1170 | nMapFunc nMap2 = n_SetMap(R2->cf,sum->cf); /* can change something global: not usable |
---|
| 1171 | after the next nSetMap call :( */ |
---|
[a6904c] | 1172 | for (i=1; i<= rVar(R2); i++) |
---|
| 1173 | for (j=i+1; j<=rVar(R2); j++) |
---|
| 1174 | { |
---|
| 1175 | assume(MATELEM(C2,i,j) != NULL); |
---|
[028192] | 1176 | MATELEM(C,rVar(R1)+i,rVar(R1)+j) = p_PermPoly(MATELEM(C2,i,j),perm2,R2,sum, nMap2,par_perm2,rPar(R2)); |
---|
[a6904c] | 1177 | |
---|
| 1178 | if (MATELEM(D2,i,j) != NULL) |
---|
[028192] | 1179 | MATELEM(D,rVar(R1)+i,rVar(R1)+j) = p_PermPoly(MATELEM(D2,i,j),perm2,R2,sum, nMap2,par_perm2,rPar(R2)); |
---|
[a6904c] | 1180 | } |
---|
| 1181 | |
---|
[32d07a5] | 1182 | id_Test((ideal)C, sum); |
---|
| 1183 | id_Test((ideal)D, sum); |
---|
[a6904c] | 1184 | |
---|
| 1185 | // Now sum is non-commutative with blocked structure constants! |
---|
| 1186 | if (nc_CallPlural(C, D, NULL, NULL, sum, false, false, true, sum)) |
---|
| 1187 | WarnS("Error initializing non-commutative multiplication!"); |
---|
| 1188 | |
---|
| 1189 | /* delete R1, R2*/ |
---|
| 1190 | |
---|
| 1191 | #if 0 |
---|
| 1192 | #ifdef RDEBUG |
---|
| 1193 | rWrite(sum); |
---|
| 1194 | rDebugPrint(sum); |
---|
| 1195 | |
---|
| 1196 | Print("\nRefs: R1: %d, R2: %d\n", R1->GetNC()->ref, R2->GetNC()->ref); |
---|
| 1197 | |
---|
| 1198 | #endif |
---|
| 1199 | #endif |
---|
| 1200 | |
---|
| 1201 | |
---|
| 1202 | rDelete(R1); |
---|
| 1203 | rDelete(R2); |
---|
| 1204 | |
---|
| 1205 | /* delete perm arrays */ |
---|
| 1206 | if (perm1!=NULL) omFree((ADDRESS)perm1); |
---|
| 1207 | if (perm2!=NULL) omFree((ADDRESS)perm2); |
---|
| 1208 | if (par_perm1!=NULL) omFree((ADDRESS)par_perm1); |
---|
| 1209 | if (par_perm2!=NULL) omFree((ADDRESS)par_perm2); |
---|
| 1210 | |
---|
[b388be] | 1211 | // rChangeCurrRing(old_ring); |
---|
[a6904c] | 1212 | } |
---|
| 1213 | |
---|
| 1214 | } |
---|
| 1215 | #endif |
---|
| 1216 | |
---|
| 1217 | ideal Q=NULL; |
---|
| 1218 | ideal Q1=NULL, Q2=NULL; |
---|
| 1219 | if (r1->qideal!=NULL) |
---|
| 1220 | { |
---|
[b388be] | 1221 | // rChangeCurrRing(sum); |
---|
[a6904c] | 1222 | // if (r2->qideal!=NULL) |
---|
| 1223 | // { |
---|
| 1224 | // WerrorS("todo: qring+qring"); |
---|
| 1225 | // return -1; |
---|
| 1226 | // } |
---|
| 1227 | // else |
---|
| 1228 | // {} |
---|
| 1229 | /* these were defined in the Plural Part above... */ |
---|
| 1230 | int *perm1 = (int *)omAlloc0((rVar(r1)+1)*sizeof(int)); |
---|
| 1231 | int *par_perm1 = NULL; |
---|
| 1232 | if (rPar(r1)!=0) par_perm1=(int *)omAlloc0((rPar(r1)+1)*sizeof(int)); |
---|
[4c6e420] | 1233 | maFindPerm(r1->names, rVar(r1), rParameter(r1), rPar(r1), |
---|
| 1234 | sum->names, rVar(sum), rParameter(sum), rPar(sum), |
---|
[7ac612] | 1235 | perm1, par_perm1, sum->cf->type); |
---|
[613174] | 1236 | nMapFunc nMap1 = n_SetMap(r1->cf,sum->cf); |
---|
[a6904c] | 1237 | Q1 = idInit(IDELEMS(r1->qideal),1); |
---|
[b388be] | 1238 | |
---|
[a6904c] | 1239 | for (int for_i=0;for_i<IDELEMS(r1->qideal);for_i++) |
---|
[b388be] | 1240 | Q1->m[for_i] = p_PermPoly( |
---|
[f70f641] | 1241 | r1->qideal->m[for_i], perm1, |
---|
| 1242 | r1, sum, |
---|
| 1243 | nMap1, |
---|
| 1244 | par_perm1, rPar(r1)); |
---|
| 1245 | |
---|
[a6904c] | 1246 | omFree((ADDRESS)perm1); |
---|
| 1247 | } |
---|
| 1248 | |
---|
| 1249 | if (r2->qideal!=NULL) |
---|
| 1250 | { |
---|
[dd012ca] | 1251 | //if (currRing!=sum) |
---|
| 1252 | // rChangeCurrRing(sum); |
---|
[a6904c] | 1253 | int *perm2 = (int *)omAlloc0((rVar(r2)+1)*sizeof(int)); |
---|
| 1254 | int *par_perm2 = NULL; |
---|
| 1255 | if (rPar(r2)!=0) par_perm2=(int *)omAlloc0((rPar(r2)+1)*sizeof(int)); |
---|
[4c6e420] | 1256 | maFindPerm(r2->names, rVar(r2), rParameter(r2), rPar(r2), |
---|
| 1257 | sum->names, rVar(sum), rParameter(sum), rPar(sum), |
---|
[7ac612] | 1258 | perm2, par_perm2, sum->cf->type); |
---|
[613174] | 1259 | nMapFunc nMap2 = n_SetMap(r2->cf,sum->cf); |
---|
[a6904c] | 1260 | Q2 = idInit(IDELEMS(r2->qideal),1); |
---|
[f70f641] | 1261 | |
---|
[a6904c] | 1262 | for (int for_i=0;for_i<IDELEMS(r2->qideal);for_i++) |
---|
[f70f641] | 1263 | Q2->m[for_i] = p_PermPoly( |
---|
| 1264 | r2->qideal->m[for_i], perm2, |
---|
| 1265 | r2, sum, |
---|
| 1266 | nMap2, |
---|
| 1267 | par_perm2, rPar(r2)); |
---|
| 1268 | |
---|
[a6904c] | 1269 | omFree((ADDRESS)perm2); |
---|
| 1270 | } |
---|
| 1271 | if ( (Q1!=NULL) || ( Q2!=NULL)) |
---|
| 1272 | { |
---|
[a665eb] | 1273 | Q = id_SimpleAdd(Q1,Q2,sum); |
---|
[a6904c] | 1274 | } |
---|
| 1275 | sum->qideal = Q; |
---|
| 1276 | |
---|
| 1277 | #ifdef HAVE_PLURAL |
---|
| 1278 | if( rIsPluralRing(sum) ) |
---|
| 1279 | nc_SetupQuotient( sum ); |
---|
| 1280 | #endif |
---|
| 1281 | return 1; |
---|
| 1282 | } |
---|
| 1283 | |
---|
| 1284 | /*2 |
---|
| 1285 | *returns -1 for not compatible, (sum is undefined) |
---|
| 1286 | * 0 for equal, (and sum) |
---|
| 1287 | * 1 for compatible (and sum) |
---|
| 1288 | */ |
---|
| 1289 | int rSum(ring r1, ring r2, ring &sum) |
---|
| 1290 | { |
---|
| 1291 | if (r1==r2) |
---|
| 1292 | { |
---|
| 1293 | sum=r1; |
---|
| 1294 | r1->ref++; |
---|
| 1295 | return 0; |
---|
| 1296 | } |
---|
[83bde7] | 1297 | return rSumInternal(r1,r2,sum,TRUE,FALSE); |
---|
[a6904c] | 1298 | } |
---|
| 1299 | |
---|
| 1300 | /*2 |
---|
[1745e5] | 1301 | * create a copy of the ring r |
---|
[a6904c] | 1302 | * used for qring definition,.. |
---|
| 1303 | * DOES NOT CALL rComplete |
---|
| 1304 | */ |
---|
| 1305 | ring rCopy0(const ring r, BOOLEAN copy_qideal, BOOLEAN copy_ordering) |
---|
| 1306 | { |
---|
| 1307 | if (r == NULL) return NULL; |
---|
| 1308 | int i,j; |
---|
| 1309 | ring res=(ring)omAllocBin(sip_sring_bin); |
---|
| 1310 | memset(res,0,sizeof(ip_sring)); |
---|
[611871] | 1311 | //memcpy(res,r,sizeof(ip_sring)); |
---|
[a6904c] | 1312 | //memset: res->idroot=NULL; /* local objects */ |
---|
| 1313 | //ideal minideal; |
---|
| 1314 | res->options=r->options; /* ring dependent options */ |
---|
| 1315 | |
---|
| 1316 | //memset: res->ordsgn=NULL; |
---|
| 1317 | //memset: res->typ=NULL; |
---|
| 1318 | //memset: res->VarOffset=NULL; |
---|
| 1319 | //memset: res->firstwv=NULL; |
---|
| 1320 | |
---|
[c5e0e1] | 1321 | //struct omBin PolyBin; /* Bin from where monoms are allocated */ |
---|
[a6904c] | 1322 | //memset: res->PolyBin=NULL; // rComplete |
---|
[f70f641] | 1323 | res->cf=r->cf; /* coeffs */ |
---|
| 1324 | res->cf->ref++; |
---|
| 1325 | |
---|
[a6904c] | 1326 | //memset: res->ref=0; /* reference counter to the ring */ |
---|
| 1327 | |
---|
| 1328 | res->float_len=r->float_len; /* additional char-flags */ |
---|
| 1329 | res->float_len2=r->float_len2; /* additional char-flags */ |
---|
| 1330 | |
---|
[01c1d0] | 1331 | res->N=rVar(r); /* number of vars */ |
---|
[a6904c] | 1332 | res->OrdSgn=r->OrdSgn; /* 1 for polynomial rings, -1 otherwise */ |
---|
| 1333 | |
---|
| 1334 | res->firstBlockEnds=r->firstBlockEnds; |
---|
| 1335 | #ifdef HAVE_PLURAL |
---|
| 1336 | res->real_var_start=r->real_var_start; |
---|
| 1337 | res->real_var_end=r->real_var_end; |
---|
| 1338 | #endif |
---|
| 1339 | |
---|
| 1340 | #ifdef HAVE_SHIFTBBA |
---|
| 1341 | res->isLPring=r->isLPring; /* 0 for non-letterplace rings, otherwise the number of LP blocks, at least 1, known also as lV */ |
---|
| 1342 | #endif |
---|
| 1343 | |
---|
| 1344 | res->VectorOut=r->VectorOut; |
---|
| 1345 | res->ShortOut=r->ShortOut; |
---|
| 1346 | res->CanShortOut=r->CanShortOut; |
---|
| 1347 | res->LexOrder=r->LexOrder; // TRUE if the monomial ordering has polynomial and power series blocks |
---|
| 1348 | res->MixedOrder=r->MixedOrder; // ?? 1 for lex ordering (except ls), -1 otherwise |
---|
| 1349 | res->ComponentOrder=r->ComponentOrder; |
---|
| 1350 | |
---|
| 1351 | //memset: res->ExpL_Size=0; |
---|
| 1352 | //memset: res->CmpL_Size=0; |
---|
| 1353 | //memset: res->VarL_Size=0; |
---|
| 1354 | //memset: res->pCompIndex=0; |
---|
| 1355 | //memset: res->pOrdIndex=0; |
---|
| 1356 | //memset: res->OrdSize=0; |
---|
| 1357 | //memset: res->VarL_LowIndex=0; |
---|
| 1358 | //memset: res->MinExpPerLong=0; |
---|
| 1359 | //memset: res->NegWeightL_Size=0; |
---|
| 1360 | //memset: res->NegWeightL_Offset=NULL; |
---|
| 1361 | //memset: res->VarL_Offset=NULL; |
---|
| 1362 | |
---|
| 1363 | // the following are set by rComplete unless predefined |
---|
| 1364 | // therefore, we copy these values: maybe they are non-standard |
---|
| 1365 | /* mask for getting single exponents */ |
---|
| 1366 | res->bitmask=r->bitmask; |
---|
| 1367 | res->divmask=r->divmask; |
---|
| 1368 | res->BitsPerExp = r->BitsPerExp; |
---|
| 1369 | res->ExpPerLong = r->ExpPerLong; |
---|
| 1370 | |
---|
| 1371 | //memset: res->p_Procs=NULL; |
---|
| 1372 | //memset: res->pFDeg=NULL; |
---|
| 1373 | //memset: res->pLDeg=NULL; |
---|
| 1374 | //memset: res->pFDegOrig=NULL; |
---|
| 1375 | //memset: res->pLDegOrig=NULL; |
---|
| 1376 | //memset: res->p_Setm=NULL; |
---|
| 1377 | //memset: res->cf=NULL; |
---|
| 1378 | res->options=r->options; |
---|
[4c6e420] | 1379 | |
---|
| 1380 | /* |
---|
[6ccdd3a] | 1381 | if (r->extRing!=NULL) |
---|
| 1382 | r->extRing->ref++; |
---|
[4c6e420] | 1383 | |
---|
[6ccdd3a] | 1384 | res->extRing=r->extRing; |
---|
[a6904c] | 1385 | //memset: res->minideal=NULL; |
---|
[4c6e420] | 1386 | */ |
---|
| 1387 | |
---|
| 1388 | |
---|
[a6904c] | 1389 | if (copy_ordering == TRUE) |
---|
| 1390 | { |
---|
| 1391 | i=rBlocks(r); |
---|
[351a5f] | 1392 | res->wvhdl = (int **)omAlloc(i * sizeof(int *)); |
---|
[a6904c] | 1393 | res->order = (int *) omAlloc(i * sizeof(int)); |
---|
| 1394 | res->block0 = (int *) omAlloc(i * sizeof(int)); |
---|
| 1395 | res->block1 = (int *) omAlloc(i * sizeof(int)); |
---|
| 1396 | for (j=0; j<i; j++) |
---|
| 1397 | { |
---|
| 1398 | if (r->wvhdl[j]!=NULL) |
---|
| 1399 | { |
---|
| 1400 | res->wvhdl[j] = (int*) omMemDup(r->wvhdl[j]); |
---|
| 1401 | } |
---|
| 1402 | else |
---|
| 1403 | res->wvhdl[j]=NULL; |
---|
| 1404 | } |
---|
[611871] | 1405 | memcpy(res->order,r->order,i * sizeof(int)); |
---|
| 1406 | memcpy(res->block0,r->block0,i * sizeof(int)); |
---|
| 1407 | memcpy(res->block1,r->block1,i * sizeof(int)); |
---|
[a6904c] | 1408 | } |
---|
| 1409 | //memset: else |
---|
| 1410 | //memset: { |
---|
| 1411 | //memset: res->wvhdl = NULL; |
---|
| 1412 | //memset: res->order = NULL; |
---|
| 1413 | //memset: res->block0 = NULL; |
---|
| 1414 | //memset: res->block1 = NULL; |
---|
| 1415 | //memset: } |
---|
| 1416 | |
---|
[dd012ca] | 1417 | res->names = (char **)omAlloc0(rVar(r) * sizeof(char *)); |
---|
[a6904c] | 1418 | for (i=0; i<rVar(res); i++) |
---|
| 1419 | { |
---|
| 1420 | res->names[i] = omStrDup(r->names[i]); |
---|
| 1421 | } |
---|
| 1422 | if (r->qideal!=NULL) |
---|
| 1423 | { |
---|
| 1424 | if (copy_qideal) |
---|
| 1425 | { |
---|
| 1426 | #ifndef NDEBUG |
---|
| 1427 | if (!copy_ordering) |
---|
| 1428 | WerrorS("internal error: rCopy0(Q,TRUE,FALSE)"); |
---|
| 1429 | else |
---|
| 1430 | #endif |
---|
| 1431 | { |
---|
| 1432 | #ifndef NDEBUG |
---|
| 1433 | WarnS("internal bad stuff: rCopy0(Q,TRUE,TRUE)"); |
---|
| 1434 | #endif |
---|
| 1435 | rComplete(res); |
---|
| 1436 | res->qideal= idrCopyR_NoSort(r->qideal, r, res); |
---|
| 1437 | rUnComplete(res); |
---|
| 1438 | } |
---|
| 1439 | } |
---|
| 1440 | //memset: else res->qideal = NULL; |
---|
| 1441 | } |
---|
| 1442 | //memset: else res->qideal = NULL; |
---|
| 1443 | //memset: res->GetNC() = NULL; // copy is purely commutative!!! |
---|
| 1444 | return res; |
---|
| 1445 | } |
---|
| 1446 | |
---|
[1745e5] | 1447 | /*2 |
---|
| 1448 | * create a copy of the ring r |
---|
| 1449 | * used for qring definition,.. |
---|
| 1450 | * DOES NOT CALL rComplete |
---|
| 1451 | */ |
---|
| 1452 | ring rCopy0AndAddA(const ring r, int64vec *wv64, BOOLEAN copy_qideal, BOOLEAN copy_ordering) |
---|
| 1453 | { |
---|
| 1454 | if (r == NULL) return NULL; |
---|
| 1455 | int i,j; |
---|
| 1456 | ring res=(ring)omAllocBin(sip_sring_bin); |
---|
| 1457 | memset(res,0,sizeof(ip_sring)); |
---|
| 1458 | //memcpy(res,r,sizeof(ip_sring)); |
---|
| 1459 | //memset: res->idroot=NULL; /* local objects */ |
---|
| 1460 | //ideal minideal; |
---|
| 1461 | res->options=r->options; /* ring dependent options */ |
---|
| 1462 | |
---|
| 1463 | //memset: res->ordsgn=NULL; |
---|
| 1464 | //memset: res->typ=NULL; |
---|
| 1465 | //memset: res->VarOffset=NULL; |
---|
| 1466 | //memset: res->firstwv=NULL; |
---|
| 1467 | |
---|
| 1468 | //struct omBin PolyBin; /* Bin from where monoms are allocated */ |
---|
| 1469 | //memset: res->PolyBin=NULL; // rComplete |
---|
| 1470 | res->cf=r->cf; /* coeffs */ |
---|
| 1471 | res->cf->ref++; |
---|
| 1472 | |
---|
| 1473 | //memset: res->ref=0; /* reference counter to the ring */ |
---|
| 1474 | |
---|
| 1475 | res->float_len=r->float_len; /* additional char-flags */ |
---|
| 1476 | res->float_len2=r->float_len2; /* additional char-flags */ |
---|
| 1477 | |
---|
| 1478 | res->N=rVar(r); /* number of vars */ |
---|
| 1479 | res->OrdSgn=r->OrdSgn; /* 1 for polynomial rings, -1 otherwise */ |
---|
| 1480 | |
---|
| 1481 | res->firstBlockEnds=r->firstBlockEnds; |
---|
| 1482 | #ifdef HAVE_PLURAL |
---|
| 1483 | res->real_var_start=r->real_var_start; |
---|
| 1484 | res->real_var_end=r->real_var_end; |
---|
| 1485 | #endif |
---|
| 1486 | |
---|
| 1487 | #ifdef HAVE_SHIFTBBA |
---|
| 1488 | res->isLPring=r->isLPring; /* 0 for non-letterplace rings, otherwise the number of LP blocks, at least 1, known also as lV */ |
---|
| 1489 | #endif |
---|
| 1490 | |
---|
| 1491 | res->VectorOut=r->VectorOut; |
---|
| 1492 | res->ShortOut=r->ShortOut; |
---|
| 1493 | res->CanShortOut=r->CanShortOut; |
---|
| 1494 | res->LexOrder=r->LexOrder; // TRUE if the monomial ordering has polynomial and power series blocks |
---|
| 1495 | res->MixedOrder=r->MixedOrder; // ?? 1 for lex ordering (except ls), -1 otherwise |
---|
| 1496 | res->ComponentOrder=r->ComponentOrder; |
---|
| 1497 | |
---|
| 1498 | //memset: res->ExpL_Size=0; |
---|
| 1499 | //memset: res->CmpL_Size=0; |
---|
| 1500 | //memset: res->VarL_Size=0; |
---|
| 1501 | //memset: res->pCompIndex=0; |
---|
| 1502 | //memset: res->pOrdIndex=0; |
---|
| 1503 | //memset: res->OrdSize=0; |
---|
| 1504 | //memset: res->VarL_LowIndex=0; |
---|
| 1505 | //memset: res->MinExpPerLong=0; |
---|
| 1506 | //memset: res->NegWeightL_Size=0; |
---|
| 1507 | //memset: res->NegWeightL_Offset=NULL; |
---|
| 1508 | //memset: res->VarL_Offset=NULL; |
---|
| 1509 | |
---|
| 1510 | // the following are set by rComplete unless predefined |
---|
| 1511 | // therefore, we copy these values: maybe they are non-standard |
---|
| 1512 | /* mask for getting single exponents */ |
---|
| 1513 | res->bitmask=r->bitmask; |
---|
| 1514 | res->divmask=r->divmask; |
---|
| 1515 | res->BitsPerExp = r->BitsPerExp; |
---|
| 1516 | res->ExpPerLong = r->ExpPerLong; |
---|
| 1517 | |
---|
| 1518 | //memset: res->p_Procs=NULL; |
---|
| 1519 | //memset: res->pFDeg=NULL; |
---|
| 1520 | //memset: res->pLDeg=NULL; |
---|
| 1521 | //memset: res->pFDegOrig=NULL; |
---|
| 1522 | //memset: res->pLDegOrig=NULL; |
---|
| 1523 | //memset: res->p_Setm=NULL; |
---|
| 1524 | //memset: res->cf=NULL; |
---|
| 1525 | res->options=r->options; |
---|
| 1526 | |
---|
| 1527 | /* |
---|
| 1528 | if (r->extRing!=NULL) |
---|
| 1529 | r->extRing->ref++; |
---|
| 1530 | |
---|
| 1531 | res->extRing=r->extRing; |
---|
| 1532 | //memset: res->minideal=NULL; |
---|
| 1533 | */ |
---|
| 1534 | |
---|
| 1535 | |
---|
| 1536 | if (copy_ordering == TRUE) |
---|
| 1537 | { |
---|
| 1538 | i=rBlocks(r)+1; // DIFF to rCopy0 |
---|
| 1539 | res->wvhdl = (int **)omAlloc(i * sizeof(int *)); |
---|
| 1540 | res->order = (int *) omAlloc(i * sizeof(int)); |
---|
| 1541 | res->block0 = (int *) omAlloc(i * sizeof(int)); |
---|
| 1542 | res->block1 = (int *) omAlloc(i * sizeof(int)); |
---|
| 1543 | for (j=0; j<i-1; j++) |
---|
| 1544 | { |
---|
| 1545 | if (r->wvhdl[j]!=NULL) |
---|
| 1546 | { |
---|
| 1547 | res->wvhdl[j+1] = (int*) omMemDup(r->wvhdl[j]); //DIFF |
---|
| 1548 | } |
---|
| 1549 | else |
---|
| 1550 | res->wvhdl[j+1]=NULL; //DIFF |
---|
| 1551 | } |
---|
| 1552 | memcpy(&(res->order[1]),r->order,(i-1) * sizeof(int)); //DIFF |
---|
| 1553 | memcpy(&(res->block0[1]),r->block0,(i-1) * sizeof(int)); //DIFF |
---|
| 1554 | memcpy(&(res->block1[1]),r->block1,(i-1) * sizeof(int)); //DIFF |
---|
| 1555 | } |
---|
| 1556 | //memset: else |
---|
| 1557 | //memset: { |
---|
| 1558 | //memset: res->wvhdl = NULL; |
---|
| 1559 | //memset: res->order = NULL; |
---|
| 1560 | //memset: res->block0 = NULL; |
---|
| 1561 | //memset: res->block1 = NULL; |
---|
| 1562 | //memset: } |
---|
| 1563 | |
---|
| 1564 | //the added A |
---|
| 1565 | res->order[0]=ringorder_a64; |
---|
| 1566 | int length=wv64->rows(); |
---|
| 1567 | int64 *A=(int64 *)omAlloc(length*sizeof(int64)); |
---|
| 1568 | for(j=length-1;j>=0;j--) |
---|
| 1569 | { |
---|
| 1570 | A[j]=(*wv64)[j]; |
---|
| 1571 | } |
---|
| 1572 | res->wvhdl[0]=(int *)A; |
---|
| 1573 | res->block0[0]=1; |
---|
| 1574 | res->block1[0]=length; |
---|
| 1575 | // |
---|
| 1576 | |
---|
| 1577 | res->names = (char **)omAlloc0(rVar(r) * sizeof(char *)); |
---|
| 1578 | for (i=0; i<rVar(res); i++) |
---|
| 1579 | { |
---|
| 1580 | res->names[i] = omStrDup(r->names[i]); |
---|
| 1581 | } |
---|
| 1582 | if (r->qideal!=NULL) |
---|
| 1583 | { |
---|
| 1584 | if (copy_qideal) |
---|
| 1585 | { |
---|
| 1586 | #ifndef NDEBUG |
---|
| 1587 | if (!copy_ordering) |
---|
| 1588 | WerrorS("internal error: rCopy0(Q,TRUE,FALSE)"); |
---|
| 1589 | else |
---|
| 1590 | #endif |
---|
| 1591 | { |
---|
| 1592 | #ifndef NDEBUG |
---|
| 1593 | WarnS("internal bad stuff: rCopy0(Q,TRUE,TRUE)"); |
---|
| 1594 | #endif |
---|
| 1595 | rComplete(res); |
---|
| 1596 | res->qideal= idrCopyR_NoSort(r->qideal, r, res); |
---|
| 1597 | rUnComplete(res); |
---|
| 1598 | } |
---|
| 1599 | } |
---|
| 1600 | //memset: else res->qideal = NULL; |
---|
| 1601 | } |
---|
| 1602 | //memset: else res->qideal = NULL; |
---|
| 1603 | //memset: res->GetNC() = NULL; // copy is purely commutative!!! |
---|
| 1604 | return res; |
---|
| 1605 | } |
---|
| 1606 | |
---|
[a6904c] | 1607 | /*2 |
---|
| 1608 | * create a copy of the ring r, which must be equivalent to currRing |
---|
| 1609 | * used for qring definition,.. |
---|
| 1610 | * (i.e.: normal rings: same nCopy as currRing; |
---|
| 1611 | * qring: same nCopy, same idCopy as currRing) |
---|
| 1612 | */ |
---|
| 1613 | ring rCopy(ring r) |
---|
| 1614 | { |
---|
| 1615 | if (r == NULL) return NULL; |
---|
| 1616 | ring res=rCopy0(r,FALSE,TRUE); |
---|
| 1617 | rComplete(res, 1); // res is purely commutative so far |
---|
| 1618 | if (r->qideal!=NULL) res->qideal=idrCopyR_NoSort(r->qideal, r, res); |
---|
| 1619 | |
---|
| 1620 | #ifdef HAVE_PLURAL |
---|
| 1621 | if (rIsPluralRing(r)) |
---|
| 1622 | if( nc_rCopy(res, r, true) ); |
---|
| 1623 | #endif |
---|
| 1624 | |
---|
| 1625 | return res; |
---|
| 1626 | } |
---|
| 1627 | |
---|
| 1628 | // returns TRUE, if r1 equals r2 FALSE, otherwise Equality is |
---|
| 1629 | // determined componentwise, if qr == 1, then qrideal equality is |
---|
| 1630 | // tested, as well |
---|
| 1631 | BOOLEAN rEqual(ring r1, ring r2, BOOLEAN qr) |
---|
| 1632 | { |
---|
| 1633 | int i, j; |
---|
| 1634 | |
---|
| 1635 | if (r1 == r2) return TRUE; |
---|
| 1636 | |
---|
| 1637 | if (r1 == NULL || r2 == NULL) return FALSE; |
---|
| 1638 | |
---|
[dd012ca] | 1639 | if ((r1->cf->type != r2->cf->type) |
---|
[a6904c] | 1640 | || (r1->float_len != r2->float_len) |
---|
| 1641 | || (r1->float_len2 != r2->float_len2) |
---|
| 1642 | || (rVar(r1) != rVar(r2)) |
---|
| 1643 | || (r1->OrdSgn != r2->OrdSgn) |
---|
| 1644 | || (rPar(r1) != rPar(r2))) |
---|
| 1645 | return FALSE; |
---|
| 1646 | |
---|
| 1647 | for (i=0; i<rVar(r1); i++) |
---|
| 1648 | { |
---|
| 1649 | if (r1->names[i] != NULL && r2->names[i] != NULL) |
---|
| 1650 | { |
---|
| 1651 | if (strcmp(r1->names[i], r2->names[i])) return FALSE; |
---|
| 1652 | } |
---|
| 1653 | else if ((r1->names[i] != NULL) ^ (r2->names[i] != NULL)) |
---|
| 1654 | { |
---|
| 1655 | return FALSE; |
---|
| 1656 | } |
---|
| 1657 | } |
---|
| 1658 | |
---|
| 1659 | i=0; |
---|
| 1660 | while (r1->order[i] != 0) |
---|
| 1661 | { |
---|
| 1662 | if (r2->order[i] == 0) return FALSE; |
---|
| 1663 | if ((r1->order[i] != r2->order[i]) |
---|
| 1664 | || (r1->block0[i] != r2->block0[i]) |
---|
| 1665 | || (r1->block1[i] != r2->block1[i])) |
---|
| 1666 | return FALSE; |
---|
| 1667 | if (r1->wvhdl[i] != NULL) |
---|
| 1668 | { |
---|
| 1669 | if (r2->wvhdl[i] == NULL) |
---|
| 1670 | return FALSE; |
---|
| 1671 | for (j=0; j<r1->block1[i]-r1->block0[i]+1; j++) |
---|
| 1672 | if (r2->wvhdl[i][j] != r1->wvhdl[i][j]) |
---|
| 1673 | return FALSE; |
---|
| 1674 | } |
---|
| 1675 | else if (r2->wvhdl[i] != NULL) return FALSE; |
---|
| 1676 | i++; |
---|
| 1677 | } |
---|
| 1678 | if (r2->order[i] != 0) return FALSE; |
---|
| 1679 | |
---|
| 1680 | for (i=0; i<rPar(r1);i++) |
---|
| 1681 | { |
---|
[4c6e420] | 1682 | if (strcmp(rParameter(r1)[i], rParameter(r2)[i])!=0) |
---|
[a6904c] | 1683 | return FALSE; |
---|
| 1684 | } |
---|
| 1685 | |
---|
[4c6e420] | 1686 | if ( !rMinpolyIsNULL(r1) ) |
---|
[a6904c] | 1687 | { |
---|
[4c6e420] | 1688 | if ( rMinpolyIsNULL(r2) ) return FALSE; |
---|
[6ccdd3a] | 1689 | if (! p_EqualPolys(r1->cf->extRing->minideal->m[0], |
---|
| 1690 | r2->cf->extRing->minideal->m[0], |
---|
| 1691 | r1->cf->extRing)) |
---|
[bfa04e] | 1692 | return FALSE; |
---|
[a6904c] | 1693 | } |
---|
[4c6e420] | 1694 | else if (!rMinpolyIsNULL(r2)) return FALSE; |
---|
[a6904c] | 1695 | |
---|
| 1696 | if (qr) |
---|
| 1697 | { |
---|
| 1698 | if (r1->qideal != NULL) |
---|
| 1699 | { |
---|
| 1700 | ideal id1 = r1->qideal, id2 = r2->qideal; |
---|
| 1701 | int i, n; |
---|
| 1702 | poly *m1, *m2; |
---|
| 1703 | |
---|
| 1704 | if (id2 == NULL) return FALSE; |
---|
| 1705 | if ((n = IDELEMS(id1)) != IDELEMS(id2)) return FALSE; |
---|
| 1706 | |
---|
| 1707 | { |
---|
| 1708 | m1 = id1->m; |
---|
| 1709 | m2 = id2->m; |
---|
| 1710 | for (i=0; i<n; i++) |
---|
[dd012ca] | 1711 | if (! p_EqualPolys(m1[i],m2[i],r1)) return FALSE; |
---|
[a6904c] | 1712 | } |
---|
| 1713 | } |
---|
| 1714 | else if (r2->qideal != NULL) return FALSE; |
---|
| 1715 | } |
---|
| 1716 | |
---|
| 1717 | return TRUE; |
---|
| 1718 | } |
---|
| 1719 | |
---|
| 1720 | // returns TRUE, if r1 and r2 represents the monomials in the same way |
---|
| 1721 | // FALSE, otherwise |
---|
| 1722 | // this is an analogue to rEqual but not so strict |
---|
| 1723 | BOOLEAN rSamePolyRep(ring r1, ring r2) |
---|
| 1724 | { |
---|
| 1725 | int i, j; |
---|
| 1726 | |
---|
| 1727 | if (r1 == r2) return TRUE; |
---|
| 1728 | |
---|
| 1729 | if (r1 == NULL || r2 == NULL) return FALSE; |
---|
| 1730 | |
---|
[dd012ca] | 1731 | if ((r1->cf->type != r2->cf->type) |
---|
[a6904c] | 1732 | || (r1->float_len != r2->float_len) |
---|
| 1733 | || (r1->float_len2 != r2->float_len2) |
---|
| 1734 | || (rVar(r1) != rVar(r2)) |
---|
| 1735 | || (r1->OrdSgn != r2->OrdSgn) |
---|
| 1736 | || (rPar(r1) != rPar(r2))) |
---|
| 1737 | return FALSE; |
---|
| 1738 | |
---|
| 1739 | if (rVar(r1)!=rVar(r2)) return FALSE; |
---|
| 1740 | if (rPar(r1)!=rPar(r2)) return FALSE; |
---|
| 1741 | |
---|
| 1742 | i=0; |
---|
| 1743 | while (r1->order[i] != 0) |
---|
| 1744 | { |
---|
| 1745 | if (r2->order[i] == 0) return FALSE; |
---|
| 1746 | if ((r1->order[i] != r2->order[i]) |
---|
| 1747 | || (r1->block0[i] != r2->block0[i]) |
---|
| 1748 | || (r1->block1[i] != r2->block1[i])) |
---|
| 1749 | return FALSE; |
---|
| 1750 | if (r1->wvhdl[i] != NULL) |
---|
| 1751 | { |
---|
| 1752 | if (r2->wvhdl[i] == NULL) |
---|
| 1753 | return FALSE; |
---|
| 1754 | for (j=0; j<r1->block1[i]-r1->block0[i]+1; j++) |
---|
| 1755 | if (r2->wvhdl[i][j] != r1->wvhdl[i][j]) |
---|
| 1756 | return FALSE; |
---|
| 1757 | } |
---|
| 1758 | else if (r2->wvhdl[i] != NULL) return FALSE; |
---|
| 1759 | i++; |
---|
| 1760 | } |
---|
| 1761 | if (r2->order[i] != 0) return FALSE; |
---|
| 1762 | |
---|
[aec5c9] | 1763 | // we do not check minpoly/minideal |
---|
[a6904c] | 1764 | // we do not check qideal |
---|
| 1765 | |
---|
| 1766 | return TRUE; |
---|
| 1767 | } |
---|
| 1768 | |
---|
| 1769 | rOrderType_t rGetOrderType(ring r) |
---|
| 1770 | { |
---|
| 1771 | // check for simple ordering |
---|
| 1772 | if (rHasSimpleOrder(r)) |
---|
| 1773 | { |
---|
| 1774 | if ((r->order[1] == ringorder_c) |
---|
| 1775 | || (r->order[1] == ringorder_C)) |
---|
| 1776 | { |
---|
| 1777 | switch(r->order[0]) |
---|
| 1778 | { |
---|
| 1779 | case ringorder_dp: |
---|
| 1780 | case ringorder_wp: |
---|
| 1781 | case ringorder_ds: |
---|
| 1782 | case ringorder_ws: |
---|
| 1783 | case ringorder_ls: |
---|
| 1784 | case ringorder_unspec: |
---|
| 1785 | if (r->order[1] == ringorder_C |
---|
| 1786 | || r->order[0] == ringorder_unspec) |
---|
| 1787 | return rOrderType_ExpComp; |
---|
| 1788 | return rOrderType_Exp; |
---|
| 1789 | |
---|
| 1790 | default: |
---|
| 1791 | assume(r->order[0] == ringorder_lp || |
---|
| 1792 | r->order[0] == ringorder_rs || |
---|
| 1793 | r->order[0] == ringorder_Dp || |
---|
| 1794 | r->order[0] == ringorder_Wp || |
---|
| 1795 | r->order[0] == ringorder_Ds || |
---|
| 1796 | r->order[0] == ringorder_Ws); |
---|
| 1797 | |
---|
| 1798 | if (r->order[1] == ringorder_c) return rOrderType_ExpComp; |
---|
| 1799 | return rOrderType_Exp; |
---|
| 1800 | } |
---|
| 1801 | } |
---|
| 1802 | else |
---|
| 1803 | { |
---|
| 1804 | assume((r->order[0]==ringorder_c)||(r->order[0]==ringorder_C)); |
---|
| 1805 | return rOrderType_CompExp; |
---|
| 1806 | } |
---|
| 1807 | } |
---|
| 1808 | else |
---|
| 1809 | return rOrderType_General; |
---|
| 1810 | } |
---|
| 1811 | |
---|
| 1812 | BOOLEAN rHasSimpleOrder(const ring r) |
---|
| 1813 | { |
---|
| 1814 | if (r->order[0] == ringorder_unspec) return TRUE; |
---|
| 1815 | int blocks = rBlocks(r) - 1; |
---|
| 1816 | assume(blocks >= 1); |
---|
| 1817 | if (blocks == 1) return TRUE; |
---|
[273fed] | 1818 | |
---|
[f70f641] | 1819 | int s = 0; |
---|
[273fed] | 1820 | while( (s < blocks) && (r->order[s] == ringorder_IS) && (r->order[blocks-1] == ringorder_IS) ) |
---|
| 1821 | { |
---|
| 1822 | s++; |
---|
| 1823 | blocks--; |
---|
| 1824 | } |
---|
| 1825 | |
---|
| 1826 | if ((blocks - s) > 2) return FALSE; |
---|
| 1827 | |
---|
| 1828 | assume( blocks == s + 2 ); |
---|
[f70f641] | 1829 | |
---|
[273fed] | 1830 | if ( |
---|
| 1831 | (r->order[s] != ringorder_c) |
---|
| 1832 | && (r->order[s] != ringorder_C) |
---|
| 1833 | && (r->order[s+1] != ringorder_c) |
---|
| 1834 | && (r->order[s+1] != ringorder_C) |
---|
| 1835 | ) |
---|
[a6904c] | 1836 | return FALSE; |
---|
[273fed] | 1837 | if ((r->order[s+1] == ringorder_M) |
---|
| 1838 | || (r->order[s] == ringorder_M)) |
---|
[a6904c] | 1839 | return FALSE; |
---|
| 1840 | return TRUE; |
---|
| 1841 | } |
---|
| 1842 | |
---|
| 1843 | // returns TRUE, if simple lp or ls ordering |
---|
| 1844 | BOOLEAN rHasSimpleLexOrder(const ring r) |
---|
| 1845 | { |
---|
| 1846 | return rHasSimpleOrder(r) && |
---|
| 1847 | (r->order[0] == ringorder_ls || |
---|
| 1848 | r->order[0] == ringorder_lp || |
---|
| 1849 | r->order[1] == ringorder_ls || |
---|
| 1850 | r->order[1] == ringorder_lp); |
---|
| 1851 | } |
---|
| 1852 | |
---|
| 1853 | BOOLEAN rOrder_is_DegOrdering(const rRingOrder_t order) |
---|
| 1854 | { |
---|
| 1855 | switch(order) |
---|
| 1856 | { |
---|
| 1857 | case ringorder_dp: |
---|
| 1858 | case ringorder_Dp: |
---|
| 1859 | case ringorder_ds: |
---|
| 1860 | case ringorder_Ds: |
---|
| 1861 | case ringorder_Ws: |
---|
| 1862 | case ringorder_Wp: |
---|
| 1863 | case ringorder_ws: |
---|
| 1864 | case ringorder_wp: |
---|
| 1865 | return TRUE; |
---|
| 1866 | |
---|
| 1867 | default: |
---|
| 1868 | return FALSE; |
---|
| 1869 | } |
---|
| 1870 | } |
---|
| 1871 | |
---|
| 1872 | BOOLEAN rOrder_is_WeightedOrdering(rRingOrder_t order) |
---|
| 1873 | { |
---|
| 1874 | switch(order) |
---|
| 1875 | { |
---|
| 1876 | case ringorder_Ws: |
---|
| 1877 | case ringorder_Wp: |
---|
| 1878 | case ringorder_ws: |
---|
| 1879 | case ringorder_wp: |
---|
| 1880 | return TRUE; |
---|
| 1881 | |
---|
| 1882 | default: |
---|
| 1883 | return FALSE; |
---|
| 1884 | } |
---|
| 1885 | } |
---|
| 1886 | |
---|
| 1887 | BOOLEAN rHasSimpleOrderAA(ring r) |
---|
| 1888 | { |
---|
[273fed] | 1889 | if (r->order[0] == ringorder_unspec) return TRUE; |
---|
[a6904c] | 1890 | int blocks = rBlocks(r) - 1; |
---|
[273fed] | 1891 | assume(blocks >= 1); |
---|
| 1892 | if (blocks == 1) return TRUE; |
---|
| 1893 | |
---|
[f70f641] | 1894 | int s = 0; |
---|
[273fed] | 1895 | while( (s < blocks) && (r->order[s] == ringorder_IS) && (r->order[blocks-1] == ringorder_IS) ) |
---|
[a6904c] | 1896 | { |
---|
[273fed] | 1897 | s++; |
---|
| 1898 | blocks--; |
---|
| 1899 | } |
---|
| 1900 | |
---|
| 1901 | if ((blocks - s) > 3) return FALSE; |
---|
[f70f641] | 1902 | |
---|
[273fed] | 1903 | // if ((blocks > 3) || (blocks < 2)) return FALSE; |
---|
| 1904 | if ((blocks - s) == 3) |
---|
| 1905 | { |
---|
| 1906 | return (((r->order[s] == ringorder_aa) && (r->order[s+1] != ringorder_M) && |
---|
| 1907 | ((r->order[s+2] == ringorder_c) || (r->order[s+2] == ringorder_C))) || |
---|
| 1908 | (((r->order[s] == ringorder_c) || (r->order[s] == ringorder_C)) && |
---|
| 1909 | (r->order[s+1] == ringorder_aa) && (r->order[s+2] != ringorder_M))); |
---|
[a6904c] | 1910 | } |
---|
| 1911 | else |
---|
| 1912 | { |
---|
[273fed] | 1913 | return ((r->order[s] == ringorder_aa) && (r->order[s+1] != ringorder_M)); |
---|
[a6904c] | 1914 | } |
---|
| 1915 | } |
---|
| 1916 | |
---|
| 1917 | // return TRUE if p_SetComp requires p_Setm |
---|
| 1918 | BOOLEAN rOrd_SetCompRequiresSetm(ring r) |
---|
| 1919 | { |
---|
| 1920 | if (r->typ != NULL) |
---|
| 1921 | { |
---|
| 1922 | int pos; |
---|
| 1923 | for (pos=0;pos<r->OrdSize;pos++) |
---|
| 1924 | { |
---|
| 1925 | sro_ord* o=&(r->typ[pos]); |
---|
| 1926 | if ((o->ord_typ == ro_syzcomp) || (o->ord_typ == ro_syz) || (o->ord_typ == ro_is) || (o->ord_typ == ro_isTemp)) return TRUE; |
---|
| 1927 | } |
---|
| 1928 | } |
---|
| 1929 | return FALSE; |
---|
| 1930 | } |
---|
| 1931 | |
---|
| 1932 | // return TRUE if p->exp[r->pOrdIndex] holds total degree of p */ |
---|
| 1933 | BOOLEAN rOrd_is_Totaldegree_Ordering(ring r) |
---|
| 1934 | { |
---|
| 1935 | // Hmm.... what about Syz orderings? |
---|
| 1936 | return (rVar(r) > 1 && |
---|
| 1937 | ((rHasSimpleOrder(r) && |
---|
| 1938 | (rOrder_is_DegOrdering((rRingOrder_t)r->order[0]) || |
---|
| 1939 | rOrder_is_DegOrdering(( rRingOrder_t)r->order[1]))) || |
---|
| 1940 | (rHasSimpleOrderAA(r) && |
---|
| 1941 | (rOrder_is_DegOrdering((rRingOrder_t)r->order[1]) || |
---|
| 1942 | rOrder_is_DegOrdering((rRingOrder_t)r->order[2]))))); |
---|
| 1943 | } |
---|
| 1944 | |
---|
| 1945 | // return TRUE if p->exp[r->pOrdIndex] holds a weighted degree of p */ |
---|
[351a5f] | 1946 | BOOLEAN rOrd_is_WeightedDegree_Ordering(ring r ) |
---|
[a6904c] | 1947 | { |
---|
| 1948 | // Hmm.... what about Syz orderings? |
---|
| 1949 | return ((rVar(r) > 1) && |
---|
| 1950 | rHasSimpleOrder(r) && |
---|
| 1951 | (rOrder_is_WeightedOrdering((rRingOrder_t)r->order[0]) || |
---|
| 1952 | rOrder_is_WeightedOrdering(( rRingOrder_t)r->order[1]))); |
---|
| 1953 | } |
---|
| 1954 | |
---|
| 1955 | BOOLEAN rIsPolyVar(int v, ring r) |
---|
| 1956 | { |
---|
| 1957 | int i=0; |
---|
| 1958 | while(r->order[i]!=0) |
---|
| 1959 | { |
---|
| 1960 | if((r->block0[i]<=v) |
---|
| 1961 | && (r->block1[i]>=v)) |
---|
| 1962 | { |
---|
| 1963 | switch(r->order[i]) |
---|
| 1964 | { |
---|
| 1965 | case ringorder_a: |
---|
| 1966 | return (r->wvhdl[i][v-r->block0[i]]>0); |
---|
| 1967 | case ringorder_M: |
---|
| 1968 | return 2; /*don't know*/ |
---|
| 1969 | case ringorder_a64: /* assume: all weight are non-negative!*/ |
---|
| 1970 | case ringorder_lp: |
---|
| 1971 | case ringorder_rs: |
---|
| 1972 | case ringorder_dp: |
---|
| 1973 | case ringorder_Dp: |
---|
| 1974 | case ringorder_wp: |
---|
| 1975 | case ringorder_Wp: |
---|
| 1976 | return TRUE; |
---|
| 1977 | case ringorder_ls: |
---|
| 1978 | case ringorder_ds: |
---|
| 1979 | case ringorder_Ds: |
---|
| 1980 | case ringorder_ws: |
---|
| 1981 | case ringorder_Ws: |
---|
| 1982 | return FALSE; |
---|
| 1983 | default: |
---|
| 1984 | break; |
---|
| 1985 | } |
---|
| 1986 | } |
---|
| 1987 | i++; |
---|
| 1988 | } |
---|
| 1989 | return 3; /* could not find var v*/ |
---|
| 1990 | } |
---|
| 1991 | |
---|
| 1992 | #ifdef RDEBUG |
---|
| 1993 | // This should eventually become a full-fledge ring check, like pTest |
---|
| 1994 | BOOLEAN rDBTest(ring r, const char* fn, const int l) |
---|
| 1995 | { |
---|
| 1996 | int i,j; |
---|
| 1997 | |
---|
| 1998 | if (r == NULL) |
---|
| 1999 | { |
---|
| 2000 | dReportError("Null ring in %s:%d", fn, l); |
---|
| 2001 | return FALSE; |
---|
| 2002 | } |
---|
| 2003 | |
---|
| 2004 | |
---|
| 2005 | if (r->N == 0) return TRUE; |
---|
| 2006 | |
---|
| 2007 | // omCheckAddrSize(r,sizeof(ip_sring)); |
---|
| 2008 | #if OM_CHECK > 0 |
---|
| 2009 | i=rBlocks(r); |
---|
| 2010 | omCheckAddrSize(r->order,i*sizeof(int)); |
---|
| 2011 | omCheckAddrSize(r->block0,i*sizeof(int)); |
---|
| 2012 | omCheckAddrSize(r->block1,i*sizeof(int)); |
---|
| 2013 | if (r->wvhdl!=NULL) |
---|
| 2014 | { |
---|
[f2de2e] | 2015 | omCheckAddrSize(r->wvhdl,i*sizeof(int *)); |
---|
| 2016 | for (j=0;j<i; j++) |
---|
| 2017 | { |
---|
| 2018 | if (r->wvhdl[j] != NULL) omCheckAddr(r->wvhdl[j]); |
---|
| 2019 | } |
---|
[a6904c] | 2020 | } |
---|
| 2021 | #endif |
---|
| 2022 | if (r->VarOffset == NULL) |
---|
| 2023 | { |
---|
| 2024 | dReportError("Null ring VarOffset -- no rComplete (?) in n %s:%d", fn, l); |
---|
| 2025 | return FALSE; |
---|
| 2026 | } |
---|
| 2027 | omCheckAddrSize(r->VarOffset,(r->N+1)*sizeof(int)); |
---|
| 2028 | |
---|
| 2029 | if ((r->OrdSize==0)!=(r->typ==NULL)) |
---|
| 2030 | { |
---|
| 2031 | dReportError("mismatch OrdSize and typ-pointer in %s:%d"); |
---|
| 2032 | return FALSE; |
---|
| 2033 | } |
---|
| 2034 | omcheckAddrSize(r->typ,r->OrdSize*sizeof(*(r->typ))); |
---|
| 2035 | omCheckAddrSize(r->VarOffset,(r->N+1)*sizeof(*(r->VarOffset))); |
---|
| 2036 | // test assumptions: |
---|
| 2037 | for(i=0;i<=r->N;i++) // for all variables (i = 0..N) |
---|
| 2038 | { |
---|
| 2039 | if(r->typ!=NULL) |
---|
| 2040 | { |
---|
| 2041 | for(j=0;j<r->OrdSize;j++) // for all ordering blocks (j =0..OrdSize-1) |
---|
| 2042 | { |
---|
| 2043 | if(r->typ[j].ord_typ == ro_isTemp) |
---|
| 2044 | { |
---|
| 2045 | const int p = r->typ[j].data.isTemp.suffixpos; |
---|
| 2046 | |
---|
| 2047 | if(p <= j) |
---|
| 2048 | dReportError("ordrec prefix %d is unmatched",j); |
---|
| 2049 | |
---|
| 2050 | assume( p < r->OrdSize ); |
---|
| 2051 | |
---|
| 2052 | if(r->typ[p].ord_typ != ro_is) |
---|
| 2053 | dReportError("ordrec prefix %d is unmatched (suffix: %d is wrong!!!)",j, p); |
---|
| 2054 | |
---|
| 2055 | // Skip all intermediate blocks for undone variables: |
---|
| 2056 | if(r->typ[j].data.isTemp.pVarOffset[i] != -1) // Check i^th variable |
---|
| 2057 | { |
---|
| 2058 | j = p - 1; // SKIP ALL INTERNAL BLOCKS...??? |
---|
| 2059 | continue; // To make for check OrdSize bound... |
---|
| 2060 | } |
---|
| 2061 | } |
---|
| 2062 | else if (r->typ[j].ord_typ == ro_is) |
---|
| 2063 | { |
---|
| 2064 | // Skip all intermediate blocks for undone variables: |
---|
| 2065 | if(r->typ[j].data.is.pVarOffset[i] != -1) |
---|
| 2066 | { |
---|
| 2067 | // ??? |
---|
| 2068 | } |
---|
| 2069 | |
---|
| 2070 | } |
---|
| 2071 | else |
---|
| 2072 | { |
---|
| 2073 | if (r->typ[j].ord_typ==ro_cp) |
---|
| 2074 | { |
---|
| 2075 | if(((short)r->VarOffset[i]) == r->typ[j].data.cp.place) |
---|
| 2076 | dReportError("ordrec %d conflicts with var %d",j,i); |
---|
| 2077 | } |
---|
| 2078 | else |
---|
| 2079 | if ((r->typ[j].ord_typ!=ro_syzcomp) |
---|
| 2080 | && (r->VarOffset[i] == r->typ[j].data.dp.place)) |
---|
| 2081 | dReportError("ordrec %d conflicts with var %d",j,i); |
---|
| 2082 | } |
---|
| 2083 | } |
---|
| 2084 | } |
---|
| 2085 | int tmp; |
---|
| 2086 | tmp=r->VarOffset[i] & 0xffffff; |
---|
| 2087 | #if SIZEOF_LONG == 8 |
---|
| 2088 | if ((r->VarOffset[i] >> 24) >63) |
---|
| 2089 | #else |
---|
| 2090 | if ((r->VarOffset[i] >> 24) >31) |
---|
| 2091 | #endif |
---|
| 2092 | dReportError("bit_start out of range:%d",r->VarOffset[i] >> 24); |
---|
| 2093 | if (i > 0 && ((tmp<0) ||(tmp>r->ExpL_Size-1))) |
---|
| 2094 | { |
---|
| 2095 | dReportError("varoffset out of range for var %d: %d",i,tmp); |
---|
| 2096 | } |
---|
| 2097 | } |
---|
| 2098 | if(r->typ!=NULL) |
---|
| 2099 | { |
---|
| 2100 | for(j=0;j<r->OrdSize;j++) |
---|
| 2101 | { |
---|
| 2102 | if ((r->typ[j].ord_typ==ro_dp) |
---|
| 2103 | || (r->typ[j].ord_typ==ro_wp) |
---|
| 2104 | || (r->typ[j].ord_typ==ro_wp_neg)) |
---|
| 2105 | { |
---|
| 2106 | if (r->typ[j].data.dp.start > r->typ[j].data.dp.end) |
---|
| 2107 | dReportError("in ordrec %d: start(%d) > end(%d)",j, |
---|
| 2108 | r->typ[j].data.dp.start, r->typ[j].data.dp.end); |
---|
| 2109 | if ((r->typ[j].data.dp.start < 1) |
---|
| 2110 | || (r->typ[j].data.dp.end > r->N)) |
---|
| 2111 | dReportError("in ordrec %d: start(%d)<1 or end(%d)>vars(%d)",j, |
---|
| 2112 | r->typ[j].data.dp.start, r->typ[j].data.dp.end,r->N); |
---|
| 2113 | } |
---|
| 2114 | } |
---|
| 2115 | } |
---|
[4c6e420] | 2116 | |
---|
| 2117 | if (!rMinpolyIsNULL(r)) |
---|
[6ccdd3a] | 2118 | omCheckAddr(r->cf->extRing->minideal->m[0]); |
---|
[4c6e420] | 2119 | |
---|
[a6904c] | 2120 | //assume(r->cf!=NULL); |
---|
| 2121 | |
---|
| 2122 | return TRUE; |
---|
| 2123 | } |
---|
| 2124 | #endif |
---|
| 2125 | |
---|
| 2126 | static void rO_Align(int &place, int &bitplace) |
---|
| 2127 | { |
---|
| 2128 | // increment place to the next aligned one |
---|
| 2129 | // (count as Exponent_t,align as longs) |
---|
| 2130 | if (bitplace!=BITS_PER_LONG) |
---|
| 2131 | { |
---|
| 2132 | place++; |
---|
| 2133 | bitplace=BITS_PER_LONG; |
---|
| 2134 | } |
---|
| 2135 | } |
---|
| 2136 | |
---|
| 2137 | static void rO_TDegree(int &place, int &bitplace, int start, int end, |
---|
| 2138 | long *o, sro_ord &ord_struct) |
---|
| 2139 | { |
---|
| 2140 | // degree (aligned) of variables v_start..v_end, ordsgn 1 |
---|
| 2141 | rO_Align(place,bitplace); |
---|
| 2142 | ord_struct.ord_typ=ro_dp; |
---|
| 2143 | ord_struct.data.dp.start=start; |
---|
| 2144 | ord_struct.data.dp.end=end; |
---|
| 2145 | ord_struct.data.dp.place=place; |
---|
| 2146 | o[place]=1; |
---|
| 2147 | place++; |
---|
| 2148 | rO_Align(place,bitplace); |
---|
| 2149 | } |
---|
| 2150 | |
---|
| 2151 | static void rO_TDegree_neg(int &place, int &bitplace, int start, int end, |
---|
| 2152 | long *o, sro_ord &ord_struct) |
---|
| 2153 | { |
---|
| 2154 | // degree (aligned) of variables v_start..v_end, ordsgn -1 |
---|
| 2155 | rO_Align(place,bitplace); |
---|
| 2156 | ord_struct.ord_typ=ro_dp; |
---|
| 2157 | ord_struct.data.dp.start=start; |
---|
| 2158 | ord_struct.data.dp.end=end; |
---|
| 2159 | ord_struct.data.dp.place=place; |
---|
| 2160 | o[place]=-1; |
---|
| 2161 | place++; |
---|
| 2162 | rO_Align(place,bitplace); |
---|
| 2163 | } |
---|
| 2164 | |
---|
| 2165 | static void rO_WDegree(int &place, int &bitplace, int start, int end, |
---|
| 2166 | long *o, sro_ord &ord_struct, int *weights) |
---|
| 2167 | { |
---|
| 2168 | // weighted degree (aligned) of variables v_start..v_end, ordsgn 1 |
---|
| 2169 | while((start<end) && (weights[0]==0)) { start++; weights++; } |
---|
| 2170 | while((start<end) && (weights[end-start]==0)) { end--; } |
---|
| 2171 | int i; |
---|
| 2172 | int pure_tdeg=1; |
---|
| 2173 | for(i=start;i<=end;i++) |
---|
| 2174 | { |
---|
| 2175 | if(weights[i-start]!=1) |
---|
| 2176 | { |
---|
| 2177 | pure_tdeg=0; |
---|
| 2178 | break; |
---|
| 2179 | } |
---|
| 2180 | } |
---|
| 2181 | if (pure_tdeg) |
---|
| 2182 | { |
---|
| 2183 | rO_TDegree(place,bitplace,start,end,o,ord_struct); |
---|
| 2184 | return; |
---|
| 2185 | } |
---|
| 2186 | rO_Align(place,bitplace); |
---|
| 2187 | ord_struct.ord_typ=ro_wp; |
---|
| 2188 | ord_struct.data.wp.start=start; |
---|
| 2189 | ord_struct.data.wp.end=end; |
---|
| 2190 | ord_struct.data.wp.place=place; |
---|
| 2191 | ord_struct.data.wp.weights=weights; |
---|
| 2192 | o[place]=1; |
---|
| 2193 | place++; |
---|
| 2194 | rO_Align(place,bitplace); |
---|
| 2195 | for(i=start;i<=end;i++) |
---|
| 2196 | { |
---|
| 2197 | if(weights[i-start]<0) |
---|
| 2198 | { |
---|
| 2199 | ord_struct.ord_typ=ro_wp_neg; |
---|
| 2200 | break; |
---|
| 2201 | } |
---|
| 2202 | } |
---|
| 2203 | } |
---|
| 2204 | |
---|
| 2205 | static void rO_WDegree64(int &place, int &bitplace, int start, int end, |
---|
| 2206 | long *o, sro_ord &ord_struct, int64 *weights) |
---|
| 2207 | { |
---|
| 2208 | // weighted degree (aligned) of variables v_start..v_end, ordsgn 1, |
---|
| 2209 | // reserved 2 places |
---|
| 2210 | rO_Align(place,bitplace); |
---|
| 2211 | ord_struct.ord_typ=ro_wp64; |
---|
| 2212 | ord_struct.data.wp64.start=start; |
---|
| 2213 | ord_struct.data.wp64.end=end; |
---|
| 2214 | ord_struct.data.wp64.place=place; |
---|
| 2215 | ord_struct.data.wp64.weights64=weights; |
---|
| 2216 | o[place]=1; |
---|
| 2217 | place++; |
---|
| 2218 | o[place]=1; |
---|
| 2219 | place++; |
---|
| 2220 | rO_Align(place,bitplace); |
---|
| 2221 | } |
---|
| 2222 | |
---|
| 2223 | static void rO_WDegree_neg(int &place, int &bitplace, int start, int end, |
---|
| 2224 | long *o, sro_ord &ord_struct, int *weights) |
---|
| 2225 | { |
---|
| 2226 | // weighted degree (aligned) of variables v_start..v_end, ordsgn -1 |
---|
| 2227 | while((start<end) && (weights[0]==0)) { start++; weights++; } |
---|
| 2228 | while((start<end) && (weights[end-start]==0)) { end--; } |
---|
| 2229 | rO_Align(place,bitplace); |
---|
| 2230 | ord_struct.ord_typ=ro_wp; |
---|
| 2231 | ord_struct.data.wp.start=start; |
---|
| 2232 | ord_struct.data.wp.end=end; |
---|
| 2233 | ord_struct.data.wp.place=place; |
---|
| 2234 | ord_struct.data.wp.weights=weights; |
---|
| 2235 | o[place]=-1; |
---|
| 2236 | place++; |
---|
| 2237 | rO_Align(place,bitplace); |
---|
| 2238 | int i; |
---|
| 2239 | for(i=start;i<=end;i++) |
---|
| 2240 | { |
---|
| 2241 | if(weights[i-start]<0) |
---|
| 2242 | { |
---|
| 2243 | ord_struct.ord_typ=ro_wp_neg; |
---|
| 2244 | break; |
---|
| 2245 | } |
---|
| 2246 | } |
---|
| 2247 | } |
---|
| 2248 | |
---|
| 2249 | static void rO_LexVars(int &place, int &bitplace, int start, int end, |
---|
| 2250 | int &prev_ord, long *o,int *v, int bits, int opt_var) |
---|
| 2251 | { |
---|
| 2252 | // a block of variables v_start..v_end with lex order, ordsgn 1 |
---|
| 2253 | int k; |
---|
| 2254 | int incr=1; |
---|
| 2255 | if(prev_ord==-1) rO_Align(place,bitplace); |
---|
| 2256 | |
---|
| 2257 | if (start>end) |
---|
| 2258 | { |
---|
| 2259 | incr=-1; |
---|
| 2260 | } |
---|
| 2261 | for(k=start;;k+=incr) |
---|
| 2262 | { |
---|
| 2263 | bitplace-=bits; |
---|
| 2264 | if (bitplace < 0) { bitplace=BITS_PER_LONG-bits; place++; } |
---|
| 2265 | o[place]=1; |
---|
| 2266 | v[k]= place | (bitplace << 24); |
---|
| 2267 | if (k==end) break; |
---|
| 2268 | } |
---|
| 2269 | prev_ord=1; |
---|
| 2270 | if (opt_var!= -1) |
---|
| 2271 | { |
---|
| 2272 | assume((opt_var == end+1) ||(opt_var == end-1)); |
---|
| 2273 | if((opt_var != end+1) &&(opt_var != end-1)) WarnS("hier-2"); |
---|
| 2274 | int save_bitplace=bitplace; |
---|
| 2275 | bitplace-=bits; |
---|
| 2276 | if (bitplace < 0) |
---|
| 2277 | { |
---|
| 2278 | bitplace=save_bitplace; |
---|
| 2279 | return; |
---|
| 2280 | } |
---|
| 2281 | // there is enough space for the optional var |
---|
| 2282 | v[opt_var]=place | (bitplace << 24); |
---|
| 2283 | } |
---|
| 2284 | } |
---|
| 2285 | |
---|
| 2286 | static void rO_LexVars_neg(int &place, int &bitplace, int start, int end, |
---|
| 2287 | int &prev_ord, long *o,int *v, int bits, int opt_var) |
---|
| 2288 | { |
---|
| 2289 | // a block of variables v_start..v_end with lex order, ordsgn -1 |
---|
| 2290 | int k; |
---|
| 2291 | int incr=1; |
---|
| 2292 | if(prev_ord==1) rO_Align(place,bitplace); |
---|
| 2293 | |
---|
| 2294 | if (start>end) |
---|
| 2295 | { |
---|
| 2296 | incr=-1; |
---|
| 2297 | } |
---|
| 2298 | for(k=start;;k+=incr) |
---|
| 2299 | { |
---|
| 2300 | bitplace-=bits; |
---|
| 2301 | if (bitplace < 0) { bitplace=BITS_PER_LONG-bits; place++; } |
---|
| 2302 | o[place]=-1; |
---|
| 2303 | v[k]=place | (bitplace << 24); |
---|
| 2304 | if (k==end) break; |
---|
| 2305 | } |
---|
| 2306 | prev_ord=-1; |
---|
| 2307 | // #if 0 |
---|
| 2308 | if (opt_var!= -1) |
---|
| 2309 | { |
---|
| 2310 | assume((opt_var == end+1) ||(opt_var == end-1)); |
---|
| 2311 | if((opt_var != end+1) &&(opt_var != end-1)) WarnS("hier-1"); |
---|
| 2312 | int save_bitplace=bitplace; |
---|
| 2313 | bitplace-=bits; |
---|
| 2314 | if (bitplace < 0) |
---|
| 2315 | { |
---|
| 2316 | bitplace=save_bitplace; |
---|
| 2317 | return; |
---|
| 2318 | } |
---|
| 2319 | // there is enough space for the optional var |
---|
| 2320 | v[opt_var]=place | (bitplace << 24); |
---|
| 2321 | } |
---|
| 2322 | // #endif |
---|
| 2323 | } |
---|
| 2324 | |
---|
| 2325 | static void rO_Syzcomp(int &place, int &bitplace, int &prev_ord, |
---|
| 2326 | long *o, sro_ord &ord_struct) |
---|
| 2327 | { |
---|
| 2328 | // ordering is derived from component number |
---|
| 2329 | rO_Align(place,bitplace); |
---|
| 2330 | ord_struct.ord_typ=ro_syzcomp; |
---|
| 2331 | ord_struct.data.syzcomp.place=place; |
---|
| 2332 | ord_struct.data.syzcomp.Components=NULL; |
---|
| 2333 | ord_struct.data.syzcomp.ShiftedComponents=NULL; |
---|
| 2334 | o[place]=1; |
---|
| 2335 | prev_ord=1; |
---|
| 2336 | place++; |
---|
| 2337 | rO_Align(place,bitplace); |
---|
| 2338 | } |
---|
| 2339 | |
---|
| 2340 | static void rO_Syz(int &place, int &bitplace, int &prev_ord, |
---|
| 2341 | long *o, sro_ord &ord_struct) |
---|
| 2342 | { |
---|
| 2343 | // ordering is derived from component number |
---|
| 2344 | // let's reserve one Exponent_t for it |
---|
| 2345 | if ((prev_ord== 1) || (bitplace!=BITS_PER_LONG)) |
---|
| 2346 | rO_Align(place,bitplace); |
---|
| 2347 | ord_struct.ord_typ=ro_syz; |
---|
| 2348 | ord_struct.data.syz.place=place; |
---|
| 2349 | ord_struct.data.syz.limit=0; |
---|
| 2350 | ord_struct.data.syz.syz_index = NULL; |
---|
| 2351 | ord_struct.data.syz.curr_index = 1; |
---|
| 2352 | o[place]= -1; |
---|
| 2353 | prev_ord=-1; |
---|
| 2354 | place++; |
---|
| 2355 | } |
---|
| 2356 | |
---|
[2e4f788] | 2357 | #ifndef NDEBUG |
---|
| 2358 | # define MYTEST 0 |
---|
| 2359 | #else /* ifndef NDEBUG */ |
---|
| 2360 | # define MYTEST 0 |
---|
| 2361 | #endif /* ifndef NDEBUG */ |
---|
[a6904c] | 2362 | |
---|
| 2363 | static void rO_ISPrefix(int &place, int &bitplace, int &prev_ord, |
---|
[9bb5457] | 2364 | long *o, int /*N*/, int *v, sro_ord &ord_struct) |
---|
[a6904c] | 2365 | { |
---|
| 2366 | if ((prev_ord== 1) || (bitplace!=BITS_PER_LONG)) |
---|
| 2367 | rO_Align(place,bitplace); |
---|
| 2368 | // since we add something afterwards - it's better to start with anew!? |
---|
| 2369 | |
---|
| 2370 | ord_struct.ord_typ = ro_isTemp; |
---|
| 2371 | ord_struct.data.isTemp.start = place; |
---|
| 2372 | ord_struct.data.isTemp.pVarOffset = (int *)omMemDup(v); |
---|
| 2373 | ord_struct.data.isTemp.suffixpos = -1; |
---|
| 2374 | |
---|
| 2375 | // We will act as rO_Syz on our own!!! |
---|
| 2376 | // Here we allocate an exponent as a level placeholder |
---|
| 2377 | o[place]= -1; |
---|
| 2378 | prev_ord=-1; |
---|
| 2379 | place++; |
---|
| 2380 | } |
---|
| 2381 | static void rO_ISSuffix(int &place, int &bitplace, int &prev_ord, long *o, |
---|
| 2382 | int N, int *v, sro_ord *tmp_typ, int &typ_i, int sgn) |
---|
| 2383 | { |
---|
| 2384 | |
---|
| 2385 | // Let's find previous prefix: |
---|
| 2386 | int typ_j = typ_i - 1; |
---|
| 2387 | while(typ_j >= 0) |
---|
| 2388 | { |
---|
| 2389 | if( tmp_typ[typ_j].ord_typ == ro_isTemp) |
---|
| 2390 | break; |
---|
| 2391 | typ_j --; |
---|
| 2392 | } |
---|
| 2393 | |
---|
| 2394 | assume( typ_j >= 0 ); |
---|
| 2395 | |
---|
| 2396 | if( typ_j < 0 ) // Found NO prefix!!! :( |
---|
| 2397 | return; |
---|
| 2398 | |
---|
| 2399 | assume( tmp_typ[typ_j].ord_typ == ro_isTemp ); |
---|
| 2400 | |
---|
| 2401 | // Get saved state: |
---|
| 2402 | const int start = tmp_typ[typ_j].data.isTemp.start; |
---|
| 2403 | int *pVarOffset = tmp_typ[typ_j].data.isTemp.pVarOffset; |
---|
| 2404 | |
---|
| 2405 | /* |
---|
| 2406 | // shift up all blocks |
---|
| 2407 | while(typ_j < (typ_i-1)) |
---|
| 2408 | { |
---|
| 2409 | tmp_typ[typ_j] = tmp_typ[typ_j+1]; |
---|
| 2410 | typ_j++; |
---|
| 2411 | } |
---|
| 2412 | typ_j = typ_i - 1; // No increment for typ_i |
---|
| 2413 | */ |
---|
| 2414 | tmp_typ[typ_j].data.isTemp.suffixpos = typ_i; |
---|
| 2415 | |
---|
| 2416 | // Let's keep that dummy for now... |
---|
| 2417 | typ_j = typ_i; // the typ to change! |
---|
| 2418 | typ_i++; // Just for now... |
---|
| 2419 | |
---|
| 2420 | |
---|
| 2421 | for( int i = 0; i <= N; i++ ) // Note [0] == component !!! No Skip? |
---|
| 2422 | { |
---|
| 2423 | // Was i-th variable allocated inbetween? |
---|
| 2424 | if( v[i] != pVarOffset[i] ) |
---|
| 2425 | { |
---|
| 2426 | pVarOffset[i] = v[i]; // Save for later... |
---|
| 2427 | v[i] = -1; // Undo! |
---|
| 2428 | assume( pVarOffset[i] != -1 ); |
---|
| 2429 | } |
---|
| 2430 | else |
---|
| 2431 | pVarOffset[i] = -1; // No change here... |
---|
| 2432 | } |
---|
| 2433 | |
---|
| 2434 | if( pVarOffset[0] != -1 ) |
---|
| 2435 | pVarOffset[0] &= 0x0fff; |
---|
| 2436 | |
---|
| 2437 | sro_ord &ord_struct = tmp_typ[typ_j]; |
---|
| 2438 | |
---|
| 2439 | |
---|
| 2440 | ord_struct.ord_typ = ro_is; |
---|
| 2441 | ord_struct.data.is.start = start; |
---|
| 2442 | ord_struct.data.is.end = place; |
---|
| 2443 | ord_struct.data.is.pVarOffset = pVarOffset; |
---|
| 2444 | |
---|
| 2445 | |
---|
| 2446 | // What about component??? |
---|
| 2447 | // if( v[0] != -1 ) // There is a component already...??? |
---|
| 2448 | // if( o[ v[0] & 0x0fff ] == sgn ) |
---|
| 2449 | // { |
---|
| 2450 | // pVarOffset[0] = -1; // NEVER USED Afterwards... |
---|
| 2451 | // return; |
---|
| 2452 | // } |
---|
| 2453 | |
---|
| 2454 | |
---|
| 2455 | // Moreover: we need to allocate the module component (v[0]) here! |
---|
| 2456 | if( v[0] == -1) // It's possible that there was module component v0 at the begining (before prefix)! |
---|
| 2457 | { |
---|
| 2458 | // Start with a whole long exponent |
---|
| 2459 | if( bitplace != BITS_PER_LONG ) |
---|
| 2460 | rO_Align(place, bitplace); |
---|
| 2461 | |
---|
| 2462 | assume( bitplace == BITS_PER_LONG ); |
---|
| 2463 | bitplace -= BITS_PER_LONG; |
---|
| 2464 | assume(bitplace == 0); |
---|
| 2465 | v[0] = place | (bitplace << 24); // Never mind whether pVarOffset[0] > 0!!! |
---|
| 2466 | o[place] = sgn; // Singnum for component ordering |
---|
| 2467 | prev_ord = sgn; |
---|
| 2468 | } |
---|
| 2469 | } |
---|
| 2470 | |
---|
| 2471 | |
---|
| 2472 | static unsigned long rGetExpSize(unsigned long bitmask, int & bits) |
---|
| 2473 | { |
---|
| 2474 | if (bitmask == 0) |
---|
| 2475 | { |
---|
| 2476 | bits=16; bitmask=0xffff; |
---|
| 2477 | } |
---|
| 2478 | else if (bitmask <= 1L) |
---|
| 2479 | { |
---|
| 2480 | bits=1; bitmask = 1L; |
---|
| 2481 | } |
---|
| 2482 | else if (bitmask <= 3L) |
---|
| 2483 | { |
---|
| 2484 | bits=2; bitmask = 3L; |
---|
| 2485 | } |
---|
| 2486 | else if (bitmask <= 7L) |
---|
| 2487 | { |
---|
| 2488 | bits=3; bitmask=7L; |
---|
| 2489 | } |
---|
| 2490 | else if (bitmask <= 0xfL) |
---|
| 2491 | { |
---|
| 2492 | bits=4; bitmask=0xfL; |
---|
| 2493 | } |
---|
| 2494 | else if (bitmask <= 0x1fL) |
---|
| 2495 | { |
---|
| 2496 | bits=5; bitmask=0x1fL; |
---|
| 2497 | } |
---|
| 2498 | else if (bitmask <= 0x3fL) |
---|
| 2499 | { |
---|
| 2500 | bits=6; bitmask=0x3fL; |
---|
| 2501 | } |
---|
| 2502 | #if SIZEOF_LONG == 8 |
---|
| 2503 | else if (bitmask <= 0x7fL) |
---|
| 2504 | { |
---|
| 2505 | bits=7; bitmask=0x7fL; /* 64 bit longs only */ |
---|
| 2506 | } |
---|
| 2507 | #endif |
---|
| 2508 | else if (bitmask <= 0xffL) |
---|
| 2509 | { |
---|
| 2510 | bits=8; bitmask=0xffL; |
---|
| 2511 | } |
---|
| 2512 | #if SIZEOF_LONG == 8 |
---|
| 2513 | else if (bitmask <= 0x1ffL) |
---|
| 2514 | { |
---|
| 2515 | bits=9; bitmask=0x1ffL; /* 64 bit longs only */ |
---|
| 2516 | } |
---|
| 2517 | #endif |
---|
| 2518 | else if (bitmask <= 0x3ffL) |
---|
| 2519 | { |
---|
| 2520 | bits=10; bitmask=0x3ffL; |
---|
| 2521 | } |
---|
| 2522 | #if SIZEOF_LONG == 8 |
---|
| 2523 | else if (bitmask <= 0xfffL) |
---|
| 2524 | { |
---|
| 2525 | bits=12; bitmask=0xfff; /* 64 bit longs only */ |
---|
| 2526 | } |
---|
| 2527 | #endif |
---|
| 2528 | else if (bitmask <= 0xffffL) |
---|
| 2529 | { |
---|
| 2530 | bits=16; bitmask=0xffffL; |
---|
| 2531 | } |
---|
| 2532 | #if SIZEOF_LONG == 8 |
---|
| 2533 | else if (bitmask <= 0xfffffL) |
---|
| 2534 | { |
---|
| 2535 | bits=20; bitmask=0xfffffL; /* 64 bit longs only */ |
---|
| 2536 | } |
---|
| 2537 | else if (bitmask <= 0xffffffffL) |
---|
| 2538 | { |
---|
| 2539 | bits=32; bitmask=0xffffffffL; |
---|
| 2540 | } |
---|
| 2541 | else if (bitmask <= 0x7fffffffffffffffL) |
---|
| 2542 | { |
---|
| 2543 | bits=63; bitmask=0x7fffffffffffffffL; /* for overflow tests*/ |
---|
| 2544 | } |
---|
| 2545 | else |
---|
| 2546 | { |
---|
| 2547 | bits=63; bitmask=0x7fffffffffffffffL; /* for overflow tests*/ |
---|
| 2548 | } |
---|
| 2549 | #else |
---|
| 2550 | else if (bitmask <= 0x7fffffff) |
---|
| 2551 | { |
---|
| 2552 | bits=31; bitmask=0x7fffffff; /* for overflow tests*/ |
---|
| 2553 | } |
---|
| 2554 | else |
---|
| 2555 | { |
---|
| 2556 | bits=31; bitmask=0x7fffffffL; /* for overflow tests*/ |
---|
| 2557 | } |
---|
| 2558 | #endif |
---|
| 2559 | return bitmask; |
---|
| 2560 | } |
---|
| 2561 | |
---|
| 2562 | /*2 |
---|
| 2563 | * optimize rGetExpSize for a block of N variables, exp <=bitmask |
---|
| 2564 | */ |
---|
| 2565 | static unsigned long rGetExpSize(unsigned long bitmask, int & bits, int N) |
---|
| 2566 | { |
---|
| 2567 | bitmask =rGetExpSize(bitmask, bits); |
---|
| 2568 | int vars_per_long=BIT_SIZEOF_LONG/bits; |
---|
| 2569 | int bits1; |
---|
| 2570 | loop |
---|
| 2571 | { |
---|
| 2572 | if (bits == BIT_SIZEOF_LONG-1) |
---|
| 2573 | { |
---|
| 2574 | bits = BIT_SIZEOF_LONG - 1; |
---|
| 2575 | return LONG_MAX; |
---|
| 2576 | } |
---|
| 2577 | unsigned long bitmask1 =rGetExpSize(bitmask+1, bits1); |
---|
| 2578 | int vars_per_long1=BIT_SIZEOF_LONG/bits1; |
---|
| 2579 | if ((((N+vars_per_long-1)/vars_per_long) == |
---|
| 2580 | ((N+vars_per_long1-1)/vars_per_long1))) |
---|
| 2581 | { |
---|
| 2582 | vars_per_long=vars_per_long1; |
---|
| 2583 | bits=bits1; |
---|
| 2584 | bitmask=bitmask1; |
---|
| 2585 | } |
---|
| 2586 | else |
---|
| 2587 | { |
---|
| 2588 | return bitmask; /* and bits */ |
---|
| 2589 | } |
---|
| 2590 | } |
---|
| 2591 | } |
---|
| 2592 | |
---|
| 2593 | |
---|
| 2594 | /*2 |
---|
| 2595 | * create a copy of the ring r, which must be equivalent to currRing |
---|
| 2596 | * used for std computations |
---|
| 2597 | * may share data structures with currRing |
---|
| 2598 | * DOES CALL rComplete |
---|
| 2599 | */ |
---|
| 2600 | ring rModifyRing(ring r, BOOLEAN omit_degree, |
---|
| 2601 | BOOLEAN omit_comp, |
---|
| 2602 | unsigned long exp_limit) |
---|
| 2603 | { |
---|
| 2604 | assume (r != NULL ); |
---|
| 2605 | assume (exp_limit > 1); |
---|
| 2606 | BOOLEAN need_other_ring; |
---|
| 2607 | BOOLEAN omitted_degree = FALSE; |
---|
| 2608 | |
---|
| 2609 | int iNeedInducedOrderingSetup = 0; ///< How many induced ordering block do we have? |
---|
| 2610 | int bits; |
---|
| 2611 | |
---|
| 2612 | exp_limit=rGetExpSize(exp_limit, bits, r->N); |
---|
| 2613 | need_other_ring = (exp_limit != r->bitmask); |
---|
| 2614 | |
---|
| 2615 | int nblocks=rBlocks(r); |
---|
| 2616 | int *order=(int*)omAlloc0((nblocks+1)*sizeof(int)); |
---|
| 2617 | int *block0=(int*)omAlloc0((nblocks+1)*sizeof(int)); |
---|
| 2618 | int *block1=(int*)omAlloc0((nblocks+1)*sizeof(int)); |
---|
[351a5f] | 2619 | int **wvhdl=(int**)omAlloc0((nblocks+1)*sizeof(int *)); |
---|
[a6904c] | 2620 | |
---|
| 2621 | int i=0; |
---|
| 2622 | int j=0; /* i index in r, j index in res */ |
---|
| 2623 | |
---|
| 2624 | for( int r_ord=r->order[i]; (r_ord != 0) && (i < nblocks); j++, r_ord=r->order[++i]) |
---|
| 2625 | { |
---|
| 2626 | BOOLEAN copy_block_index=TRUE; |
---|
| 2627 | |
---|
| 2628 | if (r->block0[i]==r->block1[i]) |
---|
| 2629 | { |
---|
| 2630 | switch(r_ord) |
---|
| 2631 | { |
---|
| 2632 | case ringorder_wp: |
---|
| 2633 | case ringorder_dp: |
---|
| 2634 | case ringorder_Wp: |
---|
| 2635 | case ringorder_Dp: |
---|
| 2636 | r_ord=ringorder_lp; |
---|
| 2637 | break; |
---|
| 2638 | case ringorder_Ws: |
---|
| 2639 | case ringorder_Ds: |
---|
| 2640 | case ringorder_ws: |
---|
| 2641 | case ringorder_ds: |
---|
| 2642 | r_ord=ringorder_ls; |
---|
| 2643 | break; |
---|
| 2644 | default: |
---|
| 2645 | break; |
---|
| 2646 | } |
---|
| 2647 | } |
---|
| 2648 | switch(r_ord) |
---|
| 2649 | { |
---|
| 2650 | case ringorder_S: |
---|
| 2651 | { |
---|
| 2652 | #ifndef NDEBUG |
---|
[6e66d2] | 2653 | Warn("Error: unhandled ordering in rModifyRing: ringorder_S = [%d]", r_ord); |
---|
[a6904c] | 2654 | #endif |
---|
| 2655 | order[j]=r_ord; /*r->order[i];*/ |
---|
| 2656 | break; |
---|
| 2657 | } |
---|
| 2658 | case ringorder_C: |
---|
| 2659 | case ringorder_c: |
---|
| 2660 | if (!omit_comp) |
---|
| 2661 | { |
---|
| 2662 | order[j]=r_ord; /*r->order[i]*/; |
---|
| 2663 | } |
---|
| 2664 | else |
---|
| 2665 | { |
---|
| 2666 | j--; |
---|
| 2667 | need_other_ring=TRUE; |
---|
| 2668 | omit_comp=FALSE; |
---|
| 2669 | copy_block_index=FALSE; |
---|
| 2670 | } |
---|
| 2671 | break; |
---|
| 2672 | case ringorder_wp: |
---|
| 2673 | case ringorder_dp: |
---|
| 2674 | case ringorder_ws: |
---|
| 2675 | case ringorder_ds: |
---|
| 2676 | if(!omit_degree) |
---|
| 2677 | { |
---|
| 2678 | order[j]=r_ord; /*r->order[i]*/; |
---|
| 2679 | } |
---|
| 2680 | else |
---|
| 2681 | { |
---|
| 2682 | order[j]=ringorder_rs; |
---|
| 2683 | need_other_ring=TRUE; |
---|
| 2684 | omit_degree=FALSE; |
---|
| 2685 | omitted_degree = TRUE; |
---|
| 2686 | } |
---|
| 2687 | break; |
---|
| 2688 | case ringorder_Wp: |
---|
| 2689 | case ringorder_Dp: |
---|
| 2690 | case ringorder_Ws: |
---|
| 2691 | case ringorder_Ds: |
---|
| 2692 | if(!omit_degree) |
---|
| 2693 | { |
---|
| 2694 | order[j]=r_ord; /*r->order[i];*/ |
---|
| 2695 | } |
---|
| 2696 | else |
---|
| 2697 | { |
---|
| 2698 | order[j]=ringorder_lp; |
---|
| 2699 | need_other_ring=TRUE; |
---|
| 2700 | omit_degree=FALSE; |
---|
| 2701 | omitted_degree = TRUE; |
---|
| 2702 | } |
---|
| 2703 | break; |
---|
| 2704 | case ringorder_IS: |
---|
| 2705 | { |
---|
| 2706 | if (omit_comp) |
---|
| 2707 | { |
---|
[6e66d2] | 2708 | #ifndef NDEBUG |
---|
| 2709 | Warn("Error: WRONG USAGE of rModifyRing: cannot omit component due to the ordering block [%d]: %d (ringorder_IS)", i, r_ord); |
---|
| 2710 | #endif |
---|
[a6904c] | 2711 | omit_comp = FALSE; |
---|
| 2712 | } |
---|
| 2713 | order[j]=r_ord; /*r->order[i];*/ |
---|
| 2714 | iNeedInducedOrderingSetup++; |
---|
| 2715 | break; |
---|
| 2716 | } |
---|
| 2717 | case ringorder_s: |
---|
| 2718 | { |
---|
| 2719 | assume((i == 0) && (j == 0)); |
---|
| 2720 | if (omit_comp) |
---|
| 2721 | { |
---|
| 2722 | #ifndef NDEBUG |
---|
[324710] | 2723 | Warn("WRONG USAGE? of rModifyRing: omitting component due to the ordering block [%d]: %d (ringorder_s)", i, r_ord); |
---|
[a6904c] | 2724 | #endif |
---|
| 2725 | omit_comp = FALSE; |
---|
| 2726 | } |
---|
| 2727 | order[j]=r_ord; /*r->order[i];*/ |
---|
| 2728 | break; |
---|
| 2729 | } |
---|
| 2730 | default: |
---|
| 2731 | order[j]=r_ord; /*r->order[i];*/ |
---|
| 2732 | break; |
---|
| 2733 | } |
---|
| 2734 | if (copy_block_index) |
---|
| 2735 | { |
---|
| 2736 | block0[j]=r->block0[i]; |
---|
| 2737 | block1[j]=r->block1[i]; |
---|
| 2738 | wvhdl[j]=r->wvhdl[i]; |
---|
| 2739 | } |
---|
| 2740 | |
---|
| 2741 | // order[j]=ringorder_no; // done by omAlloc0 |
---|
| 2742 | } |
---|
| 2743 | if(!need_other_ring) |
---|
| 2744 | { |
---|
| 2745 | omFreeSize(order,(nblocks+1)*sizeof(int)); |
---|
| 2746 | omFreeSize(block0,(nblocks+1)*sizeof(int)); |
---|
| 2747 | omFreeSize(block1,(nblocks+1)*sizeof(int)); |
---|
[351a5f] | 2748 | omFreeSize(wvhdl,(nblocks+1)*sizeof(int *)); |
---|
[a6904c] | 2749 | return r; |
---|
| 2750 | } |
---|
| 2751 | ring res=(ring)omAlloc0Bin(sip_sring_bin); |
---|
| 2752 | *res = *r; |
---|
| 2753 | |
---|
| 2754 | #ifdef HAVE_PLURAL |
---|
| 2755 | res->GetNC() = NULL; |
---|
| 2756 | #endif |
---|
| 2757 | |
---|
| 2758 | // res->qideal, res->idroot ??? |
---|
| 2759 | res->wvhdl=wvhdl; |
---|
| 2760 | res->order=order; |
---|
| 2761 | res->block0=block0; |
---|
| 2762 | res->block1=block1; |
---|
| 2763 | res->bitmask=exp_limit; |
---|
| 2764 | int tmpref=r->cf->ref; |
---|
| 2765 | rComplete(res, 1); |
---|
| 2766 | r->cf->ref=tmpref; |
---|
| 2767 | |
---|
| 2768 | // adjust res->pFDeg: if it was changed globally, then |
---|
| 2769 | // it must also be changed for new ring |
---|
| 2770 | if (r->pFDegOrig != res->pFDegOrig && |
---|
| 2771 | rOrd_is_WeightedDegree_Ordering(r)) |
---|
| 2772 | { |
---|
| 2773 | // still might need adjustment for weighted orderings |
---|
| 2774 | // and omit_degree |
---|
| 2775 | res->firstwv = r->firstwv; |
---|
| 2776 | res->firstBlockEnds = r->firstBlockEnds; |
---|
[19ae652] | 2777 | res->pFDeg = res->pFDegOrig = p_WFirstTotalDegree; |
---|
[a6904c] | 2778 | } |
---|
| 2779 | if (omitted_degree) |
---|
| 2780 | res->pLDeg = res->pLDegOrig = r->pLDegOrig; |
---|
| 2781 | |
---|
| 2782 | rOptimizeLDeg(res); |
---|
| 2783 | |
---|
| 2784 | // set syzcomp |
---|
| 2785 | if (res->typ != NULL) |
---|
| 2786 | { |
---|
| 2787 | if( res->typ[0].ord_typ == ro_syz) // "s" Always on [0] place! |
---|
| 2788 | { |
---|
| 2789 | res->typ[0] = r->typ[0]; // Copy struct!? + setup the same limit! |
---|
| 2790 | |
---|
| 2791 | if (r->typ[0].data.syz.limit > 0) |
---|
| 2792 | { |
---|
| 2793 | res->typ[0].data.syz.syz_index |
---|
| 2794 | = (int*) omAlloc((r->typ[0].data.syz.limit +1)*sizeof(int)); |
---|
| 2795 | memcpy(res->typ[0].data.syz.syz_index, r->typ[0].data.syz.syz_index, |
---|
| 2796 | (r->typ[0].data.syz.limit +1)*sizeof(int)); |
---|
| 2797 | } |
---|
| 2798 | } |
---|
| 2799 | |
---|
| 2800 | if( iNeedInducedOrderingSetup > 0 ) |
---|
| 2801 | { |
---|
| 2802 | for(j = 0, i = 0; (i < nblocks) && (iNeedInducedOrderingSetup > 0); i++) |
---|
| 2803 | if( res->typ[i].ord_typ == ro_is ) // Search for suffixes! |
---|
| 2804 | { |
---|
| 2805 | ideal F = idrHeadR(r->typ[i].data.is.F, r, res); // Copy F from r into res! |
---|
| 2806 | assume( |
---|
[f70f641] | 2807 | rSetISReference( res, |
---|
[a6904c] | 2808 | F, // WILL BE COPIED! |
---|
| 2809 | r->typ[i].data.is.limit, |
---|
| 2810 | j++, |
---|
[13366d] | 2811 | r->typ[i].data.is.componentWeights // WILL BE COPIED |
---|
| 2812 | ) |
---|
[a6904c] | 2813 | ); |
---|
| 2814 | id_Delete(&F, res); |
---|
| 2815 | iNeedInducedOrderingSetup--; |
---|
| 2816 | } |
---|
| 2817 | } // Process all induced Ordering blocks! ... |
---|
| 2818 | } |
---|
| 2819 | // the special case: homog (omit_degree) and 1 block rs: that is global: |
---|
| 2820 | // it comes from dp |
---|
| 2821 | res->OrdSgn=r->OrdSgn; |
---|
| 2822 | |
---|
| 2823 | |
---|
| 2824 | #ifdef HAVE_PLURAL |
---|
| 2825 | if (rIsPluralRing(r)) |
---|
| 2826 | { |
---|
| 2827 | if ( nc_rComplete(r, res, false) ) // no qideal! |
---|
| 2828 | { |
---|
| 2829 | #ifndef NDEBUG |
---|
| 2830 | WarnS("error in nc_rComplete"); |
---|
| 2831 | #endif |
---|
| 2832 | // cleanup? |
---|
| 2833 | |
---|
| 2834 | // rDelete(res); |
---|
| 2835 | // return r; |
---|
| 2836 | |
---|
| 2837 | // just go on.. |
---|
| 2838 | } |
---|
| 2839 | |
---|
| 2840 | if( rIsSCA(r) ) |
---|
| 2841 | { |
---|
| 2842 | if( !sca_Force(res, scaFirstAltVar(r), scaLastAltVar(r)) ) |
---|
| 2843 | WarnS("error in sca_Force!"); |
---|
| 2844 | } |
---|
| 2845 | } |
---|
| 2846 | #endif |
---|
| 2847 | |
---|
| 2848 | return res; |
---|
| 2849 | } |
---|
| 2850 | |
---|
| 2851 | // construct Wp,C ring |
---|
| 2852 | ring rModifyRing_Wp(ring r, int* weights) |
---|
| 2853 | { |
---|
| 2854 | ring res=(ring)omAlloc0Bin(sip_sring_bin); |
---|
| 2855 | *res = *r; |
---|
| 2856 | #ifdef HAVE_PLURAL |
---|
| 2857 | res->GetNC() = NULL; |
---|
| 2858 | #endif |
---|
| 2859 | |
---|
| 2860 | /*weights: entries for 3 blocks: NULL*/ |
---|
[351a5f] | 2861 | res->wvhdl = (int **)omAlloc0(3 * sizeof(int *)); |
---|
[a6904c] | 2862 | /*order: Wp,C,0*/ |
---|
| 2863 | res->order = (int *) omAlloc(3 * sizeof(int *)); |
---|
| 2864 | res->block0 = (int *)omAlloc0(3 * sizeof(int *)); |
---|
| 2865 | res->block1 = (int *)omAlloc0(3 * sizeof(int *)); |
---|
| 2866 | /* ringorder Wp for the first block: var 1..r->N */ |
---|
| 2867 | res->order[0] = ringorder_Wp; |
---|
| 2868 | res->block0[0] = 1; |
---|
| 2869 | res->block1[0] = r->N; |
---|
| 2870 | res->wvhdl[0] = weights; |
---|
| 2871 | /* ringorder C for the second block: no vars */ |
---|
| 2872 | res->order[1] = ringorder_C; |
---|
| 2873 | /* the last block: everything is 0 */ |
---|
| 2874 | res->order[2] = 0; |
---|
| 2875 | /*polynomial ring*/ |
---|
| 2876 | res->OrdSgn = 1; |
---|
| 2877 | |
---|
| 2878 | int tmpref=r->cf->ref; |
---|
| 2879 | rComplete(res, 1); |
---|
| 2880 | r->cf->ref=tmpref; |
---|
| 2881 | #ifdef HAVE_PLURAL |
---|
| 2882 | if (rIsPluralRing(r)) |
---|
| 2883 | { |
---|
| 2884 | if ( nc_rComplete(r, res, false) ) // no qideal! |
---|
| 2885 | { |
---|
| 2886 | #ifndef NDEBUG |
---|
| 2887 | WarnS("error in nc_rComplete"); |
---|
| 2888 | #endif |
---|
| 2889 | // cleanup? |
---|
| 2890 | |
---|
| 2891 | // rDelete(res); |
---|
| 2892 | // return r; |
---|
| 2893 | |
---|
| 2894 | // just go on.. |
---|
| 2895 | } |
---|
| 2896 | } |
---|
| 2897 | #endif |
---|
| 2898 | return res; |
---|
| 2899 | } |
---|
| 2900 | |
---|
| 2901 | // construct lp, C ring with r->N variables, r->names vars.... |
---|
| 2902 | ring rModifyRing_Simple(ring r, BOOLEAN ommit_degree, BOOLEAN ommit_comp, unsigned long exp_limit, BOOLEAN &simple) |
---|
| 2903 | { |
---|
| 2904 | simple=TRUE; |
---|
| 2905 | if (!rHasSimpleOrder(r)) |
---|
| 2906 | { |
---|
| 2907 | simple=FALSE; // sorting needed |
---|
| 2908 | assume (r != NULL ); |
---|
| 2909 | assume (exp_limit > 1); |
---|
| 2910 | int bits; |
---|
| 2911 | |
---|
| 2912 | exp_limit=rGetExpSize(exp_limit, bits, r->N); |
---|
| 2913 | |
---|
| 2914 | int nblocks=1+(ommit_comp!=0); |
---|
| 2915 | int *order=(int*)omAlloc0((nblocks+1)*sizeof(int)); |
---|
| 2916 | int *block0=(int*)omAlloc0((nblocks+1)*sizeof(int)); |
---|
| 2917 | int *block1=(int*)omAlloc0((nblocks+1)*sizeof(int)); |
---|
[351a5f] | 2918 | int **wvhdl=(int**)omAlloc0((nblocks+1)*sizeof(int *)); |
---|
[a6904c] | 2919 | |
---|
| 2920 | order[0]=ringorder_lp; |
---|
| 2921 | block0[0]=1; |
---|
| 2922 | block1[0]=r->N; |
---|
| 2923 | if (!ommit_comp) |
---|
| 2924 | { |
---|
| 2925 | order[1]=ringorder_C; |
---|
| 2926 | } |
---|
| 2927 | ring res=(ring)omAlloc0Bin(sip_sring_bin); |
---|
| 2928 | *res = *r; |
---|
| 2929 | #ifdef HAVE_PLURAL |
---|
| 2930 | res->GetNC() = NULL; |
---|
| 2931 | #endif |
---|
| 2932 | // res->qideal, res->idroot ??? |
---|
| 2933 | res->wvhdl=wvhdl; |
---|
| 2934 | res->order=order; |
---|
| 2935 | res->block0=block0; |
---|
| 2936 | res->block1=block1; |
---|
| 2937 | res->bitmask=exp_limit; |
---|
| 2938 | int tmpref=r->cf->ref; |
---|
| 2939 | rComplete(res, 1); |
---|
| 2940 | r->cf->ref=tmpref; |
---|
| 2941 | |
---|
| 2942 | #ifdef HAVE_PLURAL |
---|
| 2943 | if (rIsPluralRing(r)) |
---|
| 2944 | { |
---|
| 2945 | if ( nc_rComplete(r, res, false) ) // no qideal! |
---|
| 2946 | { |
---|
| 2947 | #ifndef NDEBUG |
---|
| 2948 | WarnS("error in nc_rComplete"); |
---|
| 2949 | #endif |
---|
| 2950 | // cleanup? |
---|
| 2951 | |
---|
| 2952 | // rDelete(res); |
---|
| 2953 | // return r; |
---|
| 2954 | |
---|
| 2955 | // just go on.. |
---|
| 2956 | } |
---|
| 2957 | } |
---|
| 2958 | #endif |
---|
| 2959 | |
---|
| 2960 | rOptimizeLDeg(res); |
---|
| 2961 | |
---|
| 2962 | return res; |
---|
| 2963 | } |
---|
| 2964 | return rModifyRing(r, ommit_degree, ommit_comp, exp_limit); |
---|
| 2965 | } |
---|
| 2966 | |
---|
| 2967 | void rKillModifiedRing_Simple(ring r) |
---|
| 2968 | { |
---|
| 2969 | rKillModifiedRing(r); |
---|
| 2970 | } |
---|
| 2971 | |
---|
| 2972 | |
---|
| 2973 | void rKillModifiedRing(ring r) |
---|
| 2974 | { |
---|
| 2975 | rUnComplete(r); |
---|
| 2976 | omFree(r->order); |
---|
| 2977 | omFree(r->block0); |
---|
| 2978 | omFree(r->block1); |
---|
| 2979 | omFree(r->wvhdl); |
---|
| 2980 | omFreeBin(r,sip_sring_bin); |
---|
| 2981 | } |
---|
| 2982 | |
---|
| 2983 | void rKillModified_Wp_Ring(ring r) |
---|
| 2984 | { |
---|
| 2985 | rUnComplete(r); |
---|
| 2986 | omFree(r->order); |
---|
| 2987 | omFree(r->block0); |
---|
| 2988 | omFree(r->block1); |
---|
| 2989 | omFree(r->wvhdl[0]); |
---|
| 2990 | omFree(r->wvhdl); |
---|
| 2991 | omFreeBin(r,sip_sring_bin); |
---|
| 2992 | } |
---|
| 2993 | |
---|
| 2994 | static void rSetOutParams(ring r) |
---|
| 2995 | { |
---|
| 2996 | r->VectorOut = (r->order[0] == ringorder_c); |
---|
| 2997 | r->ShortOut = TRUE; |
---|
| 2998 | { |
---|
| 2999 | int i; |
---|
[4c6e420] | 3000 | if (rParameter(r)!=NULL) |
---|
[a6904c] | 3001 | { |
---|
| 3002 | for (i=0;i<rPar(r);i++) |
---|
| 3003 | { |
---|
[4c6e420] | 3004 | if(strlen(rParameter(r)[i])>1) |
---|
[a6904c] | 3005 | { |
---|
| 3006 | r->ShortOut=FALSE; |
---|
| 3007 | break; |
---|
| 3008 | } |
---|
| 3009 | } |
---|
| 3010 | } |
---|
| 3011 | if (r->ShortOut) |
---|
| 3012 | { |
---|
| 3013 | // Hmm... sometimes (e.g., from maGetPreimage) new variables |
---|
[2fa2b4] | 3014 | // are introduced, but their names are never set |
---|
[a6904c] | 3015 | // hence, we do the following awkward trick |
---|
| 3016 | int N = omSizeWOfAddr(r->names); |
---|
| 3017 | if (r->N < N) N = r->N; |
---|
| 3018 | |
---|
| 3019 | for (i=(N-1);i>=0;i--) |
---|
| 3020 | { |
---|
| 3021 | if(r->names[i] != NULL && strlen(r->names[i])>1) |
---|
| 3022 | { |
---|
| 3023 | r->ShortOut=FALSE; |
---|
| 3024 | break; |
---|
| 3025 | } |
---|
| 3026 | } |
---|
| 3027 | } |
---|
| 3028 | } |
---|
| 3029 | r->CanShortOut = r->ShortOut; |
---|
| 3030 | } |
---|
| 3031 | |
---|
| 3032 | /*2 |
---|
[8047af8] | 3033 | * sets r->MixedOrder and r->ComponentOrder for orderings with more than one block |
---|
[a6904c] | 3034 | * block of variables (ip is the block number, o_r the number of the ordering) |
---|
| 3035 | * o is the position of the orderingering in r |
---|
| 3036 | */ |
---|
| 3037 | static void rHighSet(ring r, int o_r, int o) |
---|
| 3038 | { |
---|
| 3039 | switch(o_r) |
---|
| 3040 | { |
---|
| 3041 | case ringorder_lp: |
---|
| 3042 | case ringorder_dp: |
---|
| 3043 | case ringorder_Dp: |
---|
| 3044 | case ringorder_wp: |
---|
| 3045 | case ringorder_Wp: |
---|
| 3046 | case ringorder_rp: |
---|
| 3047 | case ringorder_a: |
---|
| 3048 | case ringorder_aa: |
---|
| 3049 | case ringorder_a64: |
---|
| 3050 | if (r->OrdSgn==-1) r->MixedOrder=TRUE; |
---|
| 3051 | break; |
---|
| 3052 | case ringorder_ls: |
---|
| 3053 | case ringorder_rs: |
---|
| 3054 | case ringorder_ds: |
---|
| 3055 | case ringorder_Ds: |
---|
| 3056 | case ringorder_s: |
---|
| 3057 | break; |
---|
| 3058 | case ringorder_ws: |
---|
| 3059 | case ringorder_Ws: |
---|
| 3060 | if (r->wvhdl[o]!=NULL) |
---|
| 3061 | { |
---|
| 3062 | int i; |
---|
| 3063 | for(i=r->block1[o]-r->block0[o];i>=0;i--) |
---|
| 3064 | if (r->wvhdl[o][i]<0) { r->MixedOrder=TRUE; break; } |
---|
| 3065 | } |
---|
| 3066 | break; |
---|
| 3067 | case ringorder_c: |
---|
| 3068 | r->ComponentOrder=1; |
---|
| 3069 | break; |
---|
| 3070 | case ringorder_C: |
---|
| 3071 | case ringorder_S: |
---|
| 3072 | r->ComponentOrder=-1; |
---|
| 3073 | break; |
---|
| 3074 | case ringorder_M: |
---|
[8047af8] | 3075 | r->LexOrder=TRUE; |
---|
[a6904c] | 3076 | break; |
---|
| 3077 | case ringorder_IS: |
---|
| 3078 | { // TODO: What is r->ComponentOrder??? |
---|
| 3079 | r->MixedOrder=TRUE; |
---|
| 3080 | /* |
---|
| 3081 | if( r->block0[o] != 0 ) // Suffix has the comonent |
---|
| 3082 | r->ComponentOrder = r->block0[o]; |
---|
| 3083 | else // Prefix has level... |
---|
| 3084 | r->ComponentOrder=-1; |
---|
| 3085 | */ |
---|
| 3086 | break; |
---|
| 3087 | } |
---|
| 3088 | |
---|
| 3089 | default: |
---|
| 3090 | dReportError("wrong internal ordering:%d at %s, l:%d\n",o_r,__FILE__,__LINE__); |
---|
| 3091 | } |
---|
| 3092 | } |
---|
| 3093 | |
---|
| 3094 | static void rSetFirstWv(ring r, int i, int* order, int* block1, int** wvhdl) |
---|
| 3095 | { |
---|
| 3096 | // cheat for ringorder_aa |
---|
| 3097 | if (order[i] == ringorder_aa) |
---|
| 3098 | i++; |
---|
| 3099 | if(block1[i]!=r->N) r->LexOrder=TRUE; |
---|
| 3100 | r->firstBlockEnds=block1[i]; |
---|
| 3101 | r->firstwv = wvhdl[i]; |
---|
| 3102 | if ((order[i]== ringorder_ws) |
---|
| 3103 | || (order[i]==ringorder_Ws) |
---|
| 3104 | || (order[i]== ringorder_wp) |
---|
| 3105 | || (order[i]==ringorder_Wp) |
---|
| 3106 | || (order[i]== ringorder_a) |
---|
| 3107 | /*|| (order[i]==ringorder_A)*/) |
---|
| 3108 | { |
---|
| 3109 | int j; |
---|
| 3110 | for(j=block1[i]-r->block0[i];j>=0;j--) |
---|
| 3111 | { |
---|
| 3112 | if (r->firstwv[j]<0) r->MixedOrder=TRUE; |
---|
| 3113 | if (r->firstwv[j]==0) r->LexOrder=TRUE; |
---|
| 3114 | } |
---|
| 3115 | } |
---|
| 3116 | else if (order[i]==ringorder_a64) |
---|
| 3117 | { |
---|
| 3118 | int j; |
---|
| 3119 | int64 *w=rGetWeightVec(r); |
---|
| 3120 | for(j=block1[i]-r->block0[i];j>=0;j--) |
---|
| 3121 | { |
---|
| 3122 | if (w[j]==0) r->LexOrder=TRUE; |
---|
| 3123 | } |
---|
| 3124 | } |
---|
| 3125 | } |
---|
| 3126 | |
---|
| 3127 | static void rOptimizeLDeg(ring r) |
---|
| 3128 | { |
---|
[c6a3eb2] | 3129 | if (r->pFDeg == p_Deg) |
---|
[a6904c] | 3130 | { |
---|
| 3131 | if (r->pLDeg == pLDeg1) |
---|
| 3132 | r->pLDeg = pLDeg1_Deg; |
---|
| 3133 | if (r->pLDeg == pLDeg1c) |
---|
| 3134 | r->pLDeg = pLDeg1c_Deg; |
---|
| 3135 | } |
---|
[99bdcf] | 3136 | else if (r->pFDeg == p_Totaldegree) |
---|
[a6904c] | 3137 | { |
---|
| 3138 | if (r->pLDeg == pLDeg1) |
---|
| 3139 | r->pLDeg = pLDeg1_Totaldegree; |
---|
| 3140 | if (r->pLDeg == pLDeg1c) |
---|
| 3141 | r->pLDeg = pLDeg1c_Totaldegree; |
---|
| 3142 | } |
---|
[19ae652] | 3143 | else if (r->pFDeg == p_WFirstTotalDegree) |
---|
[a6904c] | 3144 | { |
---|
| 3145 | if (r->pLDeg == pLDeg1) |
---|
| 3146 | r->pLDeg = pLDeg1_WFirstTotalDegree; |
---|
| 3147 | if (r->pLDeg == pLDeg1c) |
---|
| 3148 | r->pLDeg = pLDeg1c_WFirstTotalDegree; |
---|
| 3149 | } |
---|
| 3150 | } |
---|
| 3151 | |
---|
| 3152 | // set pFDeg, pLDeg, MixOrder, ComponentOrder, etc |
---|
| 3153 | static void rSetDegStuff(ring r) |
---|
| 3154 | { |
---|
| 3155 | int* order = r->order; |
---|
| 3156 | int* block0 = r->block0; |
---|
| 3157 | int* block1 = r->block1; |
---|
| 3158 | int** wvhdl = r->wvhdl; |
---|
| 3159 | |
---|
| 3160 | if (order[0]==ringorder_S ||order[0]==ringorder_s || order[0]==ringorder_IS) |
---|
| 3161 | { |
---|
| 3162 | order++; |
---|
| 3163 | block0++; |
---|
| 3164 | block1++; |
---|
| 3165 | wvhdl++; |
---|
| 3166 | } |
---|
| 3167 | r->LexOrder = FALSE; |
---|
| 3168 | r->MixedOrder = FALSE; |
---|
| 3169 | r->ComponentOrder = 1; |
---|
[99bdcf] | 3170 | r->pFDeg = p_Totaldegree; |
---|
[a6904c] | 3171 | r->pLDeg = (r->OrdSgn == 1 ? pLDegb : pLDeg0); |
---|
| 3172 | |
---|
| 3173 | /*======== ordering type is (_,c) =========================*/ |
---|
| 3174 | if ((order[0]==ringorder_unspec) || (order[1] == 0) |
---|
| 3175 | ||( |
---|
| 3176 | ((order[1]==ringorder_c)||(order[1]==ringorder_C) |
---|
[f70f641] | 3177 | ||(order[1]==ringorder_S) |
---|
[a6904c] | 3178 | ||(order[1]==ringorder_s)) |
---|
| 3179 | && (order[0]!=ringorder_M) |
---|
| 3180 | && (order[2]==0)) |
---|
| 3181 | ) |
---|
| 3182 | { |
---|
| 3183 | if ((order[0]!=ringorder_unspec) |
---|
[273fed] | 3184 | && ((order[1]==ringorder_C)||(order[1]==ringorder_S)|| |
---|
[a6904c] | 3185 | (order[1]==ringorder_s))) |
---|
| 3186 | r->ComponentOrder=-1; |
---|
| 3187 | if (r->OrdSgn == -1) r->pLDeg = pLDeg0c; |
---|
| 3188 | if ((order[0] == ringorder_lp) |
---|
| 3189 | || (order[0] == ringorder_ls) |
---|
| 3190 | || (order[0] == ringorder_rp) |
---|
| 3191 | || (order[0] == ringorder_rs)) |
---|
| 3192 | { |
---|
| 3193 | r->LexOrder=TRUE; |
---|
| 3194 | r->pLDeg = pLDeg1c; |
---|
[99bdcf] | 3195 | r->pFDeg = p_Totaldegree; |
---|
[a6904c] | 3196 | } |
---|
| 3197 | if ((order[0] == ringorder_a) |
---|
| 3198 | || (order[0] == ringorder_wp) |
---|
| 3199 | || (order[0] == ringorder_Wp) |
---|
| 3200 | || (order[0] == ringorder_ws) |
---|
| 3201 | || (order[0] == ringorder_Ws)) |
---|
[19ae652] | 3202 | r->pFDeg = p_WFirstTotalDegree; |
---|
[a6904c] | 3203 | r->firstBlockEnds=block1[0]; |
---|
| 3204 | r->firstwv = wvhdl[0]; |
---|
| 3205 | } |
---|
| 3206 | /*======== ordering type is (c,_) =========================*/ |
---|
| 3207 | else if (((order[0]==ringorder_c) |
---|
| 3208 | ||(order[0]==ringorder_C) |
---|
[273fed] | 3209 | ||(order[0]==ringorder_S) |
---|
[a6904c] | 3210 | ||(order[0]==ringorder_s)) |
---|
| 3211 | && (order[1]!=ringorder_M) |
---|
| 3212 | && (order[2]==0)) |
---|
| 3213 | { |
---|
[273fed] | 3214 | if ((order[0]==ringorder_C)||(order[0]==ringorder_S)|| |
---|
[a6904c] | 3215 | order[0]==ringorder_s) |
---|
| 3216 | r->ComponentOrder=-1; |
---|
| 3217 | if ((order[1] == ringorder_lp) |
---|
| 3218 | || (order[1] == ringorder_ls) |
---|
| 3219 | || (order[1] == ringorder_rp) |
---|
| 3220 | || order[1] == ringorder_rs) |
---|
| 3221 | { |
---|
| 3222 | r->LexOrder=TRUE; |
---|
| 3223 | r->pLDeg = pLDeg1c; |
---|
[99bdcf] | 3224 | r->pFDeg = p_Totaldegree; |
---|
[a6904c] | 3225 | } |
---|
| 3226 | r->firstBlockEnds=block1[1]; |
---|
[f2de2e] | 3227 | if (wvhdl!=NULL) r->firstwv = wvhdl[1]; |
---|
[a6904c] | 3228 | if ((order[1] == ringorder_a) |
---|
| 3229 | || (order[1] == ringorder_wp) |
---|
| 3230 | || (order[1] == ringorder_Wp) |
---|
| 3231 | || (order[1] == ringorder_ws) |
---|
| 3232 | || (order[1] == ringorder_Ws)) |
---|
[19ae652] | 3233 | r->pFDeg = p_WFirstTotalDegree; |
---|
[a6904c] | 3234 | } |
---|
| 3235 | /*------- more than one block ----------------------*/ |
---|
| 3236 | else |
---|
| 3237 | { |
---|
[273fed] | 3238 | if ((r->VectorOut)||(order[0]==ringorder_C)||(order[0]==ringorder_S)||(order[0]==ringorder_s)) |
---|
[a6904c] | 3239 | { |
---|
| 3240 | rSetFirstWv(r, 1, order, block1, wvhdl); |
---|
| 3241 | } |
---|
| 3242 | else |
---|
| 3243 | rSetFirstWv(r, 0, order, block1, wvhdl); |
---|
| 3244 | |
---|
| 3245 | /*the number of orderings:*/ |
---|
| 3246 | int i = 0; |
---|
| 3247 | while (order[++i] != 0); |
---|
| 3248 | do |
---|
| 3249 | { |
---|
| 3250 | i--; |
---|
| 3251 | rHighSet(r, order[i],i); |
---|
| 3252 | } |
---|
| 3253 | while (i != 0); |
---|
| 3254 | |
---|
| 3255 | if ((order[0]!=ringorder_c) |
---|
| 3256 | && (order[0]!=ringorder_C) |
---|
[273fed] | 3257 | && (order[0]!=ringorder_S) |
---|
[a6904c] | 3258 | && (order[0]!=ringorder_s)) |
---|
| 3259 | { |
---|
| 3260 | r->pLDeg = pLDeg1c; |
---|
| 3261 | } |
---|
| 3262 | else |
---|
| 3263 | { |
---|
| 3264 | r->pLDeg = pLDeg1; |
---|
| 3265 | } |
---|
[8e45403] | 3266 | r->pFDeg = p_WTotaldegree; // may be improved: p_Totaldegree for lp/dp/ls/.. blocks |
---|
[a6904c] | 3267 | } |
---|
[f70f641] | 3268 | |
---|
[a6904c] | 3269 | if (rOrd_is_Totaldegree_Ordering(r) || rOrd_is_WeightedDegree_Ordering(r)) |
---|
[c6a3eb2] | 3270 | r->pFDeg = p_Deg; |
---|
[a6904c] | 3271 | |
---|
| 3272 | r->pFDegOrig = r->pFDeg; |
---|
| 3273 | r->pLDegOrig = r->pLDeg; |
---|
| 3274 | rOptimizeLDeg(r); |
---|
| 3275 | } |
---|
| 3276 | |
---|
| 3277 | /*2 |
---|
| 3278 | * set NegWeightL_Size, NegWeightL_Offset |
---|
| 3279 | */ |
---|
| 3280 | static void rSetNegWeight(ring r) |
---|
| 3281 | { |
---|
| 3282 | int i,l; |
---|
| 3283 | if (r->typ!=NULL) |
---|
| 3284 | { |
---|
| 3285 | l=0; |
---|
| 3286 | for(i=0;i<r->OrdSize;i++) |
---|
| 3287 | { |
---|
| 3288 | if(r->typ[i].ord_typ==ro_wp_neg) l++; |
---|
| 3289 | } |
---|
| 3290 | if (l>0) |
---|
| 3291 | { |
---|
| 3292 | r->NegWeightL_Size=l; |
---|
| 3293 | r->NegWeightL_Offset=(int *) omAlloc(l*sizeof(int)); |
---|
| 3294 | l=0; |
---|
| 3295 | for(i=0;i<r->OrdSize;i++) |
---|
| 3296 | { |
---|
| 3297 | if(r->typ[i].ord_typ==ro_wp_neg) |
---|
| 3298 | { |
---|
| 3299 | r->NegWeightL_Offset[l]=r->typ[i].data.wp.place; |
---|
| 3300 | l++; |
---|
| 3301 | } |
---|
| 3302 | } |
---|
| 3303 | return; |
---|
| 3304 | } |
---|
| 3305 | } |
---|
| 3306 | r->NegWeightL_Size = 0; |
---|
| 3307 | r->NegWeightL_Offset = NULL; |
---|
| 3308 | } |
---|
| 3309 | |
---|
| 3310 | static void rSetOption(ring r) |
---|
| 3311 | { |
---|
| 3312 | // set redthrough |
---|
| 3313 | if (!TEST_OPT_OLDSTD && r->OrdSgn == 1 && ! r->LexOrder) |
---|
| 3314 | r->options |= Sy_bit(OPT_REDTHROUGH); |
---|
| 3315 | else |
---|
| 3316 | r->options &= ~Sy_bit(OPT_REDTHROUGH); |
---|
| 3317 | |
---|
| 3318 | // set intStrategy |
---|
| 3319 | #ifdef HAVE_RINGS |
---|
[17e473] | 3320 | if ( |
---|
| 3321 | rField_is_Extension(r) |
---|
| 3322 | || rField_is_Q(r) |
---|
| 3323 | || rField_is_Ring(r)) |
---|
[a6904c] | 3324 | #else |
---|
| 3325 | if (rField_is_Extension(r) || rField_is_Q(r)) |
---|
| 3326 | #endif |
---|
| 3327 | r->options |= Sy_bit(OPT_INTSTRATEGY); |
---|
| 3328 | else |
---|
| 3329 | r->options &= ~Sy_bit(OPT_INTSTRATEGY); |
---|
| 3330 | |
---|
| 3331 | // set redTail |
---|
| 3332 | if (r->LexOrder || r->OrdSgn == -1 || rField_is_Extension(r)) |
---|
| 3333 | r->options &= ~Sy_bit(OPT_REDTAIL); |
---|
| 3334 | else |
---|
| 3335 | r->options |= Sy_bit(OPT_REDTAIL); |
---|
| 3336 | } |
---|
| 3337 | |
---|
[8261b2] | 3338 | static void rCheckOrdSgn(ring r,int i/*current block*/); |
---|
| 3339 | |
---|
[a6904c] | 3340 | BOOLEAN rComplete(ring r, int force) |
---|
| 3341 | { |
---|
| 3342 | if (r->VarOffset!=NULL && force == 0) return FALSE; |
---|
| 3343 | rSetOutParams(r); |
---|
| 3344 | int n=rBlocks(r)-1; |
---|
| 3345 | int i; |
---|
| 3346 | int bits; |
---|
| 3347 | r->bitmask=rGetExpSize(r->bitmask,bits,r->N); |
---|
| 3348 | r->BitsPerExp = bits; |
---|
| 3349 | r->ExpPerLong = BIT_SIZEOF_LONG / bits; |
---|
| 3350 | r->divmask=rGetDivMask(bits); |
---|
| 3351 | |
---|
| 3352 | // will be used for ordsgn: |
---|
| 3353 | long *tmp_ordsgn=(long *)omAlloc0(3*(n+r->N)*sizeof(long)); |
---|
| 3354 | // will be used for VarOffset: |
---|
| 3355 | int *v=(int *)omAlloc((r->N+1)*sizeof(int)); |
---|
| 3356 | for(i=r->N; i>=0 ; i--) |
---|
| 3357 | { |
---|
| 3358 | v[i]=-1; |
---|
| 3359 | } |
---|
| 3360 | sro_ord *tmp_typ=(sro_ord *)omAlloc0(3*(n+r->N)*sizeof(sro_ord)); |
---|
| 3361 | int typ_i=0; |
---|
| 3362 | int prev_ordsgn=0; |
---|
| 3363 | |
---|
| 3364 | // fill in v, tmp_typ, tmp_ordsgn, determine typ_i (== ordSize) |
---|
| 3365 | int j=0; |
---|
| 3366 | int j_bits=BITS_PER_LONG; |
---|
| 3367 | |
---|
| 3368 | BOOLEAN need_to_add_comp=FALSE; // Only for ringorder_s and ringorder_S! |
---|
| 3369 | |
---|
| 3370 | for(i=0;i<n;i++) |
---|
| 3371 | { |
---|
| 3372 | tmp_typ[typ_i].order_index=i; |
---|
| 3373 | switch (r->order[i]) |
---|
| 3374 | { |
---|
| 3375 | case ringorder_a: |
---|
| 3376 | case ringorder_aa: |
---|
| 3377 | rO_WDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn,tmp_typ[typ_i], |
---|
| 3378 | r->wvhdl[i]); |
---|
| 3379 | typ_i++; |
---|
| 3380 | break; |
---|
| 3381 | |
---|
| 3382 | case ringorder_a64: |
---|
| 3383 | rO_WDegree64(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3384 | tmp_typ[typ_i], (int64 *)(r->wvhdl[i])); |
---|
| 3385 | typ_i++; |
---|
| 3386 | break; |
---|
| 3387 | |
---|
| 3388 | case ringorder_c: |
---|
| 3389 | rO_Align(j, j_bits); |
---|
| 3390 | rO_LexVars_neg(j, j_bits, 0,0, prev_ordsgn,tmp_ordsgn,v,BITS_PER_LONG, -1); |
---|
| 3391 | break; |
---|
| 3392 | |
---|
| 3393 | case ringorder_C: |
---|
| 3394 | rO_Align(j, j_bits); |
---|
| 3395 | rO_LexVars(j, j_bits, 0,0, prev_ordsgn,tmp_ordsgn,v,BITS_PER_LONG, -1); |
---|
| 3396 | break; |
---|
| 3397 | |
---|
| 3398 | case ringorder_M: |
---|
| 3399 | { |
---|
| 3400 | int k,l; |
---|
| 3401 | k=r->block1[i]-r->block0[i]+1; // number of vars |
---|
| 3402 | for(l=0;l<k;l++) |
---|
| 3403 | { |
---|
| 3404 | rO_WDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3405 | tmp_typ[typ_i], |
---|
| 3406 | r->wvhdl[i]+(r->block1[i]-r->block0[i]+1)*l); |
---|
| 3407 | typ_i++; |
---|
| 3408 | } |
---|
| 3409 | break; |
---|
| 3410 | } |
---|
| 3411 | |
---|
| 3412 | case ringorder_lp: |
---|
| 3413 | rO_LexVars(j, j_bits, r->block0[i],r->block1[i], prev_ordsgn, |
---|
| 3414 | tmp_ordsgn,v,bits, -1); |
---|
| 3415 | break; |
---|
| 3416 | |
---|
| 3417 | case ringorder_ls: |
---|
| 3418 | rO_LexVars_neg(j, j_bits, r->block0[i],r->block1[i], prev_ordsgn, |
---|
| 3419 | tmp_ordsgn,v, bits, -1); |
---|
[8261b2] | 3420 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3421 | break; |
---|
| 3422 | |
---|
| 3423 | case ringorder_rs: |
---|
| 3424 | rO_LexVars_neg(j, j_bits, r->block1[i],r->block0[i], prev_ordsgn, |
---|
| 3425 | tmp_ordsgn,v, bits, -1); |
---|
[8261b2] | 3426 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3427 | break; |
---|
| 3428 | |
---|
| 3429 | case ringorder_rp: |
---|
| 3430 | rO_LexVars(j, j_bits, r->block1[i],r->block0[i], prev_ordsgn, |
---|
| 3431 | tmp_ordsgn,v, bits, -1); |
---|
| 3432 | break; |
---|
| 3433 | |
---|
| 3434 | case ringorder_dp: |
---|
| 3435 | if (r->block0[i]==r->block1[i]) |
---|
| 3436 | { |
---|
| 3437 | rO_LexVars(j, j_bits, r->block0[i],r->block0[i], prev_ordsgn, |
---|
| 3438 | tmp_ordsgn,v, bits, -1); |
---|
| 3439 | } |
---|
| 3440 | else |
---|
| 3441 | { |
---|
| 3442 | rO_TDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3443 | tmp_typ[typ_i]); |
---|
| 3444 | typ_i++; |
---|
| 3445 | rO_LexVars_neg(j, j_bits, r->block1[i],r->block0[i]+1, |
---|
| 3446 | prev_ordsgn,tmp_ordsgn,v,bits, r->block0[i]); |
---|
| 3447 | } |
---|
| 3448 | break; |
---|
| 3449 | |
---|
| 3450 | case ringorder_Dp: |
---|
| 3451 | if (r->block0[i]==r->block1[i]) |
---|
| 3452 | { |
---|
| 3453 | rO_LexVars(j, j_bits, r->block0[i],r->block0[i], prev_ordsgn, |
---|
| 3454 | tmp_ordsgn,v, bits, -1); |
---|
| 3455 | } |
---|
| 3456 | else |
---|
| 3457 | { |
---|
| 3458 | rO_TDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3459 | tmp_typ[typ_i]); |
---|
| 3460 | typ_i++; |
---|
| 3461 | rO_LexVars(j, j_bits, r->block0[i],r->block1[i]-1, prev_ordsgn, |
---|
| 3462 | tmp_ordsgn,v, bits, r->block1[i]); |
---|
| 3463 | } |
---|
| 3464 | break; |
---|
| 3465 | |
---|
| 3466 | case ringorder_ds: |
---|
| 3467 | if (r->block0[i]==r->block1[i]) |
---|
| 3468 | { |
---|
| 3469 | rO_LexVars_neg(j, j_bits,r->block0[i],r->block1[i],prev_ordsgn, |
---|
| 3470 | tmp_ordsgn,v,bits, -1); |
---|
| 3471 | } |
---|
| 3472 | else |
---|
| 3473 | { |
---|
| 3474 | rO_TDegree_neg(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3475 | tmp_typ[typ_i]); |
---|
| 3476 | typ_i++; |
---|
| 3477 | rO_LexVars_neg(j, j_bits, r->block1[i],r->block0[i]+1, |
---|
| 3478 | prev_ordsgn,tmp_ordsgn,v,bits, r->block0[i]); |
---|
| 3479 | } |
---|
[8261b2] | 3480 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3481 | break; |
---|
| 3482 | |
---|
| 3483 | case ringorder_Ds: |
---|
| 3484 | if (r->block0[i]==r->block1[i]) |
---|
| 3485 | { |
---|
| 3486 | rO_LexVars_neg(j, j_bits, r->block0[i],r->block0[i],prev_ordsgn, |
---|
| 3487 | tmp_ordsgn,v, bits, -1); |
---|
| 3488 | } |
---|
| 3489 | else |
---|
| 3490 | { |
---|
| 3491 | rO_TDegree_neg(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3492 | tmp_typ[typ_i]); |
---|
| 3493 | typ_i++; |
---|
| 3494 | rO_LexVars(j, j_bits, r->block0[i],r->block1[i]-1, prev_ordsgn, |
---|
| 3495 | tmp_ordsgn,v, bits, r->block1[i]); |
---|
| 3496 | } |
---|
[8261b2] | 3497 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3498 | break; |
---|
| 3499 | |
---|
| 3500 | case ringorder_wp: |
---|
| 3501 | rO_WDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3502 | tmp_typ[typ_i], r->wvhdl[i]); |
---|
| 3503 | typ_i++; |
---|
| 3504 | { // check for weights <=0 |
---|
| 3505 | int jj; |
---|
| 3506 | BOOLEAN have_bad_weights=FALSE; |
---|
| 3507 | for(jj=r->block1[i]-r->block0[i];jj>=0; jj--) |
---|
| 3508 | { |
---|
| 3509 | if (r->wvhdl[i][jj]<=0) have_bad_weights=TRUE; |
---|
| 3510 | } |
---|
| 3511 | if (have_bad_weights) |
---|
| 3512 | { |
---|
| 3513 | rO_TDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3514 | tmp_typ[typ_i]); |
---|
| 3515 | typ_i++; |
---|
[84893c] | 3516 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3517 | } |
---|
| 3518 | } |
---|
| 3519 | if (r->block1[i]!=r->block0[i]) |
---|
| 3520 | { |
---|
| 3521 | rO_LexVars_neg(j, j_bits,r->block1[i],r->block0[i]+1, prev_ordsgn, |
---|
| 3522 | tmp_ordsgn, v,bits, r->block0[i]); |
---|
| 3523 | } |
---|
| 3524 | break; |
---|
| 3525 | |
---|
| 3526 | case ringorder_Wp: |
---|
| 3527 | rO_WDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3528 | tmp_typ[typ_i], r->wvhdl[i]); |
---|
| 3529 | typ_i++; |
---|
| 3530 | { // check for weights <=0 |
---|
[8261b2] | 3531 | int jj; |
---|
[a6904c] | 3532 | BOOLEAN have_bad_weights=FALSE; |
---|
[8261b2] | 3533 | for(jj=r->block1[i]-r->block0[i];jj>=0; jj--) |
---|
[a6904c] | 3534 | { |
---|
[8261b2] | 3535 | if (r->wvhdl[i][jj]<=0) have_bad_weights=TRUE; |
---|
[a6904c] | 3536 | } |
---|
| 3537 | if (have_bad_weights) |
---|
| 3538 | { |
---|
| 3539 | rO_TDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3540 | tmp_typ[typ_i]); |
---|
| 3541 | typ_i++; |
---|
[84893c] | 3542 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3543 | } |
---|
| 3544 | } |
---|
| 3545 | if (r->block1[i]!=r->block0[i]) |
---|
| 3546 | { |
---|
| 3547 | rO_LexVars(j, j_bits,r->block0[i],r->block1[i]-1, prev_ordsgn, |
---|
| 3548 | tmp_ordsgn,v, bits, r->block1[i]); |
---|
| 3549 | } |
---|
| 3550 | break; |
---|
| 3551 | |
---|
| 3552 | case ringorder_ws: |
---|
| 3553 | rO_WDegree_neg(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3554 | tmp_typ[typ_i], r->wvhdl[i]); |
---|
| 3555 | typ_i++; |
---|
| 3556 | if (r->block1[i]!=r->block0[i]) |
---|
| 3557 | { |
---|
| 3558 | rO_LexVars_neg(j, j_bits,r->block1[i],r->block0[i]+1, prev_ordsgn, |
---|
| 3559 | tmp_ordsgn, v,bits, r->block0[i]); |
---|
| 3560 | } |
---|
[84893c] | 3561 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3562 | break; |
---|
| 3563 | |
---|
| 3564 | case ringorder_Ws: |
---|
| 3565 | rO_WDegree_neg(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3566 | tmp_typ[typ_i], r->wvhdl[i]); |
---|
| 3567 | typ_i++; |
---|
| 3568 | if (r->block1[i]!=r->block0[i]) |
---|
| 3569 | { |
---|
| 3570 | rO_LexVars(j, j_bits,r->block0[i],r->block1[i]-1, prev_ordsgn, |
---|
| 3571 | tmp_ordsgn,v, bits, r->block1[i]); |
---|
| 3572 | } |
---|
[84893c] | 3573 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3574 | break; |
---|
| 3575 | |
---|
| 3576 | case ringorder_S: |
---|
[1ed346] | 3577 | assume(typ_i == 1); // For LaScala3 only: on the 2nd place ([1])! |
---|
| 3578 | // TODO: for K[x]: it is 0...?! |
---|
[a6904c] | 3579 | rO_Syzcomp(j, j_bits,prev_ordsgn, tmp_ordsgn,tmp_typ[typ_i]); |
---|
| 3580 | need_to_add_comp=TRUE; |
---|
| 3581 | typ_i++; |
---|
| 3582 | break; |
---|
| 3583 | |
---|
| 3584 | case ringorder_s: |
---|
| 3585 | assume(typ_i == 0 && j == 0); |
---|
[1ed346] | 3586 | rO_Syz(j, j_bits, prev_ordsgn, tmp_ordsgn, tmp_typ[typ_i]); // set syz-limit? |
---|
[a6904c] | 3587 | need_to_add_comp=TRUE; |
---|
| 3588 | typ_i++; |
---|
| 3589 | break; |
---|
| 3590 | |
---|
| 3591 | case ringorder_IS: |
---|
| 3592 | { |
---|
| 3593 | |
---|
| 3594 | assume( r->block0[i] == r->block1[i] ); |
---|
[273fed] | 3595 | const int s = r->block0[i]; |
---|
| 3596 | assume( -2 < s && s < 2); |
---|
[a6904c] | 3597 | |
---|
| 3598 | if(s == 0) // Prefix IS |
---|
| 3599 | rO_ISPrefix(j, j_bits, prev_ordsgn, tmp_ordsgn, r->N, v, tmp_typ[typ_i++]); // What about prev_ordsgn? |
---|
| 3600 | else // s = +1 or -1 // Note: typ_i might be incrimented here inside! |
---|
| 3601 | { |
---|
| 3602 | rO_ISSuffix(j, j_bits, prev_ordsgn, tmp_ordsgn, r->N, v, tmp_typ, typ_i, s); // Suffix. |
---|
| 3603 | need_to_add_comp=FALSE; |
---|
| 3604 | } |
---|
| 3605 | |
---|
| 3606 | break; |
---|
| 3607 | } |
---|
| 3608 | case ringorder_unspec: |
---|
| 3609 | case ringorder_no: |
---|
| 3610 | default: |
---|
| 3611 | dReportError("undef. ringorder used\n"); |
---|
| 3612 | break; |
---|
| 3613 | } |
---|
| 3614 | } |
---|
| 3615 | |
---|
| 3616 | int j0=j; // save j |
---|
| 3617 | int j_bits0=j_bits; // save jbits |
---|
| 3618 | rO_Align(j,j_bits); |
---|
| 3619 | r->CmpL_Size = j; |
---|
| 3620 | |
---|
| 3621 | j_bits=j_bits0; j=j0; |
---|
| 3622 | |
---|
| 3623 | // fill in some empty slots with variables not already covered |
---|
| 3624 | // v0 is special, is therefore normally already covered |
---|
| 3625 | // now we do have rings without comp... |
---|
| 3626 | if((need_to_add_comp) && (v[0]== -1)) |
---|
| 3627 | { |
---|
| 3628 | if (prev_ordsgn==1) |
---|
| 3629 | { |
---|
| 3630 | rO_Align(j, j_bits); |
---|
| 3631 | rO_LexVars(j, j_bits, 0,0, prev_ordsgn,tmp_ordsgn,v,BITS_PER_LONG, -1); |
---|
| 3632 | } |
---|
| 3633 | else |
---|
| 3634 | { |
---|
| 3635 | rO_Align(j, j_bits); |
---|
| 3636 | rO_LexVars_neg(j, j_bits, 0,0, prev_ordsgn,tmp_ordsgn,v,BITS_PER_LONG, -1); |
---|
| 3637 | } |
---|
| 3638 | } |
---|
| 3639 | // the variables |
---|
| 3640 | for(i=1 ; i<=r->N ; i++) |
---|
| 3641 | { |
---|
| 3642 | if(v[i]==(-1)) |
---|
| 3643 | { |
---|
| 3644 | if (prev_ordsgn==1) |
---|
| 3645 | { |
---|
| 3646 | rO_LexVars(j, j_bits, i,i, prev_ordsgn,tmp_ordsgn,v,bits, -1); |
---|
| 3647 | } |
---|
| 3648 | else |
---|
| 3649 | { |
---|
| 3650 | rO_LexVars_neg(j,j_bits,i,i, prev_ordsgn,tmp_ordsgn,v,bits, -1); |
---|
| 3651 | } |
---|
| 3652 | } |
---|
| 3653 | } |
---|
| 3654 | |
---|
| 3655 | rO_Align(j,j_bits); |
---|
| 3656 | // ---------------------------- |
---|
| 3657 | // finished with constructing the monomial, computing sizes: |
---|
| 3658 | |
---|
| 3659 | r->ExpL_Size=j; |
---|
| 3660 | r->PolyBin = omGetSpecBin(POLYSIZE + (r->ExpL_Size)*sizeof(long)); |
---|
| 3661 | assume(r->PolyBin != NULL); |
---|
| 3662 | |
---|
| 3663 | // ---------------------------- |
---|
| 3664 | // indices and ordsgn vector for comparison |
---|
| 3665 | // |
---|
| 3666 | // r->pCompHighIndex already set |
---|
| 3667 | r->ordsgn=(long *)omAlloc0(r->ExpL_Size*sizeof(long)); |
---|
| 3668 | |
---|
| 3669 | for(j=0;j<r->CmpL_Size;j++) |
---|
| 3670 | { |
---|
| 3671 | r->ordsgn[j] = tmp_ordsgn[j]; |
---|
| 3672 | } |
---|
| 3673 | |
---|
| 3674 | omFreeSize((ADDRESS)tmp_ordsgn,(3*(n+r->N)*sizeof(long))); |
---|
| 3675 | |
---|
| 3676 | // ---------------------------- |
---|
| 3677 | // description of orderings for setm: |
---|
| 3678 | // |
---|
| 3679 | r->OrdSize=typ_i; |
---|
| 3680 | if (typ_i==0) r->typ=NULL; |
---|
| 3681 | else |
---|
| 3682 | { |
---|
| 3683 | r->typ=(sro_ord*)omAlloc(typ_i*sizeof(sro_ord)); |
---|
| 3684 | memcpy(r->typ,tmp_typ,typ_i*sizeof(sro_ord)); |
---|
| 3685 | } |
---|
| 3686 | omFreeSize((ADDRESS)tmp_typ,(3*(n+r->N)*sizeof(sro_ord))); |
---|
| 3687 | |
---|
| 3688 | // ---------------------------- |
---|
| 3689 | // indices for (first copy of ) variable entries in exp.e vector (VarOffset): |
---|
| 3690 | r->VarOffset=v; |
---|
| 3691 | |
---|
| 3692 | // ---------------------------- |
---|
| 3693 | // other indicies |
---|
| 3694 | r->pCompIndex=(r->VarOffset[0] & 0xffff); //r->VarOffset[0]; |
---|
| 3695 | i=0; // position |
---|
| 3696 | j=0; // index in r->typ |
---|
| 3697 | if (i==r->pCompIndex) i++; // IS??? |
---|
| 3698 | while ((j < r->OrdSize) |
---|
| 3699 | && ((r->typ[j].ord_typ==ro_syzcomp) || |
---|
| 3700 | (r->typ[j].ord_typ==ro_syz) || (r->typ[j].ord_typ==ro_isTemp) || (r->typ[j].ord_typ==ro_is) || |
---|
| 3701 | (r->order[r->typ[j].order_index] == ringorder_aa))) |
---|
| 3702 | { |
---|
| 3703 | i++; j++; |
---|
| 3704 | } |
---|
| 3705 | // No use of j anymore!!!???? |
---|
| 3706 | |
---|
| 3707 | if (i==r->pCompIndex) i++; |
---|
| 3708 | r->pOrdIndex=i; // How came it is "i" here???!!!! exp[r->pOrdIndex] is order of a poly... This may be wrong!!! IS |
---|
| 3709 | |
---|
| 3710 | // ---------------------------- |
---|
| 3711 | rSetDegStuff(r); |
---|
| 3712 | rSetOption(r); |
---|
| 3713 | // ---------------------------- |
---|
| 3714 | // r->p_Setm |
---|
| 3715 | r->p_Setm = p_GetSetmProc(r); |
---|
| 3716 | |
---|
| 3717 | // ---------------------------- |
---|
| 3718 | // set VarL_* |
---|
| 3719 | rSetVarL(r); |
---|
| 3720 | |
---|
| 3721 | // ---------------------------- |
---|
| 3722 | // right-adjust VarOffset |
---|
| 3723 | rRightAdjustVarOffset(r); |
---|
| 3724 | |
---|
| 3725 | // ---------------------------- |
---|
| 3726 | // set NegWeightL* |
---|
| 3727 | rSetNegWeight(r); |
---|
| 3728 | |
---|
| 3729 | // ---------------------------- |
---|
| 3730 | // p_Procs: call AFTER NegWeightL |
---|
| 3731 | r->p_Procs = (p_Procs_s*)omAlloc(sizeof(p_Procs_s)); |
---|
| 3732 | p_ProcsSet(r, r->p_Procs); |
---|
| 3733 | return FALSE; |
---|
| 3734 | } |
---|
| 3735 | |
---|
[8261b2] | 3736 | static void rCheckOrdSgn(ring r,int i/*current block*/) |
---|
| 3737 | { // set r->OrdSgn |
---|
[99d8fd5] | 3738 | if ( r->OrdSgn==1) |
---|
| 3739 | { |
---|
| 3740 | int oo=-1; |
---|
| 3741 | int jj; |
---|
| 3742 | for(jj=i-1;jj>=0;jj--) |
---|
| 3743 | { |
---|
| 3744 | if(((r->order[jj]==ringorder_a) |
---|
| 3745 | ||(r->order[jj]==ringorder_aa) |
---|
| 3746 | ||(r->order[jj]==ringorder_a64)) |
---|
| 3747 | &&(r->block0[jj]<=r->block0[i]) |
---|
| 3748 | &&(r->block1[jj]>=r->block1[i])) |
---|
| 3749 | { oo=1; break;} |
---|
| 3750 | } |
---|
| 3751 | r->OrdSgn=oo; |
---|
| 3752 | } |
---|
[8261b2] | 3753 | } |
---|
| 3754 | |
---|
[84893c] | 3755 | |
---|
[a6904c] | 3756 | void rUnComplete(ring r) |
---|
| 3757 | { |
---|
| 3758 | if (r == NULL) return; |
---|
| 3759 | if (r->VarOffset != NULL) |
---|
| 3760 | { |
---|
| 3761 | if (r->OrdSize!=0 && r->typ != NULL) |
---|
| 3762 | { |
---|
| 3763 | for(int i = 0; i < r->OrdSize; i++) |
---|
| 3764 | if( r->typ[i].ord_typ == ro_is) // Search for suffixes! (prefix have the same VarOffset) |
---|
| 3765 | { |
---|
| 3766 | id_Delete(&r->typ[i].data.is.F, r); |
---|
| 3767 | r->typ[i].data.is.F = NULL; // ? |
---|
| 3768 | |
---|
| 3769 | if( r->typ[i].data.is.componentWeights != NULL ) |
---|
| 3770 | { |
---|
| 3771 | delete r->typ[i].data.is.componentWeights; |
---|
| 3772 | r->typ[i].data.is.componentWeights = NULL; // ? |
---|
| 3773 | } |
---|
| 3774 | |
---|
| 3775 | if( r->typ[i].data.is.pVarOffset != NULL ) |
---|
| 3776 | { |
---|
| 3777 | omFreeSize((ADDRESS)r->typ[i].data.is.pVarOffset, (r->N +1)*sizeof(int)); |
---|
| 3778 | r->typ[i].data.is.pVarOffset = NULL; // ? |
---|
| 3779 | } |
---|
| 3780 | } |
---|
| 3781 | else if (r->typ[i].ord_typ == ro_syz) |
---|
| 3782 | { |
---|
| 3783 | if(r->typ[i].data.syz.limit > 0) |
---|
| 3784 | omFreeSize(r->typ[i].data.syz.syz_index, ((r->typ[i].data.syz.limit) +1)*sizeof(int)); |
---|
| 3785 | r->typ[i].data.syz.syz_index = NULL; |
---|
| 3786 | } |
---|
| 3787 | else if (r->typ[i].ord_typ == ro_syzcomp) |
---|
| 3788 | { |
---|
[1ed346] | 3789 | assume( r->typ[i].data.syzcomp.ShiftedComponents == NULL ); |
---|
| 3790 | assume( r->typ[i].data.syzcomp.Components == NULL ); |
---|
| 3791 | // WarnS( "rUnComplete : ord_typ == ro_syzcomp was unhandled!!! Possibly memory leak!!!" ); |
---|
[a6904c] | 3792 | #ifndef NDEBUG |
---|
[1ed346] | 3793 | // assume(0); |
---|
[a6904c] | 3794 | #endif |
---|
| 3795 | } |
---|
| 3796 | |
---|
| 3797 | omFreeSize((ADDRESS)r->typ,r->OrdSize*sizeof(sro_ord)); r->typ = NULL; |
---|
| 3798 | } |
---|
| 3799 | |
---|
| 3800 | if (r->order != NULL) |
---|
| 3801 | { |
---|
| 3802 | // delete r->order!!!??? |
---|
| 3803 | } |
---|
| 3804 | |
---|
| 3805 | if (r->PolyBin != NULL) |
---|
| 3806 | omUnGetSpecBin(&(r->PolyBin)); |
---|
| 3807 | |
---|
| 3808 | omFreeSize((ADDRESS)r->VarOffset, (r->N +1)*sizeof(int)); |
---|
| 3809 | |
---|
| 3810 | if (r->ordsgn != NULL && r->CmpL_Size != 0) |
---|
| 3811 | omFreeSize((ADDRESS)r->ordsgn,r->ExpL_Size*sizeof(long)); |
---|
| 3812 | if (r->p_Procs != NULL) |
---|
| 3813 | omFreeSize(r->p_Procs, sizeof(p_Procs_s)); |
---|
| 3814 | omfreeSize(r->VarL_Offset, r->VarL_Size*sizeof(int)); |
---|
| 3815 | } |
---|
| 3816 | if (r->NegWeightL_Offset!=NULL) |
---|
| 3817 | { |
---|
| 3818 | omFreeSize(r->NegWeightL_Offset, r->NegWeightL_Size*sizeof(int)); |
---|
| 3819 | r->NegWeightL_Offset=NULL; |
---|
| 3820 | } |
---|
| 3821 | } |
---|
| 3822 | |
---|
| 3823 | // set r->VarL_Size, r->VarL_Offset, r->VarL_LowIndex |
---|
| 3824 | static void rSetVarL(ring r) |
---|
| 3825 | { |
---|
| 3826 | int min = INT_MAX, min_j = -1; |
---|
| 3827 | int* VarL_Number = (int*) omAlloc0(r->ExpL_Size*sizeof(int)); |
---|
| 3828 | |
---|
| 3829 | int i,j; |
---|
| 3830 | |
---|
| 3831 | // count how often a var long is occupied by an exponent |
---|
| 3832 | for (i=1; i<=r->N; i++) |
---|
| 3833 | { |
---|
| 3834 | VarL_Number[r->VarOffset[i] & 0xffffff]++; |
---|
| 3835 | } |
---|
| 3836 | |
---|
| 3837 | // determine how many and min |
---|
| 3838 | for (i=0, j=0; i<r->ExpL_Size; i++) |
---|
| 3839 | { |
---|
| 3840 | if (VarL_Number[i] != 0) |
---|
| 3841 | { |
---|
| 3842 | if (min > VarL_Number[i]) |
---|
| 3843 | { |
---|
| 3844 | min = VarL_Number[i]; |
---|
| 3845 | min_j = j; |
---|
| 3846 | } |
---|
| 3847 | j++; |
---|
| 3848 | } |
---|
| 3849 | } |
---|
| 3850 | |
---|
| 3851 | r->VarL_Size = j; // number of long with exp. entries in |
---|
| 3852 | // in p->exp |
---|
| 3853 | r->VarL_Offset = (int*) omAlloc(r->VarL_Size*sizeof(int)); |
---|
| 3854 | r->VarL_LowIndex = 0; |
---|
| 3855 | |
---|
| 3856 | // set VarL_Offset |
---|
| 3857 | for (i=0, j=0; i<r->ExpL_Size; i++) |
---|
| 3858 | { |
---|
| 3859 | if (VarL_Number[i] != 0) |
---|
| 3860 | { |
---|
| 3861 | r->VarL_Offset[j] = i; |
---|
| 3862 | if (j > 0 && r->VarL_Offset[j-1] != r->VarL_Offset[j] - 1) |
---|
| 3863 | r->VarL_LowIndex = -1; |
---|
| 3864 | j++; |
---|
| 3865 | } |
---|
| 3866 | } |
---|
| 3867 | if (r->VarL_LowIndex >= 0) |
---|
| 3868 | r->VarL_LowIndex = r->VarL_Offset[0]; |
---|
| 3869 | |
---|
| 3870 | r->MinExpPerLong = min; |
---|
| 3871 | if (min_j != 0) |
---|
| 3872 | { |
---|
| 3873 | j = r->VarL_Offset[min_j]; |
---|
| 3874 | r->VarL_Offset[min_j] = r->VarL_Offset[0]; |
---|
| 3875 | r->VarL_Offset[0] = j; |
---|
| 3876 | } |
---|
| 3877 | omFree(VarL_Number); |
---|
| 3878 | } |
---|
| 3879 | |
---|
| 3880 | static void rRightAdjustVarOffset(ring r) |
---|
| 3881 | { |
---|
| 3882 | int* shifts = (int*) omAlloc(r->ExpL_Size*sizeof(int)); |
---|
| 3883 | int i; |
---|
| 3884 | // initialize shifts |
---|
| 3885 | for (i=0;i<r->ExpL_Size;i++) |
---|
| 3886 | shifts[i] = BIT_SIZEOF_LONG; |
---|
| 3887 | |
---|
| 3888 | // find minimal bit shift in each long exp entry |
---|
| 3889 | for (i=1;i<=r->N;i++) |
---|
| 3890 | { |
---|
| 3891 | if (shifts[r->VarOffset[i] & 0xffffff] > r->VarOffset[i] >> 24) |
---|
| 3892 | shifts[r->VarOffset[i] & 0xffffff] = r->VarOffset[i] >> 24; |
---|
| 3893 | } |
---|
| 3894 | // reset r->VarOffset: set the minimal shift to 0 |
---|
| 3895 | for (i=1;i<=r->N;i++) |
---|
| 3896 | { |
---|
| 3897 | if (shifts[r->VarOffset[i] & 0xffffff] != 0) |
---|
| 3898 | r->VarOffset[i] |
---|
| 3899 | = (r->VarOffset[i] & 0xffffff) | |
---|
| 3900 | (((r->VarOffset[i] >> 24) - shifts[r->VarOffset[i] & 0xffffff]) << 24); |
---|
| 3901 | } |
---|
| 3902 | omFree(shifts); |
---|
| 3903 | } |
---|
| 3904 | |
---|
| 3905 | // get r->divmask depending on bits per exponent |
---|
| 3906 | static unsigned long rGetDivMask(int bits) |
---|
| 3907 | { |
---|
| 3908 | unsigned long divmask = 1; |
---|
| 3909 | int i = bits; |
---|
| 3910 | |
---|
| 3911 | while (i < BIT_SIZEOF_LONG) |
---|
| 3912 | { |
---|
| 3913 | divmask |= (((unsigned long) 1) << (unsigned long) i); |
---|
| 3914 | i += bits; |
---|
| 3915 | } |
---|
| 3916 | return divmask; |
---|
| 3917 | } |
---|
| 3918 | |
---|
| 3919 | #ifdef RDEBUG |
---|
| 3920 | void rDebugPrint(ring r) |
---|
| 3921 | { |
---|
| 3922 | if (r==NULL) |
---|
| 3923 | { |
---|
| 3924 | PrintS("NULL ?\n"); |
---|
| 3925 | return; |
---|
| 3926 | } |
---|
| 3927 | // corresponds to ro_typ from ring.h: |
---|
| 3928 | const char *TYP[]={"ro_dp","ro_wp","ro_wp64","ro_wp_neg","ro_cp", |
---|
| 3929 | "ro_syzcomp", "ro_syz", "ro_isTemp", "ro_is", "ro_none"}; |
---|
| 3930 | int i,j; |
---|
| 3931 | |
---|
| 3932 | Print("ExpL_Size:%d ",r->ExpL_Size); |
---|
| 3933 | Print("CmpL_Size:%d ",r->CmpL_Size); |
---|
| 3934 | Print("VarL_Size:%d\n",r->VarL_Size); |
---|
| 3935 | Print("bitmask=0x%lx (expbound=%ld) \n",r->bitmask, r->bitmask); |
---|
| 3936 | Print("BitsPerExp=%d ExpPerLong=%d MinExpPerLong=%d at L[%d]\n", r->BitsPerExp, r->ExpPerLong, r->MinExpPerLong, r->VarL_Offset[0]); |
---|
| 3937 | PrintS("varoffset:\n"); |
---|
| 3938 | if (r->VarOffset==NULL) PrintS(" NULL\n"); |
---|
| 3939 | else |
---|
| 3940 | for(j=0;j<=r->N;j++) |
---|
| 3941 | Print(" v%d at e-pos %d, bit %d\n", |
---|
| 3942 | j,r->VarOffset[j] & 0xffffff, r->VarOffset[j] >>24); |
---|
| 3943 | Print("divmask=%lx\n", r->divmask); |
---|
| 3944 | PrintS("ordsgn:\n"); |
---|
| 3945 | for(j=0;j<r->CmpL_Size;j++) |
---|
| 3946 | Print(" ordsgn %ld at pos %d\n",r->ordsgn[j],j); |
---|
| 3947 | Print("OrdSgn:%d\n",r->OrdSgn); |
---|
| 3948 | PrintS("ordrec:\n"); |
---|
| 3949 | for(j=0;j<r->OrdSize;j++) |
---|
| 3950 | { |
---|
| 3951 | Print(" typ %s", TYP[r->typ[j].ord_typ]); |
---|
| 3952 | |
---|
[273fed] | 3953 | |
---|
| 3954 | if (r->typ[j].ord_typ==ro_syz) |
---|
| 3955 | { |
---|
| 3956 | const short place = r->typ[j].data.syz.place; |
---|
| 3957 | const int limit = r->typ[j].data.syz.limit; |
---|
| 3958 | const int curr_index = r->typ[j].data.syz.curr_index; |
---|
| 3959 | const int* syz_index = r->typ[j].data.syz.syz_index; |
---|
| 3960 | |
---|
| 3961 | Print(" limit %d (place: %d, curr_index: %d), syz_index: ", limit, place, curr_index); |
---|
| 3962 | |
---|
| 3963 | if( syz_index == NULL ) |
---|
| 3964 | PrintS("(NULL)"); |
---|
| 3965 | else |
---|
| 3966 | { |
---|
| 3967 | Print("{"); |
---|
| 3968 | for( i=0; i <= limit; i++ ) |
---|
| 3969 | Print("%d ", syz_index[i]); |
---|
| 3970 | Print("}"); |
---|
| 3971 | } |
---|
| 3972 | |
---|
| 3973 | } |
---|
| 3974 | else if (r->typ[j].ord_typ==ro_isTemp) |
---|
[a6904c] | 3975 | { |
---|
| 3976 | Print(" start (level) %d, suffixpos: %d, VO: ",r->typ[j].data.isTemp.start, r->typ[j].data.isTemp.suffixpos); |
---|
| 3977 | |
---|
| 3978 | } |
---|
[273fed] | 3979 | else if (r->typ[j].ord_typ==ro_is) |
---|
[a6904c] | 3980 | { |
---|
| 3981 | Print(" start %d, end: %d: ",r->typ[j].data.is.start, r->typ[j].data.is.end); |
---|
| 3982 | |
---|
| 3983 | // for( int k = 0; k <= r->N; k++) if (r->typ[j].data.is.pVarOffset[k] != -1) Print("[%2d]: %04x; ", k, r->typ[j].data.is.pVarOffset[k]); |
---|
| 3984 | |
---|
| 3985 | Print(" limit %d\n",r->typ[j].data.is.limit); |
---|
| 3986 | #ifndef NDEBUG |
---|
[f7a975] | 3987 | //PrintS(" F: ");idShow(r->typ[j].data.is.F, r, r, 1); |
---|
[a6904c] | 3988 | #endif |
---|
| 3989 | |
---|
| 3990 | PrintS("weights: "); |
---|
| 3991 | |
---|
| 3992 | if( r->typ[j].data.is.componentWeights == NULL ) |
---|
| 3993 | PrintS("NULL == [0,...0]\n"); |
---|
| 3994 | else |
---|
| 3995 | { |
---|
| 3996 | (r->typ[j].data.is.componentWeights)->show(); PrintLn(); |
---|
| 3997 | } |
---|
| 3998 | } |
---|
| 3999 | else |
---|
| 4000 | { |
---|
| 4001 | Print(" place %d",r->typ[j].data.dp.place); |
---|
| 4002 | |
---|
| 4003 | if (r->typ[j].ord_typ!=ro_syzcomp && r->typ[j].ord_typ!=ro_syz) |
---|
| 4004 | { |
---|
| 4005 | Print(" start %d",r->typ[j].data.dp.start); |
---|
| 4006 | Print(" end %d",r->typ[j].data.dp.end); |
---|
| 4007 | if ((r->typ[j].ord_typ==ro_wp) |
---|
| 4008 | || (r->typ[j].ord_typ==ro_wp_neg)) |
---|
| 4009 | { |
---|
| 4010 | PrintS(" w:"); |
---|
| 4011 | for(int l=r->typ[j].data.wp.start;l<=r->typ[j].data.wp.end;l++) |
---|
| 4012 | Print(" %d",r->typ[j].data.wp.weights[l-r->typ[j].data.wp.start]); |
---|
| 4013 | } |
---|
| 4014 | else if (r->typ[j].ord_typ==ro_wp64) |
---|
| 4015 | { |
---|
| 4016 | PrintS(" w64:"); |
---|
| 4017 | int l; |
---|
| 4018 | for(l=r->typ[j].data.wp64.start;l<=r->typ[j].data.wp64.end;l++) |
---|
| 4019 | Print(" %ld",(long)(((int64*)r->typ[j].data.wp64.weights64)+l-r->typ[j].data.wp64.start)); |
---|
| 4020 | } |
---|
| 4021 | } |
---|
| 4022 | } |
---|
| 4023 | PrintLn(); |
---|
| 4024 | } |
---|
| 4025 | Print("pOrdIndex:%d pCompIndex:%d\n", r->pOrdIndex, r->pCompIndex); |
---|
| 4026 | Print("OrdSize:%d\n",r->OrdSize); |
---|
| 4027 | PrintS("--------------------\n"); |
---|
| 4028 | for(j=0;j<r->ExpL_Size;j++) |
---|
| 4029 | { |
---|
| 4030 | Print("L[%d]: ",j); |
---|
| 4031 | if (j< r->CmpL_Size) |
---|
| 4032 | Print("ordsgn %ld ", r->ordsgn[j]); |
---|
| 4033 | else |
---|
| 4034 | PrintS("no comp "); |
---|
| 4035 | i=1; |
---|
| 4036 | for(;i<=r->N;i++) |
---|
| 4037 | { |
---|
| 4038 | if( (r->VarOffset[i] & 0xffffff) == j ) |
---|
| 4039 | { Print("v%d at e[%d], bit %d; ", i,r->VarOffset[i] & 0xffffff, |
---|
| 4040 | r->VarOffset[i] >>24 ); } |
---|
| 4041 | } |
---|
| 4042 | if( r->pCompIndex==j ) PrintS("v0; "); |
---|
| 4043 | for(i=0;i<r->OrdSize;i++) |
---|
| 4044 | { |
---|
| 4045 | if (r->typ[i].data.dp.place == j) |
---|
| 4046 | { |
---|
| 4047 | Print("ordrec:%s (start:%d, end:%d) ",TYP[r->typ[i].ord_typ], |
---|
| 4048 | r->typ[i].data.dp.start, r->typ[i].data.dp.end); |
---|
| 4049 | } |
---|
| 4050 | } |
---|
| 4051 | |
---|
| 4052 | if (j==r->pOrdIndex) |
---|
| 4053 | PrintS("pOrdIndex\n"); |
---|
| 4054 | else |
---|
| 4055 | PrintLn(); |
---|
| 4056 | } |
---|
[8047af8] | 4057 | Print("LexOrder:%d, MixedOrder:%d\n",r->LexOrder, r->MixedOrder); |
---|
[a6904c] | 4058 | |
---|
| 4059 | // p_Procs stuff |
---|
| 4060 | p_Procs_s proc_names; |
---|
| 4061 | const char* field; |
---|
| 4062 | const char* length; |
---|
| 4063 | const char* ord; |
---|
| 4064 | p_Debug_GetProcNames(r, &proc_names); // changes p_Procs!!! |
---|
| 4065 | p_Debug_GetSpecNames(r, field, length, ord); |
---|
| 4066 | |
---|
| 4067 | Print("p_Spec : %s, %s, %s\n", field, length, ord); |
---|
| 4068 | PrintS("p_Procs :\n"); |
---|
| 4069 | for (i=0; i<(int) (sizeof(p_Procs_s)/sizeof(void*)); i++) |
---|
| 4070 | { |
---|
| 4071 | Print(" %s,\n", ((char**) &proc_names)[i]); |
---|
| 4072 | } |
---|
[273fed] | 4073 | |
---|
| 4074 | { |
---|
| 4075 | #define pFDeg_CASE(A) if(r->pFDeg == A) PrintS( "" #A "" ) |
---|
| 4076 | Print("\npFDeg : "); |
---|
[f70f641] | 4077 | |
---|
[273fed] | 4078 | pFDeg_CASE(p_Totaldegree); else |
---|
[028192] | 4079 | pFDeg_CASE(p_WFirstTotalDegree); else |
---|
| 4080 | pFDeg_CASE(p_WTotaldegree); else |
---|
| 4081 | pFDeg_CASE(p_Deg); else |
---|
[9bb5457] | 4082 | Print("(%p)", (void*)(r->pFDeg)); // default case |
---|
[f70f641] | 4083 | |
---|
[273fed] | 4084 | PrintS("\n"); |
---|
| 4085 | #undef pFDeg_CASE |
---|
| 4086 | } |
---|
[f70f641] | 4087 | |
---|
[a6904c] | 4088 | } |
---|
| 4089 | |
---|
| 4090 | void p_DebugPrint(poly p, const ring r) |
---|
| 4091 | { |
---|
| 4092 | int i,j; |
---|
| 4093 | p_Write(p,r); |
---|
| 4094 | j=2; |
---|
| 4095 | while(p!=NULL) |
---|
| 4096 | { |
---|
| 4097 | Print("\nexp[0..%d]\n",r->ExpL_Size-1); |
---|
| 4098 | for(i=0;i<r->ExpL_Size;i++) |
---|
| 4099 | Print("%ld ",p->exp[i]); |
---|
| 4100 | PrintLn(); |
---|
| 4101 | Print("v0:%ld ",p_GetComp(p, r)); |
---|
[b1ff71] | 4102 | for(i=1;i<=r->N;i++) Print(" v%d:%ld",i,p_GetExp(p,i, r)); |
---|
[a6904c] | 4103 | PrintLn(); |
---|
| 4104 | pIter(p); |
---|
| 4105 | j--; |
---|
| 4106 | if (j==0) { PrintS("...\n"); break; } |
---|
| 4107 | } |
---|
| 4108 | } |
---|
| 4109 | |
---|
| 4110 | #endif // RDEBUG |
---|
| 4111 | |
---|
| 4112 | /// debug-print monomial poly/vector p, assuming that it lives in the ring R |
---|
| 4113 | static inline void m_DebugPrint(const poly p, const ring R) |
---|
| 4114 | { |
---|
| 4115 | Print("\nexp[0..%d]\n", R->ExpL_Size - 1); |
---|
| 4116 | for(int i = 0; i < R->ExpL_Size; i++) |
---|
| 4117 | Print("%09lx ", p->exp[i]); |
---|
| 4118 | PrintLn(); |
---|
| 4119 | Print("v0:%9ld ", p_GetComp(p, R)); |
---|
[b1ff71] | 4120 | for(int i = 1; i <= R->N; i++) Print(" v%d:%5ld",i, p_GetExp(p, i, R)); |
---|
[a6904c] | 4121 | PrintLn(); |
---|
| 4122 | } |
---|
| 4123 | |
---|
| 4124 | |
---|
| 4125 | #ifndef NDEBUG |
---|
| 4126 | /// debug-print at most nTerms (2 by default) terms from poly/vector p, |
---|
| 4127 | /// assuming that lt(p) lives in lmRing and tail(p) lives in tailRing. |
---|
| 4128 | void p_DebugPrint(const poly p, const ring lmRing, const ring tailRing, const int nTerms) |
---|
| 4129 | { |
---|
| 4130 | assume( nTerms >= 0 ); |
---|
| 4131 | if( p != NULL ) |
---|
| 4132 | { |
---|
| 4133 | assume( p != NULL ); |
---|
| 4134 | |
---|
| 4135 | p_Write(p, lmRing, tailRing); |
---|
| 4136 | |
---|
| 4137 | if( (p != NULL) && (nTerms > 0) ) |
---|
| 4138 | { |
---|
| 4139 | assume( p != NULL ); |
---|
| 4140 | assume( nTerms > 0 ); |
---|
| 4141 | |
---|
| 4142 | // debug pring leading term |
---|
| 4143 | m_DebugPrint(p, lmRing); |
---|
| 4144 | |
---|
| 4145 | poly q = pNext(p); // q = tail(p) |
---|
| 4146 | |
---|
| 4147 | // debug pring tail (at most nTerms-1 terms from it) |
---|
| 4148 | for(int j = nTerms - 1; (q !=NULL) && (j > 0); pIter(q), --j) |
---|
| 4149 | m_DebugPrint(q, tailRing); |
---|
| 4150 | |
---|
| 4151 | if (q != NULL) |
---|
| 4152 | PrintS("...\n"); |
---|
| 4153 | } |
---|
| 4154 | } |
---|
| 4155 | else |
---|
| 4156 | PrintS("0\n"); |
---|
| 4157 | } |
---|
| 4158 | #endif |
---|
| 4159 | |
---|
| 4160 | |
---|
| 4161 | // F = system("ISUpdateComponents", F, V, MIN ); |
---|
| 4162 | // // replace gen(i) -> gen(MIN + V[i-MIN]) for all i > MIN in all terms from F! |
---|
[351a5f] | 4163 | void pISUpdateComponents(ideal F, const intvec *const V, const int MIN, const ring r ) |
---|
[a6904c] | 4164 | { |
---|
| 4165 | assume( V != NULL ); |
---|
| 4166 | assume( MIN >= 0 ); |
---|
| 4167 | |
---|
| 4168 | if( F == NULL ) |
---|
| 4169 | return; |
---|
| 4170 | |
---|
| 4171 | for( int j = (F->ncols*F->nrows) - 1; j >= 0; j-- ) |
---|
| 4172 | { |
---|
| 4173 | #ifdef PDEBUG |
---|
| 4174 | Print("F[%d]:", j); |
---|
| 4175 | p_DebugPrint(F->m[j], r, r, 0); |
---|
| 4176 | #endif |
---|
| 4177 | |
---|
| 4178 | for( poly p = F->m[j]; p != NULL; pIter(p) ) |
---|
| 4179 | { |
---|
| 4180 | int c = p_GetComp(p, r); |
---|
| 4181 | |
---|
| 4182 | if( c > MIN ) |
---|
| 4183 | { |
---|
| 4184 | #ifdef PDEBUG |
---|
| 4185 | Print("gen[%d] -> gen(%d)\n", c, MIN + (*V)[ c - MIN - 1 ]); |
---|
| 4186 | #endif |
---|
| 4187 | |
---|
| 4188 | p_SetComp( p, MIN + (*V)[ c - MIN - 1 ], r ); |
---|
| 4189 | } |
---|
| 4190 | } |
---|
| 4191 | #ifdef PDEBUG |
---|
| 4192 | Print("new F[%d]:", j); |
---|
| 4193 | p_Test(F->m[j], r); |
---|
| 4194 | p_DebugPrint(F->m[j], r, r, 0); |
---|
| 4195 | #endif |
---|
| 4196 | } |
---|
| 4197 | |
---|
| 4198 | } |
---|
| 4199 | |
---|
| 4200 | |
---|
| 4201 | |
---|
| 4202 | |
---|
| 4203 | /*2 |
---|
| 4204 | * asssume that rComplete was called with r |
---|
| 4205 | * assume that the first block ist ringorder_S |
---|
| 4206 | * change the block to reflect the sequence given by appending v |
---|
| 4207 | */ |
---|
[af66d6] | 4208 | static inline void rNChangeSComps(int* currComponents, long* currShiftedComponents, ring r) |
---|
| 4209 | { |
---|
| 4210 | assume(r->typ[1].ord_typ == ro_syzcomp); |
---|
| 4211 | |
---|
| 4212 | r->typ[1].data.syzcomp.ShiftedComponents = currShiftedComponents; |
---|
| 4213 | r->typ[1].data.syzcomp.Components = currComponents; |
---|
| 4214 | } |
---|
| 4215 | |
---|
| 4216 | static inline void rNGetSComps(int** currComponents, long** currShiftedComponents, ring r) |
---|
| 4217 | { |
---|
| 4218 | assume(r->typ[1].ord_typ == ro_syzcomp); |
---|
[a6904c] | 4219 | |
---|
[af66d6] | 4220 | *currShiftedComponents = r->typ[1].data.syzcomp.ShiftedComponents; |
---|
| 4221 | *currComponents = r->typ[1].data.syzcomp.Components; |
---|
| 4222 | } |
---|
[a6904c] | 4223 | #ifdef PDEBUG |
---|
[af66d6] | 4224 | static inline void rDBChangeSComps(int* currComponents, |
---|
[a6904c] | 4225 | long* currShiftedComponents, |
---|
| 4226 | int length, |
---|
| 4227 | ring r) |
---|
| 4228 | { |
---|
[1ed346] | 4229 | assume(r->typ[1].ord_typ == ro_syzcomp); |
---|
[f70f641] | 4230 | |
---|
[a6904c] | 4231 | r->typ[1].data.syzcomp.length = length; |
---|
| 4232 | rNChangeSComps( currComponents, currShiftedComponents, r); |
---|
| 4233 | } |
---|
[af66d6] | 4234 | static inline void rDBGetSComps(int** currComponents, |
---|
[a6904c] | 4235 | long** currShiftedComponents, |
---|
| 4236 | int *length, |
---|
| 4237 | ring r) |
---|
| 4238 | { |
---|
[1ed346] | 4239 | assume(r->typ[1].ord_typ == ro_syzcomp); |
---|
[f70f641] | 4240 | |
---|
[a6904c] | 4241 | *length = r->typ[1].data.syzcomp.length; |
---|
| 4242 | rNGetSComps( currComponents, currShiftedComponents, r); |
---|
| 4243 | } |
---|
| 4244 | #endif |
---|
| 4245 | |
---|
[af66d6] | 4246 | void rChangeSComps(int* currComponents, long* currShiftedComponents, int length, ring r) |
---|
[a6904c] | 4247 | { |
---|
[af66d6] | 4248 | #ifdef PDEBUG |
---|
| 4249 | rDBChangeSComps(currComponents, currShiftedComponents, length, r); |
---|
| 4250 | #else |
---|
| 4251 | rNChangeSComps(currComponents, currShiftedComponents, r); |
---|
| 4252 | #endif |
---|
[a6904c] | 4253 | } |
---|
| 4254 | |
---|
[af66d6] | 4255 | void rGetSComps(int** currComponents, long** currShiftedComponents, int *length, ring r) |
---|
[a6904c] | 4256 | { |
---|
[af66d6] | 4257 | #ifdef PDEBUG |
---|
| 4258 | rDBGetSComps(currComponents, currShiftedComponents, length, r); |
---|
| 4259 | #else |
---|
| 4260 | rNGetSComps(currComponents, currShiftedComponents, r); |
---|
| 4261 | #endif |
---|
[a6904c] | 4262 | } |
---|
| 4263 | |
---|
[af66d6] | 4264 | |
---|
[a6904c] | 4265 | ///////////////////////////////////////////////////////////////////////////// |
---|
| 4266 | // |
---|
| 4267 | // The following routines all take as input a ring r, and return R |
---|
| 4268 | // where R has a certain property. R might be equal r in which case r |
---|
| 4269 | // had already this property |
---|
| 4270 | // |
---|
[7eb7b5] | 4271 | ring rAssure_SyzComp(const ring r, BOOLEAN complete) |
---|
[a6904c] | 4272 | { |
---|
| 4273 | if ( (r->order[0] == ringorder_s) ) return r; |
---|
[273fed] | 4274 | |
---|
[a6904c] | 4275 | if ( (r->order[0] == ringorder_IS) ) |
---|
| 4276 | { |
---|
| 4277 | #ifndef NDEBUG |
---|
[273fed] | 4278 | WarnS("rAssure_SyzComp: input ring has an IS-ordering!"); |
---|
[a6904c] | 4279 | #endif |
---|
| 4280 | // return r; |
---|
| 4281 | } |
---|
| 4282 | ring res=rCopy0(r, FALSE, FALSE); |
---|
| 4283 | int i=rBlocks(r); |
---|
| 4284 | int j; |
---|
| 4285 | |
---|
| 4286 | res->order=(int *)omAlloc((i+1)*sizeof(int)); |
---|
| 4287 | res->block0=(int *)omAlloc0((i+1)*sizeof(int)); |
---|
| 4288 | res->block1=(int *)omAlloc0((i+1)*sizeof(int)); |
---|
| 4289 | int ** wvhdl =(int **)omAlloc0((i+1)*sizeof(int**)); |
---|
| 4290 | for(j=i;j>0;j--) |
---|
| 4291 | { |
---|
| 4292 | res->order[j]=r->order[j-1]; |
---|
| 4293 | res->block0[j]=r->block0[j-1]; |
---|
| 4294 | res->block1[j]=r->block1[j-1]; |
---|
| 4295 | if (r->wvhdl[j-1] != NULL) |
---|
| 4296 | { |
---|
| 4297 | wvhdl[j] = (int*) omMemDup(r->wvhdl[j-1]); |
---|
| 4298 | } |
---|
| 4299 | } |
---|
| 4300 | res->order[0]=ringorder_s; |
---|
| 4301 | |
---|
| 4302 | res->wvhdl = wvhdl; |
---|
| 4303 | |
---|
| 4304 | if (complete) |
---|
| 4305 | { |
---|
| 4306 | rComplete(res, 1); |
---|
| 4307 | |
---|
| 4308 | #ifdef HAVE_PLURAL |
---|
| 4309 | if (rIsPluralRing(r)) |
---|
| 4310 | { |
---|
| 4311 | if ( nc_rComplete(r, res, false) ) // no qideal! |
---|
| 4312 | { |
---|
| 4313 | #ifndef NDEBUG |
---|
| 4314 | WarnS("error in nc_rComplete"); // cleanup?// rDelete(res);// return r; // just go on.. |
---|
| 4315 | #endif |
---|
| 4316 | } |
---|
| 4317 | } |
---|
| 4318 | assume(rIsPluralRing(r) == rIsPluralRing(res)); |
---|
| 4319 | #endif |
---|
| 4320 | |
---|
| 4321 | |
---|
| 4322 | #ifdef HAVE_PLURAL |
---|
| 4323 | ring old_ring = r; |
---|
| 4324 | #endif |
---|
| 4325 | |
---|
| 4326 | if (r->qideal!=NULL) |
---|
| 4327 | { |
---|
| 4328 | res->qideal= idrCopyR_NoSort(r->qideal, r, res); |
---|
| 4329 | |
---|
[f7a975] | 4330 | assume(id_RankFreeModule(res->qideal, res) == 0); |
---|
[a6904c] | 4331 | |
---|
| 4332 | #ifdef HAVE_PLURAL |
---|
| 4333 | if( rIsPluralRing(res) ) |
---|
| 4334 | if( nc_SetupQuotient(res, r, true) ) |
---|
| 4335 | { |
---|
| 4336 | // WarnS("error in nc_SetupQuotient"); // cleanup? rDelete(res); return r; // just go on...? |
---|
| 4337 | } |
---|
| 4338 | |
---|
| 4339 | #endif |
---|
[f7a975] | 4340 | assume(id_RankFreeModule(res->qideal, res) == 0); |
---|
[a6904c] | 4341 | } |
---|
| 4342 | |
---|
| 4343 | #ifdef HAVE_PLURAL |
---|
| 4344 | assume((res->qideal==NULL) == (old_ring->qideal==NULL)); |
---|
| 4345 | assume(rIsPluralRing(res) == rIsPluralRing(old_ring)); |
---|
| 4346 | assume(rIsSCA(res) == rIsSCA(old_ring)); |
---|
| 4347 | assume(ncRingType(res) == ncRingType(old_ring)); |
---|
| 4348 | #endif |
---|
| 4349 | } |
---|
| 4350 | |
---|
| 4351 | return res; |
---|
| 4352 | } |
---|
| 4353 | |
---|
| 4354 | ring rAssure_TDeg(ring r, int start_var, int end_var, int &pos) |
---|
| 4355 | { |
---|
| 4356 | int i; |
---|
| 4357 | if (r->typ!=NULL) |
---|
| 4358 | { |
---|
| 4359 | for(i=r->OrdSize-1;i>=0;i--) |
---|
| 4360 | { |
---|
| 4361 | if ((r->typ[i].ord_typ==ro_dp) |
---|
| 4362 | && (r->typ[i].data.dp.start==start_var) |
---|
| 4363 | && (r->typ[i].data.dp.end==end_var)) |
---|
| 4364 | { |
---|
| 4365 | pos=r->typ[i].data.dp.place; |
---|
| 4366 | //printf("no change, pos=%d\n",pos); |
---|
| 4367 | return r; |
---|
| 4368 | } |
---|
| 4369 | } |
---|
| 4370 | } |
---|
| 4371 | |
---|
| 4372 | #ifdef HAVE_PLURAL |
---|
| 4373 | nc_struct* save=r->GetNC(); |
---|
| 4374 | r->GetNC()=NULL; |
---|
| 4375 | #endif |
---|
| 4376 | ring res=rCopy(r); |
---|
| 4377 | |
---|
| 4378 | i=rBlocks(r); |
---|
| 4379 | int j; |
---|
| 4380 | |
---|
| 4381 | res->ExpL_Size=r->ExpL_Size+1; // one word more in each monom |
---|
| 4382 | res->PolyBin=omGetSpecBin(POLYSIZE + (res->ExpL_Size)*sizeof(long)); |
---|
| 4383 | omFree((ADDRESS)res->ordsgn); |
---|
| 4384 | res->ordsgn=(long *)omAlloc0(res->ExpL_Size*sizeof(long)); |
---|
| 4385 | for(j=0;j<r->CmpL_Size;j++) |
---|
| 4386 | { |
---|
| 4387 | res->ordsgn[j] = r->ordsgn[j]; |
---|
| 4388 | } |
---|
| 4389 | res->OrdSize=r->OrdSize+1; // one block more for pSetm |
---|
| 4390 | if (r->typ!=NULL) |
---|
| 4391 | omFree((ADDRESS)res->typ); |
---|
| 4392 | res->typ=(sro_ord*)omAlloc0(res->OrdSize*sizeof(sro_ord)); |
---|
| 4393 | if (r->typ!=NULL) |
---|
| 4394 | memcpy(res->typ,r->typ,r->OrdSize*sizeof(sro_ord)); |
---|
| 4395 | // the additional block for pSetm: total degree at the last word |
---|
| 4396 | // but not included in the compare part |
---|
| 4397 | res->typ[res->OrdSize-1].ord_typ=ro_dp; |
---|
| 4398 | res->typ[res->OrdSize-1].data.dp.start=start_var; |
---|
| 4399 | res->typ[res->OrdSize-1].data.dp.end=end_var; |
---|
| 4400 | res->typ[res->OrdSize-1].data.dp.place=res->ExpL_Size-1; |
---|
| 4401 | pos=res->ExpL_Size-1; |
---|
| 4402 | //if ((start_var==1) && (end_var==res->N)) res->pOrdIndex=pos; |
---|
| 4403 | extern void p_Setm_General(poly p, ring r); |
---|
| 4404 | res->p_Setm=p_Setm_General; |
---|
| 4405 | // ---------------------------- |
---|
| 4406 | omFree((ADDRESS)res->p_Procs); |
---|
| 4407 | res->p_Procs = (p_Procs_s*)omAlloc(sizeof(p_Procs_s)); |
---|
| 4408 | |
---|
| 4409 | p_ProcsSet(res, res->p_Procs); |
---|
| 4410 | if (res->qideal!=NULL) id_Delete(&res->qideal,res); |
---|
| 4411 | #ifdef HAVE_PLURAL |
---|
| 4412 | r->GetNC()=save; |
---|
| 4413 | if (rIsPluralRing(r)) |
---|
| 4414 | { |
---|
| 4415 | if ( nc_rComplete(r, res, false) ) // no qideal! |
---|
| 4416 | { |
---|
| 4417 | #ifndef NDEBUG |
---|
| 4418 | WarnS("error in nc_rComplete"); |
---|
| 4419 | #endif |
---|
| 4420 | // just go on.. |
---|
| 4421 | } |
---|
| 4422 | } |
---|
| 4423 | #endif |
---|
| 4424 | if (r->qideal!=NULL) |
---|
| 4425 | { |
---|
| 4426 | res->qideal=idrCopyR_NoSort(r->qideal,r, res); |
---|
| 4427 | #ifdef HAVE_PLURAL |
---|
| 4428 | if (rIsPluralRing(res)) |
---|
| 4429 | { |
---|
[b388be] | 4430 | // nc_SetupQuotient(res, currRing); |
---|
| 4431 | nc_SetupQuotient(res, r); // ? |
---|
[a6904c] | 4432 | } |
---|
| 4433 | assume((res->qideal==NULL) == (r->qideal==NULL)); |
---|
| 4434 | #endif |
---|
| 4435 | } |
---|
| 4436 | |
---|
| 4437 | #ifdef HAVE_PLURAL |
---|
| 4438 | assume(rIsPluralRing(res) == rIsPluralRing(r)); |
---|
| 4439 | assume(rIsSCA(res) == rIsSCA(r)); |
---|
| 4440 | assume(ncRingType(res) == ncRingType(r)); |
---|
| 4441 | #endif |
---|
| 4442 | |
---|
| 4443 | return res; |
---|
| 4444 | } |
---|
| 4445 | |
---|
[7eb7b5] | 4446 | ring rAssure_HasComp(const ring r) |
---|
[a6904c] | 4447 | { |
---|
| 4448 | int last_block; |
---|
| 4449 | int i=0; |
---|
| 4450 | do |
---|
| 4451 | { |
---|
| 4452 | if (r->order[i] == ringorder_c || |
---|
| 4453 | r->order[i] == ringorder_C) return r; |
---|
| 4454 | if (r->order[i] == 0) |
---|
| 4455 | break; |
---|
| 4456 | i++; |
---|
| 4457 | } while (1); |
---|
| 4458 | //WarnS("re-creating ring with comps"); |
---|
| 4459 | last_block=i-1; |
---|
| 4460 | |
---|
| 4461 | ring new_r = rCopy0(r, FALSE, FALSE); |
---|
| 4462 | i+=2; |
---|
[351a5f] | 4463 | new_r->wvhdl=(int **)omAlloc0(i * sizeof(int *)); |
---|
[a6904c] | 4464 | new_r->order = (int *) omAlloc0(i * sizeof(int)); |
---|
| 4465 | new_r->block0 = (int *) omAlloc0(i * sizeof(int)); |
---|
| 4466 | new_r->block1 = (int *) omAlloc0(i * sizeof(int)); |
---|
[611871] | 4467 | memcpy(new_r->order,r->order,(i-1) * sizeof(int)); |
---|
| 4468 | memcpy(new_r->block0,r->block0,(i-1) * sizeof(int)); |
---|
| 4469 | memcpy(new_r->block1,r->block1,(i-1) * sizeof(int)); |
---|
[a6904c] | 4470 | for (int j=0; j<=last_block; j++) |
---|
| 4471 | { |
---|
| 4472 | if (r->wvhdl[j]!=NULL) |
---|
| 4473 | { |
---|
| 4474 | new_r->wvhdl[j] = (int*) omMemDup(r->wvhdl[j]); |
---|
| 4475 | } |
---|
| 4476 | } |
---|
| 4477 | last_block++; |
---|
| 4478 | new_r->order[last_block]=ringorder_C; |
---|
| 4479 | //new_r->block0[last_block]=0; |
---|
| 4480 | //new_r->block1[last_block]=0; |
---|
| 4481 | //new_r->wvhdl[last_block]=NULL; |
---|
| 4482 | |
---|
| 4483 | rComplete(new_r, 1); |
---|
| 4484 | |
---|
| 4485 | #ifdef HAVE_PLURAL |
---|
| 4486 | if (rIsPluralRing(r)) |
---|
| 4487 | { |
---|
| 4488 | if ( nc_rComplete(r, new_r, false) ) // no qideal! |
---|
| 4489 | { |
---|
| 4490 | #ifndef NDEBUG |
---|
| 4491 | WarnS("error in nc_rComplete"); // cleanup?// rDelete(res);// return r; // just go on.. |
---|
| 4492 | #endif |
---|
| 4493 | } |
---|
| 4494 | } |
---|
| 4495 | assume(rIsPluralRing(r) == rIsPluralRing(new_r)); |
---|
| 4496 | #endif |
---|
| 4497 | |
---|
| 4498 | return new_r; |
---|
| 4499 | } |
---|
| 4500 | |
---|
[2c52441] | 4501 | ring rAssure_CompLastBlock(ring r, BOOLEAN complete) |
---|
[a6904c] | 4502 | { |
---|
| 4503 | int last_block = rBlocks(r) - 2; |
---|
| 4504 | if (r->order[last_block] != ringorder_c && |
---|
| 4505 | r->order[last_block] != ringorder_C) |
---|
| 4506 | { |
---|
| 4507 | int c_pos = 0; |
---|
| 4508 | int i; |
---|
| 4509 | |
---|
| 4510 | for (i=0; i< last_block; i++) |
---|
| 4511 | { |
---|
| 4512 | if (r->order[i] == ringorder_c || r->order[i] == ringorder_C) |
---|
| 4513 | { |
---|
| 4514 | c_pos = i; |
---|
| 4515 | break; |
---|
| 4516 | } |
---|
| 4517 | } |
---|
| 4518 | if (c_pos != -1) |
---|
| 4519 | { |
---|
| 4520 | ring new_r = rCopy0(r, FALSE, TRUE); |
---|
| 4521 | for (i=c_pos+1; i<=last_block; i++) |
---|
| 4522 | { |
---|
| 4523 | new_r->order[i-1] = new_r->order[i]; |
---|
| 4524 | new_r->block0[i-1] = new_r->block0[i]; |
---|
| 4525 | new_r->block1[i-1] = new_r->block1[i]; |
---|
| 4526 | new_r->wvhdl[i-1] = new_r->wvhdl[i]; |
---|
| 4527 | } |
---|
| 4528 | new_r->order[last_block] = r->order[c_pos]; |
---|
| 4529 | new_r->block0[last_block] = r->block0[c_pos]; |
---|
| 4530 | new_r->block1[last_block] = r->block1[c_pos]; |
---|
| 4531 | new_r->wvhdl[last_block] = r->wvhdl[c_pos]; |
---|
| 4532 | if (complete) |
---|
| 4533 | { |
---|
| 4534 | rComplete(new_r, 1); |
---|
| 4535 | |
---|
| 4536 | #ifdef HAVE_PLURAL |
---|
| 4537 | if (rIsPluralRing(r)) |
---|
| 4538 | { |
---|
| 4539 | if ( nc_rComplete(r, new_r, false) ) // no qideal! |
---|
| 4540 | { |
---|
| 4541 | #ifndef NDEBUG |
---|
| 4542 | WarnS("error in nc_rComplete"); // cleanup?// rDelete(res);// return r; // just go on.. |
---|
| 4543 | #endif |
---|
| 4544 | } |
---|
| 4545 | } |
---|
| 4546 | assume(rIsPluralRing(r) == rIsPluralRing(new_r)); |
---|
| 4547 | #endif |
---|
| 4548 | } |
---|
| 4549 | return new_r; |
---|
| 4550 | } |
---|
| 4551 | } |
---|
| 4552 | return r; |
---|
| 4553 | } |
---|
| 4554 | |
---|
| 4555 | // Moves _c or _C ordering to the last place AND adds _s on the 1st place |
---|
[2c52441] | 4556 | ring rAssure_SyzComp_CompLastBlock(const ring r, BOOLEAN) |
---|
[a6904c] | 4557 | { |
---|
[2c52441] | 4558 | rTest(r); |
---|
| 4559 | |
---|
[7eb7b5] | 4560 | ring new_r_1 = rAssure_CompLastBlock(r, FALSE); // due to this FALSE - no completion! |
---|
[a6904c] | 4561 | ring new_r = rAssure_SyzComp(new_r_1, FALSE); // new_r_1 is used only here!!! |
---|
| 4562 | |
---|
[2c52441] | 4563 | if (new_r == r) |
---|
| 4564 | return r; |
---|
| 4565 | |
---|
| 4566 | ring old_r = r; |
---|
| 4567 | if (new_r_1 != new_r && new_r_1 != old_r) rDelete(new_r_1); |
---|
| 4568 | |
---|
| 4569 | rComplete(new_r, 1); |
---|
[a6904c] | 4570 | #ifdef HAVE_PLURAL |
---|
[2c52441] | 4571 | if (rIsPluralRing(old_r)) |
---|
| 4572 | { |
---|
| 4573 | if ( nc_rComplete(old_r, new_r, false) ) // no qideal! |
---|
| 4574 | { |
---|
| 4575 | # ifndef NDEBUG |
---|
| 4576 | WarnS("error in nc_rComplete"); // cleanup? rDelete(res); return r; // just go on...? |
---|
| 4577 | # endif |
---|
| 4578 | } |
---|
| 4579 | } |
---|
[a6904c] | 4580 | #endif |
---|
[2c52441] | 4581 | |
---|
[b388be] | 4582 | ///? rChangeCurrRing(new_r); |
---|
[2c52441] | 4583 | if (old_r->qideal != NULL) |
---|
| 4584 | { |
---|
[8e0bf8] | 4585 | new_r->qideal = idrCopyR(old_r->qideal, old_r, new_r); |
---|
[7eb7b5] | 4586 | //currQuotient = new_r->qideal; |
---|
[2c52441] | 4587 | } |
---|
[a6904c] | 4588 | |
---|
| 4589 | #ifdef HAVE_PLURAL |
---|
[2c52441] | 4590 | if( rIsPluralRing(old_r) ) |
---|
| 4591 | if( nc_SetupQuotient(new_r, old_r, true) ) |
---|
| 4592 | { |
---|
[a6904c] | 4593 | #ifndef NDEBUG |
---|
[2c52441] | 4594 | WarnS("error in nc_SetupQuotient"); // cleanup? rDelete(res); return r; // just go on...? |
---|
[a6904c] | 4595 | #endif |
---|
[2c52441] | 4596 | } |
---|
[a6904c] | 4597 | #endif |
---|
| 4598 | |
---|
| 4599 | #ifdef HAVE_PLURAL |
---|
[2c52441] | 4600 | assume((new_r->qideal==NULL) == (old_r->qideal==NULL)); |
---|
| 4601 | assume(rIsPluralRing(new_r) == rIsPluralRing(old_r)); |
---|
| 4602 | assume(rIsSCA(new_r) == rIsSCA(old_r)); |
---|
| 4603 | assume(ncRingType(new_r) == ncRingType(old_r)); |
---|
[a6904c] | 4604 | #endif |
---|
[2c52441] | 4605 | |
---|
| 4606 | rTest(new_r); |
---|
| 4607 | rTest(old_r); |
---|
| 4608 | return new_r; |
---|
[a6904c] | 4609 | } |
---|
| 4610 | |
---|
| 4611 | // use this for global orderings consisting of two blocks |
---|
[7eb7b5] | 4612 | static ring rAssure_Global(rRingOrder_t b1, rRingOrder_t b2, const ring r) |
---|
[a6904c] | 4613 | { |
---|
[7eb7b5] | 4614 | int r_blocks = rBlocks(r); |
---|
[a6904c] | 4615 | |
---|
| 4616 | assume(b1 == ringorder_c || b1 == ringorder_C || |
---|
| 4617 | b2 == ringorder_c || b2 == ringorder_C || |
---|
| 4618 | b2 == ringorder_S); |
---|
| 4619 | if ((r_blocks == 3) && |
---|
[7eb7b5] | 4620 | (r->order[0] == b1) && |
---|
| 4621 | (r->order[1] == b2) && |
---|
| 4622 | (r->order[2] == 0)) |
---|
| 4623 | return r; |
---|
| 4624 | ring res = rCopy0(r, TRUE, FALSE); |
---|
[a6904c] | 4625 | res->order = (int*)omAlloc0(3*sizeof(int)); |
---|
| 4626 | res->block0 = (int*)omAlloc0(3*sizeof(int)); |
---|
| 4627 | res->block1 = (int*)omAlloc0(3*sizeof(int)); |
---|
| 4628 | res->wvhdl = (int**)omAlloc0(3*sizeof(int*)); |
---|
| 4629 | res->order[0] = b1; |
---|
| 4630 | res->order[1] = b2; |
---|
| 4631 | if (b1 == ringorder_c || b1 == ringorder_C) |
---|
| 4632 | { |
---|
| 4633 | res->block0[1] = 1; |
---|
[7eb7b5] | 4634 | res->block1[1] = r->N; |
---|
[a6904c] | 4635 | } |
---|
| 4636 | else |
---|
| 4637 | { |
---|
| 4638 | res->block0[0] = 1; |
---|
[7eb7b5] | 4639 | res->block1[0] = r->N; |
---|
[a6904c] | 4640 | } |
---|
| 4641 | // HANNES: This sould be set in rComplete |
---|
| 4642 | res->OrdSgn = 1; |
---|
| 4643 | rComplete(res, 1); |
---|
| 4644 | #ifdef HAVE_PLURAL |
---|
[7eb7b5] | 4645 | if (rIsPluralRing(r)) |
---|
[a6904c] | 4646 | { |
---|
[7eb7b5] | 4647 | if ( nc_rComplete(r, res, false) ) // no qideal! |
---|
[a6904c] | 4648 | { |
---|
| 4649 | #ifndef NDEBUG |
---|
| 4650 | WarnS("error in nc_rComplete"); |
---|
| 4651 | #endif |
---|
| 4652 | } |
---|
| 4653 | } |
---|
| 4654 | #endif |
---|
[b388be] | 4655 | // rChangeCurrRing(res); |
---|
[a6904c] | 4656 | return res; |
---|
| 4657 | } |
---|
| 4658 | |
---|
| 4659 | ring rAssure_InducedSchreyerOrdering(const ring r, BOOLEAN complete = TRUE, int sgn = 1) |
---|
| 4660 | { // TODO: ???? Add leading Syz-comp ordering here...???? |
---|
| 4661 | |
---|
| 4662 | #if MYTEST |
---|
| 4663 | Print("rAssure_InducedSchreyerOrdering(r, complete = %d, sgn = %d): r: \n", complete, sgn); |
---|
| 4664 | rWrite(r); |
---|
| 4665 | #ifdef RDEBUG |
---|
| 4666 | rDebugPrint(r); |
---|
| 4667 | #endif |
---|
| 4668 | PrintLn(); |
---|
| 4669 | #endif |
---|
[273fed] | 4670 | assume((sgn == 1) || (sgn == -1)); |
---|
[a6904c] | 4671 | |
---|
| 4672 | ring res=rCopy0(r, FALSE, FALSE); // No qideal & ordering copy. |
---|
| 4673 | |
---|
| 4674 | int n = rBlocks(r); // Including trailing zero! |
---|
| 4675 | |
---|
| 4676 | // Create 2 more blocks for prefix/suffix: |
---|
| 4677 | res->order=(int *)omAlloc0((n+2)*sizeof(int)); // 0 .. n+1 |
---|
| 4678 | res->block0=(int *)omAlloc0((n+2)*sizeof(int)); |
---|
| 4679 | res->block1=(int *)omAlloc0((n+2)*sizeof(int)); |
---|
| 4680 | int ** wvhdl =(int **)omAlloc0((n+2)*sizeof(int**)); |
---|
| 4681 | |
---|
| 4682 | // Encapsulate all existing blocks between induced Schreyer ordering markers: prefix and suffix! |
---|
| 4683 | // Note that prefix and suffix have the same ringorder marker and only differ in block[] parameters! |
---|
| 4684 | |
---|
| 4685 | // new 1st block |
---|
| 4686 | int j = 0; |
---|
| 4687 | res->order[j] = ringorder_IS; // Prefix |
---|
[273fed] | 4688 | res->block0[j] = res->block1[j] = 0; |
---|
[a6904c] | 4689 | // wvhdl[j] = NULL; |
---|
| 4690 | j++; |
---|
| 4691 | |
---|
| 4692 | for(int i = 0; (i <= n) && (r->order[i] != 0); i++, j++) // i = [0 .. n-1] <- non-zero old blocks |
---|
| 4693 | { |
---|
| 4694 | res->order [j] = r->order [i]; |
---|
| 4695 | res->block0[j] = r->block0[i]; |
---|
| 4696 | res->block1[j] = r->block1[i]; |
---|
| 4697 | |
---|
| 4698 | if (r->wvhdl[i] != NULL) |
---|
| 4699 | { |
---|
| 4700 | wvhdl[j] = (int*) omMemDup(r->wvhdl[i]); |
---|
| 4701 | } // else wvhdl[j] = NULL; |
---|
| 4702 | } |
---|
| 4703 | |
---|
| 4704 | // new last block |
---|
| 4705 | res->order [j] = ringorder_IS; // Suffix |
---|
| 4706 | res->block0[j] = res->block1[j] = sgn; // Sign of v[o]: 1 for C, -1 for c |
---|
| 4707 | // wvhdl[j] = NULL; |
---|
| 4708 | j++; |
---|
| 4709 | |
---|
| 4710 | // res->order [j] = 0; // The End! |
---|
| 4711 | res->wvhdl = wvhdl; |
---|
| 4712 | |
---|
| 4713 | // j == the last zero block now! |
---|
| 4714 | assume(j == (n+1)); |
---|
| 4715 | assume(res->order[0]==ringorder_IS); |
---|
| 4716 | assume(res->order[j-1]==ringorder_IS); |
---|
| 4717 | assume(res->order[j]==0); |
---|
| 4718 | |
---|
| 4719 | |
---|
| 4720 | if (complete) |
---|
| 4721 | { |
---|
| 4722 | rComplete(res, 1); |
---|
| 4723 | |
---|
| 4724 | #ifdef HAVE_PLURAL |
---|
| 4725 | if (rIsPluralRing(r)) |
---|
| 4726 | { |
---|
| 4727 | if ( nc_rComplete(r, res, false) ) // no qideal! |
---|
| 4728 | { |
---|
| 4729 | #ifndef NDEBUG |
---|
| 4730 | WarnS("error in nc_rComplete"); // cleanup?// rDelete(res);// return r; // just go on.. |
---|
| 4731 | #endif |
---|
| 4732 | } |
---|
| 4733 | } |
---|
| 4734 | assume(rIsPluralRing(r) == rIsPluralRing(res)); |
---|
| 4735 | #endif |
---|
| 4736 | |
---|
| 4737 | |
---|
| 4738 | #ifdef HAVE_PLURAL |
---|
| 4739 | ring old_ring = r; |
---|
| 4740 | #endif |
---|
| 4741 | |
---|
| 4742 | if (r->qideal!=NULL) |
---|
| 4743 | { |
---|
| 4744 | res->qideal= idrCopyR_NoSort(r->qideal, r, res); |
---|
| 4745 | |
---|
[f7a975] | 4746 | assume(id_RankFreeModule(res->qideal, res) == 0); |
---|
[a6904c] | 4747 | |
---|
| 4748 | #ifdef HAVE_PLURAL |
---|
| 4749 | if( rIsPluralRing(res) ) |
---|
| 4750 | if( nc_SetupQuotient(res, r, true) ) |
---|
| 4751 | { |
---|
| 4752 | // WarnS("error in nc_SetupQuotient"); // cleanup? rDelete(res); return r; // just go on...? |
---|
| 4753 | } |
---|
| 4754 | |
---|
| 4755 | #endif |
---|
[f7a975] | 4756 | assume(id_RankFreeModule(res->qideal, res) == 0); |
---|
[a6904c] | 4757 | } |
---|
| 4758 | |
---|
| 4759 | #ifdef HAVE_PLURAL |
---|
| 4760 | assume((res->qideal==NULL) == (old_ring->qideal==NULL)); |
---|
| 4761 | assume(rIsPluralRing(res) == rIsPluralRing(old_ring)); |
---|
| 4762 | assume(rIsSCA(res) == rIsSCA(old_ring)); |
---|
| 4763 | assume(ncRingType(res) == ncRingType(old_ring)); |
---|
| 4764 | #endif |
---|
| 4765 | } |
---|
| 4766 | |
---|
| 4767 | return res; |
---|
| 4768 | } |
---|
| 4769 | |
---|
[7eb7b5] | 4770 | ring rAssure_dp_S(const ring r) |
---|
[a6904c] | 4771 | { |
---|
[7eb7b5] | 4772 | return rAssure_Global(ringorder_dp, ringorder_S,r); |
---|
[a6904c] | 4773 | } |
---|
| 4774 | |
---|
[7eb7b5] | 4775 | ring rAssure_dp_C(const ring r) |
---|
[a6904c] | 4776 | { |
---|
[7eb7b5] | 4777 | return rAssure_Global(ringorder_dp, ringorder_C,r); |
---|
[a6904c] | 4778 | } |
---|
| 4779 | |
---|
[7eb7b5] | 4780 | ring rAssure_C_dp(const ring r) |
---|
[a6904c] | 4781 | { |
---|
[7eb7b5] | 4782 | return rAssure_Global(ringorder_C, ringorder_dp,r); |
---|
[a6904c] | 4783 | } |
---|
| 4784 | |
---|
[273fed] | 4785 | |
---|
| 4786 | |
---|
| 4787 | /// Finds p^th IS ordering, and returns its position in r->typ[] |
---|
| 4788 | /// returns -1 if something went wrong! |
---|
[028192] | 4789 | int rGetISPos(const int p, const ring r) |
---|
[273fed] | 4790 | { |
---|
| 4791 | // Put the reference set F into the ring -ordering -recor |
---|
| 4792 | #if MYTEST |
---|
| 4793 | Print("rIsIS(p: %d)\nF:", p); |
---|
| 4794 | PrintLn(); |
---|
| 4795 | #endif |
---|
| 4796 | |
---|
| 4797 | if (r->typ==NULL) |
---|
| 4798 | { |
---|
| 4799 | dReportError("'rIsIS:' Error: wrong ring! (typ == NULL)"); |
---|
| 4800 | return -1; |
---|
| 4801 | } |
---|
| 4802 | |
---|
| 4803 | int j = p; // Which IS record to use... |
---|
| 4804 | for( int pos = 0; pos < r->OrdSize; pos++ ) |
---|
| 4805 | if( r->typ[pos].ord_typ == ro_is) |
---|
| 4806 | if( j-- == 0 ) |
---|
| 4807 | { |
---|
| 4808 | return pos; |
---|
| 4809 | } |
---|
| 4810 | |
---|
| 4811 | return -1; |
---|
| 4812 | } |
---|
| 4813 | |
---|
| 4814 | |
---|
| 4815 | |
---|
| 4816 | |
---|
| 4817 | |
---|
| 4818 | |
---|
[a6904c] | 4819 | /// Changes r by setting induced ordering parameters: limit and reference leading terms |
---|
| 4820 | /// F belong to r, we will DO a copy! (same to componentWeights) |
---|
| 4821 | /// We will use it AS IS! |
---|
| 4822 | /// returns true is everything was allright! |
---|
[13366d] | 4823 | BOOLEAN rSetISReference(const ring r, const ideal F, const int i, const int p, const intvec * componentWeights) |
---|
[a6904c] | 4824 | { |
---|
| 4825 | // Put the reference set F into the ring -ordering -recor |
---|
| 4826 | |
---|
| 4827 | // TEST THAT THERE ARE DEGs!!! |
---|
| 4828 | // assume( componentWeights == NULL ); // ??? |
---|
| 4829 | if( componentWeights != NULL ) |
---|
| 4830 | { |
---|
| 4831 | // assure that the ring r has degrees!!! |
---|
| 4832 | // Add weights to degrees of F[i] |
---|
| 4833 | } |
---|
| 4834 | |
---|
| 4835 | if (r->typ==NULL) |
---|
| 4836 | { |
---|
| 4837 | dReportError("Error: WRONG USE of rSetISReference: wrong ring! (typ == NULL)"); |
---|
[13366d] | 4838 | return FALSE; |
---|
[a6904c] | 4839 | } |
---|
| 4840 | |
---|
[273fed] | 4841 | |
---|
| 4842 | int pos = rGetISPos(p, r); |
---|
| 4843 | |
---|
| 4844 | if( pos == -1 ) |
---|
| 4845 | { |
---|
| 4846 | dReportError("Error: WRONG USE of rSetISReference: specified ordering block was not found!!!" ); |
---|
[13366d] | 4847 | return FALSE; |
---|
[273fed] | 4848 | } |
---|
| 4849 | |
---|
[a6904c] | 4850 | #if MYTEST |
---|
[273fed] | 4851 | if( i != r->typ[pos].data.is.limit ) |
---|
| 4852 | Print("Changing record on pos: %d\nOld limit: %d --->> New Limit: %d\n", pos, r->typ[pos].data.is.limit, i); |
---|
[a6904c] | 4853 | #endif |
---|
| 4854 | |
---|
[273fed] | 4855 | const ideal FF = id_Copy(F, r); // idrHeadR(F, r, r); |
---|
[a6904c] | 4856 | |
---|
| 4857 | |
---|
[273fed] | 4858 | if( r->typ[pos].data.is.F != NULL) |
---|
| 4859 | { |
---|
[a6904c] | 4860 | #if MYTEST |
---|
[273fed] | 4861 | PrintS("Deleting old reference set F... \n"); // idShow(r->typ[pos].data.is.F, r); PrintLn(); |
---|
[a6904c] | 4862 | #endif |
---|
[273fed] | 4863 | id_Delete(&r->typ[pos].data.is.F, r); |
---|
| 4864 | r->typ[pos].data.is.F = NULL; |
---|
| 4865 | } |
---|
[a6904c] | 4866 | |
---|
[273fed] | 4867 | assume(r->typ[pos].data.is.F == NULL); |
---|
[a6904c] | 4868 | |
---|
[273fed] | 4869 | r->typ[pos].data.is.F = FF; // F is owened by ring now! TODO: delete at the end! |
---|
[a6904c] | 4870 | |
---|
[273fed] | 4871 | if(r->typ[pos].data.is.componentWeights != NULL) |
---|
| 4872 | { |
---|
[a6904c] | 4873 | #if MYTEST |
---|
[273fed] | 4874 | PrintS("Deleting old componentWeights: "); r->typ[pos].data.is.componentWeights->show(); PrintLn(); |
---|
[a6904c] | 4875 | #endif |
---|
[273fed] | 4876 | delete r->typ[pos].data.is.componentWeights; |
---|
| 4877 | r->typ[pos].data.is.componentWeights = NULL; |
---|
| 4878 | } |
---|
[a6904c] | 4879 | |
---|
| 4880 | |
---|
[273fed] | 4881 | assume(r->typ[pos].data.is.componentWeights == NULL); |
---|
[a6904c] | 4882 | |
---|
[273fed] | 4883 | if( componentWeights != NULL ) |
---|
| 4884 | componentWeights = ivCopy(componentWeights); // componentWeights is owened by ring now! TODO: delete at the end! |
---|
[a6904c] | 4885 | |
---|
[273fed] | 4886 | r->typ[pos].data.is.componentWeights = componentWeights; |
---|
[a6904c] | 4887 | |
---|
[273fed] | 4888 | r->typ[pos].data.is.limit = i; // First induced component |
---|
[a6904c] | 4889 | |
---|
| 4890 | #if MYTEST |
---|
[273fed] | 4891 | PrintS("New reference set FF : \n"); idShow(FF, r, r, 1); PrintLn(); |
---|
[a6904c] | 4892 | #endif |
---|
| 4893 | |
---|
[13366d] | 4894 | return TRUE; |
---|
[a6904c] | 4895 | } |
---|
| 4896 | |
---|
| 4897 | |
---|
[8e0bf8] | 4898 | void rSetSyzComp(int k, const ring r) |
---|
[a6904c] | 4899 | { |
---|
[273fed] | 4900 | if(k < 0) |
---|
| 4901 | { |
---|
| 4902 | dReportError("rSetSyzComp with negative limit!"); |
---|
| 4903 | return; |
---|
| 4904 | } |
---|
| 4905 | |
---|
| 4906 | assume( k >= 0 ); |
---|
[a6904c] | 4907 | if (TEST_OPT_PROT) Print("{%d}", k); |
---|
[8e0bf8] | 4908 | if ((r->typ!=NULL) && (r->typ[0].ord_typ==ro_syz)) |
---|
[a6904c] | 4909 | { |
---|
[8e0bf8] | 4910 | if( k == r->typ[0].data.syz.limit ) |
---|
[273fed] | 4911 | return; // nothing to do |
---|
| 4912 | |
---|
[a6904c] | 4913 | int i; |
---|
[8e0bf8] | 4914 | if (r->typ[0].data.syz.limit == 0) |
---|
[a6904c] | 4915 | { |
---|
[8e0bf8] | 4916 | r->typ[0].data.syz.syz_index = (int*) omAlloc0((k+1)*sizeof(int)); |
---|
| 4917 | r->typ[0].data.syz.syz_index[0] = 0; |
---|
| 4918 | r->typ[0].data.syz.curr_index = 1; |
---|
[a6904c] | 4919 | } |
---|
| 4920 | else |
---|
| 4921 | { |
---|
[8e0bf8] | 4922 | r->typ[0].data.syz.syz_index = (int*) |
---|
| 4923 | omReallocSize(r->typ[0].data.syz.syz_index, |
---|
| 4924 | (r->typ[0].data.syz.limit+1)*sizeof(int), |
---|
[a6904c] | 4925 | (k+1)*sizeof(int)); |
---|
| 4926 | } |
---|
[8e0bf8] | 4927 | for (i=r->typ[0].data.syz.limit + 1; i<= k; i++) |
---|
[a6904c] | 4928 | { |
---|
[8e0bf8] | 4929 | r->typ[0].data.syz.syz_index[i] = |
---|
| 4930 | r->typ[0].data.syz.curr_index; |
---|
[a6904c] | 4931 | } |
---|
[8e0bf8] | 4932 | if(k < r->typ[0].data.syz.limit) // ? |
---|
[273fed] | 4933 | { |
---|
| 4934 | #ifndef NDEBUG |
---|
[8e0bf8] | 4935 | Warn("rSetSyzComp called with smaller limit (%d) as before (%d)", k, r->typ[0].data.syz.limit); |
---|
[273fed] | 4936 | #endif |
---|
[8e0bf8] | 4937 | r->typ[0].data.syz.curr_index = 1 + r->typ[0].data.syz.syz_index[k]; |
---|
[273fed] | 4938 | } |
---|
| 4939 | |
---|
| 4940 | |
---|
[8e0bf8] | 4941 | r->typ[0].data.syz.limit = k; |
---|
| 4942 | r->typ[0].data.syz.curr_index++; |
---|
[a6904c] | 4943 | } |
---|
| 4944 | else if( |
---|
[8e0bf8] | 4945 | (r->typ!=NULL) && |
---|
| 4946 | (r->typ[0].ord_typ==ro_isTemp) |
---|
[a6904c] | 4947 | ) |
---|
| 4948 | { |
---|
[8e0bf8] | 4949 | // (r->typ[currRing->typ[0].data.isTemp.suffixpos].data.is.limit == k) |
---|
[a6904c] | 4950 | #ifndef NDEBUG |
---|
| 4951 | Warn("rSetSyzComp(%d) in an IS ring! Be careful!", k); |
---|
| 4952 | #endif |
---|
| 4953 | } |
---|
| 4954 | else |
---|
[8e0bf8] | 4955 | if ((r->order[0]!=ringorder_c) && (k!=0)) // ??? |
---|
[a6904c] | 4956 | { |
---|
| 4957 | dReportError("syzcomp in incompatible ring"); |
---|
| 4958 | } |
---|
| 4959 | #ifdef PDEBUG |
---|
| 4960 | extern int pDBsyzComp; |
---|
| 4961 | pDBsyzComp=k; |
---|
| 4962 | #endif |
---|
| 4963 | } |
---|
| 4964 | |
---|
| 4965 | // return the max-comonent wchich has syzIndex i |
---|
[1389a4] | 4966 | int rGetMaxSyzComp(int i, const ring r) |
---|
[a6904c] | 4967 | { |
---|
[1389a4] | 4968 | if ((r->typ!=NULL) && (r->typ[0].ord_typ==ro_syz) && |
---|
| 4969 | r->typ[0].data.syz.limit > 0 && i > 0) |
---|
[a6904c] | 4970 | { |
---|
[1389a4] | 4971 | assume(i <= r->typ[0].data.syz.limit); |
---|
[a6904c] | 4972 | int j; |
---|
[1389a4] | 4973 | for (j=0; j<r->typ[0].data.syz.limit; j++) |
---|
[a6904c] | 4974 | { |
---|
[1389a4] | 4975 | if (r->typ[0].data.syz.syz_index[j] == i && |
---|
| 4976 | r->typ[0].data.syz.syz_index[j+1] != i) |
---|
[a6904c] | 4977 | { |
---|
[1389a4] | 4978 | assume(r->typ[0].data.syz.syz_index[j+1] == i+1); |
---|
[a6904c] | 4979 | return j; |
---|
| 4980 | } |
---|
| 4981 | } |
---|
[1389a4] | 4982 | return r->typ[0].data.syz.limit; |
---|
[a6904c] | 4983 | } |
---|
| 4984 | else |
---|
| 4985 | { |
---|
| 4986 | return 0; |
---|
| 4987 | } |
---|
| 4988 | } |
---|
| 4989 | |
---|
| 4990 | BOOLEAN rRing_is_Homog(ring r) |
---|
| 4991 | { |
---|
| 4992 | if (r == NULL) return FALSE; |
---|
| 4993 | int i, j, nb = rBlocks(r); |
---|
| 4994 | for (i=0; i<nb; i++) |
---|
| 4995 | { |
---|
| 4996 | if (r->wvhdl[i] != NULL) |
---|
| 4997 | { |
---|
| 4998 | int length = r->block1[i] - r->block0[i]; |
---|
| 4999 | int* wvhdl = r->wvhdl[i]; |
---|
| 5000 | if (r->order[i] == ringorder_M) length *= length; |
---|
| 5001 | assume(omSizeOfAddr(wvhdl) >= length*sizeof(int)); |
---|
| 5002 | |
---|
| 5003 | for (j=0; j< length; j++) |
---|
| 5004 | { |
---|
| 5005 | if (wvhdl[j] != 0 && wvhdl[j] != 1) return FALSE; |
---|
| 5006 | } |
---|
| 5007 | } |
---|
| 5008 | } |
---|
| 5009 | return TRUE; |
---|
| 5010 | } |
---|
| 5011 | |
---|
| 5012 | BOOLEAN rRing_has_CompLastBlock(ring r) |
---|
| 5013 | { |
---|
| 5014 | assume(r != NULL); |
---|
| 5015 | int lb = rBlocks(r) - 2; |
---|
| 5016 | return (r->order[lb] == ringorder_c || r->order[lb] == ringorder_C); |
---|
| 5017 | } |
---|
| 5018 | |
---|
| 5019 | n_coeffType rFieldType(ring r) |
---|
| 5020 | { |
---|
[dd012ca] | 5021 | return (r->cf->type); |
---|
[a6904c] | 5022 | if (rField_is_Zp(r)) return n_Zp; |
---|
| 5023 | if (rField_is_Q(r)) return n_Q; |
---|
| 5024 | if (rField_is_R(r)) return n_R; |
---|
| 5025 | if (rField_is_GF(r)) return n_GF; |
---|
| 5026 | if (rField_is_long_R(r)) return n_long_R; |
---|
[141342] | 5027 | if (rField_is_Zp_a(r)) return getCoeffType(r->cf); |
---|
| 5028 | if (rField_is_Q_a(r)) return getCoeffType(r->cf); |
---|
[a6904c] | 5029 | if (rField_is_long_C(r)) return n_long_C; |
---|
| 5030 | #ifdef HAVE_RINGS |
---|
| 5031 | if (rField_is_Ring_Z(r)) return n_Z; |
---|
[351a5f] | 5032 | if (rField_is_Ring_ModN(r)) return n_Zn; |
---|
[a6904c] | 5033 | if (rField_is_Ring_PtoM(r)) return n_Zpn; |
---|
[351a5f] | 5034 | if (rField_is_Ring_2toM(r)) return n_Z2m; |
---|
[a6904c] | 5035 | #endif |
---|
| 5036 | |
---|
| 5037 | return n_unknown; |
---|
| 5038 | } |
---|
| 5039 | |
---|
| 5040 | int64 * rGetWeightVec(ring r) |
---|
| 5041 | { |
---|
| 5042 | assume(r!=NULL); |
---|
| 5043 | assume(r->OrdSize>0); |
---|
| 5044 | int i=0; |
---|
| 5045 | while((r->typ[i].ord_typ!=ro_wp64) && (r->typ[i].ord_typ>0)) i++; |
---|
| 5046 | assume(r->typ[i].ord_typ==ro_wp64); |
---|
| 5047 | return (int64*)(r->typ[i].data.wp64.weights64); |
---|
| 5048 | } |
---|
| 5049 | |
---|
| 5050 | void rSetWeightVec(ring r, int64 *wv) |
---|
| 5051 | { |
---|
| 5052 | assume(r!=NULL); |
---|
| 5053 | assume(r->OrdSize>0); |
---|
| 5054 | assume(r->typ[0].ord_typ==ro_wp64); |
---|
| 5055 | memcpy(r->typ[0].data.wp64.weights64,wv,r->N*sizeof(int64)); |
---|
| 5056 | } |
---|
| 5057 | |
---|
| 5058 | #include <ctype.h> |
---|
| 5059 | |
---|
[bbcf1d2] | 5060 | static int rRealloc1(ring r, int size, int pos) |
---|
[a6904c] | 5061 | { |
---|
| 5062 | r->order=(int*)omReallocSize(r->order, size*sizeof(int), (size+1)*sizeof(int)); |
---|
| 5063 | r->block0=(int*)omReallocSize(r->block0, size*sizeof(int), (size+1)*sizeof(int)); |
---|
| 5064 | r->block1=(int*)omReallocSize(r->block1, size*sizeof(int), (size+1)*sizeof(int)); |
---|
[351a5f] | 5065 | r->wvhdl=(int **)omReallocSize(r->wvhdl,size*sizeof(int *), (size+1)*sizeof(int *)); |
---|
[a6904c] | 5066 | for(int k=size; k>pos; k--) r->wvhdl[k]=r->wvhdl[k-1]; |
---|
| 5067 | r->order[size]=0; |
---|
| 5068 | size++; |
---|
| 5069 | return size; |
---|
| 5070 | } |
---|
[9bb5457] | 5071 | #if 0 // currently unused |
---|
| 5072 | static int rReallocM1(ring r, int size, int pos) |
---|
| 5073 | { |
---|
| 5074 | r->order=(int*)omReallocSize(r->order, size*sizeof(int), (size-1)*sizeof(int)); |
---|
| 5075 | r->block0=(int*)omReallocSize(r->block0, size*sizeof(int), (size-1)*sizeof(int)); |
---|
| 5076 | r->block1=(int*)omReallocSize(r->block1, size*sizeof(int), (size-1)*sizeof(int)); |
---|
| 5077 | r->wvhdl=(int **)omReallocSize(r->wvhdl,size*sizeof(int *), (size-1)*sizeof(int *)); |
---|
| 5078 | for(int k=pos+1; k<size; k++) r->wvhdl[k]=r->wvhdl[k+1]; |
---|
| 5079 | size--; |
---|
| 5080 | return size; |
---|
| 5081 | } |
---|
| 5082 | #endif |
---|
[a6904c] | 5083 | static void rOppWeight(int *w, int l) |
---|
| 5084 | { |
---|
| 5085 | int i2=(l+1)/2; |
---|
| 5086 | for(int j=0; j<=i2; j++) |
---|
| 5087 | { |
---|
| 5088 | int t=w[j]; |
---|
| 5089 | w[j]=w[l-j]; |
---|
| 5090 | w[l-j]=t; |
---|
| 5091 | } |
---|
| 5092 | } |
---|
| 5093 | |
---|
| 5094 | #define rOppVar(R,I) (rVar(R)+1-I) |
---|
| 5095 | |
---|
| 5096 | ring rOpposite(ring src) |
---|
| 5097 | /* creates an opposite algebra of R */ |
---|
| 5098 | /* that is R^opp, where f (*^opp) g = g*f */ |
---|
| 5099 | /* treats the case of qring */ |
---|
| 5100 | { |
---|
| 5101 | if (src == NULL) return(NULL); |
---|
| 5102 | |
---|
| 5103 | #ifdef RDEBUG |
---|
| 5104 | rTest(src); |
---|
| 5105 | #endif |
---|
| 5106 | |
---|
[1389a4] | 5107 | //rChangeCurrRing(src); |
---|
[a6904c] | 5108 | |
---|
| 5109 | #ifdef RDEBUG |
---|
| 5110 | rTest(src); |
---|
| 5111 | // rWrite(src); |
---|
| 5112 | // rDebugPrint(src); |
---|
| 5113 | #endif |
---|
| 5114 | |
---|
| 5115 | |
---|
| 5116 | ring r = rCopy0(src,FALSE); /* qideal will be deleted later on!!! */ |
---|
| 5117 | |
---|
| 5118 | // change vars v1..vN -> vN..v1 |
---|
| 5119 | int i; |
---|
| 5120 | int i2 = (rVar(r)-1)/2; |
---|
| 5121 | for(i=i2; i>=0; i--) |
---|
| 5122 | { |
---|
| 5123 | // index: 0..N-1 |
---|
| 5124 | //Print("ex var names: %d <-> %d\n",i,rOppVar(r,i)); |
---|
| 5125 | // exchange names |
---|
| 5126 | char *p; |
---|
| 5127 | p = r->names[rVar(r)-1-i]; |
---|
| 5128 | r->names[rVar(r)-1-i] = r->names[i]; |
---|
| 5129 | r->names[i] = p; |
---|
| 5130 | } |
---|
| 5131 | // i2=(rVar(r)+1)/2; |
---|
| 5132 | // for(int i=i2; i>0; i--) |
---|
| 5133 | // { |
---|
| 5134 | // // index: 1..N |
---|
| 5135 | // //Print("ex var places: %d <-> %d\n",i,rVar(r)+1-i); |
---|
| 5136 | // // exchange VarOffset |
---|
| 5137 | // int t; |
---|
| 5138 | // t=r->VarOffset[i]; |
---|
| 5139 | // r->VarOffset[i]=r->VarOffset[rOppVar(r,i)]; |
---|
| 5140 | // r->VarOffset[rOppVar(r,i)]=t; |
---|
| 5141 | // } |
---|
| 5142 | // change names: |
---|
| 5143 | for (i=rVar(r)-1; i>=0; i--) |
---|
| 5144 | { |
---|
| 5145 | char *p=r->names[i]; |
---|
| 5146 | if(isupper(*p)) *p = tolower(*p); |
---|
| 5147 | else *p = toupper(*p); |
---|
| 5148 | } |
---|
| 5149 | // change ordering: listing |
---|
| 5150 | // change ordering: compare |
---|
| 5151 | // for(i=0; i<r->OrdSize; i++) |
---|
| 5152 | // { |
---|
| 5153 | // int t,tt; |
---|
| 5154 | // switch(r->typ[i].ord_typ) |
---|
| 5155 | // { |
---|
| 5156 | // case ro_dp: |
---|
| 5157 | // // |
---|
| 5158 | // t=r->typ[i].data.dp.start; |
---|
| 5159 | // r->typ[i].data.dp.start=rOppVar(r,r->typ[i].data.dp.end); |
---|
| 5160 | // r->typ[i].data.dp.end=rOppVar(r,t); |
---|
| 5161 | // break; |
---|
| 5162 | // case ro_wp: |
---|
| 5163 | // case ro_wp_neg: |
---|
| 5164 | // { |
---|
| 5165 | // t=r->typ[i].data.wp.start; |
---|
| 5166 | // r->typ[i].data.wp.start=rOppVar(r,r->typ[i].data.wp.end); |
---|
| 5167 | // r->typ[i].data.wp.end=rOppVar(r,t); |
---|
| 5168 | // // invert r->typ[i].data.wp.weights |
---|
| 5169 | // rOppWeight(r->typ[i].data.wp.weights, |
---|
| 5170 | // r->typ[i].data.wp.end-r->typ[i].data.wp.start); |
---|
| 5171 | // break; |
---|
| 5172 | // } |
---|
| 5173 | // //case ro_wp64: |
---|
| 5174 | // case ro_syzcomp: |
---|
| 5175 | // case ro_syz: |
---|
| 5176 | // WerrorS("not implemented in rOpposite"); |
---|
| 5177 | // // should not happen |
---|
| 5178 | // break; |
---|
| 5179 | // |
---|
| 5180 | // case ro_cp: |
---|
| 5181 | // t=r->typ[i].data.cp.start; |
---|
| 5182 | // r->typ[i].data.cp.start=rOppVar(r,r->typ[i].data.cp.end); |
---|
| 5183 | // r->typ[i].data.cp.end=rOppVar(r,t); |
---|
| 5184 | // break; |
---|
| 5185 | // case ro_none: |
---|
| 5186 | // default: |
---|
| 5187 | // Werror("unknown type in rOpposite(%d)",r->typ[i].ord_typ); |
---|
| 5188 | // break; |
---|
| 5189 | // } |
---|
| 5190 | // } |
---|
| 5191 | // Change order/block structures (needed for rPrint, rAdd etc.) |
---|
| 5192 | int j=0; |
---|
| 5193 | int l=rBlocks(src); |
---|
| 5194 | for(i=0; src->order[i]!=0; i++) |
---|
| 5195 | { |
---|
| 5196 | switch (src->order[i]) |
---|
| 5197 | { |
---|
| 5198 | case ringorder_c: /* c-> c */ |
---|
| 5199 | case ringorder_C: /* C-> C */ |
---|
| 5200 | case ringorder_no /*=0*/: /* end-of-block */ |
---|
| 5201 | r->order[j]=src->order[i]; |
---|
| 5202 | j++; break; |
---|
| 5203 | case ringorder_lp: /* lp -> rp */ |
---|
| 5204 | r->order[j]=ringorder_rp; |
---|
| 5205 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5206 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5207 | break; |
---|
| 5208 | case ringorder_rp: /* rp -> lp */ |
---|
| 5209 | r->order[j]=ringorder_lp; |
---|
| 5210 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5211 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5212 | break; |
---|
| 5213 | case ringorder_dp: /* dp -> a(1..1),ls */ |
---|
| 5214 | { |
---|
[bbcf1d2] | 5215 | l=rRealloc1(r,l,j); |
---|
[a6904c] | 5216 | r->order[j]=ringorder_a; |
---|
| 5217 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5218 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5219 | r->wvhdl[j]=(int*)omAlloc((r->block1[j]-r->block0[j]+1)*sizeof(int)); |
---|
| 5220 | for(int k=r->block0[j]; k<=r->block1[j]; k++) |
---|
| 5221 | r->wvhdl[j][k-r->block0[j]]=1; |
---|
| 5222 | j++; |
---|
| 5223 | r->order[j]=ringorder_ls; |
---|
| 5224 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5225 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5226 | j++; |
---|
| 5227 | break; |
---|
| 5228 | } |
---|
| 5229 | case ringorder_Dp: /* Dp -> a(1..1),rp */ |
---|
| 5230 | { |
---|
[bbcf1d2] | 5231 | l=rRealloc1(r,l,j); |
---|
[a6904c] | 5232 | r->order[j]=ringorder_a; |
---|
| 5233 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5234 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5235 | r->wvhdl[j]=(int*)omAlloc((r->block1[j]-r->block0[j]+1)*sizeof(int)); |
---|
| 5236 | for(int k=r->block0[j]; k<=r->block1[j]; k++) |
---|
| 5237 | r->wvhdl[j][k-r->block0[j]]=1; |
---|
| 5238 | j++; |
---|
| 5239 | r->order[j]=ringorder_rp; |
---|
| 5240 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5241 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5242 | j++; |
---|
| 5243 | break; |
---|
| 5244 | } |
---|
| 5245 | case ringorder_wp: /* wp -> a(...),ls */ |
---|
| 5246 | { |
---|
[bbcf1d2] | 5247 | l=rRealloc1(r,l,j); |
---|
[a6904c] | 5248 | r->order[j]=ringorder_a; |
---|
| 5249 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5250 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
[a41623] | 5251 | r->wvhdl[j]=r->wvhdl[j+1]; r->wvhdl[j+1]=NULL; |
---|
[a6904c] | 5252 | rOppWeight(r->wvhdl[j], r->block1[j]-r->block0[j]); |
---|
| 5253 | j++; |
---|
| 5254 | r->order[j]=ringorder_ls; |
---|
| 5255 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5256 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5257 | j++; |
---|
| 5258 | break; |
---|
| 5259 | } |
---|
| 5260 | case ringorder_Wp: /* Wp -> a(...),rp */ |
---|
| 5261 | { |
---|
[bbcf1d2] | 5262 | l=rRealloc1(r,l,j); |
---|
[a6904c] | 5263 | r->order[j]=ringorder_a; |
---|
| 5264 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5265 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
[896561] | 5266 | r->wvhdl[j]=r->wvhdl[j+1]; r->wvhdl[j+1]=NULL; |
---|
[a6904c] | 5267 | rOppWeight(r->wvhdl[j], r->block1[j]-r->block0[j]); |
---|
| 5268 | j++; |
---|
| 5269 | r->order[j]=ringorder_rp; |
---|
| 5270 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5271 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5272 | j++; |
---|
| 5273 | break; |
---|
| 5274 | } |
---|
| 5275 | case ringorder_M: /* M -> M */ |
---|
| 5276 | { |
---|
| 5277 | r->order[j]=ringorder_M; |
---|
| 5278 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5279 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5280 | int n=r->block1[j]-r->block0[j]; |
---|
| 5281 | /* M is a (n+1)x(n+1) matrix */ |
---|
| 5282 | for (int nn=0; nn<=n; nn++) |
---|
| 5283 | { |
---|
| 5284 | rOppWeight(&(r->wvhdl[j][nn*(n+1)]), n /*r->block1[j]-r->block0[j]*/); |
---|
| 5285 | } |
---|
| 5286 | j++; |
---|
| 5287 | break; |
---|
| 5288 | } |
---|
| 5289 | case ringorder_a: /* a(...),ls -> wp/dp */ |
---|
| 5290 | { |
---|
| 5291 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5292 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5293 | rOppWeight(r->wvhdl[j], r->block1[j]-r->block0[j]); |
---|
| 5294 | if (src->order[i+1]==ringorder_ls) |
---|
| 5295 | { |
---|
| 5296 | r->order[j]=ringorder_wp; |
---|
| 5297 | i++; |
---|
[9bb5457] | 5298 | //l=rReallocM1(r,l,j); |
---|
[a6904c] | 5299 | } |
---|
| 5300 | else |
---|
| 5301 | { |
---|
| 5302 | r->order[j]=ringorder_a; |
---|
| 5303 | } |
---|
| 5304 | j++; |
---|
| 5305 | break; |
---|
| 5306 | } |
---|
| 5307 | // not yet done: |
---|
| 5308 | case ringorder_ls: |
---|
| 5309 | case ringorder_rs: |
---|
| 5310 | case ringorder_ds: |
---|
| 5311 | case ringorder_Ds: |
---|
| 5312 | case ringorder_ws: |
---|
| 5313 | case ringorder_Ws: |
---|
| 5314 | // should not occur: |
---|
| 5315 | case ringorder_S: |
---|
| 5316 | case ringorder_IS: |
---|
| 5317 | case ringorder_s: |
---|
| 5318 | case ringorder_aa: |
---|
| 5319 | case ringorder_L: |
---|
| 5320 | case ringorder_unspec: |
---|
| 5321 | Werror("order %s not (yet) supported", rSimpleOrdStr(src->order[i])); |
---|
| 5322 | break; |
---|
| 5323 | } |
---|
| 5324 | } |
---|
| 5325 | rComplete(r); |
---|
| 5326 | |
---|
| 5327 | |
---|
| 5328 | #ifdef RDEBUG |
---|
| 5329 | rTest(r); |
---|
| 5330 | #endif |
---|
| 5331 | |
---|
[1389a4] | 5332 | //rChangeCurrRing(r); |
---|
[a6904c] | 5333 | |
---|
| 5334 | #ifdef RDEBUG |
---|
| 5335 | rTest(r); |
---|
| 5336 | // rWrite(r); |
---|
| 5337 | // rDebugPrint(r); |
---|
| 5338 | #endif |
---|
| 5339 | |
---|
| 5340 | |
---|
| 5341 | #ifdef HAVE_PLURAL |
---|
| 5342 | // now, we initialize a non-comm structure on r |
---|
| 5343 | if (rIsPluralRing(src)) |
---|
| 5344 | { |
---|
[b388be] | 5345 | // assume( currRing == r); |
---|
[a6904c] | 5346 | |
---|
| 5347 | int *perm = (int *)omAlloc0((rVar(r)+1)*sizeof(int)); |
---|
| 5348 | int *par_perm = NULL; |
---|
[613174] | 5349 | nMapFunc nMap = n_SetMap(src->cf,r->cf); |
---|
[a6904c] | 5350 | int ni,nj; |
---|
| 5351 | for(i=1; i<=r->N; i++) |
---|
| 5352 | { |
---|
| 5353 | perm[i] = rOppVar(r,i); |
---|
| 5354 | } |
---|
| 5355 | |
---|
| 5356 | matrix C = mpNew(rVar(r),rVar(r)); |
---|
| 5357 | matrix D = mpNew(rVar(r),rVar(r)); |
---|
| 5358 | |
---|
| 5359 | for (i=1; i< rVar(r); i++) |
---|
| 5360 | { |
---|
| 5361 | for (j=i+1; j<=rVar(r); j++) |
---|
| 5362 | { |
---|
| 5363 | ni = r->N +1 - i; |
---|
| 5364 | nj = r->N +1 - j; /* i<j ==> nj < ni */ |
---|
| 5365 | |
---|
| 5366 | assume(MATELEM(src->GetNC()->C,i,j) != NULL); |
---|
[01c1d0] | 5367 | MATELEM(C,nj,ni) = p_PermPoly(MATELEM(src->GetNC()->C,i,j),perm,src,r, nMap,par_perm,rPar(src)); |
---|
[a6904c] | 5368 | |
---|
| 5369 | if(MATELEM(src->GetNC()->D,i,j) != NULL) |
---|
[01c1d0] | 5370 | MATELEM(D,nj,ni) = p_PermPoly(MATELEM(src->GetNC()->D,i,j),perm,src,r, nMap,par_perm,rPar(src)); |
---|
[a6904c] | 5371 | } |
---|
| 5372 | } |
---|
| 5373 | |
---|
[32d07a5] | 5374 | id_Test((ideal)C, r); |
---|
| 5375 | id_Test((ideal)D, r); |
---|
[a6904c] | 5376 | |
---|
| 5377 | if (nc_CallPlural(C, D, NULL, NULL, r, false, false, true, r)) // no qring setup! |
---|
| 5378 | WarnS("Error initializing non-commutative multiplication!"); |
---|
| 5379 | |
---|
| 5380 | #ifdef RDEBUG |
---|
| 5381 | rTest(r); |
---|
| 5382 | // rWrite(r); |
---|
| 5383 | // rDebugPrint(r); |
---|
| 5384 | #endif |
---|
| 5385 | |
---|
| 5386 | assume( r->GetNC()->IsSkewConstant == src->GetNC()->IsSkewConstant); |
---|
| 5387 | |
---|
| 5388 | omFreeSize((ADDRESS)perm,(rVar(r)+1)*sizeof(int)); |
---|
| 5389 | } |
---|
| 5390 | #endif /* HAVE_PLURAL */ |
---|
| 5391 | |
---|
| 5392 | /* now oppose the qideal for qrings */ |
---|
| 5393 | if (src->qideal != NULL) |
---|
| 5394 | { |
---|
| 5395 | id_Delete(&(r->qideal), r); |
---|
| 5396 | |
---|
| 5397 | #ifdef HAVE_PLURAL |
---|
[b388be] | 5398 | r->qideal = idOppose(src, src->qideal, r); // into the currRing: r |
---|
[a6904c] | 5399 | #else |
---|
[1389a4] | 5400 | r->qideal = id_Copy(src->qideal, r); // ? |
---|
[a6904c] | 5401 | #endif |
---|
| 5402 | |
---|
| 5403 | #ifdef HAVE_PLURAL |
---|
| 5404 | if( rIsPluralRing(r) ) |
---|
| 5405 | { |
---|
| 5406 | nc_SetupQuotient(r); |
---|
| 5407 | #ifdef RDEBUG |
---|
| 5408 | rTest(r); |
---|
| 5409 | // rWrite(r); |
---|
| 5410 | // rDebugPrint(r); |
---|
| 5411 | #endif |
---|
| 5412 | } |
---|
| 5413 | #endif |
---|
| 5414 | } |
---|
| 5415 | #ifdef HAVE_PLURAL |
---|
| 5416 | if( rIsPluralRing(r) ) |
---|
| 5417 | assume( ncRingType(r) == ncRingType(src) ); |
---|
| 5418 | #endif |
---|
| 5419 | rTest(r); |
---|
| 5420 | |
---|
| 5421 | return r; |
---|
| 5422 | } |
---|
| 5423 | |
---|
| 5424 | ring rEnvelope(ring R) |
---|
| 5425 | /* creates an enveloping algebra of R */ |
---|
| 5426 | /* that is R^e = R \tensor_K R^opp */ |
---|
| 5427 | { |
---|
| 5428 | ring Ropp = rOpposite(R); |
---|
| 5429 | ring Renv = NULL; |
---|
| 5430 | int stat = rSum(R, Ropp, Renv); /* takes care of qideals */ |
---|
| 5431 | if ( stat <=0 ) |
---|
| 5432 | WarnS("Error in rEnvelope at rSum"); |
---|
| 5433 | rTest(Renv); |
---|
| 5434 | return Renv; |
---|
| 5435 | } |
---|
| 5436 | |
---|
| 5437 | #ifdef HAVE_PLURAL |
---|
| 5438 | BOOLEAN nc_rComplete(const ring src, ring dest, bool bSetupQuotient) |
---|
| 5439 | /* returns TRUE is there were errors */ |
---|
| 5440 | /* dest is actualy equals src with the different ordering */ |
---|
| 5441 | /* we map src->nc correctly to dest->src */ |
---|
| 5442 | /* to be executed after rComplete, before rChangeCurrRing */ |
---|
| 5443 | { |
---|
| 5444 | // NOTE: Originally used only by idElimination to transfer NC structure to dest |
---|
| 5445 | // ring created by dirty hack (without nc_CallPlural) |
---|
| 5446 | rTest(src); |
---|
| 5447 | |
---|
| 5448 | assume(!rIsPluralRing(dest)); // destination must be a newly constructed commutative ring |
---|
| 5449 | |
---|
| 5450 | if (!rIsPluralRing(src)) |
---|
| 5451 | { |
---|
| 5452 | return FALSE; |
---|
| 5453 | } |
---|
| 5454 | |
---|
| 5455 | const int N = dest->N; |
---|
| 5456 | |
---|
| 5457 | assume(src->N == N); |
---|
| 5458 | |
---|
[b388be] | 5459 | // ring save = currRing; |
---|
[a6904c] | 5460 | |
---|
[b388be] | 5461 | // if (dest != save) |
---|
| 5462 | // rChangeCurrRing(dest); |
---|
[a6904c] | 5463 | |
---|
| 5464 | const ring srcBase = src; |
---|
| 5465 | |
---|
[613174] | 5466 | assume( n_SetMap(srcBase->cf,dest->cf) == n_SetMap(dest->cf,dest->cf) ); // currRing is important here! |
---|
[a6904c] | 5467 | |
---|
| 5468 | matrix C = mpNew(N,N); // ring independent |
---|
| 5469 | matrix D = mpNew(N,N); |
---|
| 5470 | |
---|
| 5471 | matrix C0 = src->GetNC()->C; |
---|
| 5472 | matrix D0 = src->GetNC()->D; |
---|
| 5473 | |
---|
| 5474 | // map C and D into dest |
---|
| 5475 | for (int i = 1; i < N; i++) |
---|
| 5476 | { |
---|
| 5477 | for (int j = i + 1; j <= N; j++) |
---|
| 5478 | { |
---|
[7eb7b5] | 5479 | const number n = n_Copy(p_GetCoeff(MATELEM(C0,i,j), srcBase), srcBase->cf); // src, mapping for coeffs into currRing = dest! |
---|
[a6904c] | 5480 | const poly p = p_NSet(n, dest); |
---|
| 5481 | MATELEM(C,i,j) = p; |
---|
| 5482 | if (MATELEM(D0,i,j) != NULL) |
---|
| 5483 | MATELEM(D,i,j) = prCopyR(MATELEM(D0,i,j), srcBase, dest); // ? |
---|
| 5484 | } |
---|
| 5485 | } |
---|
| 5486 | /* One must test C and D _only_ in r->GetNC()->basering!!! not in r!!! */ |
---|
| 5487 | |
---|
[f70f641] | 5488 | id_Test((ideal)C, dest); |
---|
[32d07a5] | 5489 | id_Test((ideal)D, dest); |
---|
[a6904c] | 5490 | |
---|
| 5491 | if (nc_CallPlural(C, D, NULL, NULL, dest, bSetupQuotient, false, true, dest)) // also takes care about quotient ideal |
---|
| 5492 | { |
---|
| 5493 | //WarnS("Error transferring non-commutative structure"); |
---|
| 5494 | // error message should be in the interpreter interface |
---|
| 5495 | |
---|
[0a3a629] | 5496 | mp_Delete(&C, dest); |
---|
| 5497 | mp_Delete(&D, dest); |
---|
[a6904c] | 5498 | |
---|
[b388be] | 5499 | // if (currRing != save) |
---|
| 5500 | // rChangeCurrRing(save); |
---|
[a6904c] | 5501 | |
---|
| 5502 | return TRUE; |
---|
| 5503 | } |
---|
| 5504 | |
---|
[0a3a629] | 5505 | // mp_Delete(&C, dest); // used by nc_CallPlural! |
---|
| 5506 | // mp_Delete(&D, dest); |
---|
[a6904c] | 5507 | |
---|
[b388be] | 5508 | // if (dest != save) |
---|
| 5509 | // rChangeCurrRing(save); |
---|
[a6904c] | 5510 | |
---|
| 5511 | assume(rIsPluralRing(dest)); |
---|
| 5512 | return FALSE; |
---|
| 5513 | } |
---|
| 5514 | #endif |
---|
| 5515 | |
---|
| 5516 | void rModify_a_to_A(ring r) |
---|
| 5517 | // to be called BEFORE rComplete: |
---|
| 5518 | // changes every Block with a(...) to A(...) |
---|
| 5519 | { |
---|
| 5520 | int i=0; |
---|
| 5521 | int j; |
---|
| 5522 | while(r->order[i]!=0) |
---|
| 5523 | { |
---|
| 5524 | if (r->order[i]==ringorder_a) |
---|
| 5525 | { |
---|
| 5526 | r->order[i]=ringorder_a64; |
---|
| 5527 | int *w=r->wvhdl[i]; |
---|
| 5528 | int64 *w64=(int64 *)omAlloc((r->block1[i]-r->block0[i]+1)*sizeof(int64)); |
---|
| 5529 | for(j=r->block1[i]-r->block0[i];j>=0;j--) |
---|
| 5530 | w64[j]=(int64)w[j]; |
---|
| 5531 | r->wvhdl[i]=(int*)w64; |
---|
| 5532 | omFreeSize(w,(r->block1[i]-r->block0[i]+1)*sizeof(int)); |
---|
| 5533 | } |
---|
| 5534 | i++; |
---|
| 5535 | } |
---|
| 5536 | } |
---|
[4c6e420] | 5537 | |
---|
| 5538 | |
---|
| 5539 | BOOLEAN rMinpolyIsNULL(const ring r) |
---|
| 5540 | { |
---|
| 5541 | assume(r != NULL); |
---|
| 5542 | const coeffs C = r->cf; |
---|
| 5543 | assume(C != NULL); |
---|
| 5544 | |
---|
| 5545 | if( rField_is_Extension(r) ) |
---|
| 5546 | { |
---|
[6ccdd3a] | 5547 | const ring R = C->extRing; |
---|
[4c6e420] | 5548 | assume( R != NULL ); |
---|
[aec5c9] | 5549 | return idIs0(R->minideal); |
---|
[4c6e420] | 5550 | } |
---|
| 5551 | return TRUE; |
---|
| 5552 | } |
---|
| 5553 | |
---|
[0afa07] | 5554 | poly rGetVar(const int varIndex, const ring r) |
---|
| 5555 | { |
---|
| 5556 | poly p = p_ISet(1, r); |
---|
| 5557 | p_SetExp(p, varIndex, 1, r); |
---|
| 5558 | p_Setm(p, r); |
---|
| 5559 | return p; |
---|
| 5560 | } |
---|
| 5561 | |
---|
[6637ee] | 5562 | |
---|
| 5563 | |
---|
| 5564 | number n_Param(const short iParameter, const ring r) |
---|
| 5565 | { |
---|
| 5566 | assume(r != NULL); |
---|
| 5567 | const coeffs C = r->cf; |
---|
| 5568 | assume(C != NULL); |
---|
| 5569 | |
---|
| 5570 | const n_coeffType _filed_type = getCoeffType(C); |
---|
| 5571 | |
---|
[e82417] | 5572 | if ( iParameter <= 0 || iParameter > rPar(r) ) |
---|
[6637ee] | 5573 | // Wrong parameter |
---|
| 5574 | return NULL; |
---|
| 5575 | |
---|
| 5576 | if( _filed_type == n_algExt ) |
---|
| 5577 | return naParam(iParameter, C); |
---|
| 5578 | |
---|
| 5579 | if( _filed_type == n_transExt ) |
---|
| 5580 | return ntParam(iParameter, C); |
---|
| 5581 | |
---|
| 5582 | return NULL; |
---|
| 5583 | } |
---|
| 5584 | |
---|
[e82417] | 5585 | |
---|
| 5586 | |
---|
| 5587 | int n_IsParam(number m, const ring r) |
---|
| 5588 | { |
---|
| 5589 | assume(r != NULL); |
---|
| 5590 | const coeffs C = r->cf; |
---|
| 5591 | assume(C != NULL); |
---|
| 5592 | |
---|
| 5593 | const n_coeffType _filed_type = getCoeffType(C); |
---|
| 5594 | |
---|
| 5595 | if( _filed_type == n_algExt ) |
---|
| 5596 | return naIsParam(m, C); |
---|
| 5597 | |
---|
| 5598 | if( _filed_type == n_transExt ) |
---|
| 5599 | return ntIsParam(m, C); |
---|
| 5600 | |
---|
| 5601 | return 0; |
---|
| 5602 | } |
---|
| 5603 | |
---|