[a6904c] | 1 | /**************************************** |
---|
| 2 | * Computer Algebra System SINGULAR * |
---|
| 3 | ****************************************/ |
---|
| 4 | /* $Id$ */ |
---|
| 5 | |
---|
| 6 | /* |
---|
| 7 | * ABSTRACT - the interpreter related ring operations |
---|
| 8 | */ |
---|
| 9 | |
---|
| 10 | /* includes */ |
---|
| 11 | #include <math.h> |
---|
[599326] | 12 | #include <kernel/mod2.h> |
---|
[a6904c] | 13 | |
---|
[599326] | 14 | #include <kernel/options.h> |
---|
[b1dfaf] | 15 | #include <omalloc/omalloc.h> |
---|
[599326] | 16 | #include <kernel/polys.h> |
---|
| 17 | #include <kernel/numbers.h> |
---|
| 18 | #include <kernel/febase.h> |
---|
| 19 | #include <kernel/intvec.h> |
---|
[661c214] | 20 | #include <kernel/longtrans.h> |
---|
[599326] | 21 | #include <kernel/ffields.h> |
---|
| 22 | #include <kernel/ideals.h> |
---|
| 23 | #include <kernel/ring.h> |
---|
| 24 | #include <kernel/prCopy.h> |
---|
| 25 | #include <Singular/ipshell.h> |
---|
| 26 | #include <kernel/p_Procs.h> |
---|
[a6904c] | 27 | #ifdef HAVE_PLURAL |
---|
[599326] | 28 | #include <kernel/gring.h> |
---|
| 29 | #include <kernel/sca.h> |
---|
[a6904c] | 30 | #endif |
---|
[599326] | 31 | #include <kernel/maps.h> |
---|
| 32 | #include <kernel/matpol.h> |
---|
[a6904c] | 33 | #ifdef HAVE_FACTORY |
---|
[24fd70] | 34 | #define SI_DONT_HAVE_GLOBAL_VARS |
---|
[b1dfaf] | 35 | # include <factory/factory.h> |
---|
[a6904c] | 36 | #endif |
---|
| 37 | |
---|
| 38 | #define BITS_PER_LONG 8*SIZEOF_LONG |
---|
| 39 | |
---|
| 40 | omBin sip_sring_bin = omGetSpecBin(sizeof(sip_sring)); |
---|
| 41 | |
---|
| 42 | static const char * const ringorder_name[] = |
---|
| 43 | { |
---|
| 44 | " ?", ///< ringorder_no = 0, |
---|
| 45 | "a", ///< ringorder_a, |
---|
| 46 | "A", ///< ringorder_a64, |
---|
| 47 | "c", ///< ringorder_c, |
---|
| 48 | "C", ///< ringorder_C, |
---|
| 49 | "M", ///< ringorder_M, |
---|
| 50 | "S", ///< ringorder_S, |
---|
| 51 | "s", ///< ringorder_s, |
---|
| 52 | "lp", ///< ringorder_lp, |
---|
| 53 | "dp", ///< ringorder_dp, |
---|
| 54 | "rp", ///< ringorder_rp, |
---|
| 55 | "Dp", ///< ringorder_Dp, |
---|
| 56 | "wp", ///< ringorder_wp, |
---|
| 57 | "Wp", ///< ringorder_Wp, |
---|
| 58 | "ls", ///< ringorder_ls, |
---|
| 59 | "ds", ///< ringorder_ds, |
---|
| 60 | "Ds", ///< ringorder_Ds, |
---|
| 61 | "ws", ///< ringorder_ws, |
---|
| 62 | "Ws", ///< ringorder_Ws, |
---|
| 63 | "L", ///< ringorder_L, |
---|
| 64 | "aa", ///< ringorder_aa |
---|
| 65 | "rs", ///< ringorder_rs, |
---|
| 66 | "IS", ///< ringorder_IS |
---|
| 67 | " _" ///< ringorder_unspec |
---|
| 68 | }; |
---|
| 69 | |
---|
| 70 | const char * rSimpleOrdStr(int ord) |
---|
| 71 | { |
---|
| 72 | return ringorder_name[ord]; |
---|
| 73 | } |
---|
| 74 | |
---|
| 75 | /// unconditionally deletes fields in r |
---|
| 76 | void rDelete(ring r); |
---|
| 77 | /// set r->VarL_Size, r->VarL_Offset, r->VarL_LowIndex |
---|
| 78 | static void rSetVarL(ring r); |
---|
| 79 | /// get r->divmask depending on bits per exponent |
---|
| 80 | static unsigned long rGetDivMask(int bits); |
---|
| 81 | /// right-adjust r->VarOffset |
---|
| 82 | static void rRightAdjustVarOffset(ring r); |
---|
| 83 | static void rOptimizeLDeg(ring r); |
---|
| 84 | |
---|
| 85 | /*0 implementation*/ |
---|
| 86 | //BOOLEAN rField_is_R(ring r=currRing) |
---|
| 87 | //{ |
---|
| 88 | // if (r->ch== -1) |
---|
| 89 | // { |
---|
| 90 | // if (r->float_len==(short)0) return TRUE; |
---|
| 91 | // } |
---|
| 92 | // return FALSE; |
---|
| 93 | //} |
---|
| 94 | |
---|
| 95 | /// internally changes the gloabl ring and resets the relevant |
---|
| 96 | /// global variables: |
---|
| 97 | void rChangeCurrRing(ring r) |
---|
| 98 | { |
---|
| 99 | // if ((currRing!=NULL) && (currRing->minpoly!=NULL)) |
---|
| 100 | // { |
---|
| 101 | // omCheckAddr(currRing->minpoly); |
---|
| 102 | // } |
---|
| 103 | /*------------ set global ring vars --------------------------------*/ |
---|
| 104 | currRing = r; |
---|
| 105 | currQuotient=NULL; |
---|
| 106 | if (r != NULL) |
---|
| 107 | { |
---|
| 108 | rTest(r); |
---|
| 109 | /*------------ set global ring vars --------------------------------*/ |
---|
| 110 | currQuotient=r->qideal; |
---|
| 111 | |
---|
| 112 | /*------------ global variables related to coefficients ------------*/ |
---|
| 113 | nSetChar(r); |
---|
| 114 | |
---|
| 115 | /*------------ global variables related to polys -------------------*/ |
---|
| 116 | pSetGlobals(r); |
---|
| 117 | /*------------ global variables related to factory -------------------*/ |
---|
| 118 | #ifdef HAVE_FACTORY |
---|
| 119 | //int c=ABS(nGetChar()); |
---|
| 120 | //if (c==1) c=0; |
---|
| 121 | //setCharacteristic( c ); |
---|
| 122 | #endif |
---|
| 123 | } |
---|
| 124 | } |
---|
| 125 | |
---|
[301c033] | 126 | ring rDefault(int ch, int N, char **n,int ord_size, int *ord, int *block0, int *block1) |
---|
[a6904c] | 127 | { |
---|
| 128 | ring r=(ring) omAlloc0Bin(sip_sring_bin); |
---|
| 129 | r->ch = ch; |
---|
| 130 | r->N = N; |
---|
| 131 | /*r->P = 0; Alloc0 */ |
---|
| 132 | /*names*/ |
---|
| 133 | r->names = (char **) omAlloc0(N * sizeof(char_ptr)); |
---|
| 134 | int i; |
---|
| 135 | for(i=0;i<N;i++) |
---|
| 136 | { |
---|
| 137 | r->names[i] = omStrDup(n[i]); |
---|
| 138 | } |
---|
| 139 | /*weights: entries for 2 blocks: NULL*/ |
---|
[301c033] | 140 | r->wvhdl = (int **)omAlloc0((ord_size+1) * sizeof(int_ptr)); |
---|
| 141 | r->order = ord; |
---|
| 142 | r->block0 = block0; |
---|
| 143 | r->block1 = block1; |
---|
[a6904c] | 144 | /*polynomial ring*/ |
---|
| 145 | r->OrdSgn = 1; |
---|
| 146 | |
---|
| 147 | /* complete ring intializations */ |
---|
| 148 | rComplete(r); |
---|
| 149 | return r; |
---|
| 150 | } |
---|
| 151 | |
---|
[301c033] | 152 | ring rDefault(int ch, int N, char **n) |
---|
| 153 | { |
---|
| 154 | /*order: lp,0*/ |
---|
| 155 | int *order = (int *) omAlloc(2* sizeof(int)); |
---|
| 156 | int *block0 = (int *)omAlloc0(2 * sizeof(int)); |
---|
| 157 | int *block1 = (int *)omAlloc0(2 * sizeof(int)); |
---|
| 158 | /* ringorder dp for the first block: var 1..N */ |
---|
| 159 | order[0] = ringorder_lp; |
---|
| 160 | block0[0] = 1; |
---|
| 161 | block1[0] = N; |
---|
| 162 | /* the last block: everything is 0 */ |
---|
| 163 | order[1] = 0; |
---|
| 164 | |
---|
| 165 | return rDefault(ch,N,n,2,order,block0,block1); |
---|
| 166 | } |
---|
| 167 | |
---|
[a6904c] | 168 | /////////////////////////////////////////////////////////////////////////// |
---|
| 169 | // |
---|
| 170 | // rInit: define a new ring from sleftv's |
---|
| 171 | // |
---|
| 172 | //-> ipshell.cc |
---|
| 173 | |
---|
| 174 | ///////////////////////////// |
---|
| 175 | // Auxillary functions |
---|
| 176 | // |
---|
| 177 | |
---|
| 178 | // check intvec, describing the ordering |
---|
| 179 | BOOLEAN rCheckIV(intvec *iv) |
---|
| 180 | { |
---|
| 181 | if ((iv->length()!=2)&&(iv->length()!=3)) |
---|
| 182 | { |
---|
| 183 | WerrorS("weights only for orderings wp,ws,Wp,Ws,a,M"); |
---|
| 184 | return TRUE; |
---|
| 185 | } |
---|
| 186 | return FALSE; |
---|
| 187 | } |
---|
| 188 | |
---|
| 189 | int rTypeOfMatrixOrder(intvec * order) |
---|
| 190 | { |
---|
| 191 | int i=0,j,typ=1; |
---|
| 192 | int sz = (int)sqrt((double)(order->length()-2)); |
---|
| 193 | if ((sz*sz)!=(order->length()-2)) |
---|
| 194 | { |
---|
| 195 | WerrorS("Matrix order is not a square matrix"); |
---|
| 196 | typ=0; |
---|
| 197 | } |
---|
| 198 | while ((i<sz) && (typ==1)) |
---|
| 199 | { |
---|
| 200 | j=0; |
---|
| 201 | while ((j<sz) && ((*order)[j*sz+i+2]==0)) j++; |
---|
| 202 | if (j>=sz) |
---|
| 203 | { |
---|
| 204 | typ = 0; |
---|
| 205 | WerrorS("Matrix order not complete"); |
---|
| 206 | } |
---|
| 207 | else if ((*order)[j*sz+i+2]<0) |
---|
| 208 | typ = -1; |
---|
| 209 | else |
---|
| 210 | i++; |
---|
| 211 | } |
---|
| 212 | return typ; |
---|
| 213 | } |
---|
| 214 | |
---|
| 215 | // set R->order, R->block, R->wvhdl, r->OrdSgn from sleftv |
---|
| 216 | BOOLEAN rSleftvOrdering2Ordering(sleftv *ord, ring R); |
---|
| 217 | |
---|
| 218 | // get array of strings from list of sleftv's |
---|
| 219 | BOOLEAN rSleftvList2StringArray(sleftv* sl, char** p); |
---|
| 220 | |
---|
| 221 | |
---|
| 222 | /*2 |
---|
| 223 | * set a new ring from the data: |
---|
| 224 | s: name, chr: ch, varnames: rv, ordering: ord, typ: typ |
---|
| 225 | */ |
---|
| 226 | |
---|
| 227 | int r_IsRingVar(const char *n, ring r) |
---|
| 228 | { |
---|
| 229 | if ((r!=NULL) && (r->names!=NULL)) |
---|
| 230 | { |
---|
| 231 | for (int i=0; i<r->N; i++) |
---|
| 232 | { |
---|
| 233 | if (r->names[i]==NULL) return -1; |
---|
| 234 | if (strcmp(n,r->names[i]) == 0) return (int)i; |
---|
| 235 | } |
---|
| 236 | } |
---|
| 237 | return -1; |
---|
| 238 | } |
---|
| 239 | |
---|
| 240 | |
---|
| 241 | void rWrite(ring r) |
---|
| 242 | { |
---|
| 243 | if ((r==NULL)||(r->order==NULL)) |
---|
| 244 | return; /*to avoid printing after errors....*/ |
---|
| 245 | |
---|
| 246 | int nblocks=rBlocks(r); |
---|
| 247 | |
---|
| 248 | // omCheckAddrSize(r,sizeof(ip_sring)); |
---|
| 249 | omCheckAddrSize(r->order,nblocks*sizeof(int)); |
---|
| 250 | omCheckAddrSize(r->block0,nblocks*sizeof(int)); |
---|
| 251 | omCheckAddrSize(r->block1,nblocks*sizeof(int)); |
---|
| 252 | omCheckAddrSize(r->wvhdl,nblocks*sizeof(int_ptr)); |
---|
| 253 | omCheckAddrSize(r->names,r->N*sizeof(char_ptr)); |
---|
| 254 | |
---|
| 255 | nblocks--; |
---|
| 256 | |
---|
| 257 | |
---|
| 258 | if (rField_is_GF(r)) |
---|
| 259 | { |
---|
| 260 | Print("// # ground field : %d\n",rInternalChar(r)); |
---|
| 261 | Print("// primitive element : %s\n", r->parameter[0]); |
---|
| 262 | if (r==currRing) |
---|
| 263 | { |
---|
| 264 | StringSetS("// minpoly : "); |
---|
| 265 | nfShowMipo();PrintS(StringAppendS("\n")); |
---|
| 266 | } |
---|
| 267 | } |
---|
| 268 | #ifdef HAVE_RINGS |
---|
| 269 | else if (rField_is_Ring(r)) |
---|
| 270 | { |
---|
| 271 | PrintS("// coeff. ring is : "); |
---|
| 272 | if (rField_is_Ring_Z(r)) PrintS("Integers\n"); |
---|
| 273 | long l = (long)mpz_sizeinbase(r->ringflaga, 10) + 2; |
---|
| 274 | char* s = (char*) omAlloc(l); |
---|
| 275 | mpz_get_str(s,10,r->ringflaga); |
---|
| 276 | if (rField_is_Ring_ModN(r)) Print("Z/%s\n", s); |
---|
| 277 | if (rField_is_Ring_2toM(r)) Print("Z/2^%lu\n", r->ringflagb); |
---|
| 278 | if (rField_is_Ring_PtoM(r)) Print("Z/%s^%lu\n", s, r->ringflagb); |
---|
| 279 | omFreeSize((ADDRESS)s, l); |
---|
| 280 | } |
---|
| 281 | #endif |
---|
| 282 | else |
---|
| 283 | { |
---|
| 284 | PrintS("// characteristic : "); |
---|
| 285 | if ( rField_is_R(r) ) PrintS("0 (real)\n"); /* R */ |
---|
| 286 | else if ( rField_is_long_R(r) ) |
---|
| 287 | Print("0 (real:%d digits, additional %d digits)\n", |
---|
| 288 | r->float_len,r->float_len2); /* long R */ |
---|
| 289 | else if ( rField_is_long_C(r) ) |
---|
| 290 | Print("0 (complex:%d digits, additional %d digits)\n", |
---|
| 291 | r->float_len, r->float_len2); /* long C */ |
---|
| 292 | else |
---|
| 293 | Print ("%d\n",rChar(r)); /* Fp(a) */ |
---|
| 294 | if (r->parameter!=NULL) |
---|
| 295 | { |
---|
| 296 | Print ("// %d parameter : ",rPar(r)); |
---|
| 297 | char **sp=r->parameter; |
---|
| 298 | int nop=0; |
---|
| 299 | while (nop<rPar(r)) |
---|
| 300 | { |
---|
| 301 | PrintS(*sp); |
---|
| 302 | PrintS(" "); |
---|
| 303 | sp++; nop++; |
---|
| 304 | } |
---|
| 305 | PrintS("\n// minpoly : "); |
---|
| 306 | if ( rField_is_long_C(r) ) |
---|
| 307 | { |
---|
| 308 | // i^2+1: |
---|
| 309 | Print("(%s^2+1)\n",r->parameter[0]); |
---|
| 310 | } |
---|
| 311 | else if (r->minpoly==NULL) |
---|
| 312 | { |
---|
| 313 | PrintS("0\n"); |
---|
| 314 | } |
---|
| 315 | else if (r==currRing) |
---|
| 316 | { |
---|
| 317 | StringSetS(""); nWrite(r->minpoly); PrintS(StringAppendS("\n")); |
---|
| 318 | } |
---|
| 319 | else |
---|
| 320 | { |
---|
| 321 | PrintS("...\n"); |
---|
| 322 | } |
---|
| 323 | if (r->minideal!=NULL) |
---|
| 324 | { |
---|
| 325 | if (r==currRing) iiWriteMatrix((matrix)r->minideal,"// minpolys",1,0); |
---|
| 326 | else PrintS("// minpolys=..."); |
---|
| 327 | PrintLn(); |
---|
| 328 | } |
---|
| 329 | } |
---|
| 330 | } |
---|
| 331 | Print("// number of vars : %d",r->N); |
---|
| 332 | |
---|
| 333 | //for (nblocks=0; r->order[nblocks]; nblocks++); |
---|
| 334 | nblocks=rBlocks(r)-1; |
---|
| 335 | |
---|
| 336 | for (int l=0, nlen=0 ; l<nblocks; l++) |
---|
| 337 | { |
---|
| 338 | int i; |
---|
| 339 | Print("\n// block %3d : ",l+1); |
---|
| 340 | |
---|
| 341 | Print("ordering %s", rSimpleOrdStr(r->order[l])); |
---|
| 342 | |
---|
| 343 | |
---|
| 344 | if (r->order[l] == ringorder_s) |
---|
| 345 | { |
---|
| 346 | assume( l == 0 ); |
---|
| 347 | #ifndef NDEBUG |
---|
| 348 | Print(" syzcomp at %d",r->typ[l].data.syz.limit); |
---|
| 349 | #endif |
---|
| 350 | continue; |
---|
| 351 | } |
---|
| 352 | else if (r->order[l] == ringorder_IS) |
---|
| 353 | { |
---|
[273fed] | 354 | assume( r->block0[l] == r->block1[l] ); |
---|
| 355 | const int s = r->block0[l]; |
---|
| 356 | assume( (-2 < s) && (s < 2) ); |
---|
| 357 | Print("(%d)", s); // 0 => prefix! +/-1 => suffix! |
---|
[a6904c] | 358 | continue; |
---|
| 359 | } |
---|
| 360 | else if ( |
---|
| 361 | ( (r->order[l] >= ringorder_lp) |
---|
| 362 | ||(r->order[l] == ringorder_M) |
---|
| 363 | ||(r->order[l] == ringorder_a) |
---|
| 364 | ||(r->order[l] == ringorder_a64) |
---|
| 365 | ||(r->order[l] == ringorder_aa) ) && (r->order[l] < ringorder_IS) ) |
---|
| 366 | { |
---|
| 367 | PrintS("\n// : names "); |
---|
| 368 | for (i = r->block0[l]-1; i<r->block1[l]; i++) |
---|
| 369 | { |
---|
| 370 | nlen = strlen(r->names[i]); |
---|
| 371 | Print(" %s",r->names[i]); |
---|
| 372 | } |
---|
| 373 | } |
---|
| 374 | |
---|
| 375 | if (r->wvhdl[l]!=NULL) |
---|
| 376 | { |
---|
| 377 | for (int j= 0; |
---|
| 378 | j<(r->block1[l]-r->block0[l]+1)*(r->block1[l]-r->block0[l]+1); |
---|
| 379 | j+=i) |
---|
| 380 | { |
---|
| 381 | PrintS("\n// : weights "); |
---|
| 382 | for (i = 0; i<=r->block1[l]-r->block0[l]; i++) |
---|
| 383 | { |
---|
| 384 | if (r->order[l] == ringorder_a64) |
---|
| 385 | { |
---|
| 386 | int64 *w=(int64 *)r->wvhdl[l]; |
---|
| 387 | #if SIZEOF_LONG == 4 |
---|
[bbcf1d2] | 388 | Print("%*lld " ,nlen,w[i+j]); |
---|
[a6904c] | 389 | #else |
---|
[bbcf1d2] | 390 | Print(" %*ld" ,nlen,w[i+j]); |
---|
[a6904c] | 391 | #endif |
---|
| 392 | } |
---|
| 393 | else |
---|
[bbcf1d2] | 394 | Print(" %*d" ,nlen,r->wvhdl[l][i+j]); |
---|
[a6904c] | 395 | } |
---|
| 396 | if (r->order[l]!=ringorder_M) break; |
---|
| 397 | } |
---|
| 398 | } |
---|
| 399 | } |
---|
| 400 | #ifdef HAVE_PLURAL |
---|
| 401 | if(rIsPluralRing(r)) |
---|
| 402 | { |
---|
| 403 | PrintS("\n// noncommutative relations:"); |
---|
| 404 | if (r==currRing) |
---|
| 405 | { |
---|
| 406 | poly pl=NULL; |
---|
| 407 | int nl; |
---|
| 408 | int i,j; |
---|
| 409 | for (i = 1; i<r->N; i++) |
---|
| 410 | { |
---|
| 411 | for (j = i+1; j<=r->N; j++) |
---|
| 412 | { |
---|
| 413 | nl = nIsOne(p_GetCoeff(MATELEM(r->GetNC()->C,i,j),r->GetNC()->basering)); |
---|
| 414 | if ( (MATELEM(r->GetNC()->D,i,j)!=NULL) || (!nl) ) |
---|
| 415 | { |
---|
| 416 | Print("\n// %s%s=",r->names[j-1],r->names[i-1]); |
---|
| 417 | pl = MATELEM(r->GetNC()->MT[UPMATELEM(i,j,r->N)],1,1); |
---|
| 418 | p_Write0(pl, r, r); |
---|
| 419 | } |
---|
| 420 | } |
---|
| 421 | } |
---|
| 422 | } |
---|
| 423 | else PrintS(" ..."); |
---|
[8eda39] | 424 | #if 0 /*Singularg should not differ from Singular except in error case*/ |
---|
[a6904c] | 425 | Print("\n// noncommutative type:%d", (int)ncRingType(r)); |
---|
| 426 | Print("\n// is skew constant:%d",r->GetNC()->IsSkewConstant); |
---|
| 427 | if( rIsSCA(r) ) |
---|
| 428 | { |
---|
| 429 | Print("\n// alternating variables: [%d, %d]", scaFirstAltVar(r), scaLastAltVar(r)); |
---|
| 430 | const ideal Q = SCAQuotient(r); // resides within r! |
---|
| 431 | PrintS("\n// quotient of sca by ideal"); |
---|
| 432 | |
---|
| 433 | if (Q!=NULL) |
---|
| 434 | { |
---|
| 435 | if (r==currRing) |
---|
| 436 | { |
---|
| 437 | PrintLn(); |
---|
| 438 | iiWriteMatrix((matrix)Q,"scaQ",1); |
---|
| 439 | } |
---|
| 440 | else PrintS(" ..."); |
---|
| 441 | } |
---|
| 442 | else |
---|
| 443 | PrintS(" (NULL)"); |
---|
| 444 | } |
---|
| 445 | #endif |
---|
| 446 | } |
---|
| 447 | #endif |
---|
| 448 | if (r->qideal!=NULL) |
---|
| 449 | { |
---|
| 450 | PrintS("\n// quotient ring from ideal"); |
---|
| 451 | if (r==currRing) |
---|
| 452 | { |
---|
| 453 | PrintLn(); |
---|
| 454 | iiWriteMatrix((matrix)r->qideal,"_",1); |
---|
| 455 | } |
---|
| 456 | else PrintS(" ..."); |
---|
| 457 | } |
---|
| 458 | } |
---|
| 459 | |
---|
| 460 | void rDelete(ring r) |
---|
| 461 | { |
---|
| 462 | int i, j; |
---|
| 463 | |
---|
| 464 | if (r == NULL) return; |
---|
| 465 | |
---|
| 466 | #ifdef HAVE_PLURAL |
---|
| 467 | if (rIsPluralRing(r)) |
---|
| 468 | nc_rKill(r); |
---|
| 469 | #endif |
---|
| 470 | |
---|
| 471 | nKillChar(r); |
---|
| 472 | rUnComplete(r); |
---|
| 473 | // delete order stuff |
---|
| 474 | if (r->order != NULL) |
---|
| 475 | { |
---|
| 476 | i=rBlocks(r); |
---|
| 477 | assume(r->block0 != NULL && r->block1 != NULL && r->wvhdl != NULL); |
---|
| 478 | // delete order |
---|
| 479 | omFreeSize((ADDRESS)r->order,i*sizeof(int)); |
---|
| 480 | omFreeSize((ADDRESS)r->block0,i*sizeof(int)); |
---|
| 481 | omFreeSize((ADDRESS)r->block1,i*sizeof(int)); |
---|
| 482 | // delete weights |
---|
| 483 | for (j=0; j<i; j++) |
---|
| 484 | { |
---|
| 485 | if (r->wvhdl[j]!=NULL) |
---|
| 486 | omFree(r->wvhdl[j]); |
---|
| 487 | } |
---|
| 488 | omFreeSize((ADDRESS)r->wvhdl,i*sizeof(int *)); |
---|
| 489 | } |
---|
| 490 | else |
---|
| 491 | { |
---|
| 492 | assume(r->block0 == NULL && r->block1 == NULL && r->wvhdl == NULL); |
---|
| 493 | } |
---|
| 494 | |
---|
| 495 | // delete varnames |
---|
| 496 | if(r->names!=NULL) |
---|
| 497 | { |
---|
| 498 | for (i=0; i<r->N; i++) |
---|
| 499 | { |
---|
| 500 | if (r->names[i] != NULL) omFree((ADDRESS)r->names[i]); |
---|
| 501 | } |
---|
| 502 | omFreeSize((ADDRESS)r->names,r->N*sizeof(char_ptr)); |
---|
| 503 | } |
---|
| 504 | |
---|
| 505 | // delete parameter |
---|
| 506 | if (r->parameter!=NULL) |
---|
| 507 | { |
---|
| 508 | char **s=r->parameter; |
---|
| 509 | j = 0; |
---|
| 510 | while (j < rPar(r)) |
---|
| 511 | { |
---|
| 512 | if (*s != NULL) omFree((ADDRESS)*s); |
---|
| 513 | s++; |
---|
| 514 | j++; |
---|
| 515 | } |
---|
| 516 | omFreeSize((ADDRESS)r->parameter,rPar(r)*sizeof(char_ptr)); |
---|
| 517 | } |
---|
| 518 | #ifdef HAVE_RINGS |
---|
| 519 | if (r->ringflaga != NULL) |
---|
| 520 | { |
---|
| 521 | mpz_clear(r->ringflaga); |
---|
| 522 | omFree((ADDRESS)r->ringflaga); |
---|
| 523 | } |
---|
| 524 | if (r->nrnModul != NULL) |
---|
| 525 | { |
---|
| 526 | mpz_clear(r->nrnModul); |
---|
| 527 | omFree((ADDRESS)r->nrnModul); |
---|
| 528 | } |
---|
| 529 | #endif |
---|
| 530 | omFreeBin(r, sip_sring_bin); |
---|
| 531 | } |
---|
| 532 | |
---|
| 533 | int rOrderName(char * ordername) |
---|
| 534 | { |
---|
| 535 | int order=ringorder_unspec; |
---|
| 536 | while (order!= 0) |
---|
| 537 | { |
---|
| 538 | if (strcmp(ordername,rSimpleOrdStr(order))==0) |
---|
| 539 | break; |
---|
| 540 | order--; |
---|
| 541 | } |
---|
| 542 | if (order==0) Werror("wrong ring order `%s`",ordername); |
---|
| 543 | omFree((ADDRESS)ordername); |
---|
| 544 | return order; |
---|
| 545 | } |
---|
| 546 | |
---|
| 547 | char * rOrdStr(ring r) |
---|
| 548 | { |
---|
| 549 | if ((r==NULL)||(r->order==NULL)) return omStrDup(""); |
---|
| 550 | int nblocks,l,i; |
---|
| 551 | |
---|
| 552 | for (nblocks=0; r->order[nblocks]; nblocks++); |
---|
| 553 | nblocks--; |
---|
| 554 | |
---|
| 555 | StringSetS(""); |
---|
| 556 | for (l=0; ; l++) |
---|
| 557 | { |
---|
| 558 | StringAppendS((char *)rSimpleOrdStr(r->order[l])); |
---|
[273fed] | 559 | if ( |
---|
| 560 | (r->order[l] != ringorder_c) |
---|
| 561 | && (r->order[l] != ringorder_C) |
---|
| 562 | && (r->order[l] != ringorder_s) |
---|
| 563 | && (r->order[l] != ringorder_S) |
---|
| 564 | && (r->order[l] != ringorder_IS) |
---|
| 565 | ) |
---|
[a6904c] | 566 | { |
---|
| 567 | if (r->wvhdl[l]!=NULL) |
---|
| 568 | { |
---|
| 569 | StringAppendS("("); |
---|
| 570 | for (int j= 0; |
---|
| 571 | j<(r->block1[l]-r->block0[l]+1)*(r->block1[l]-r->block0[l]+1); |
---|
| 572 | j+=i+1) |
---|
| 573 | { |
---|
| 574 | char c=','; |
---|
| 575 | if(r->order[l]==ringorder_a64) |
---|
| 576 | { |
---|
| 577 | int64 * w=(int64 *)r->wvhdl[l]; |
---|
| 578 | for (i = 0; i<r->block1[l]-r->block0[l]; i++) |
---|
| 579 | { |
---|
| 580 | StringAppend("%lld," ,w[i]); |
---|
| 581 | } |
---|
| 582 | StringAppend("%lld)" ,w[i]); |
---|
| 583 | break; |
---|
| 584 | } |
---|
| 585 | else |
---|
| 586 | { |
---|
| 587 | for (i = 0; i<r->block1[l]-r->block0[l]; i++) |
---|
| 588 | { |
---|
| 589 | StringAppend("%d," ,r->wvhdl[l][i+j]); |
---|
| 590 | } |
---|
| 591 | } |
---|
| 592 | if (r->order[l]!=ringorder_M) |
---|
| 593 | { |
---|
| 594 | StringAppend("%d)" ,r->wvhdl[l][i+j]); |
---|
| 595 | break; |
---|
| 596 | } |
---|
| 597 | if (j+i+1==(r->block1[l]-r->block0[l]+1)*(r->block1[l]-r->block0[l]+1)) |
---|
| 598 | c=')'; |
---|
| 599 | StringAppend("%d%c" ,r->wvhdl[l][i+j],c); |
---|
| 600 | } |
---|
| 601 | } |
---|
| 602 | else |
---|
| 603 | StringAppend("(%d)",r->block1[l]-r->block0[l]+1); |
---|
| 604 | } |
---|
[273fed] | 605 | else if (r->order[l] == ringorder_IS) |
---|
| 606 | { |
---|
| 607 | assume( r->block0[l] == r->block1[l] ); |
---|
| 608 | const int s = r->block0[l]; |
---|
| 609 | assume( (-2 < s) && (s < 2) ); |
---|
| 610 | |
---|
| 611 | StringAppend("(%d)", s); |
---|
| 612 | } |
---|
| 613 | |
---|
[a6904c] | 614 | if (l==nblocks) return omStrDup(StringAppendS("")); |
---|
| 615 | StringAppendS(","); |
---|
| 616 | } |
---|
| 617 | } |
---|
| 618 | |
---|
| 619 | char * rVarStr(ring r) |
---|
| 620 | { |
---|
| 621 | if ((r==NULL)||(r->names==NULL)) return omStrDup(""); |
---|
| 622 | int i; |
---|
| 623 | int l=2; |
---|
| 624 | char *s; |
---|
| 625 | |
---|
| 626 | for (i=0; i<r->N; i++) |
---|
| 627 | { |
---|
| 628 | l+=strlen(r->names[i])+1; |
---|
| 629 | } |
---|
| 630 | s=(char *)omAlloc((long)l); |
---|
| 631 | s[0]='\0'; |
---|
| 632 | for (i=0; i<r->N-1; i++) |
---|
| 633 | { |
---|
| 634 | strcat(s,r->names[i]); |
---|
| 635 | strcat(s,","); |
---|
| 636 | } |
---|
| 637 | strcat(s,r->names[i]); |
---|
| 638 | return s; |
---|
| 639 | } |
---|
| 640 | |
---|
| 641 | char * rCharStr(ring r) |
---|
| 642 | { |
---|
| 643 | char *s; |
---|
| 644 | int i; |
---|
| 645 | |
---|
| 646 | #ifdef HAVE_RINGS |
---|
| 647 | if (rField_is_Ring_Z(r)) |
---|
| 648 | { |
---|
| 649 | s=omStrDup("integer"); /* Z */ |
---|
| 650 | return s; |
---|
| 651 | } |
---|
| 652 | if(rField_is_Ring_2toM(r)) |
---|
| 653 | { |
---|
[c380cd] | 654 | char* s = (char*) omAlloc(7+10+2); |
---|
| 655 | sprintf(s,"integer,%lu",r->ringflagb); |
---|
| 656 | return s; |
---|
[a6904c] | 657 | } |
---|
| 658 | if(rField_is_Ring_ModN(r)) |
---|
| 659 | { |
---|
[c380cd] | 660 | long l = (long)mpz_sizeinbase(r->ringflaga, 10) + 2+7; |
---|
| 661 | char* s = (char*) omAlloc(l); |
---|
| 662 | gmp_sprintf(s,"integer,%Zd",r->ringflaga); |
---|
| 663 | return s; |
---|
[a6904c] | 664 | } |
---|
| 665 | if(rField_is_Ring_PtoM(r)) |
---|
| 666 | { |
---|
[c380cd] | 667 | long l = (long)mpz_sizeinbase(r->ringflaga, 10) + 2+7+10; |
---|
| 668 | char* s = (char*) omAlloc(l); |
---|
| 669 | gmp_sprintf(s,"integer,%Zd^%lu",r->ringflaga,r->ringflagb); |
---|
| 670 | return s; |
---|
[a6904c] | 671 | } |
---|
| 672 | #endif |
---|
| 673 | if (r->parameter==NULL) |
---|
| 674 | { |
---|
| 675 | i=r->ch; |
---|
| 676 | if(i==-1) |
---|
| 677 | s=omStrDup("real"); /* R */ |
---|
| 678 | else |
---|
| 679 | { |
---|
| 680 | s=(char *)omAlloc(MAX_INT_LEN+1); |
---|
| 681 | sprintf(s,"%d",i); /* Q, Z/p */ |
---|
| 682 | } |
---|
| 683 | return s; |
---|
| 684 | } |
---|
| 685 | if (rField_is_long_C(r)) |
---|
| 686 | { |
---|
| 687 | s=(char *)omAlloc(21+strlen(r->parameter[0])); |
---|
| 688 | sprintf(s,"complex,%d,%s",r->float_len,r->parameter[0]); /* C */ |
---|
| 689 | return s; |
---|
| 690 | } |
---|
| 691 | int l=0; |
---|
| 692 | for(i=0; i<rPar(r);i++) |
---|
| 693 | { |
---|
| 694 | l+=(strlen(r->parameter[i])+1); |
---|
| 695 | } |
---|
| 696 | s=(char *)omAlloc((long)(l+MAX_INT_LEN+1)); |
---|
| 697 | s[0]='\0'; |
---|
| 698 | if (r->ch<0) sprintf(s,"%d",-r->ch); /* Fp(a) */ |
---|
| 699 | else if (r->ch==1) sprintf(s,"0"); /* Q(a) */ |
---|
| 700 | else |
---|
| 701 | { |
---|
| 702 | sprintf(s,"%d,%s",r->ch,r->parameter[0]); /* GF(q) */ |
---|
| 703 | return s; |
---|
| 704 | } |
---|
| 705 | char tt[2]; |
---|
| 706 | tt[0]=','; |
---|
| 707 | tt[1]='\0'; |
---|
| 708 | for(i=0; i<rPar(r);i++) |
---|
| 709 | { |
---|
| 710 | strcat(s,tt); |
---|
| 711 | strcat(s,r->parameter[i]); |
---|
| 712 | } |
---|
| 713 | return s; |
---|
| 714 | } |
---|
| 715 | |
---|
| 716 | char * rParStr(ring r) |
---|
| 717 | { |
---|
| 718 | if ((r==NULL)||(r->parameter==NULL)) return omStrDup(""); |
---|
| 719 | |
---|
| 720 | int i; |
---|
| 721 | int l=2; |
---|
| 722 | |
---|
| 723 | for (i=0; i<rPar(r); i++) |
---|
| 724 | { |
---|
| 725 | l+=strlen(r->parameter[i])+1; |
---|
| 726 | } |
---|
| 727 | char *s=(char *)omAlloc((long)l); |
---|
| 728 | s[0]='\0'; |
---|
| 729 | for (i=0; i<rPar(r)-1; i++) |
---|
| 730 | { |
---|
| 731 | strcat(s,r->parameter[i]); |
---|
| 732 | strcat(s,","); |
---|
| 733 | } |
---|
| 734 | strcat(s,r->parameter[i]); |
---|
| 735 | return s; |
---|
| 736 | } |
---|
| 737 | |
---|
| 738 | char * rString(ring r) |
---|
| 739 | { |
---|
| 740 | char *ch=rCharStr(r); |
---|
| 741 | char *var=rVarStr(r); |
---|
| 742 | char *ord=rOrdStr(r); |
---|
| 743 | char *res=(char *)omAlloc(strlen(ch)+strlen(var)+strlen(ord)+9); |
---|
| 744 | sprintf(res,"(%s),(%s),(%s)",ch,var,ord); |
---|
| 745 | omFree((ADDRESS)ch); |
---|
| 746 | omFree((ADDRESS)var); |
---|
| 747 | omFree((ADDRESS)ord); |
---|
| 748 | return res; |
---|
| 749 | } |
---|
| 750 | |
---|
[df2551] | 751 | int rIsExtension(const ring r) |
---|
[a6904c] | 752 | { |
---|
| 753 | return (r->parameter!=NULL); /* R, Q, Fp: FALSE */ |
---|
| 754 | } |
---|
| 755 | |
---|
[df2551] | 756 | static int binaryPower (const int a, const int b) |
---|
[a6904c] | 757 | { |
---|
| 758 | /* computes a^b according to the binary representation of b, |
---|
| 759 | i.e., a^7 = a^4 * a^2 * a^1. This saves some multiplications. */ |
---|
| 760 | int result = 1; |
---|
| 761 | int factor = a; |
---|
| 762 | int bb = b; |
---|
| 763 | while (bb != 0) |
---|
| 764 | { |
---|
| 765 | if (bb % 2 != 0) result = result * factor; |
---|
| 766 | bb = bb / 2; |
---|
| 767 | factor = factor * factor; |
---|
| 768 | } |
---|
| 769 | return result; |
---|
| 770 | } |
---|
| 771 | |
---|
| 772 | int rChar(ring r) |
---|
| 773 | { |
---|
[9dd6a25] | 774 | #ifdef HAVE_RINGS |
---|
[a6904c] | 775 | if (rField_is_Ring_2toM(r)) |
---|
| 776 | return binaryPower(2, (int)(unsigned long)r->ringflagb); |
---|
| 777 | if (rField_is_Ring_ModN(r)) |
---|
| 778 | return (int)mpz_get_ui(r->ringflaga); |
---|
| 779 | if (rField_is_Ring_PtoM(r)) |
---|
| 780 | return binaryPower((int)mpz_get_ui(r->ringflaga), |
---|
| 781 | (int)(unsigned long)r->ringflagb); |
---|
[9dd6a25] | 782 | #endif |
---|
[a6904c] | 783 | if (rField_is_numeric(r)) |
---|
| 784 | return 0; |
---|
| 785 | if (!rIsExtension(r)) /* Q, Fp */ |
---|
| 786 | return r->ch; |
---|
| 787 | if (rField_is_Zp_a(r)) /* Fp(a) */ |
---|
| 788 | return -r->ch; |
---|
| 789 | if (rField_is_Q_a(r)) /* Q(a) */ |
---|
| 790 | return 0; |
---|
| 791 | /*else*/ /* GF(p,n) */ |
---|
| 792 | { |
---|
| 793 | if ((r->ch & 1)==0) return 2; |
---|
| 794 | int i=3; |
---|
| 795 | while ((r->ch % i)!=0) i+=2; |
---|
| 796 | return i; |
---|
| 797 | } |
---|
| 798 | } |
---|
| 799 | |
---|
| 800 | /*2 |
---|
| 801 | *returns -1 for not compatible, (sum is undefined) |
---|
| 802 | * 1 for compatible (and sum) |
---|
| 803 | */ |
---|
[9ae29a] | 804 | /* vartest: test for variable/paramter names |
---|
[a6904c] | 805 | * dp_dp: for comm. rings: use block order dp + dp/ds/wp |
---|
| 806 | */ |
---|
[9ae29a] | 807 | int rSumInternal(ring r1, ring r2, ring &sum, BOOLEAN vartest, BOOLEAN dp_dp) |
---|
[a6904c] | 808 | { |
---|
| 809 | ring save=currRing; |
---|
| 810 | ip_sring tmpR; |
---|
| 811 | memset(&tmpR,0,sizeof(tmpR)); |
---|
| 812 | /* check coeff. field =====================================================*/ |
---|
[611871] | 813 | if ((rFieldType(r1)==rFieldType(r2)) |
---|
| 814 | && (rInternalChar(r1)==rInternalChar(r2))) |
---|
[a6904c] | 815 | { |
---|
| 816 | tmpR.ch=rInternalChar(r1); |
---|
| 817 | if (rField_is_Q(r1)||rField_is_Zp(r1)||rField_is_GF(r1)) /*Q, Z/p, GF(p,n)*/ |
---|
| 818 | { |
---|
| 819 | if (r1->parameter!=NULL) |
---|
| 820 | { |
---|
[9ae29a] | 821 | if (!vartest || (strcmp(r1->parameter[0],r2->parameter[0])==0)) /* 1 par */ |
---|
| 822 | { |
---|
[a6904c] | 823 | tmpR.parameter=(char **)omAllocBin(char_ptr_bin); |
---|
| 824 | tmpR.parameter[0]=omStrDup(r1->parameter[0]); |
---|
| 825 | tmpR.P=1; |
---|
[9ae29a] | 826 | } |
---|
| 827 | else |
---|
| 828 | { |
---|
| 829 | WerrorS("GF(p,n)+GF(p,n)"); |
---|
| 830 | return -1; |
---|
| 831 | } |
---|
[a6904c] | 832 | } |
---|
| 833 | } |
---|
[611871] | 834 | else if (rField_is_Extension(r1)) /* Q(a),Z/p(a) */ |
---|
[a6904c] | 835 | { |
---|
| 836 | if (r1->minpoly!=NULL) |
---|
| 837 | { |
---|
| 838 | if (r2->minpoly!=NULL) |
---|
| 839 | { |
---|
| 840 | // HANNES: TODO: delete nSetChar |
---|
| 841 | rChangeCurrRing(r1); |
---|
[9ae29a] | 842 | if ((!vartest || (strcmp(r1->parameter[0],r2->parameter[0])==0)) /* 1 par */ |
---|
| 843 | && n_Equal(r1->minpoly,r2->minpoly, r1)) |
---|
[a6904c] | 844 | { |
---|
| 845 | tmpR.parameter=(char **)omAllocBin(char_ptr_bin); |
---|
| 846 | tmpR.parameter[0]=omStrDup(r1->parameter[0]); |
---|
| 847 | tmpR.minpoly=n_Copy(r1->minpoly, r1); |
---|
| 848 | tmpR.P=1; |
---|
| 849 | // HANNES: TODO: delete nSetChar |
---|
| 850 | rChangeCurrRing(save); |
---|
| 851 | } |
---|
| 852 | else |
---|
| 853 | { |
---|
| 854 | // HANNES: TODO: delete nSetChar |
---|
| 855 | rChangeCurrRing(save); |
---|
| 856 | WerrorS("different minpolys"); |
---|
| 857 | return -1; |
---|
| 858 | } |
---|
| 859 | } |
---|
| 860 | else |
---|
| 861 | { |
---|
[9ae29a] | 862 | if ((!vartest || (strcmp(r1->parameter[0],r2->parameter[0])==0)) /* 1 par */ |
---|
| 863 | && (rPar(r2)==1)) |
---|
[a6904c] | 864 | { |
---|
| 865 | tmpR.parameter=(char **)omAllocBin(char_ptr_bin); |
---|
| 866 | tmpR.parameter[0]=omStrDup(r1->parameter[0]); |
---|
| 867 | tmpR.P=1; |
---|
| 868 | tmpR.minpoly=n_Copy(r1->minpoly, r1); |
---|
| 869 | } |
---|
| 870 | else |
---|
| 871 | { |
---|
| 872 | WerrorS("different parameters and minpoly!=0"); |
---|
| 873 | return -1; |
---|
| 874 | } |
---|
| 875 | } |
---|
| 876 | } |
---|
| 877 | else /* r1->minpoly==NULL */ |
---|
| 878 | { |
---|
| 879 | if (r2->minpoly!=NULL) |
---|
| 880 | { |
---|
[9ae29a] | 881 | if ((!vartest || (strcmp(r1->parameter[0],r2->parameter[0])==0)) /* 1 par */ |
---|
| 882 | && (rPar(r1)==1)) |
---|
[a6904c] | 883 | { |
---|
| 884 | tmpR.parameter=(char **)omAllocBin(char_ptr_bin); |
---|
| 885 | tmpR.parameter[0]=omStrDup(r1->parameter[0]); |
---|
| 886 | tmpR.P=1; |
---|
| 887 | tmpR.minpoly=n_Copy(r2->minpoly, r2); |
---|
| 888 | } |
---|
| 889 | else |
---|
| 890 | { |
---|
| 891 | WerrorS("different parameters and minpoly!=0"); |
---|
| 892 | return -1; |
---|
| 893 | } |
---|
| 894 | } |
---|
| 895 | else |
---|
| 896 | { |
---|
| 897 | int len=rPar(r1)+rPar(r2); |
---|
| 898 | tmpR.parameter=(char **)omAlloc0(len*sizeof(char_ptr)); |
---|
| 899 | int i; |
---|
| 900 | for (i=0;i<rPar(r1);i++) |
---|
| 901 | { |
---|
| 902 | tmpR.parameter[i]=omStrDup(r1->parameter[i]); |
---|
| 903 | } |
---|
| 904 | int j,l; |
---|
| 905 | for(j=0;j<rPar(r2);j++) |
---|
| 906 | { |
---|
[9ae29a] | 907 | if (vartest) |
---|
| 908 | { |
---|
| 909 | for(l=0;l<i;l++) |
---|
| 910 | { |
---|
| 911 | if(strcmp(tmpR.parameter[l],r2->parameter[j])==0) |
---|
| 912 | break; |
---|
| 913 | } |
---|
| 914 | } |
---|
| 915 | else |
---|
| 916 | l=i; |
---|
| 917 | if (l==i) |
---|
| 918 | { |
---|
| 919 | tmpR.parameter[i]=omStrDup(r2->parameter[j]); |
---|
| 920 | i++; |
---|
| 921 | } |
---|
[a6904c] | 922 | } |
---|
| 923 | if (i!=len) |
---|
| 924 | { |
---|
[07f2e1c] | 925 | tmpR.parameter=(char**)omReallocSize(tmpR.parameter, |
---|
| 926 | len*sizeof(char_ptr), |
---|
| 927 | i*sizeof(char_ptr)); |
---|
[a6904c] | 928 | } |
---|
| 929 | tmpR.P=i; |
---|
| 930 | } |
---|
| 931 | } |
---|
| 932 | } |
---|
[611871] | 933 | #ifdef HAVE_RINGS |
---|
| 934 | else if (rField_is_Ring(r1)||rField_is_Ring(r2)) |
---|
| 935 | { |
---|
[07f2e1c] | 936 | if (r1->ringtype != r2->ringtype) |
---|
| 937 | { |
---|
| 938 | Werror("rSumInternal not yet implemented for %s", |
---|
| 939 | "different coefficient rings"); |
---|
| 940 | return -1; |
---|
| 941 | } |
---|
| 942 | else |
---|
| 943 | { |
---|
| 944 | tmpR.ch = rInternalChar(r1); |
---|
| 945 | tmpR.ringtype = r1->ringtype; |
---|
| 946 | if (r1->ringflaga != NULL) |
---|
| 947 | { |
---|
| 948 | omBin tmpBin = omGetSpecBin(sizeof(mpz_t)); |
---|
| 949 | tmpR.ringflaga = (int_number)omAllocBin(tmpBin); |
---|
| 950 | mpz_init_set(tmpR.ringflaga, (int_number)r1->ringflaga); |
---|
| 951 | } |
---|
| 952 | tmpR.ringflagb = r1->ringflagb; |
---|
| 953 | tmpR.nr2mModul = r1->nr2mModul; |
---|
| 954 | if (r1->nrnModul != NULL) |
---|
| 955 | { |
---|
| 956 | omBin tmpBin = omGetSpecBin(sizeof(mpz_t)); |
---|
| 957 | tmpR.nrnModul = (int_number)omAllocBin(tmpBin); |
---|
| 958 | mpz_init_set(tmpR.nrnModul, (int_number)r1->nrnModul); |
---|
| 959 | } |
---|
| 960 | } |
---|
[611871] | 961 | } |
---|
| 962 | #endif |
---|
[a6904c] | 963 | } |
---|
| 964 | else /* r1->ch!=r2->ch */ |
---|
| 965 | { |
---|
| 966 | if (r1->ch<-1) /* Z/p(a) */ |
---|
| 967 | { |
---|
| 968 | if ((r2->ch==0) /* Q */ |
---|
| 969 | || (r2->ch==-r1->ch)) /* Z/p */ |
---|
| 970 | { |
---|
| 971 | tmpR.ch=rInternalChar(r1); |
---|
| 972 | tmpR.P=rPar(r1); |
---|
| 973 | tmpR.parameter=(char **)omAlloc(rPar(r1)*sizeof(char_ptr)); |
---|
| 974 | int i; |
---|
| 975 | for (i=0;i<rPar(r1);i++) |
---|
| 976 | { |
---|
| 977 | tmpR.parameter[i]=omStrDup(r1->parameter[i]); |
---|
| 978 | } |
---|
| 979 | if (r1->minpoly!=NULL) |
---|
| 980 | { |
---|
| 981 | tmpR.minpoly=n_Copy(r1->minpoly, r1); |
---|
| 982 | } |
---|
| 983 | } |
---|
| 984 | else /* R, Q(a),Z/q,Z/p(a),GF(p,n) */ |
---|
| 985 | { |
---|
| 986 | WerrorS("Z/p(a)+(R,Q(a),Z/q(a),GF(q,n))"); |
---|
| 987 | return -1; |
---|
| 988 | } |
---|
| 989 | } |
---|
| 990 | else if (r1->ch==-1) /* R */ |
---|
| 991 | { |
---|
| 992 | WerrorS("R+.."); |
---|
| 993 | return -1; |
---|
| 994 | } |
---|
| 995 | else if (r1->ch==0) /* Q */ |
---|
| 996 | { |
---|
| 997 | if ((r2->ch<-1)||(r2->ch==1)) /* Z/p(a),Q(a) */ |
---|
| 998 | { |
---|
| 999 | tmpR.ch=rInternalChar(r2); |
---|
| 1000 | tmpR.P=rPar(r2); |
---|
| 1001 | tmpR.parameter=(char **)omAlloc(rPar(r2)*sizeof(char_ptr)); |
---|
| 1002 | int i; |
---|
| 1003 | for (i=0;i<rPar(r2);i++) |
---|
| 1004 | { |
---|
| 1005 | tmpR.parameter[i]=omStrDup(r2->parameter[i]); |
---|
| 1006 | } |
---|
| 1007 | if (r2->minpoly!=NULL) |
---|
| 1008 | { |
---|
| 1009 | tmpR.minpoly=n_Copy(r2->minpoly, r2); |
---|
| 1010 | } |
---|
| 1011 | } |
---|
| 1012 | else if (r2->ch>1) /* Z/p,GF(p,n) */ |
---|
| 1013 | { |
---|
| 1014 | tmpR.ch=r2->ch; |
---|
| 1015 | if (r2->parameter!=NULL) |
---|
| 1016 | { |
---|
| 1017 | tmpR.parameter=(char **)omAllocBin(char_ptr_bin); |
---|
| 1018 | tmpR.P=1; |
---|
| 1019 | tmpR.parameter[0]=omStrDup(r2->parameter[0]); |
---|
| 1020 | } |
---|
| 1021 | } |
---|
| 1022 | else |
---|
| 1023 | { |
---|
| 1024 | WerrorS("Q+R"); |
---|
| 1025 | return -1; /* R */ |
---|
| 1026 | } |
---|
| 1027 | } |
---|
| 1028 | else if (r1->ch==1) /* Q(a) */ |
---|
| 1029 | { |
---|
| 1030 | if (r2->ch==0) /* Q */ |
---|
| 1031 | { |
---|
| 1032 | tmpR.ch=rInternalChar(r1); |
---|
| 1033 | tmpR.P=rPar(r1); |
---|
| 1034 | tmpR.parameter=(char **)omAlloc(rPar(r1)*sizeof(char_ptr)); |
---|
| 1035 | int i; |
---|
| 1036 | for(i=0;i<rPar(r1);i++) |
---|
| 1037 | { |
---|
| 1038 | tmpR.parameter[i]=omStrDup(r1->parameter[i]); |
---|
| 1039 | } |
---|
| 1040 | if (r1->minpoly!=NULL) |
---|
| 1041 | { |
---|
| 1042 | tmpR.minpoly=n_Copy(r1->minpoly, r1); |
---|
| 1043 | } |
---|
| 1044 | } |
---|
| 1045 | else /* R, Z/p,GF(p,n) */ |
---|
| 1046 | { |
---|
| 1047 | WerrorS("Q(a)+(R,Z/p,GF(p,n))"); |
---|
| 1048 | return -1; |
---|
| 1049 | } |
---|
| 1050 | } |
---|
| 1051 | else /* r1->ch >=2 , Z/p */ |
---|
| 1052 | { |
---|
| 1053 | if (r2->ch==0) /* Q */ |
---|
| 1054 | { |
---|
| 1055 | tmpR.ch=r1->ch; |
---|
| 1056 | } |
---|
| 1057 | else if (r2->ch==-r1->ch) /* Z/p(a) */ |
---|
| 1058 | { |
---|
| 1059 | tmpR.ch=rInternalChar(r2); |
---|
| 1060 | tmpR.P=rPar(r2); |
---|
| 1061 | tmpR.parameter=(char **)omAlloc(rPar(r2)*sizeof(char_ptr)); |
---|
| 1062 | int i; |
---|
| 1063 | for(i=0;i<rPar(r2);i++) |
---|
| 1064 | { |
---|
| 1065 | tmpR.parameter[i]=omStrDup(r2->parameter[i]); |
---|
| 1066 | } |
---|
| 1067 | if (r2->minpoly!=NULL) |
---|
| 1068 | { |
---|
| 1069 | tmpR.minpoly=n_Copy(r2->minpoly, r2); |
---|
| 1070 | } |
---|
| 1071 | } |
---|
| 1072 | else |
---|
| 1073 | { |
---|
| 1074 | WerrorS("Z/p+(GF(q,n),Z/q(a),R,Q(a))"); |
---|
| 1075 | return -1; /* GF(p,n),Z/q(a),R,Q(a) */ |
---|
| 1076 | } |
---|
| 1077 | } |
---|
| 1078 | } |
---|
| 1079 | /* variable names ========================================================*/ |
---|
| 1080 | int i,j,k; |
---|
| 1081 | int l=r1->N+r2->N; |
---|
| 1082 | char **names=(char **)omAlloc0(l*sizeof(char_ptr)); |
---|
| 1083 | k=0; |
---|
| 1084 | |
---|
| 1085 | // collect all varnames from r1, except those which are parameters |
---|
| 1086 | // of r2, or those which are the empty string |
---|
| 1087 | for (i=0;i<r1->N;i++) |
---|
| 1088 | { |
---|
| 1089 | BOOLEAN b=TRUE; |
---|
| 1090 | |
---|
| 1091 | if (*(r1->names[i]) == '\0') |
---|
| 1092 | b = FALSE; |
---|
[9ae29a] | 1093 | else if ((r2->parameter!=NULL) && (strlen(r1->names[i])==1)) |
---|
| 1094 | { |
---|
| 1095 | if (vartest) |
---|
| 1096 | { |
---|
| 1097 | for(j=0;j<rPar(r2);j++) |
---|
| 1098 | { |
---|
| 1099 | if (strcmp(r1->names[i],r2->parameter[j])==0) |
---|
| 1100 | { |
---|
| 1101 | b=FALSE; |
---|
| 1102 | break; |
---|
| 1103 | } |
---|
| 1104 | } |
---|
| 1105 | } |
---|
| 1106 | } |
---|
[a6904c] | 1107 | |
---|
| 1108 | if (b) |
---|
| 1109 | { |
---|
| 1110 | //Print("name : %d: %s\n",k,r1->names[i]); |
---|
| 1111 | names[k]=omStrDup(r1->names[i]); |
---|
| 1112 | k++; |
---|
| 1113 | } |
---|
| 1114 | //else |
---|
| 1115 | // Print("no name (par1) %s\n",r1->names[i]); |
---|
| 1116 | } |
---|
| 1117 | // Add variables from r2, except those which are parameters of r1 |
---|
| 1118 | // those which are empty strings, and those which equal a var of r1 |
---|
| 1119 | for(i=0;i<r2->N;i++) |
---|
| 1120 | { |
---|
| 1121 | BOOLEAN b=TRUE; |
---|
| 1122 | |
---|
| 1123 | if (*(r2->names[i]) == '\0') |
---|
| 1124 | b = FALSE; |
---|
[9ae29a] | 1125 | else if ((r1->parameter!=NULL) && (strlen(r2->names[i])==1)) |
---|
| 1126 | { |
---|
| 1127 | if (vartest) |
---|
| 1128 | { |
---|
| 1129 | for(j=0;j<rPar(r1);j++) |
---|
| 1130 | { |
---|
| 1131 | if (strcmp(r2->names[i],r1->parameter[j])==0) |
---|
| 1132 | { |
---|
| 1133 | b=FALSE; |
---|
| 1134 | break; |
---|
| 1135 | } |
---|
| 1136 | } |
---|
| 1137 | } |
---|
| 1138 | } |
---|
[a6904c] | 1139 | |
---|
| 1140 | if (b) |
---|
| 1141 | { |
---|
[9ae29a] | 1142 | if (vartest) |
---|
| 1143 | { |
---|
| 1144 | for(j=0;j<r1->N;j++) |
---|
| 1145 | { |
---|
| 1146 | if (strcmp(r1->names[j],r2->names[i])==0) |
---|
| 1147 | { |
---|
| 1148 | b=FALSE; |
---|
| 1149 | break; |
---|
| 1150 | } |
---|
| 1151 | } |
---|
| 1152 | } |
---|
| 1153 | if (b) |
---|
| 1154 | { |
---|
| 1155 | //Print("name : %d : %s\n",k,r2->names[i]); |
---|
| 1156 | names[k]=omStrDup(r2->names[i]); |
---|
| 1157 | k++; |
---|
| 1158 | } |
---|
| 1159 | //else |
---|
| 1160 | // Print("no name (var): %s\n",r2->names[i]); |
---|
[a6904c] | 1161 | } |
---|
| 1162 | //else |
---|
| 1163 | // Print("no name (par): %s\n",r2->names[i]); |
---|
| 1164 | } |
---|
| 1165 | // check whether we found any vars at all |
---|
| 1166 | if (k == 0) |
---|
| 1167 | { |
---|
| 1168 | names[k]=omStrDup(""); |
---|
| 1169 | k=1; |
---|
| 1170 | } |
---|
| 1171 | tmpR.N=k; |
---|
| 1172 | tmpR.names=names; |
---|
| 1173 | /* ordering *======================================================== */ |
---|
| 1174 | tmpR.OrdSgn=1; |
---|
| 1175 | if (dp_dp |
---|
| 1176 | #ifdef HAVE_PLURAL |
---|
| 1177 | && !rIsPluralRing(r1) && !rIsPluralRing(r2) |
---|
| 1178 | #endif |
---|
| 1179 | ) |
---|
| 1180 | { |
---|
| 1181 | tmpR.order=(int*)omAlloc(4*sizeof(int)); |
---|
| 1182 | tmpR.block0=(int*)omAlloc0(4*sizeof(int)); |
---|
| 1183 | tmpR.block1=(int*)omAlloc0(4*sizeof(int)); |
---|
| 1184 | tmpR.wvhdl=(int**)omAlloc0(4*sizeof(int_ptr)); |
---|
| 1185 | tmpR.order[0]=ringorder_dp; |
---|
| 1186 | tmpR.block0[0]=1; |
---|
| 1187 | tmpR.block1[0]=rVar(r1); |
---|
| 1188 | if (r2->OrdSgn==1) |
---|
| 1189 | { |
---|
| 1190 | if ((r2->block0[0]==1) |
---|
| 1191 | && (r2->block1[0]==rVar(r2)) |
---|
| 1192 | && ((r2->order[0]==ringorder_wp) |
---|
| 1193 | || (r2->order[0]==ringorder_Wp) |
---|
| 1194 | || (r2->order[0]==ringorder_Dp)) |
---|
| 1195 | ) |
---|
| 1196 | { |
---|
| 1197 | tmpR.order[1]=r2->order[0]; |
---|
| 1198 | if (r2->wvhdl[0]!=NULL) |
---|
| 1199 | tmpR.wvhdl[1]=(int *)omMemDup(r2->wvhdl[0]); |
---|
| 1200 | } |
---|
| 1201 | else |
---|
| 1202 | tmpR.order[1]=ringorder_dp; |
---|
| 1203 | } |
---|
| 1204 | else |
---|
| 1205 | { |
---|
| 1206 | tmpR.order[1]=ringorder_ds; |
---|
| 1207 | tmpR.OrdSgn=-1; |
---|
| 1208 | } |
---|
| 1209 | tmpR.block0[1]=rVar(r1)+1; |
---|
| 1210 | tmpR.block1[1]=rVar(r1)+rVar(r2); |
---|
| 1211 | tmpR.order[2]=ringorder_C; |
---|
| 1212 | tmpR.order[3]=0; |
---|
| 1213 | } |
---|
| 1214 | else |
---|
| 1215 | { |
---|
| 1216 | if ((r1->order[0]==ringorder_unspec) |
---|
| 1217 | && (r2->order[0]==ringorder_unspec)) |
---|
| 1218 | { |
---|
| 1219 | tmpR.order=(int*)omAlloc(3*sizeof(int)); |
---|
| 1220 | tmpR.block0=(int*)omAlloc(3*sizeof(int)); |
---|
| 1221 | tmpR.block1=(int*)omAlloc(3*sizeof(int)); |
---|
| 1222 | tmpR.wvhdl=(int**)omAlloc0(3*sizeof(int_ptr)); |
---|
| 1223 | tmpR.order[0]=ringorder_unspec; |
---|
| 1224 | tmpR.order[1]=ringorder_C; |
---|
| 1225 | tmpR.order[2]=0; |
---|
| 1226 | tmpR.block0[0]=1; |
---|
| 1227 | tmpR.block1[0]=tmpR.N; |
---|
| 1228 | } |
---|
| 1229 | else if (l==k) /* r3=r1+r2 */ |
---|
| 1230 | { |
---|
| 1231 | int b; |
---|
| 1232 | ring rb; |
---|
| 1233 | if (r1->order[0]==ringorder_unspec) |
---|
| 1234 | { |
---|
| 1235 | /* extend order of r2 to r3 */ |
---|
| 1236 | b=rBlocks(r2); |
---|
| 1237 | rb=r2; |
---|
| 1238 | tmpR.OrdSgn=r2->OrdSgn; |
---|
| 1239 | } |
---|
| 1240 | else if (r2->order[0]==ringorder_unspec) |
---|
| 1241 | { |
---|
| 1242 | /* extend order of r1 to r3 */ |
---|
| 1243 | b=rBlocks(r1); |
---|
| 1244 | rb=r1; |
---|
| 1245 | tmpR.OrdSgn=r1->OrdSgn; |
---|
| 1246 | } |
---|
| 1247 | else |
---|
| 1248 | { |
---|
| 1249 | b=rBlocks(r1)+rBlocks(r2)-2; /* for only one order C, only one 0 */ |
---|
| 1250 | rb=NULL; |
---|
| 1251 | } |
---|
| 1252 | tmpR.order=(int*)omAlloc0(b*sizeof(int)); |
---|
| 1253 | tmpR.block0=(int*)omAlloc0(b*sizeof(int)); |
---|
| 1254 | tmpR.block1=(int*)omAlloc0(b*sizeof(int)); |
---|
| 1255 | tmpR.wvhdl=(int**)omAlloc0(b*sizeof(int_ptr)); |
---|
| 1256 | /* weights not implemented yet ...*/ |
---|
| 1257 | if (rb!=NULL) |
---|
| 1258 | { |
---|
| 1259 | for (i=0;i<b;i++) |
---|
| 1260 | { |
---|
| 1261 | tmpR.order[i]=rb->order[i]; |
---|
| 1262 | tmpR.block0[i]=rb->block0[i]; |
---|
| 1263 | tmpR.block1[i]=rb->block1[i]; |
---|
| 1264 | if (rb->wvhdl[i]!=NULL) |
---|
| 1265 | WarnS("rSum: weights not implemented"); |
---|
| 1266 | } |
---|
| 1267 | tmpR.block0[0]=1; |
---|
| 1268 | } |
---|
| 1269 | else /* ring sum for complete rings */ |
---|
| 1270 | { |
---|
| 1271 | for (i=0;r1->order[i]!=0;i++) |
---|
| 1272 | { |
---|
| 1273 | tmpR.order[i]=r1->order[i]; |
---|
| 1274 | tmpR.block0[i]=r1->block0[i]; |
---|
| 1275 | tmpR.block1[i]=r1->block1[i]; |
---|
| 1276 | if (r1->wvhdl[i]!=NULL) |
---|
| 1277 | tmpR.wvhdl[i] = (int*) omMemDup(r1->wvhdl[i]); |
---|
| 1278 | } |
---|
| 1279 | j=i; |
---|
| 1280 | i--; |
---|
| 1281 | if ((r1->order[i]==ringorder_c) |
---|
| 1282 | ||(r1->order[i]==ringorder_C)) |
---|
| 1283 | { |
---|
| 1284 | j--; |
---|
| 1285 | tmpR.order[b-2]=r1->order[i]; |
---|
| 1286 | } |
---|
| 1287 | for (i=0;r2->order[i]!=0;i++) |
---|
| 1288 | { |
---|
| 1289 | if ((r2->order[i]!=ringorder_c) |
---|
| 1290 | &&(r2->order[i]!=ringorder_C)) |
---|
| 1291 | { |
---|
| 1292 | tmpR.order[j]=r2->order[i]; |
---|
| 1293 | tmpR.block0[j]=r2->block0[i]+rVar(r1); |
---|
| 1294 | tmpR.block1[j]=r2->block1[i]+rVar(r1); |
---|
| 1295 | if (r2->wvhdl[i]!=NULL) |
---|
| 1296 | { |
---|
| 1297 | tmpR.wvhdl[j] = (int*) omMemDup(r2->wvhdl[i]); |
---|
| 1298 | } |
---|
| 1299 | j++; |
---|
| 1300 | } |
---|
| 1301 | } |
---|
| 1302 | if((r1->OrdSgn==-1)||(r2->OrdSgn==-1)) |
---|
| 1303 | tmpR.OrdSgn=-1; |
---|
| 1304 | } |
---|
| 1305 | } |
---|
[07f2e1c] | 1306 | else if ((k==rVar(r1)) && (k==rVar(r2))) /* r1 and r2 are "quite" |
---|
| 1307 | the same ring */ |
---|
[a6904c] | 1308 | /* copy r1, because we have the variables from r1 */ |
---|
| 1309 | { |
---|
| 1310 | int b=rBlocks(r1); |
---|
| 1311 | |
---|
| 1312 | tmpR.order=(int*)omAlloc0(b*sizeof(int)); |
---|
| 1313 | tmpR.block0=(int*)omAlloc0(b*sizeof(int)); |
---|
| 1314 | tmpR.block1=(int*)omAlloc0(b*sizeof(int)); |
---|
| 1315 | tmpR.wvhdl=(int**)omAlloc0(b*sizeof(int_ptr)); |
---|
| 1316 | /* weights not implemented yet ...*/ |
---|
| 1317 | for (i=0;i<b;i++) |
---|
| 1318 | { |
---|
| 1319 | tmpR.order[i]=r1->order[i]; |
---|
| 1320 | tmpR.block0[i]=r1->block0[i]; |
---|
| 1321 | tmpR.block1[i]=r1->block1[i]; |
---|
| 1322 | if (r1->wvhdl[i]!=NULL) |
---|
| 1323 | { |
---|
| 1324 | tmpR.wvhdl[i] = (int*) omMemDup(r1->wvhdl[i]); |
---|
| 1325 | } |
---|
| 1326 | } |
---|
| 1327 | tmpR.OrdSgn=r1->OrdSgn; |
---|
| 1328 | } |
---|
| 1329 | else |
---|
| 1330 | { |
---|
| 1331 | for(i=0;i<k;i++) omFree((ADDRESS)tmpR.names[i]); |
---|
| 1332 | omFreeSize((ADDRESS)names,tmpR.N*sizeof(char_ptr)); |
---|
| 1333 | Werror("difficulties with variables: %d,%d -> %d",rVar(r1),rVar(r2),k); |
---|
| 1334 | return -1; |
---|
| 1335 | } |
---|
| 1336 | } |
---|
| 1337 | sum=(ring)omAllocBin(sip_sring_bin); |
---|
| 1338 | memcpy(sum,&tmpR,sizeof(ip_sring)); |
---|
| 1339 | rComplete(sum); |
---|
| 1340 | |
---|
| 1341 | //#ifdef RDEBUG |
---|
| 1342 | // rDebugPrint(sum); |
---|
| 1343 | //#endif |
---|
| 1344 | |
---|
| 1345 | #ifdef HAVE_PLURAL |
---|
| 1346 | if(1) |
---|
| 1347 | { |
---|
| 1348 | ring old_ring = currRing; |
---|
| 1349 | |
---|
| 1350 | BOOLEAN R1_is_nc = rIsPluralRing(r1); |
---|
| 1351 | BOOLEAN R2_is_nc = rIsPluralRing(r2); |
---|
| 1352 | |
---|
| 1353 | if ( (R1_is_nc) || (R2_is_nc)) |
---|
| 1354 | { |
---|
| 1355 | rChangeCurrRing(r1); /* since rCopy works well only in currRing */ |
---|
| 1356 | ring R1 = rCopy(r1); |
---|
| 1357 | if ( !R1_is_nc ) nc_rCreateNCcomm(R1); |
---|
| 1358 | |
---|
| 1359 | #if 0 |
---|
| 1360 | #ifdef RDEBUG |
---|
| 1361 | rWrite(R1); |
---|
| 1362 | rDebugPrint(R1); |
---|
| 1363 | #endif |
---|
| 1364 | #endif |
---|
| 1365 | rChangeCurrRing(r2); |
---|
| 1366 | ring R2 = rCopy(r2); |
---|
| 1367 | if ( !R2_is_nc ) nc_rCreateNCcomm(R2); |
---|
| 1368 | |
---|
| 1369 | #if 0 |
---|
| 1370 | #ifdef RDEBUG |
---|
| 1371 | rWrite(R2); |
---|
| 1372 | rDebugPrint(R2); |
---|
| 1373 | #endif |
---|
| 1374 | #endif |
---|
| 1375 | |
---|
| 1376 | rChangeCurrRing(sum); // ? |
---|
| 1377 | |
---|
| 1378 | // Projections from R_i into Sum: |
---|
| 1379 | /* multiplication matrices business: */ |
---|
| 1380 | /* find permutations of vars and pars */ |
---|
| 1381 | int *perm1 = (int *)omAlloc0((rVar(R1)+1)*sizeof(int)); |
---|
| 1382 | int *par_perm1 = NULL; |
---|
| 1383 | if (rPar(R1)!=0) par_perm1=(int *)omAlloc0((rPar(R1)+1)*sizeof(int)); |
---|
| 1384 | |
---|
| 1385 | int *perm2 = (int *)omAlloc0((rVar(R2)+1)*sizeof(int)); |
---|
| 1386 | int *par_perm2 = NULL; |
---|
| 1387 | if (rPar(R2)!=0) par_perm2=(int *)omAlloc0((rPar(R2)+1)*sizeof(int)); |
---|
| 1388 | |
---|
| 1389 | maFindPerm(R1->names, rVar(R1), R1->parameter, rPar(R1), |
---|
| 1390 | sum->names, rVar(sum), sum->parameter, rPar(sum), |
---|
| 1391 | perm1, par_perm1, sum->ch); |
---|
| 1392 | |
---|
| 1393 | maFindPerm(R2->names, rVar(R2), R2->parameter, rPar(R2), |
---|
| 1394 | sum->names, rVar(sum), sum->parameter, rPar(sum), |
---|
| 1395 | perm2, par_perm2, sum->ch); |
---|
| 1396 | |
---|
| 1397 | |
---|
| 1398 | matrix C1 = R1->GetNC()->C, C2 = R2->GetNC()->C; |
---|
| 1399 | matrix D1 = R1->GetNC()->D, D2 = R2->GetNC()->D; |
---|
| 1400 | |
---|
| 1401 | // !!!! BUG? C1 and C2 might live in different baserings!!! |
---|
| 1402 | // it cannot be both the currRing! :) |
---|
| 1403 | // the currRing is sum! |
---|
| 1404 | |
---|
| 1405 | int l = rVar(R1) + rVar(R2); |
---|
| 1406 | |
---|
| 1407 | matrix C = mpNew(l,l); |
---|
| 1408 | matrix D = mpNew(l,l); |
---|
| 1409 | |
---|
| 1410 | for (i = 1; i <= rVar(R1); i++) |
---|
| 1411 | for (j= rVar(R1)+1; j <= l; j++) |
---|
| 1412 | MATELEM(C,i,j) = p_One( sum); // in 'sum' |
---|
| 1413 | |
---|
| 1414 | idTest((ideal)C); |
---|
| 1415 | |
---|
[07f2e1c] | 1416 | nMapFunc nMap1 = nSetMap(R1); /* can change something global: not usable |
---|
| 1417 | after the next nSetMap call :( */ |
---|
[a6904c] | 1418 | // Create blocked C and D matrices: |
---|
| 1419 | for (i=1; i<= rVar(R1); i++) |
---|
| 1420 | for (j=i+1; j<=rVar(R1); j++) |
---|
| 1421 | { |
---|
| 1422 | assume(MATELEM(C1,i,j) != NULL); |
---|
| 1423 | MATELEM(C,i,j) = pPermPoly(MATELEM(C1,i,j), perm1, R1, nMap1, par_perm1, rPar(R1)); // need ADD + CMP ops. |
---|
| 1424 | |
---|
| 1425 | if (MATELEM(D1,i,j) != NULL) |
---|
| 1426 | MATELEM(D,i,j) = pPermPoly(MATELEM(D1,i,j),perm1,R1,nMap1,par_perm1,rPar(R1)); |
---|
| 1427 | } |
---|
| 1428 | |
---|
| 1429 | idTest((ideal)C); |
---|
| 1430 | idTest((ideal)D); |
---|
| 1431 | |
---|
| 1432 | |
---|
[07f2e1c] | 1433 | nMapFunc nMap2 = nSetMap(R2); /* can change something global: not usable |
---|
| 1434 | after the next nSetMap call :( */ |
---|
[a6904c] | 1435 | for (i=1; i<= rVar(R2); i++) |
---|
| 1436 | for (j=i+1; j<=rVar(R2); j++) |
---|
| 1437 | { |
---|
| 1438 | assume(MATELEM(C2,i,j) != NULL); |
---|
| 1439 | MATELEM(C,rVar(R1)+i,rVar(R1)+j) = pPermPoly(MATELEM(C2,i,j),perm2,R2,nMap2,par_perm2,rPar(R2)); |
---|
| 1440 | |
---|
| 1441 | if (MATELEM(D2,i,j) != NULL) |
---|
| 1442 | MATELEM(D,rVar(R1)+i,rVar(R1)+j) = pPermPoly(MATELEM(D2,i,j),perm2,R2,nMap2,par_perm2,rPar(R2)); |
---|
| 1443 | } |
---|
| 1444 | |
---|
| 1445 | idTest((ideal)C); |
---|
| 1446 | idTest((ideal)D); |
---|
| 1447 | |
---|
| 1448 | // Now sum is non-commutative with blocked structure constants! |
---|
| 1449 | if (nc_CallPlural(C, D, NULL, NULL, sum, false, false, true, sum)) |
---|
| 1450 | WarnS("Error initializing non-commutative multiplication!"); |
---|
| 1451 | |
---|
| 1452 | /* delete R1, R2*/ |
---|
| 1453 | |
---|
| 1454 | #if 0 |
---|
| 1455 | #ifdef RDEBUG |
---|
| 1456 | rWrite(sum); |
---|
| 1457 | rDebugPrint(sum); |
---|
| 1458 | |
---|
| 1459 | Print("\nRefs: R1: %d, R2: %d\n", R1->GetNC()->ref, R2->GetNC()->ref); |
---|
| 1460 | |
---|
| 1461 | #endif |
---|
| 1462 | #endif |
---|
| 1463 | |
---|
| 1464 | |
---|
| 1465 | rDelete(R1); |
---|
| 1466 | rDelete(R2); |
---|
| 1467 | |
---|
| 1468 | /* delete perm arrays */ |
---|
| 1469 | if (perm1!=NULL) omFree((ADDRESS)perm1); |
---|
| 1470 | if (perm2!=NULL) omFree((ADDRESS)perm2); |
---|
| 1471 | if (par_perm1!=NULL) omFree((ADDRESS)par_perm1); |
---|
| 1472 | if (par_perm2!=NULL) omFree((ADDRESS)par_perm2); |
---|
| 1473 | |
---|
| 1474 | rChangeCurrRing(old_ring); |
---|
| 1475 | } |
---|
| 1476 | |
---|
| 1477 | } |
---|
| 1478 | #endif |
---|
| 1479 | |
---|
| 1480 | ideal Q=NULL; |
---|
| 1481 | ideal Q1=NULL, Q2=NULL; |
---|
| 1482 | ring old_ring2 = currRing; |
---|
| 1483 | if (r1->qideal!=NULL) |
---|
| 1484 | { |
---|
| 1485 | rChangeCurrRing(sum); |
---|
| 1486 | // if (r2->qideal!=NULL) |
---|
| 1487 | // { |
---|
| 1488 | // WerrorS("todo: qring+qring"); |
---|
| 1489 | // return -1; |
---|
| 1490 | // } |
---|
| 1491 | // else |
---|
| 1492 | // {} |
---|
| 1493 | /* these were defined in the Plural Part above... */ |
---|
| 1494 | int *perm1 = (int *)omAlloc0((rVar(r1)+1)*sizeof(int)); |
---|
| 1495 | int *par_perm1 = NULL; |
---|
| 1496 | if (rPar(r1)!=0) par_perm1=(int *)omAlloc0((rPar(r1)+1)*sizeof(int)); |
---|
| 1497 | maFindPerm(r1->names, rVar(r1), r1->parameter, rPar(r1), |
---|
| 1498 | sum->names, rVar(sum), sum->parameter, rPar(sum), |
---|
| 1499 | perm1, par_perm1, sum->ch); |
---|
| 1500 | nMapFunc nMap1 = nSetMap(r1); |
---|
| 1501 | Q1 = idInit(IDELEMS(r1->qideal),1); |
---|
| 1502 | for (int for_i=0;for_i<IDELEMS(r1->qideal);for_i++) |
---|
| 1503 | Q1->m[for_i] = pPermPoly(r1->qideal->m[for_i],perm1,r1,nMap1,par_perm1,rPar(r1)); |
---|
| 1504 | omFree((ADDRESS)perm1); |
---|
| 1505 | } |
---|
| 1506 | |
---|
| 1507 | if (r2->qideal!=NULL) |
---|
| 1508 | { |
---|
| 1509 | if (currRing!=sum) |
---|
| 1510 | rChangeCurrRing(sum); |
---|
| 1511 | int *perm2 = (int *)omAlloc0((rVar(r2)+1)*sizeof(int)); |
---|
| 1512 | int *par_perm2 = NULL; |
---|
| 1513 | if (rPar(r2)!=0) par_perm2=(int *)omAlloc0((rPar(r2)+1)*sizeof(int)); |
---|
| 1514 | maFindPerm(r2->names, rVar(r2), r2->parameter, rPar(r2), |
---|
| 1515 | sum->names, rVar(sum), sum->parameter, rPar(sum), |
---|
| 1516 | perm2, par_perm2, sum->ch); |
---|
| 1517 | nMapFunc nMap2 = nSetMap(r2); |
---|
| 1518 | Q2 = idInit(IDELEMS(r2->qideal),1); |
---|
| 1519 | for (int for_i=0;for_i<IDELEMS(r2->qideal);for_i++) |
---|
| 1520 | Q2->m[for_i] = pPermPoly(r2->qideal->m[for_i],perm2,r2,nMap2,par_perm2,rPar(r2)); |
---|
| 1521 | omFree((ADDRESS)perm2); |
---|
| 1522 | } |
---|
| 1523 | if ( (Q1!=NULL) || ( Q2!=NULL)) |
---|
| 1524 | { |
---|
| 1525 | Q = idSimpleAdd(Q1,Q2); |
---|
| 1526 | rChangeCurrRing(old_ring2); |
---|
| 1527 | } |
---|
| 1528 | sum->qideal = Q; |
---|
| 1529 | |
---|
| 1530 | #ifdef HAVE_PLURAL |
---|
| 1531 | if( rIsPluralRing(sum) ) |
---|
| 1532 | nc_SetupQuotient( sum ); |
---|
| 1533 | #endif |
---|
| 1534 | return 1; |
---|
| 1535 | } |
---|
| 1536 | |
---|
| 1537 | /*2 |
---|
| 1538 | *returns -1 for not compatible, (sum is undefined) |
---|
| 1539 | * 0 for equal, (and sum) |
---|
| 1540 | * 1 for compatible (and sum) |
---|
| 1541 | */ |
---|
| 1542 | int rSum(ring r1, ring r2, ring &sum) |
---|
| 1543 | { |
---|
| 1544 | if (r1==r2) |
---|
| 1545 | { |
---|
| 1546 | sum=r1; |
---|
| 1547 | r1->ref++; |
---|
| 1548 | return 0; |
---|
| 1549 | } |
---|
[83bde7] | 1550 | return rSumInternal(r1,r2,sum,TRUE,FALSE); |
---|
[a6904c] | 1551 | } |
---|
| 1552 | |
---|
| 1553 | /*2 |
---|
| 1554 | * create a copy of the ring r, which must be equivalent to currRing |
---|
| 1555 | * used for qring definition,.. |
---|
| 1556 | * (i.e.: normal rings: same nCopy as currRing; |
---|
| 1557 | * qring: same nCopy, same idCopy as currRing) |
---|
| 1558 | * DOES NOT CALL rComplete |
---|
| 1559 | */ |
---|
| 1560 | ring rCopy0(const ring r, BOOLEAN copy_qideal, BOOLEAN copy_ordering) |
---|
| 1561 | { |
---|
| 1562 | if (r == NULL) return NULL; |
---|
| 1563 | int i,j; |
---|
| 1564 | ring res=(ring)omAllocBin(sip_sring_bin); |
---|
| 1565 | memset(res,0,sizeof(ip_sring)); |
---|
[611871] | 1566 | //memcpy(res,r,sizeof(ip_sring)); |
---|
[a6904c] | 1567 | //memset: res->idroot=NULL; /* local objects */ |
---|
| 1568 | //ideal minideal; |
---|
| 1569 | res->options=r->options; /* ring dependent options */ |
---|
| 1570 | |
---|
| 1571 | //memset: res->ordsgn=NULL; |
---|
| 1572 | //memset: res->typ=NULL; |
---|
| 1573 | //memset: res->VarOffset=NULL; |
---|
| 1574 | //memset: res->firstwv=NULL; |
---|
| 1575 | |
---|
[c5e0e1] | 1576 | //struct omBin PolyBin; /* Bin from where monoms are allocated */ |
---|
[a6904c] | 1577 | //memset: res->PolyBin=NULL; // rComplete |
---|
| 1578 | res->ch=r->ch; /* characteristic */ |
---|
| 1579 | #ifdef HAVE_RINGS |
---|
| 1580 | res->ringtype=r->ringtype; /* cring = 0 => coefficient field, cring = 1 => coeffs from Z/2^m */ |
---|
| 1581 | if (r->ringflaga!=NULL) |
---|
| 1582 | { |
---|
| 1583 | res->ringflaga = (int_number) omAlloc(sizeof(mpz_t)); |
---|
| 1584 | mpz_init_set(res->ringflaga,r->ringflaga); |
---|
| 1585 | } |
---|
| 1586 | res->ringflagb=r->ringflagb; |
---|
| 1587 | if (r->nrnModul!=NULL) |
---|
| 1588 | { |
---|
| 1589 | res->nrnModul = (int_number) omAlloc(sizeof(mpz_t)); |
---|
| 1590 | mpz_init_set(res->nrnModul,r->nrnModul); |
---|
| 1591 | } |
---|
| 1592 | #endif |
---|
| 1593 | //memset: res->ref=0; /* reference counter to the ring */ |
---|
| 1594 | |
---|
| 1595 | res->float_len=r->float_len; /* additional char-flags */ |
---|
| 1596 | res->float_len2=r->float_len2; /* additional char-flags */ |
---|
| 1597 | |
---|
| 1598 | res->N=r->N; /* number of vars */ |
---|
| 1599 | res->P=r->P; /* number of pars */ |
---|
| 1600 | res->OrdSgn=r->OrdSgn; /* 1 for polynomial rings, -1 otherwise */ |
---|
| 1601 | |
---|
| 1602 | res->firstBlockEnds=r->firstBlockEnds; |
---|
| 1603 | #ifdef HAVE_PLURAL |
---|
| 1604 | res->real_var_start=r->real_var_start; |
---|
| 1605 | res->real_var_end=r->real_var_end; |
---|
| 1606 | #endif |
---|
| 1607 | |
---|
| 1608 | #ifdef HAVE_SHIFTBBA |
---|
| 1609 | res->isLPring=r->isLPring; /* 0 for non-letterplace rings, otherwise the number of LP blocks, at least 1, known also as lV */ |
---|
| 1610 | #endif |
---|
| 1611 | |
---|
| 1612 | res->VectorOut=r->VectorOut; |
---|
| 1613 | res->ShortOut=r->ShortOut; |
---|
| 1614 | res->CanShortOut=r->CanShortOut; |
---|
| 1615 | res->LexOrder=r->LexOrder; // TRUE if the monomial ordering has polynomial and power series blocks |
---|
| 1616 | res->MixedOrder=r->MixedOrder; // ?? 1 for lex ordering (except ls), -1 otherwise |
---|
| 1617 | res->ComponentOrder=r->ComponentOrder; |
---|
| 1618 | |
---|
| 1619 | //memset: res->ExpL_Size=0; |
---|
| 1620 | //memset: res->CmpL_Size=0; |
---|
| 1621 | //memset: res->VarL_Size=0; |
---|
| 1622 | //memset: res->pCompIndex=0; |
---|
| 1623 | //memset: res->pOrdIndex=0; |
---|
| 1624 | //memset: res->OrdSize=0; |
---|
| 1625 | //memset: res->VarL_LowIndex=0; |
---|
| 1626 | //memset: res->MinExpPerLong=0; |
---|
| 1627 | //memset: res->NegWeightL_Size=0; |
---|
| 1628 | //memset: res->NegWeightL_Offset=NULL; |
---|
| 1629 | //memset: res->VarL_Offset=NULL; |
---|
| 1630 | |
---|
| 1631 | // the following are set by rComplete unless predefined |
---|
| 1632 | // therefore, we copy these values: maybe they are non-standard |
---|
| 1633 | /* mask for getting single exponents */ |
---|
| 1634 | res->bitmask=r->bitmask; |
---|
| 1635 | res->divmask=r->divmask; |
---|
| 1636 | res->BitsPerExp = r->BitsPerExp; |
---|
| 1637 | res->ExpPerLong = r->ExpPerLong; |
---|
| 1638 | |
---|
| 1639 | //memset: res->p_Procs=NULL; |
---|
| 1640 | //memset: res->pFDeg=NULL; |
---|
| 1641 | //memset: res->pLDeg=NULL; |
---|
| 1642 | //memset: res->pFDegOrig=NULL; |
---|
| 1643 | //memset: res->pLDegOrig=NULL; |
---|
| 1644 | //memset: res->p_Setm=NULL; |
---|
| 1645 | //memset: res->cf=NULL; |
---|
| 1646 | res->options=r->options; |
---|
| 1647 | #ifdef HAVE_RINGS |
---|
| 1648 | res->ringtype=r->ringtype; |
---|
| 1649 | #endif |
---|
| 1650 | // |
---|
| 1651 | if (r->algring!=NULL) |
---|
| 1652 | r->algring->ref++; |
---|
| 1653 | res->algring=r->algring; |
---|
| 1654 | //memset: res->minideal=NULL; |
---|
| 1655 | if (r->parameter!=NULL) |
---|
| 1656 | { |
---|
[6139c4] | 1657 | if (r->minpoly!=NULL) res->minpoly=nCopy(r->minpoly); |
---|
[a6904c] | 1658 | int l=rPar(r); |
---|
| 1659 | res->parameter=(char **)omAlloc(l*sizeof(char_ptr)); |
---|
| 1660 | int i; |
---|
| 1661 | for(i=0;i<rPar(r);i++) |
---|
| 1662 | { |
---|
| 1663 | res->parameter[i]=omStrDup(r->parameter[i]); |
---|
| 1664 | } |
---|
| 1665 | if (r->minideal!=NULL) |
---|
| 1666 | { |
---|
| 1667 | res->minideal=id_Copy(r->minideal,r->algring); |
---|
| 1668 | } |
---|
| 1669 | } |
---|
| 1670 | if (copy_ordering == TRUE) |
---|
| 1671 | { |
---|
| 1672 | i=rBlocks(r); |
---|
| 1673 | res->wvhdl = (int **)omAlloc(i * sizeof(int_ptr)); |
---|
| 1674 | res->order = (int *) omAlloc(i * sizeof(int)); |
---|
| 1675 | res->block0 = (int *) omAlloc(i * sizeof(int)); |
---|
| 1676 | res->block1 = (int *) omAlloc(i * sizeof(int)); |
---|
| 1677 | for (j=0; j<i; j++) |
---|
| 1678 | { |
---|
| 1679 | if (r->wvhdl[j]!=NULL) |
---|
| 1680 | { |
---|
| 1681 | res->wvhdl[j] = (int*) omMemDup(r->wvhdl[j]); |
---|
| 1682 | } |
---|
| 1683 | else |
---|
| 1684 | res->wvhdl[j]=NULL; |
---|
| 1685 | } |
---|
[611871] | 1686 | memcpy(res->order,r->order,i * sizeof(int)); |
---|
| 1687 | memcpy(res->block0,r->block0,i * sizeof(int)); |
---|
| 1688 | memcpy(res->block1,r->block1,i * sizeof(int)); |
---|
[a6904c] | 1689 | } |
---|
| 1690 | //memset: else |
---|
| 1691 | //memset: { |
---|
| 1692 | //memset: res->wvhdl = NULL; |
---|
| 1693 | //memset: res->order = NULL; |
---|
| 1694 | //memset: res->block0 = NULL; |
---|
| 1695 | //memset: res->block1 = NULL; |
---|
| 1696 | //memset: } |
---|
| 1697 | |
---|
| 1698 | res->names = (char **)omAlloc0(rVar(r) * sizeof(char_ptr)); |
---|
| 1699 | for (i=0; i<rVar(res); i++) |
---|
| 1700 | { |
---|
| 1701 | res->names[i] = omStrDup(r->names[i]); |
---|
| 1702 | } |
---|
| 1703 | if (r->qideal!=NULL) |
---|
| 1704 | { |
---|
| 1705 | if (copy_qideal) |
---|
| 1706 | { |
---|
| 1707 | #ifndef NDEBUG |
---|
| 1708 | if (!copy_ordering) |
---|
| 1709 | WerrorS("internal error: rCopy0(Q,TRUE,FALSE)"); |
---|
| 1710 | else |
---|
| 1711 | #endif |
---|
| 1712 | { |
---|
| 1713 | #ifndef NDEBUG |
---|
| 1714 | WarnS("internal bad stuff: rCopy0(Q,TRUE,TRUE)"); |
---|
| 1715 | #endif |
---|
| 1716 | rComplete(res); |
---|
| 1717 | res->qideal= idrCopyR_NoSort(r->qideal, r, res); |
---|
| 1718 | rUnComplete(res); |
---|
| 1719 | } |
---|
| 1720 | } |
---|
| 1721 | //memset: else res->qideal = NULL; |
---|
| 1722 | } |
---|
| 1723 | //memset: else res->qideal = NULL; |
---|
| 1724 | //memset: res->GetNC() = NULL; // copy is purely commutative!!! |
---|
| 1725 | return res; |
---|
| 1726 | } |
---|
| 1727 | |
---|
| 1728 | /*2 |
---|
| 1729 | * create a copy of the ring r, which must be equivalent to currRing |
---|
| 1730 | * used for qring definition,.. |
---|
| 1731 | * (i.e.: normal rings: same nCopy as currRing; |
---|
| 1732 | * qring: same nCopy, same idCopy as currRing) |
---|
| 1733 | */ |
---|
| 1734 | ring rCopy(ring r) |
---|
| 1735 | { |
---|
| 1736 | if (r == NULL) return NULL; |
---|
| 1737 | ring res=rCopy0(r,FALSE,TRUE); |
---|
| 1738 | rComplete(res, 1); // res is purely commutative so far |
---|
| 1739 | if (r->qideal!=NULL) res->qideal=idrCopyR_NoSort(r->qideal, r, res); |
---|
| 1740 | |
---|
| 1741 | #ifdef HAVE_PLURAL |
---|
| 1742 | if (rIsPluralRing(r)) |
---|
| 1743 | if( nc_rCopy(res, r, true) ); |
---|
| 1744 | #endif |
---|
| 1745 | |
---|
| 1746 | return res; |
---|
| 1747 | } |
---|
| 1748 | |
---|
| 1749 | // returns TRUE, if r1 equals r2 FALSE, otherwise Equality is |
---|
| 1750 | // determined componentwise, if qr == 1, then qrideal equality is |
---|
| 1751 | // tested, as well |
---|
| 1752 | BOOLEAN rEqual(ring r1, ring r2, BOOLEAN qr) |
---|
| 1753 | { |
---|
| 1754 | int i, j; |
---|
| 1755 | |
---|
| 1756 | if (r1 == r2) return TRUE; |
---|
| 1757 | |
---|
| 1758 | if (r1 == NULL || r2 == NULL) return FALSE; |
---|
| 1759 | |
---|
| 1760 | if ((rInternalChar(r1) != rInternalChar(r2)) |
---|
| 1761 | || (r1->float_len != r2->float_len) |
---|
| 1762 | || (r1->float_len2 != r2->float_len2) |
---|
| 1763 | || (rVar(r1) != rVar(r2)) |
---|
| 1764 | || (r1->OrdSgn != r2->OrdSgn) |
---|
| 1765 | || (rPar(r1) != rPar(r2))) |
---|
| 1766 | return FALSE; |
---|
| 1767 | |
---|
| 1768 | for (i=0; i<rVar(r1); i++) |
---|
| 1769 | { |
---|
| 1770 | if (r1->names[i] != NULL && r2->names[i] != NULL) |
---|
| 1771 | { |
---|
| 1772 | if (strcmp(r1->names[i], r2->names[i])) return FALSE; |
---|
| 1773 | } |
---|
| 1774 | else if ((r1->names[i] != NULL) ^ (r2->names[i] != NULL)) |
---|
| 1775 | { |
---|
| 1776 | return FALSE; |
---|
| 1777 | } |
---|
| 1778 | } |
---|
| 1779 | |
---|
| 1780 | i=0; |
---|
| 1781 | while (r1->order[i] != 0) |
---|
| 1782 | { |
---|
| 1783 | if (r2->order[i] == 0) return FALSE; |
---|
| 1784 | if ((r1->order[i] != r2->order[i]) |
---|
| 1785 | || (r1->block0[i] != r2->block0[i]) |
---|
| 1786 | || (r1->block1[i] != r2->block1[i])) |
---|
| 1787 | return FALSE; |
---|
| 1788 | if (r1->wvhdl[i] != NULL) |
---|
| 1789 | { |
---|
| 1790 | if (r2->wvhdl[i] == NULL) |
---|
| 1791 | return FALSE; |
---|
| 1792 | for (j=0; j<r1->block1[i]-r1->block0[i]+1; j++) |
---|
| 1793 | if (r2->wvhdl[i][j] != r1->wvhdl[i][j]) |
---|
| 1794 | return FALSE; |
---|
| 1795 | } |
---|
| 1796 | else if (r2->wvhdl[i] != NULL) return FALSE; |
---|
| 1797 | i++; |
---|
| 1798 | } |
---|
| 1799 | if (r2->order[i] != 0) return FALSE; |
---|
| 1800 | |
---|
| 1801 | for (i=0; i<rPar(r1);i++) |
---|
| 1802 | { |
---|
| 1803 | if (strcmp(r1->parameter[i], r2->parameter[i])!=0) |
---|
| 1804 | return FALSE; |
---|
| 1805 | } |
---|
| 1806 | |
---|
| 1807 | if (r1->minpoly != NULL) |
---|
| 1808 | { |
---|
| 1809 | if (r2->minpoly == NULL) return FALSE; |
---|
| 1810 | if (currRing == r1 || currRing == r2) |
---|
| 1811 | { |
---|
| 1812 | if (! nEqual(r1->minpoly, r2->minpoly)) return FALSE; |
---|
| 1813 | } |
---|
| 1814 | } |
---|
| 1815 | else if (r2->minpoly != NULL) return FALSE; |
---|
| 1816 | |
---|
| 1817 | if (qr) |
---|
| 1818 | { |
---|
| 1819 | if (r1->qideal != NULL) |
---|
| 1820 | { |
---|
| 1821 | ideal id1 = r1->qideal, id2 = r2->qideal; |
---|
| 1822 | int i, n; |
---|
| 1823 | poly *m1, *m2; |
---|
| 1824 | |
---|
| 1825 | if (id2 == NULL) return FALSE; |
---|
| 1826 | if ((n = IDELEMS(id1)) != IDELEMS(id2)) return FALSE; |
---|
| 1827 | |
---|
| 1828 | if (currRing == r1 || currRing == r2) |
---|
| 1829 | { |
---|
| 1830 | m1 = id1->m; |
---|
| 1831 | m2 = id2->m; |
---|
| 1832 | for (i=0; i<n; i++) |
---|
| 1833 | if (! pEqualPolys(m1[i],m2[i])) return FALSE; |
---|
| 1834 | } |
---|
| 1835 | } |
---|
| 1836 | else if (r2->qideal != NULL) return FALSE; |
---|
| 1837 | } |
---|
| 1838 | |
---|
| 1839 | return TRUE; |
---|
| 1840 | } |
---|
| 1841 | |
---|
| 1842 | // returns TRUE, if r1 and r2 represents the monomials in the same way |
---|
| 1843 | // FALSE, otherwise |
---|
| 1844 | // this is an analogue to rEqual but not so strict |
---|
| 1845 | BOOLEAN rSamePolyRep(ring r1, ring r2) |
---|
| 1846 | { |
---|
| 1847 | int i, j; |
---|
| 1848 | |
---|
| 1849 | if (r1 == r2) return TRUE; |
---|
| 1850 | |
---|
| 1851 | if (r1 == NULL || r2 == NULL) return FALSE; |
---|
| 1852 | |
---|
| 1853 | if ((rInternalChar(r1) != rInternalChar(r2)) |
---|
| 1854 | || (r1->float_len != r2->float_len) |
---|
| 1855 | || (r1->float_len2 != r2->float_len2) |
---|
| 1856 | || (rVar(r1) != rVar(r2)) |
---|
| 1857 | || (r1->OrdSgn != r2->OrdSgn) |
---|
| 1858 | || (rPar(r1) != rPar(r2))) |
---|
| 1859 | return FALSE; |
---|
| 1860 | |
---|
| 1861 | if (rVar(r1)!=rVar(r2)) return FALSE; |
---|
| 1862 | if (rPar(r1)!=rPar(r2)) return FALSE; |
---|
| 1863 | |
---|
| 1864 | i=0; |
---|
| 1865 | while (r1->order[i] != 0) |
---|
| 1866 | { |
---|
| 1867 | if (r2->order[i] == 0) return FALSE; |
---|
| 1868 | if ((r1->order[i] != r2->order[i]) |
---|
| 1869 | || (r1->block0[i] != r2->block0[i]) |
---|
| 1870 | || (r1->block1[i] != r2->block1[i])) |
---|
| 1871 | return FALSE; |
---|
| 1872 | if (r1->wvhdl[i] != NULL) |
---|
| 1873 | { |
---|
| 1874 | if (r2->wvhdl[i] == NULL) |
---|
| 1875 | return FALSE; |
---|
| 1876 | for (j=0; j<r1->block1[i]-r1->block0[i]+1; j++) |
---|
| 1877 | if (r2->wvhdl[i][j] != r1->wvhdl[i][j]) |
---|
| 1878 | return FALSE; |
---|
| 1879 | } |
---|
| 1880 | else if (r2->wvhdl[i] != NULL) return FALSE; |
---|
| 1881 | i++; |
---|
| 1882 | } |
---|
| 1883 | if (r2->order[i] != 0) return FALSE; |
---|
| 1884 | |
---|
| 1885 | // we do not check minpoly |
---|
| 1886 | // we do not check qideal |
---|
| 1887 | |
---|
| 1888 | return TRUE; |
---|
| 1889 | } |
---|
| 1890 | |
---|
| 1891 | rOrderType_t rGetOrderType(ring r) |
---|
| 1892 | { |
---|
| 1893 | // check for simple ordering |
---|
| 1894 | if (rHasSimpleOrder(r)) |
---|
| 1895 | { |
---|
| 1896 | if ((r->order[1] == ringorder_c) |
---|
| 1897 | || (r->order[1] == ringorder_C)) |
---|
| 1898 | { |
---|
| 1899 | switch(r->order[0]) |
---|
| 1900 | { |
---|
| 1901 | case ringorder_dp: |
---|
| 1902 | case ringorder_wp: |
---|
| 1903 | case ringorder_ds: |
---|
| 1904 | case ringorder_ws: |
---|
| 1905 | case ringorder_ls: |
---|
| 1906 | case ringorder_unspec: |
---|
| 1907 | if (r->order[1] == ringorder_C |
---|
| 1908 | || r->order[0] == ringorder_unspec) |
---|
| 1909 | return rOrderType_ExpComp; |
---|
| 1910 | return rOrderType_Exp; |
---|
| 1911 | |
---|
| 1912 | default: |
---|
| 1913 | assume(r->order[0] == ringorder_lp || |
---|
| 1914 | r->order[0] == ringorder_rs || |
---|
| 1915 | r->order[0] == ringorder_Dp || |
---|
| 1916 | r->order[0] == ringorder_Wp || |
---|
| 1917 | r->order[0] == ringorder_Ds || |
---|
| 1918 | r->order[0] == ringorder_Ws); |
---|
| 1919 | |
---|
| 1920 | if (r->order[1] == ringorder_c) return rOrderType_ExpComp; |
---|
| 1921 | return rOrderType_Exp; |
---|
| 1922 | } |
---|
| 1923 | } |
---|
| 1924 | else |
---|
| 1925 | { |
---|
| 1926 | assume((r->order[0]==ringorder_c)||(r->order[0]==ringorder_C)); |
---|
| 1927 | return rOrderType_CompExp; |
---|
| 1928 | } |
---|
| 1929 | } |
---|
| 1930 | else |
---|
| 1931 | return rOrderType_General; |
---|
| 1932 | } |
---|
| 1933 | |
---|
| 1934 | BOOLEAN rHasSimpleOrder(const ring r) |
---|
| 1935 | { |
---|
| 1936 | if (r->order[0] == ringorder_unspec) return TRUE; |
---|
| 1937 | int blocks = rBlocks(r) - 1; |
---|
| 1938 | assume(blocks >= 1); |
---|
| 1939 | if (blocks == 1) return TRUE; |
---|
[273fed] | 1940 | |
---|
| 1941 | int s = 0; |
---|
| 1942 | while( (s < blocks) && (r->order[s] == ringorder_IS) && (r->order[blocks-1] == ringorder_IS) ) |
---|
| 1943 | { |
---|
| 1944 | s++; |
---|
| 1945 | blocks--; |
---|
| 1946 | } |
---|
| 1947 | |
---|
| 1948 | if ((blocks - s) > 2) return FALSE; |
---|
| 1949 | |
---|
| 1950 | assume( blocks == s + 2 ); |
---|
| 1951 | |
---|
| 1952 | if ( |
---|
| 1953 | (r->order[s] != ringorder_c) |
---|
| 1954 | && (r->order[s] != ringorder_C) |
---|
| 1955 | && (r->order[s+1] != ringorder_c) |
---|
| 1956 | && (r->order[s+1] != ringorder_C) |
---|
| 1957 | ) |
---|
[a6904c] | 1958 | return FALSE; |
---|
[273fed] | 1959 | if ((r->order[s+1] == ringorder_M) |
---|
| 1960 | || (r->order[s] == ringorder_M)) |
---|
[a6904c] | 1961 | return FALSE; |
---|
| 1962 | return TRUE; |
---|
| 1963 | } |
---|
| 1964 | |
---|
| 1965 | // returns TRUE, if simple lp or ls ordering |
---|
| 1966 | BOOLEAN rHasSimpleLexOrder(const ring r) |
---|
| 1967 | { |
---|
| 1968 | return rHasSimpleOrder(r) && |
---|
| 1969 | (r->order[0] == ringorder_ls || |
---|
| 1970 | r->order[0] == ringorder_lp || |
---|
| 1971 | r->order[1] == ringorder_ls || |
---|
| 1972 | r->order[1] == ringorder_lp); |
---|
| 1973 | } |
---|
| 1974 | |
---|
| 1975 | BOOLEAN rOrder_is_DegOrdering(const rRingOrder_t order) |
---|
| 1976 | { |
---|
| 1977 | switch(order) |
---|
| 1978 | { |
---|
| 1979 | case ringorder_dp: |
---|
| 1980 | case ringorder_Dp: |
---|
| 1981 | case ringorder_ds: |
---|
| 1982 | case ringorder_Ds: |
---|
| 1983 | case ringorder_Ws: |
---|
| 1984 | case ringorder_Wp: |
---|
| 1985 | case ringorder_ws: |
---|
| 1986 | case ringorder_wp: |
---|
| 1987 | return TRUE; |
---|
| 1988 | |
---|
| 1989 | default: |
---|
| 1990 | return FALSE; |
---|
| 1991 | } |
---|
| 1992 | } |
---|
| 1993 | |
---|
| 1994 | BOOLEAN rOrder_is_WeightedOrdering(rRingOrder_t order) |
---|
| 1995 | { |
---|
| 1996 | switch(order) |
---|
| 1997 | { |
---|
| 1998 | case ringorder_Ws: |
---|
| 1999 | case ringorder_Wp: |
---|
| 2000 | case ringorder_ws: |
---|
| 2001 | case ringorder_wp: |
---|
| 2002 | return TRUE; |
---|
| 2003 | |
---|
| 2004 | default: |
---|
| 2005 | return FALSE; |
---|
| 2006 | } |
---|
| 2007 | } |
---|
| 2008 | |
---|
| 2009 | BOOLEAN rHasSimpleOrderAA(ring r) |
---|
| 2010 | { |
---|
[273fed] | 2011 | if (r->order[0] == ringorder_unspec) return TRUE; |
---|
[a6904c] | 2012 | int blocks = rBlocks(r) - 1; |
---|
[273fed] | 2013 | assume(blocks >= 1); |
---|
| 2014 | if (blocks == 1) return TRUE; |
---|
| 2015 | |
---|
| 2016 | int s = 0; |
---|
| 2017 | while( (s < blocks) && (r->order[s] == ringorder_IS) && (r->order[blocks-1] == ringorder_IS) ) |
---|
[a6904c] | 2018 | { |
---|
[273fed] | 2019 | s++; |
---|
| 2020 | blocks--; |
---|
| 2021 | } |
---|
| 2022 | |
---|
| 2023 | if ((blocks - s) > 3) return FALSE; |
---|
| 2024 | |
---|
| 2025 | // if ((blocks > 3) || (blocks < 2)) return FALSE; |
---|
| 2026 | if ((blocks - s) == 3) |
---|
| 2027 | { |
---|
| 2028 | return (((r->order[s] == ringorder_aa) && (r->order[s+1] != ringorder_M) && |
---|
| 2029 | ((r->order[s+2] == ringorder_c) || (r->order[s+2] == ringorder_C))) || |
---|
| 2030 | (((r->order[s] == ringorder_c) || (r->order[s] == ringorder_C)) && |
---|
| 2031 | (r->order[s+1] == ringorder_aa) && (r->order[s+2] != ringorder_M))); |
---|
[a6904c] | 2032 | } |
---|
| 2033 | else |
---|
| 2034 | { |
---|
[273fed] | 2035 | return ((r->order[s] == ringorder_aa) && (r->order[s+1] != ringorder_M)); |
---|
[a6904c] | 2036 | } |
---|
| 2037 | } |
---|
| 2038 | |
---|
| 2039 | // return TRUE if p_SetComp requires p_Setm |
---|
| 2040 | BOOLEAN rOrd_SetCompRequiresSetm(ring r) |
---|
| 2041 | { |
---|
| 2042 | if (r->typ != NULL) |
---|
| 2043 | { |
---|
| 2044 | int pos; |
---|
| 2045 | for (pos=0;pos<r->OrdSize;pos++) |
---|
| 2046 | { |
---|
| 2047 | sro_ord* o=&(r->typ[pos]); |
---|
| 2048 | if ((o->ord_typ == ro_syzcomp) || (o->ord_typ == ro_syz) || (o->ord_typ == ro_is) || (o->ord_typ == ro_isTemp)) return TRUE; |
---|
| 2049 | } |
---|
| 2050 | } |
---|
| 2051 | return FALSE; |
---|
| 2052 | } |
---|
| 2053 | |
---|
| 2054 | // return TRUE if p->exp[r->pOrdIndex] holds total degree of p */ |
---|
| 2055 | BOOLEAN rOrd_is_Totaldegree_Ordering(ring r) |
---|
| 2056 | { |
---|
| 2057 | // Hmm.... what about Syz orderings? |
---|
| 2058 | return (rVar(r) > 1 && |
---|
| 2059 | ((rHasSimpleOrder(r) && |
---|
| 2060 | (rOrder_is_DegOrdering((rRingOrder_t)r->order[0]) || |
---|
| 2061 | rOrder_is_DegOrdering(( rRingOrder_t)r->order[1]))) || |
---|
| 2062 | (rHasSimpleOrderAA(r) && |
---|
| 2063 | (rOrder_is_DegOrdering((rRingOrder_t)r->order[1]) || |
---|
| 2064 | rOrder_is_DegOrdering((rRingOrder_t)r->order[2]))))); |
---|
| 2065 | } |
---|
| 2066 | |
---|
| 2067 | // return TRUE if p->exp[r->pOrdIndex] holds a weighted degree of p */ |
---|
| 2068 | BOOLEAN rOrd_is_WeightedDegree_Ordering(ring r =currRing) |
---|
| 2069 | { |
---|
| 2070 | // Hmm.... what about Syz orderings? |
---|
| 2071 | return ((rVar(r) > 1) && |
---|
| 2072 | rHasSimpleOrder(r) && |
---|
| 2073 | (rOrder_is_WeightedOrdering((rRingOrder_t)r->order[0]) || |
---|
| 2074 | rOrder_is_WeightedOrdering(( rRingOrder_t)r->order[1]))); |
---|
| 2075 | } |
---|
| 2076 | |
---|
| 2077 | BOOLEAN rIsPolyVar(int v, ring r) |
---|
| 2078 | { |
---|
| 2079 | int i=0; |
---|
| 2080 | while(r->order[i]!=0) |
---|
| 2081 | { |
---|
| 2082 | if((r->block0[i]<=v) |
---|
| 2083 | && (r->block1[i]>=v)) |
---|
| 2084 | { |
---|
| 2085 | switch(r->order[i]) |
---|
| 2086 | { |
---|
| 2087 | case ringorder_a: |
---|
| 2088 | return (r->wvhdl[i][v-r->block0[i]]>0); |
---|
| 2089 | case ringorder_M: |
---|
| 2090 | return 2; /*don't know*/ |
---|
| 2091 | case ringorder_a64: /* assume: all weight are non-negative!*/ |
---|
| 2092 | case ringorder_lp: |
---|
| 2093 | case ringorder_rs: |
---|
| 2094 | case ringorder_dp: |
---|
| 2095 | case ringorder_Dp: |
---|
| 2096 | case ringorder_wp: |
---|
| 2097 | case ringorder_Wp: |
---|
| 2098 | return TRUE; |
---|
| 2099 | case ringorder_ls: |
---|
| 2100 | case ringorder_ds: |
---|
| 2101 | case ringorder_Ds: |
---|
| 2102 | case ringorder_ws: |
---|
| 2103 | case ringorder_Ws: |
---|
| 2104 | return FALSE; |
---|
| 2105 | default: |
---|
| 2106 | break; |
---|
| 2107 | } |
---|
| 2108 | } |
---|
| 2109 | i++; |
---|
| 2110 | } |
---|
| 2111 | return 3; /* could not find var v*/ |
---|
| 2112 | } |
---|
| 2113 | |
---|
| 2114 | #ifdef RDEBUG |
---|
| 2115 | // This should eventually become a full-fledge ring check, like pTest |
---|
| 2116 | BOOLEAN rDBTest(ring r, const char* fn, const int l) |
---|
| 2117 | { |
---|
| 2118 | int i,j; |
---|
| 2119 | |
---|
| 2120 | if (r == NULL) |
---|
| 2121 | { |
---|
| 2122 | dReportError("Null ring in %s:%d", fn, l); |
---|
| 2123 | return FALSE; |
---|
| 2124 | } |
---|
| 2125 | |
---|
| 2126 | |
---|
| 2127 | if (r->N == 0) return TRUE; |
---|
| 2128 | |
---|
| 2129 | // omCheckAddrSize(r,sizeof(ip_sring)); |
---|
| 2130 | #if OM_CHECK > 0 |
---|
| 2131 | i=rBlocks(r); |
---|
| 2132 | omCheckAddrSize(r->order,i*sizeof(int)); |
---|
| 2133 | omCheckAddrSize(r->block0,i*sizeof(int)); |
---|
| 2134 | omCheckAddrSize(r->block1,i*sizeof(int)); |
---|
| 2135 | if (r->wvhdl!=NULL) |
---|
| 2136 | { |
---|
[f2de2e] | 2137 | omCheckAddrSize(r->wvhdl,i*sizeof(int *)); |
---|
| 2138 | for (j=0;j<i; j++) |
---|
| 2139 | { |
---|
| 2140 | if (r->wvhdl[j] != NULL) omCheckAddr(r->wvhdl[j]); |
---|
| 2141 | } |
---|
[a6904c] | 2142 | } |
---|
| 2143 | #endif |
---|
| 2144 | if (r->VarOffset == NULL) |
---|
| 2145 | { |
---|
| 2146 | dReportError("Null ring VarOffset -- no rComplete (?) in n %s:%d", fn, l); |
---|
| 2147 | return FALSE; |
---|
| 2148 | } |
---|
| 2149 | omCheckAddrSize(r->VarOffset,(r->N+1)*sizeof(int)); |
---|
| 2150 | |
---|
| 2151 | if ((r->OrdSize==0)!=(r->typ==NULL)) |
---|
| 2152 | { |
---|
| 2153 | dReportError("mismatch OrdSize and typ-pointer in %s:%d"); |
---|
| 2154 | return FALSE; |
---|
| 2155 | } |
---|
| 2156 | omcheckAddrSize(r->typ,r->OrdSize*sizeof(*(r->typ))); |
---|
| 2157 | omCheckAddrSize(r->VarOffset,(r->N+1)*sizeof(*(r->VarOffset))); |
---|
| 2158 | // test assumptions: |
---|
| 2159 | for(i=0;i<=r->N;i++) // for all variables (i = 0..N) |
---|
| 2160 | { |
---|
| 2161 | if(r->typ!=NULL) |
---|
| 2162 | { |
---|
| 2163 | for(j=0;j<r->OrdSize;j++) // for all ordering blocks (j =0..OrdSize-1) |
---|
| 2164 | { |
---|
| 2165 | if(r->typ[j].ord_typ == ro_isTemp) |
---|
| 2166 | { |
---|
| 2167 | const int p = r->typ[j].data.isTemp.suffixpos; |
---|
| 2168 | |
---|
| 2169 | if(p <= j) |
---|
| 2170 | dReportError("ordrec prefix %d is unmatched",j); |
---|
| 2171 | |
---|
| 2172 | assume( p < r->OrdSize ); |
---|
| 2173 | |
---|
| 2174 | if(r->typ[p].ord_typ != ro_is) |
---|
| 2175 | dReportError("ordrec prefix %d is unmatched (suffix: %d is wrong!!!)",j, p); |
---|
| 2176 | |
---|
| 2177 | // Skip all intermediate blocks for undone variables: |
---|
| 2178 | if(r->typ[j].data.isTemp.pVarOffset[i] != -1) // Check i^th variable |
---|
| 2179 | { |
---|
| 2180 | j = p - 1; // SKIP ALL INTERNAL BLOCKS...??? |
---|
| 2181 | continue; // To make for check OrdSize bound... |
---|
| 2182 | } |
---|
| 2183 | } |
---|
| 2184 | else if (r->typ[j].ord_typ == ro_is) |
---|
| 2185 | { |
---|
| 2186 | // Skip all intermediate blocks for undone variables: |
---|
| 2187 | if(r->typ[j].data.is.pVarOffset[i] != -1) |
---|
| 2188 | { |
---|
| 2189 | // ??? |
---|
| 2190 | } |
---|
| 2191 | |
---|
| 2192 | } |
---|
| 2193 | else |
---|
| 2194 | { |
---|
| 2195 | if (r->typ[j].ord_typ==ro_cp) |
---|
| 2196 | { |
---|
| 2197 | if(((short)r->VarOffset[i]) == r->typ[j].data.cp.place) |
---|
| 2198 | dReportError("ordrec %d conflicts with var %d",j,i); |
---|
| 2199 | } |
---|
| 2200 | else |
---|
| 2201 | if ((r->typ[j].ord_typ!=ro_syzcomp) |
---|
| 2202 | && (r->VarOffset[i] == r->typ[j].data.dp.place)) |
---|
| 2203 | dReportError("ordrec %d conflicts with var %d",j,i); |
---|
| 2204 | } |
---|
| 2205 | } |
---|
| 2206 | } |
---|
| 2207 | int tmp; |
---|
| 2208 | tmp=r->VarOffset[i] & 0xffffff; |
---|
| 2209 | #if SIZEOF_LONG == 8 |
---|
| 2210 | if ((r->VarOffset[i] >> 24) >63) |
---|
| 2211 | #else |
---|
| 2212 | if ((r->VarOffset[i] >> 24) >31) |
---|
| 2213 | #endif |
---|
| 2214 | dReportError("bit_start out of range:%d",r->VarOffset[i] >> 24); |
---|
| 2215 | if (i > 0 && ((tmp<0) ||(tmp>r->ExpL_Size-1))) |
---|
| 2216 | { |
---|
| 2217 | dReportError("varoffset out of range for var %d: %d",i,tmp); |
---|
| 2218 | } |
---|
| 2219 | } |
---|
| 2220 | if(r->typ!=NULL) |
---|
| 2221 | { |
---|
| 2222 | for(j=0;j<r->OrdSize;j++) |
---|
| 2223 | { |
---|
| 2224 | if ((r->typ[j].ord_typ==ro_dp) |
---|
| 2225 | || (r->typ[j].ord_typ==ro_wp) |
---|
| 2226 | || (r->typ[j].ord_typ==ro_wp_neg)) |
---|
| 2227 | { |
---|
| 2228 | if (r->typ[j].data.dp.start > r->typ[j].data.dp.end) |
---|
| 2229 | dReportError("in ordrec %d: start(%d) > end(%d)",j, |
---|
| 2230 | r->typ[j].data.dp.start, r->typ[j].data.dp.end); |
---|
| 2231 | if ((r->typ[j].data.dp.start < 1) |
---|
| 2232 | || (r->typ[j].data.dp.end > r->N)) |
---|
| 2233 | dReportError("in ordrec %d: start(%d)<1 or end(%d)>vars(%d)",j, |
---|
| 2234 | r->typ[j].data.dp.start, r->typ[j].data.dp.end,r->N); |
---|
| 2235 | } |
---|
| 2236 | } |
---|
| 2237 | } |
---|
| 2238 | if (r->minpoly!=NULL) |
---|
| 2239 | { |
---|
| 2240 | omCheckAddr(r->minpoly); |
---|
| 2241 | } |
---|
| 2242 | //assume(r->cf!=NULL); |
---|
| 2243 | |
---|
| 2244 | return TRUE; |
---|
| 2245 | } |
---|
| 2246 | #endif |
---|
| 2247 | |
---|
| 2248 | static void rO_Align(int &place, int &bitplace) |
---|
| 2249 | { |
---|
| 2250 | // increment place to the next aligned one |
---|
| 2251 | // (count as Exponent_t,align as longs) |
---|
| 2252 | if (bitplace!=BITS_PER_LONG) |
---|
| 2253 | { |
---|
| 2254 | place++; |
---|
| 2255 | bitplace=BITS_PER_LONG; |
---|
| 2256 | } |
---|
| 2257 | } |
---|
| 2258 | |
---|
| 2259 | static void rO_TDegree(int &place, int &bitplace, int start, int end, |
---|
| 2260 | long *o, sro_ord &ord_struct) |
---|
| 2261 | { |
---|
| 2262 | // degree (aligned) of variables v_start..v_end, ordsgn 1 |
---|
| 2263 | rO_Align(place,bitplace); |
---|
| 2264 | ord_struct.ord_typ=ro_dp; |
---|
| 2265 | ord_struct.data.dp.start=start; |
---|
| 2266 | ord_struct.data.dp.end=end; |
---|
| 2267 | ord_struct.data.dp.place=place; |
---|
| 2268 | o[place]=1; |
---|
| 2269 | place++; |
---|
| 2270 | rO_Align(place,bitplace); |
---|
| 2271 | } |
---|
| 2272 | |
---|
| 2273 | static void rO_TDegree_neg(int &place, int &bitplace, int start, int end, |
---|
| 2274 | long *o, sro_ord &ord_struct) |
---|
| 2275 | { |
---|
| 2276 | // degree (aligned) of variables v_start..v_end, ordsgn -1 |
---|
| 2277 | rO_Align(place,bitplace); |
---|
| 2278 | ord_struct.ord_typ=ro_dp; |
---|
| 2279 | ord_struct.data.dp.start=start; |
---|
| 2280 | ord_struct.data.dp.end=end; |
---|
| 2281 | ord_struct.data.dp.place=place; |
---|
| 2282 | o[place]=-1; |
---|
| 2283 | place++; |
---|
| 2284 | rO_Align(place,bitplace); |
---|
| 2285 | } |
---|
| 2286 | |
---|
| 2287 | static void rO_WDegree(int &place, int &bitplace, int start, int end, |
---|
| 2288 | long *o, sro_ord &ord_struct, int *weights) |
---|
| 2289 | { |
---|
| 2290 | // weighted degree (aligned) of variables v_start..v_end, ordsgn 1 |
---|
| 2291 | while((start<end) && (weights[0]==0)) { start++; weights++; } |
---|
| 2292 | while((start<end) && (weights[end-start]==0)) { end--; } |
---|
| 2293 | int i; |
---|
| 2294 | int pure_tdeg=1; |
---|
| 2295 | for(i=start;i<=end;i++) |
---|
| 2296 | { |
---|
| 2297 | if(weights[i-start]!=1) |
---|
| 2298 | { |
---|
| 2299 | pure_tdeg=0; |
---|
| 2300 | break; |
---|
| 2301 | } |
---|
| 2302 | } |
---|
| 2303 | if (pure_tdeg) |
---|
| 2304 | { |
---|
| 2305 | rO_TDegree(place,bitplace,start,end,o,ord_struct); |
---|
| 2306 | return; |
---|
| 2307 | } |
---|
| 2308 | rO_Align(place,bitplace); |
---|
| 2309 | ord_struct.ord_typ=ro_wp; |
---|
| 2310 | ord_struct.data.wp.start=start; |
---|
| 2311 | ord_struct.data.wp.end=end; |
---|
| 2312 | ord_struct.data.wp.place=place; |
---|
| 2313 | ord_struct.data.wp.weights=weights; |
---|
| 2314 | o[place]=1; |
---|
| 2315 | place++; |
---|
| 2316 | rO_Align(place,bitplace); |
---|
| 2317 | for(i=start;i<=end;i++) |
---|
| 2318 | { |
---|
| 2319 | if(weights[i-start]<0) |
---|
| 2320 | { |
---|
| 2321 | ord_struct.ord_typ=ro_wp_neg; |
---|
| 2322 | break; |
---|
| 2323 | } |
---|
| 2324 | } |
---|
| 2325 | } |
---|
| 2326 | |
---|
| 2327 | static void rO_WDegree64(int &place, int &bitplace, int start, int end, |
---|
| 2328 | long *o, sro_ord &ord_struct, int64 *weights) |
---|
| 2329 | { |
---|
| 2330 | // weighted degree (aligned) of variables v_start..v_end, ordsgn 1, |
---|
| 2331 | // reserved 2 places |
---|
| 2332 | rO_Align(place,bitplace); |
---|
| 2333 | ord_struct.ord_typ=ro_wp64; |
---|
| 2334 | ord_struct.data.wp64.start=start; |
---|
| 2335 | ord_struct.data.wp64.end=end; |
---|
| 2336 | ord_struct.data.wp64.place=place; |
---|
| 2337 | ord_struct.data.wp64.weights64=weights; |
---|
| 2338 | o[place]=1; |
---|
| 2339 | place++; |
---|
| 2340 | o[place]=1; |
---|
| 2341 | place++; |
---|
| 2342 | rO_Align(place,bitplace); |
---|
| 2343 | } |
---|
| 2344 | |
---|
| 2345 | static void rO_WDegree_neg(int &place, int &bitplace, int start, int end, |
---|
| 2346 | long *o, sro_ord &ord_struct, int *weights) |
---|
| 2347 | { |
---|
| 2348 | // weighted degree (aligned) of variables v_start..v_end, ordsgn -1 |
---|
| 2349 | while((start<end) && (weights[0]==0)) { start++; weights++; } |
---|
| 2350 | while((start<end) && (weights[end-start]==0)) { end--; } |
---|
| 2351 | rO_Align(place,bitplace); |
---|
| 2352 | ord_struct.ord_typ=ro_wp; |
---|
| 2353 | ord_struct.data.wp.start=start; |
---|
| 2354 | ord_struct.data.wp.end=end; |
---|
| 2355 | ord_struct.data.wp.place=place; |
---|
| 2356 | ord_struct.data.wp.weights=weights; |
---|
| 2357 | o[place]=-1; |
---|
| 2358 | place++; |
---|
| 2359 | rO_Align(place,bitplace); |
---|
| 2360 | int i; |
---|
| 2361 | for(i=start;i<=end;i++) |
---|
| 2362 | { |
---|
| 2363 | if(weights[i-start]<0) |
---|
| 2364 | { |
---|
| 2365 | ord_struct.ord_typ=ro_wp_neg; |
---|
| 2366 | break; |
---|
| 2367 | } |
---|
| 2368 | } |
---|
| 2369 | } |
---|
| 2370 | |
---|
| 2371 | static void rO_LexVars(int &place, int &bitplace, int start, int end, |
---|
| 2372 | int &prev_ord, long *o,int *v, int bits, int opt_var) |
---|
| 2373 | { |
---|
| 2374 | // a block of variables v_start..v_end with lex order, ordsgn 1 |
---|
| 2375 | int k; |
---|
| 2376 | int incr=1; |
---|
| 2377 | if(prev_ord==-1) rO_Align(place,bitplace); |
---|
| 2378 | |
---|
| 2379 | if (start>end) |
---|
| 2380 | { |
---|
| 2381 | incr=-1; |
---|
| 2382 | } |
---|
| 2383 | for(k=start;;k+=incr) |
---|
| 2384 | { |
---|
| 2385 | bitplace-=bits; |
---|
| 2386 | if (bitplace < 0) { bitplace=BITS_PER_LONG-bits; place++; } |
---|
| 2387 | o[place]=1; |
---|
| 2388 | v[k]= place | (bitplace << 24); |
---|
| 2389 | if (k==end) break; |
---|
| 2390 | } |
---|
| 2391 | prev_ord=1; |
---|
| 2392 | if (opt_var!= -1) |
---|
| 2393 | { |
---|
| 2394 | assume((opt_var == end+1) ||(opt_var == end-1)); |
---|
| 2395 | if((opt_var != end+1) &&(opt_var != end-1)) WarnS("hier-2"); |
---|
| 2396 | int save_bitplace=bitplace; |
---|
| 2397 | bitplace-=bits; |
---|
| 2398 | if (bitplace < 0) |
---|
| 2399 | { |
---|
| 2400 | bitplace=save_bitplace; |
---|
| 2401 | return; |
---|
| 2402 | } |
---|
| 2403 | // there is enough space for the optional var |
---|
| 2404 | v[opt_var]=place | (bitplace << 24); |
---|
| 2405 | } |
---|
| 2406 | } |
---|
| 2407 | |
---|
| 2408 | static void rO_LexVars_neg(int &place, int &bitplace, int start, int end, |
---|
| 2409 | int &prev_ord, long *o,int *v, int bits, int opt_var) |
---|
| 2410 | { |
---|
| 2411 | // a block of variables v_start..v_end with lex order, ordsgn -1 |
---|
| 2412 | int k; |
---|
| 2413 | int incr=1; |
---|
| 2414 | if(prev_ord==1) rO_Align(place,bitplace); |
---|
| 2415 | |
---|
| 2416 | if (start>end) |
---|
| 2417 | { |
---|
| 2418 | incr=-1; |
---|
| 2419 | } |
---|
| 2420 | for(k=start;;k+=incr) |
---|
| 2421 | { |
---|
| 2422 | bitplace-=bits; |
---|
| 2423 | if (bitplace < 0) { bitplace=BITS_PER_LONG-bits; place++; } |
---|
| 2424 | o[place]=-1; |
---|
| 2425 | v[k]=place | (bitplace << 24); |
---|
| 2426 | if (k==end) break; |
---|
| 2427 | } |
---|
| 2428 | prev_ord=-1; |
---|
| 2429 | // #if 0 |
---|
| 2430 | if (opt_var!= -1) |
---|
| 2431 | { |
---|
| 2432 | assume((opt_var == end+1) ||(opt_var == end-1)); |
---|
| 2433 | if((opt_var != end+1) &&(opt_var != end-1)) WarnS("hier-1"); |
---|
| 2434 | int save_bitplace=bitplace; |
---|
| 2435 | bitplace-=bits; |
---|
| 2436 | if (bitplace < 0) |
---|
| 2437 | { |
---|
| 2438 | bitplace=save_bitplace; |
---|
| 2439 | return; |
---|
| 2440 | } |
---|
| 2441 | // there is enough space for the optional var |
---|
| 2442 | v[opt_var]=place | (bitplace << 24); |
---|
| 2443 | } |
---|
| 2444 | // #endif |
---|
| 2445 | } |
---|
| 2446 | |
---|
| 2447 | static void rO_Syzcomp(int &place, int &bitplace, int &prev_ord, |
---|
| 2448 | long *o, sro_ord &ord_struct) |
---|
| 2449 | { |
---|
| 2450 | // ordering is derived from component number |
---|
| 2451 | rO_Align(place,bitplace); |
---|
| 2452 | ord_struct.ord_typ=ro_syzcomp; |
---|
| 2453 | ord_struct.data.syzcomp.place=place; |
---|
| 2454 | ord_struct.data.syzcomp.Components=NULL; |
---|
| 2455 | ord_struct.data.syzcomp.ShiftedComponents=NULL; |
---|
| 2456 | o[place]=1; |
---|
| 2457 | prev_ord=1; |
---|
| 2458 | place++; |
---|
| 2459 | rO_Align(place,bitplace); |
---|
| 2460 | } |
---|
| 2461 | |
---|
| 2462 | static void rO_Syz(int &place, int &bitplace, int &prev_ord, |
---|
| 2463 | long *o, sro_ord &ord_struct) |
---|
| 2464 | { |
---|
| 2465 | // ordering is derived from component number |
---|
| 2466 | // let's reserve one Exponent_t for it |
---|
| 2467 | if ((prev_ord== 1) || (bitplace!=BITS_PER_LONG)) |
---|
| 2468 | rO_Align(place,bitplace); |
---|
| 2469 | ord_struct.ord_typ=ro_syz; |
---|
| 2470 | ord_struct.data.syz.place=place; |
---|
| 2471 | ord_struct.data.syz.limit=0; |
---|
| 2472 | ord_struct.data.syz.syz_index = NULL; |
---|
| 2473 | ord_struct.data.syz.curr_index = 1; |
---|
| 2474 | o[place]= -1; |
---|
| 2475 | prev_ord=-1; |
---|
| 2476 | place++; |
---|
| 2477 | } |
---|
| 2478 | |
---|
[2e4f788] | 2479 | #ifndef NDEBUG |
---|
| 2480 | # define MYTEST 0 |
---|
| 2481 | #else /* ifndef NDEBUG */ |
---|
| 2482 | # define MYTEST 0 |
---|
| 2483 | #endif /* ifndef NDEBUG */ |
---|
[a6904c] | 2484 | |
---|
| 2485 | static void rO_ISPrefix(int &place, int &bitplace, int &prev_ord, |
---|
| 2486 | long *o, int N, int *v, sro_ord &ord_struct) |
---|
| 2487 | { |
---|
| 2488 | if ((prev_ord== 1) || (bitplace!=BITS_PER_LONG)) |
---|
| 2489 | rO_Align(place,bitplace); |
---|
| 2490 | // since we add something afterwards - it's better to start with anew!? |
---|
| 2491 | |
---|
| 2492 | ord_struct.ord_typ = ro_isTemp; |
---|
| 2493 | ord_struct.data.isTemp.start = place; |
---|
| 2494 | ord_struct.data.isTemp.pVarOffset = (int *)omMemDup(v); |
---|
| 2495 | ord_struct.data.isTemp.suffixpos = -1; |
---|
| 2496 | |
---|
| 2497 | // We will act as rO_Syz on our own!!! |
---|
| 2498 | // Here we allocate an exponent as a level placeholder |
---|
| 2499 | o[place]= -1; |
---|
| 2500 | prev_ord=-1; |
---|
| 2501 | place++; |
---|
| 2502 | |
---|
| 2503 | #if MYTEST |
---|
| 2504 | Print("rO_ISPrefix: place = %d, v: {", ord_struct.data.isTemp.start); |
---|
| 2505 | |
---|
| 2506 | for( int i = 0; i <= N; i++ ) |
---|
| 2507 | Print("v[%d]: %09x", i, ord_struct.data.isTemp.pVarOffset[i]); |
---|
| 2508 | |
---|
| 2509 | PrintS("}!\n"); |
---|
| 2510 | #endif |
---|
| 2511 | } |
---|
| 2512 | static void rO_ISSuffix(int &place, int &bitplace, int &prev_ord, long *o, |
---|
| 2513 | int N, int *v, sro_ord *tmp_typ, int &typ_i, int sgn) |
---|
| 2514 | { |
---|
| 2515 | #if MYTEST |
---|
| 2516 | Print("rO_ISSuffix: place = %d\n", place); |
---|
| 2517 | #endif |
---|
| 2518 | |
---|
| 2519 | // Let's find previous prefix: |
---|
| 2520 | int typ_j = typ_i - 1; |
---|
| 2521 | while(typ_j >= 0) |
---|
| 2522 | { |
---|
| 2523 | if( tmp_typ[typ_j].ord_typ == ro_isTemp) |
---|
| 2524 | break; |
---|
| 2525 | typ_j --; |
---|
| 2526 | } |
---|
| 2527 | |
---|
| 2528 | assume( typ_j >= 0 ); |
---|
| 2529 | |
---|
| 2530 | if( typ_j < 0 ) // Found NO prefix!!! :( |
---|
| 2531 | return; |
---|
| 2532 | |
---|
| 2533 | assume( tmp_typ[typ_j].ord_typ == ro_isTemp ); |
---|
| 2534 | |
---|
| 2535 | // Get saved state: |
---|
| 2536 | const int start = tmp_typ[typ_j].data.isTemp.start; |
---|
| 2537 | int *pVarOffset = tmp_typ[typ_j].data.isTemp.pVarOffset; |
---|
| 2538 | |
---|
| 2539 | /* |
---|
| 2540 | // shift up all blocks |
---|
| 2541 | while(typ_j < (typ_i-1)) |
---|
| 2542 | { |
---|
| 2543 | tmp_typ[typ_j] = tmp_typ[typ_j+1]; |
---|
| 2544 | typ_j++; |
---|
| 2545 | } |
---|
| 2546 | typ_j = typ_i - 1; // No increment for typ_i |
---|
| 2547 | */ |
---|
| 2548 | tmp_typ[typ_j].data.isTemp.suffixpos = typ_i; |
---|
| 2549 | |
---|
| 2550 | // Let's keep that dummy for now... |
---|
| 2551 | typ_j = typ_i; // the typ to change! |
---|
| 2552 | typ_i++; // Just for now... |
---|
| 2553 | |
---|
| 2554 | |
---|
| 2555 | #if MYTEST |
---|
[324710] | 2556 | PrintS("Changes in v: { "); |
---|
[a6904c] | 2557 | #endif |
---|
| 2558 | |
---|
| 2559 | for( int i = 0; i <= N; i++ ) // Note [0] == component !!! No Skip? |
---|
| 2560 | { |
---|
| 2561 | // Was i-th variable allocated inbetween? |
---|
| 2562 | if( v[i] != pVarOffset[i] ) |
---|
| 2563 | { |
---|
| 2564 | pVarOffset[i] = v[i]; // Save for later... |
---|
| 2565 | v[i] = -1; // Undo! |
---|
| 2566 | assume( pVarOffset[i] != -1 ); |
---|
| 2567 | #if MYTEST |
---|
[324710] | 2568 | Print("v[%d]: %010x; ", i, pVarOffset[i]); |
---|
[a6904c] | 2569 | #endif |
---|
| 2570 | } |
---|
| 2571 | else |
---|
| 2572 | pVarOffset[i] = -1; // No change here... |
---|
| 2573 | } |
---|
| 2574 | |
---|
| 2575 | if( pVarOffset[0] != -1 ) |
---|
| 2576 | pVarOffset[0] &= 0x0fff; |
---|
| 2577 | |
---|
| 2578 | #if MYTEST |
---|
[324710] | 2579 | PrintS(" }!\n"); |
---|
[a6904c] | 2580 | #endif |
---|
| 2581 | sro_ord &ord_struct = tmp_typ[typ_j]; |
---|
| 2582 | |
---|
| 2583 | |
---|
| 2584 | ord_struct.ord_typ = ro_is; |
---|
| 2585 | ord_struct.data.is.start = start; |
---|
| 2586 | ord_struct.data.is.end = place; |
---|
| 2587 | ord_struct.data.is.pVarOffset = pVarOffset; |
---|
| 2588 | |
---|
| 2589 | |
---|
| 2590 | // What about component??? |
---|
| 2591 | // if( v[0] != -1 ) // There is a component already...??? |
---|
| 2592 | // if( o[ v[0] & 0x0fff ] == sgn ) |
---|
| 2593 | // { |
---|
| 2594 | // pVarOffset[0] = -1; // NEVER USED Afterwards... |
---|
| 2595 | // return; |
---|
| 2596 | // } |
---|
| 2597 | |
---|
| 2598 | |
---|
| 2599 | // Moreover: we need to allocate the module component (v[0]) here! |
---|
| 2600 | if( v[0] == -1) // It's possible that there was module component v0 at the begining (before prefix)! |
---|
| 2601 | { |
---|
| 2602 | // Start with a whole long exponent |
---|
| 2603 | if( bitplace != BITS_PER_LONG ) |
---|
| 2604 | rO_Align(place, bitplace); |
---|
| 2605 | |
---|
| 2606 | assume( bitplace == BITS_PER_LONG ); |
---|
| 2607 | bitplace -= BITS_PER_LONG; |
---|
| 2608 | assume(bitplace == 0); |
---|
| 2609 | v[0] = place | (bitplace << 24); // Never mind whether pVarOffset[0] > 0!!! |
---|
| 2610 | o[place] = sgn; // Singnum for component ordering |
---|
| 2611 | prev_ord = sgn; |
---|
| 2612 | } |
---|
| 2613 | } |
---|
| 2614 | |
---|
| 2615 | |
---|
| 2616 | static unsigned long rGetExpSize(unsigned long bitmask, int & bits) |
---|
| 2617 | { |
---|
| 2618 | if (bitmask == 0) |
---|
| 2619 | { |
---|
| 2620 | bits=16; bitmask=0xffff; |
---|
| 2621 | } |
---|
| 2622 | else if (bitmask <= 1L) |
---|
| 2623 | { |
---|
| 2624 | bits=1; bitmask = 1L; |
---|
| 2625 | } |
---|
| 2626 | else if (bitmask <= 3L) |
---|
| 2627 | { |
---|
| 2628 | bits=2; bitmask = 3L; |
---|
| 2629 | } |
---|
| 2630 | else if (bitmask <= 7L) |
---|
| 2631 | { |
---|
| 2632 | bits=3; bitmask=7L; |
---|
| 2633 | } |
---|
| 2634 | else if (bitmask <= 0xfL) |
---|
| 2635 | { |
---|
| 2636 | bits=4; bitmask=0xfL; |
---|
| 2637 | } |
---|
| 2638 | else if (bitmask <= 0x1fL) |
---|
| 2639 | { |
---|
| 2640 | bits=5; bitmask=0x1fL; |
---|
| 2641 | } |
---|
| 2642 | else if (bitmask <= 0x3fL) |
---|
| 2643 | { |
---|
| 2644 | bits=6; bitmask=0x3fL; |
---|
| 2645 | } |
---|
| 2646 | #if SIZEOF_LONG == 8 |
---|
| 2647 | else if (bitmask <= 0x7fL) |
---|
| 2648 | { |
---|
| 2649 | bits=7; bitmask=0x7fL; /* 64 bit longs only */ |
---|
| 2650 | } |
---|
| 2651 | #endif |
---|
| 2652 | else if (bitmask <= 0xffL) |
---|
| 2653 | { |
---|
| 2654 | bits=8; bitmask=0xffL; |
---|
| 2655 | } |
---|
| 2656 | #if SIZEOF_LONG == 8 |
---|
| 2657 | else if (bitmask <= 0x1ffL) |
---|
| 2658 | { |
---|
| 2659 | bits=9; bitmask=0x1ffL; /* 64 bit longs only */ |
---|
| 2660 | } |
---|
| 2661 | #endif |
---|
| 2662 | else if (bitmask <= 0x3ffL) |
---|
| 2663 | { |
---|
| 2664 | bits=10; bitmask=0x3ffL; |
---|
| 2665 | } |
---|
| 2666 | #if SIZEOF_LONG == 8 |
---|
| 2667 | else if (bitmask <= 0xfffL) |
---|
| 2668 | { |
---|
| 2669 | bits=12; bitmask=0xfff; /* 64 bit longs only */ |
---|
| 2670 | } |
---|
| 2671 | #endif |
---|
| 2672 | else if (bitmask <= 0xffffL) |
---|
| 2673 | { |
---|
| 2674 | bits=16; bitmask=0xffffL; |
---|
| 2675 | } |
---|
| 2676 | #if SIZEOF_LONG == 8 |
---|
| 2677 | else if (bitmask <= 0xfffffL) |
---|
| 2678 | { |
---|
| 2679 | bits=20; bitmask=0xfffffL; /* 64 bit longs only */ |
---|
| 2680 | } |
---|
| 2681 | else if (bitmask <= 0xffffffffL) |
---|
| 2682 | { |
---|
| 2683 | bits=32; bitmask=0xffffffffL; |
---|
| 2684 | } |
---|
| 2685 | else if (bitmask <= 0x7fffffffffffffffL) |
---|
| 2686 | { |
---|
| 2687 | bits=63; bitmask=0x7fffffffffffffffL; /* for overflow tests*/ |
---|
| 2688 | } |
---|
| 2689 | else |
---|
| 2690 | { |
---|
| 2691 | bits=63; bitmask=0x7fffffffffffffffL; /* for overflow tests*/ |
---|
| 2692 | } |
---|
| 2693 | #else |
---|
| 2694 | else if (bitmask <= 0x7fffffff) |
---|
| 2695 | { |
---|
| 2696 | bits=31; bitmask=0x7fffffff; /* for overflow tests*/ |
---|
| 2697 | } |
---|
| 2698 | else |
---|
| 2699 | { |
---|
| 2700 | bits=31; bitmask=0x7fffffffL; /* for overflow tests*/ |
---|
| 2701 | } |
---|
| 2702 | #endif |
---|
| 2703 | return bitmask; |
---|
| 2704 | } |
---|
| 2705 | |
---|
| 2706 | /*2 |
---|
| 2707 | * optimize rGetExpSize for a block of N variables, exp <=bitmask |
---|
| 2708 | */ |
---|
| 2709 | static unsigned long rGetExpSize(unsigned long bitmask, int & bits, int N) |
---|
| 2710 | { |
---|
| 2711 | bitmask =rGetExpSize(bitmask, bits); |
---|
| 2712 | int vars_per_long=BIT_SIZEOF_LONG/bits; |
---|
| 2713 | int bits1; |
---|
| 2714 | loop |
---|
| 2715 | { |
---|
| 2716 | if (bits == BIT_SIZEOF_LONG-1) |
---|
| 2717 | { |
---|
| 2718 | bits = BIT_SIZEOF_LONG - 1; |
---|
| 2719 | return LONG_MAX; |
---|
| 2720 | } |
---|
| 2721 | unsigned long bitmask1 =rGetExpSize(bitmask+1, bits1); |
---|
| 2722 | int vars_per_long1=BIT_SIZEOF_LONG/bits1; |
---|
| 2723 | if ((((N+vars_per_long-1)/vars_per_long) == |
---|
| 2724 | ((N+vars_per_long1-1)/vars_per_long1))) |
---|
| 2725 | { |
---|
| 2726 | vars_per_long=vars_per_long1; |
---|
| 2727 | bits=bits1; |
---|
| 2728 | bitmask=bitmask1; |
---|
| 2729 | } |
---|
| 2730 | else |
---|
| 2731 | { |
---|
| 2732 | return bitmask; /* and bits */ |
---|
| 2733 | } |
---|
| 2734 | } |
---|
| 2735 | } |
---|
| 2736 | |
---|
| 2737 | |
---|
| 2738 | bool rSetISReference(const ideal F, const int i, const int p, const intvec * componentWeights, const ring r); |
---|
| 2739 | |
---|
| 2740 | |
---|
| 2741 | /*2 |
---|
| 2742 | * create a copy of the ring r, which must be equivalent to currRing |
---|
| 2743 | * used for std computations |
---|
| 2744 | * may share data structures with currRing |
---|
| 2745 | * DOES CALL rComplete |
---|
| 2746 | */ |
---|
| 2747 | ring rModifyRing(ring r, BOOLEAN omit_degree, |
---|
| 2748 | BOOLEAN omit_comp, |
---|
| 2749 | unsigned long exp_limit) |
---|
| 2750 | { |
---|
| 2751 | assume (r != NULL ); |
---|
| 2752 | assume (exp_limit > 1); |
---|
| 2753 | BOOLEAN need_other_ring; |
---|
| 2754 | BOOLEAN omitted_degree = FALSE; |
---|
| 2755 | |
---|
| 2756 | int iNeedInducedOrderingSetup = 0; ///< How many induced ordering block do we have? |
---|
| 2757 | int bits; |
---|
| 2758 | |
---|
| 2759 | exp_limit=rGetExpSize(exp_limit, bits, r->N); |
---|
| 2760 | need_other_ring = (exp_limit != r->bitmask); |
---|
| 2761 | |
---|
| 2762 | int nblocks=rBlocks(r); |
---|
| 2763 | int *order=(int*)omAlloc0((nblocks+1)*sizeof(int)); |
---|
| 2764 | int *block0=(int*)omAlloc0((nblocks+1)*sizeof(int)); |
---|
| 2765 | int *block1=(int*)omAlloc0((nblocks+1)*sizeof(int)); |
---|
| 2766 | int **wvhdl=(int**)omAlloc0((nblocks+1)*sizeof(int_ptr)); |
---|
| 2767 | |
---|
| 2768 | int i=0; |
---|
| 2769 | int j=0; /* i index in r, j index in res */ |
---|
| 2770 | |
---|
| 2771 | for( int r_ord=r->order[i]; (r_ord != 0) && (i < nblocks); j++, r_ord=r->order[++i]) |
---|
| 2772 | { |
---|
| 2773 | BOOLEAN copy_block_index=TRUE; |
---|
| 2774 | |
---|
| 2775 | if (r->block0[i]==r->block1[i]) |
---|
| 2776 | { |
---|
| 2777 | switch(r_ord) |
---|
| 2778 | { |
---|
| 2779 | case ringorder_wp: |
---|
| 2780 | case ringorder_dp: |
---|
| 2781 | case ringorder_Wp: |
---|
| 2782 | case ringorder_Dp: |
---|
| 2783 | r_ord=ringorder_lp; |
---|
| 2784 | break; |
---|
| 2785 | case ringorder_Ws: |
---|
| 2786 | case ringorder_Ds: |
---|
| 2787 | case ringorder_ws: |
---|
| 2788 | case ringorder_ds: |
---|
| 2789 | r_ord=ringorder_ls; |
---|
| 2790 | break; |
---|
| 2791 | default: |
---|
| 2792 | break; |
---|
| 2793 | } |
---|
| 2794 | } |
---|
| 2795 | switch(r_ord) |
---|
| 2796 | { |
---|
| 2797 | case ringorder_S: |
---|
| 2798 | { |
---|
| 2799 | #ifndef NDEBUG |
---|
[6e66d2] | 2800 | Warn("Error: unhandled ordering in rModifyRing: ringorder_S = [%d]", r_ord); |
---|
[a6904c] | 2801 | #endif |
---|
| 2802 | order[j]=r_ord; /*r->order[i];*/ |
---|
| 2803 | break; |
---|
| 2804 | } |
---|
| 2805 | case ringorder_C: |
---|
| 2806 | case ringorder_c: |
---|
| 2807 | if (!omit_comp) |
---|
| 2808 | { |
---|
| 2809 | order[j]=r_ord; /*r->order[i]*/; |
---|
| 2810 | } |
---|
| 2811 | else |
---|
| 2812 | { |
---|
| 2813 | j--; |
---|
| 2814 | need_other_ring=TRUE; |
---|
| 2815 | omit_comp=FALSE; |
---|
| 2816 | copy_block_index=FALSE; |
---|
| 2817 | } |
---|
| 2818 | break; |
---|
| 2819 | case ringorder_wp: |
---|
| 2820 | case ringorder_dp: |
---|
| 2821 | case ringorder_ws: |
---|
| 2822 | case ringorder_ds: |
---|
| 2823 | if(!omit_degree) |
---|
| 2824 | { |
---|
| 2825 | order[j]=r_ord; /*r->order[i]*/; |
---|
| 2826 | } |
---|
| 2827 | else |
---|
| 2828 | { |
---|
| 2829 | order[j]=ringorder_rs; |
---|
| 2830 | need_other_ring=TRUE; |
---|
| 2831 | omit_degree=FALSE; |
---|
| 2832 | omitted_degree = TRUE; |
---|
| 2833 | } |
---|
| 2834 | break; |
---|
| 2835 | case ringorder_Wp: |
---|
| 2836 | case ringorder_Dp: |
---|
| 2837 | case ringorder_Ws: |
---|
| 2838 | case ringorder_Ds: |
---|
| 2839 | if(!omit_degree) |
---|
| 2840 | { |
---|
| 2841 | order[j]=r_ord; /*r->order[i];*/ |
---|
| 2842 | } |
---|
| 2843 | else |
---|
| 2844 | { |
---|
| 2845 | order[j]=ringorder_lp; |
---|
| 2846 | need_other_ring=TRUE; |
---|
| 2847 | omit_degree=FALSE; |
---|
| 2848 | omitted_degree = TRUE; |
---|
| 2849 | } |
---|
| 2850 | break; |
---|
| 2851 | case ringorder_IS: |
---|
| 2852 | { |
---|
| 2853 | if (omit_comp) |
---|
| 2854 | { |
---|
[6e66d2] | 2855 | #ifndef NDEBUG |
---|
| 2856 | Warn("Error: WRONG USAGE of rModifyRing: cannot omit component due to the ordering block [%d]: %d (ringorder_IS)", i, r_ord); |
---|
| 2857 | #endif |
---|
[a6904c] | 2858 | omit_comp = FALSE; |
---|
| 2859 | } |
---|
| 2860 | order[j]=r_ord; /*r->order[i];*/ |
---|
| 2861 | iNeedInducedOrderingSetup++; |
---|
| 2862 | break; |
---|
| 2863 | } |
---|
| 2864 | case ringorder_s: |
---|
| 2865 | { |
---|
| 2866 | assume((i == 0) && (j == 0)); |
---|
| 2867 | if (omit_comp) |
---|
| 2868 | { |
---|
| 2869 | #ifndef NDEBUG |
---|
[324710] | 2870 | Warn("WRONG USAGE? of rModifyRing: omitting component due to the ordering block [%d]: %d (ringorder_s)", i, r_ord); |
---|
[a6904c] | 2871 | #endif |
---|
| 2872 | omit_comp = FALSE; |
---|
| 2873 | } |
---|
| 2874 | order[j]=r_ord; /*r->order[i];*/ |
---|
| 2875 | break; |
---|
| 2876 | } |
---|
| 2877 | default: |
---|
| 2878 | order[j]=r_ord; /*r->order[i];*/ |
---|
| 2879 | break; |
---|
| 2880 | } |
---|
| 2881 | if (copy_block_index) |
---|
| 2882 | { |
---|
| 2883 | block0[j]=r->block0[i]; |
---|
| 2884 | block1[j]=r->block1[i]; |
---|
| 2885 | wvhdl[j]=r->wvhdl[i]; |
---|
| 2886 | } |
---|
| 2887 | |
---|
| 2888 | // order[j]=ringorder_no; // done by omAlloc0 |
---|
| 2889 | } |
---|
| 2890 | if(!need_other_ring) |
---|
| 2891 | { |
---|
| 2892 | omFreeSize(order,(nblocks+1)*sizeof(int)); |
---|
| 2893 | omFreeSize(block0,(nblocks+1)*sizeof(int)); |
---|
| 2894 | omFreeSize(block1,(nblocks+1)*sizeof(int)); |
---|
| 2895 | omFreeSize(wvhdl,(nblocks+1)*sizeof(int_ptr)); |
---|
| 2896 | return r; |
---|
| 2897 | } |
---|
| 2898 | ring res=(ring)omAlloc0Bin(sip_sring_bin); |
---|
| 2899 | *res = *r; |
---|
| 2900 | |
---|
| 2901 | #ifdef HAVE_PLURAL |
---|
| 2902 | res->GetNC() = NULL; |
---|
| 2903 | #endif |
---|
| 2904 | |
---|
| 2905 | // res->qideal, res->idroot ??? |
---|
| 2906 | res->wvhdl=wvhdl; |
---|
| 2907 | res->order=order; |
---|
| 2908 | res->block0=block0; |
---|
| 2909 | res->block1=block1; |
---|
| 2910 | res->bitmask=exp_limit; |
---|
| 2911 | int tmpref=r->cf->ref; |
---|
| 2912 | rComplete(res, 1); |
---|
| 2913 | r->cf->ref=tmpref; |
---|
| 2914 | |
---|
| 2915 | // adjust res->pFDeg: if it was changed globally, then |
---|
| 2916 | // it must also be changed for new ring |
---|
| 2917 | if (r->pFDegOrig != res->pFDegOrig && |
---|
| 2918 | rOrd_is_WeightedDegree_Ordering(r)) |
---|
| 2919 | { |
---|
| 2920 | // still might need adjustment for weighted orderings |
---|
| 2921 | // and omit_degree |
---|
| 2922 | res->firstwv = r->firstwv; |
---|
| 2923 | res->firstBlockEnds = r->firstBlockEnds; |
---|
| 2924 | res->pFDeg = res->pFDegOrig = pWFirstTotalDegree; |
---|
| 2925 | } |
---|
| 2926 | if (omitted_degree) |
---|
| 2927 | res->pLDeg = res->pLDegOrig = r->pLDegOrig; |
---|
| 2928 | |
---|
| 2929 | rOptimizeLDeg(res); |
---|
| 2930 | |
---|
| 2931 | // set syzcomp |
---|
| 2932 | if (res->typ != NULL) |
---|
| 2933 | { |
---|
| 2934 | if( res->typ[0].ord_typ == ro_syz) // "s" Always on [0] place! |
---|
| 2935 | { |
---|
| 2936 | res->typ[0] = r->typ[0]; // Copy struct!? + setup the same limit! |
---|
| 2937 | |
---|
| 2938 | if (r->typ[0].data.syz.limit > 0) |
---|
| 2939 | { |
---|
| 2940 | res->typ[0].data.syz.syz_index |
---|
| 2941 | = (int*) omAlloc((r->typ[0].data.syz.limit +1)*sizeof(int)); |
---|
| 2942 | memcpy(res->typ[0].data.syz.syz_index, r->typ[0].data.syz.syz_index, |
---|
| 2943 | (r->typ[0].data.syz.limit +1)*sizeof(int)); |
---|
| 2944 | } |
---|
| 2945 | } |
---|
| 2946 | |
---|
| 2947 | if( iNeedInducedOrderingSetup > 0 ) |
---|
| 2948 | { |
---|
| 2949 | for(j = 0, i = 0; (i < nblocks) && (iNeedInducedOrderingSetup > 0); i++) |
---|
| 2950 | if( res->typ[i].ord_typ == ro_is ) // Search for suffixes! |
---|
| 2951 | { |
---|
| 2952 | ideal F = idrHeadR(r->typ[i].data.is.F, r, res); // Copy F from r into res! |
---|
| 2953 | assume( |
---|
| 2954 | rSetISReference( |
---|
| 2955 | F, // WILL BE COPIED! |
---|
| 2956 | r->typ[i].data.is.limit, |
---|
| 2957 | j++, |
---|
| 2958 | r->typ[i].data.is.componentWeights, // WILL BE COPIED |
---|
| 2959 | res) |
---|
| 2960 | ); |
---|
| 2961 | id_Delete(&F, res); |
---|
| 2962 | iNeedInducedOrderingSetup--; |
---|
| 2963 | } |
---|
| 2964 | } // Process all induced Ordering blocks! ... |
---|
| 2965 | } |
---|
| 2966 | // the special case: homog (omit_degree) and 1 block rs: that is global: |
---|
| 2967 | // it comes from dp |
---|
| 2968 | res->OrdSgn=r->OrdSgn; |
---|
| 2969 | |
---|
| 2970 | |
---|
| 2971 | #ifdef HAVE_PLURAL |
---|
| 2972 | if (rIsPluralRing(r)) |
---|
| 2973 | { |
---|
| 2974 | if ( nc_rComplete(r, res, false) ) // no qideal! |
---|
| 2975 | { |
---|
| 2976 | #ifndef NDEBUG |
---|
| 2977 | WarnS("error in nc_rComplete"); |
---|
| 2978 | #endif |
---|
| 2979 | // cleanup? |
---|
| 2980 | |
---|
| 2981 | // rDelete(res); |
---|
| 2982 | // return r; |
---|
| 2983 | |
---|
| 2984 | // just go on.. |
---|
| 2985 | } |
---|
| 2986 | |
---|
| 2987 | if( rIsSCA(r) ) |
---|
| 2988 | { |
---|
| 2989 | if( !sca_Force(res, scaFirstAltVar(r), scaLastAltVar(r)) ) |
---|
| 2990 | WarnS("error in sca_Force!"); |
---|
| 2991 | } |
---|
| 2992 | } |
---|
| 2993 | #endif |
---|
| 2994 | |
---|
| 2995 | return res; |
---|
| 2996 | } |
---|
| 2997 | |
---|
| 2998 | // construct Wp,C ring |
---|
| 2999 | ring rModifyRing_Wp(ring r, int* weights) |
---|
| 3000 | { |
---|
| 3001 | ring res=(ring)omAlloc0Bin(sip_sring_bin); |
---|
| 3002 | *res = *r; |
---|
| 3003 | #ifdef HAVE_PLURAL |
---|
| 3004 | res->GetNC() = NULL; |
---|
| 3005 | #endif |
---|
| 3006 | |
---|
| 3007 | /*weights: entries for 3 blocks: NULL*/ |
---|
| 3008 | res->wvhdl = (int **)omAlloc0(3 * sizeof(int_ptr)); |
---|
| 3009 | /*order: Wp,C,0*/ |
---|
| 3010 | res->order = (int *) omAlloc(3 * sizeof(int *)); |
---|
| 3011 | res->block0 = (int *)omAlloc0(3 * sizeof(int *)); |
---|
| 3012 | res->block1 = (int *)omAlloc0(3 * sizeof(int *)); |
---|
| 3013 | /* ringorder Wp for the first block: var 1..r->N */ |
---|
| 3014 | res->order[0] = ringorder_Wp; |
---|
| 3015 | res->block0[0] = 1; |
---|
| 3016 | res->block1[0] = r->N; |
---|
| 3017 | res->wvhdl[0] = weights; |
---|
| 3018 | /* ringorder C for the second block: no vars */ |
---|
| 3019 | res->order[1] = ringorder_C; |
---|
| 3020 | /* the last block: everything is 0 */ |
---|
| 3021 | res->order[2] = 0; |
---|
| 3022 | /*polynomial ring*/ |
---|
| 3023 | res->OrdSgn = 1; |
---|
| 3024 | |
---|
| 3025 | int tmpref=r->cf->ref; |
---|
| 3026 | rComplete(res, 1); |
---|
| 3027 | r->cf->ref=tmpref; |
---|
| 3028 | #ifdef HAVE_PLURAL |
---|
| 3029 | if (rIsPluralRing(r)) |
---|
| 3030 | { |
---|
| 3031 | if ( nc_rComplete(r, res, false) ) // no qideal! |
---|
| 3032 | { |
---|
| 3033 | #ifndef NDEBUG |
---|
| 3034 | WarnS("error in nc_rComplete"); |
---|
| 3035 | #endif |
---|
| 3036 | // cleanup? |
---|
| 3037 | |
---|
| 3038 | // rDelete(res); |
---|
| 3039 | // return r; |
---|
| 3040 | |
---|
| 3041 | // just go on.. |
---|
| 3042 | } |
---|
| 3043 | } |
---|
| 3044 | #endif |
---|
| 3045 | return res; |
---|
| 3046 | } |
---|
| 3047 | |
---|
| 3048 | // construct lp, C ring with r->N variables, r->names vars.... |
---|
| 3049 | ring rModifyRing_Simple(ring r, BOOLEAN ommit_degree, BOOLEAN ommit_comp, unsigned long exp_limit, BOOLEAN &simple) |
---|
| 3050 | { |
---|
| 3051 | simple=TRUE; |
---|
| 3052 | if (!rHasSimpleOrder(r)) |
---|
| 3053 | { |
---|
| 3054 | simple=FALSE; // sorting needed |
---|
| 3055 | assume (r != NULL ); |
---|
| 3056 | assume (exp_limit > 1); |
---|
| 3057 | int bits; |
---|
| 3058 | |
---|
| 3059 | exp_limit=rGetExpSize(exp_limit, bits, r->N); |
---|
| 3060 | |
---|
| 3061 | int nblocks=1+(ommit_comp!=0); |
---|
| 3062 | int *order=(int*)omAlloc0((nblocks+1)*sizeof(int)); |
---|
| 3063 | int *block0=(int*)omAlloc0((nblocks+1)*sizeof(int)); |
---|
| 3064 | int *block1=(int*)omAlloc0((nblocks+1)*sizeof(int)); |
---|
| 3065 | int **wvhdl=(int**)omAlloc0((nblocks+1)*sizeof(int_ptr)); |
---|
| 3066 | |
---|
| 3067 | order[0]=ringorder_lp; |
---|
| 3068 | block0[0]=1; |
---|
| 3069 | block1[0]=r->N; |
---|
| 3070 | if (!ommit_comp) |
---|
| 3071 | { |
---|
| 3072 | order[1]=ringorder_C; |
---|
| 3073 | } |
---|
| 3074 | ring res=(ring)omAlloc0Bin(sip_sring_bin); |
---|
| 3075 | *res = *r; |
---|
| 3076 | #ifdef HAVE_PLURAL |
---|
| 3077 | res->GetNC() = NULL; |
---|
| 3078 | #endif |
---|
| 3079 | // res->qideal, res->idroot ??? |
---|
| 3080 | res->wvhdl=wvhdl; |
---|
| 3081 | res->order=order; |
---|
| 3082 | res->block0=block0; |
---|
| 3083 | res->block1=block1; |
---|
| 3084 | res->bitmask=exp_limit; |
---|
| 3085 | int tmpref=r->cf->ref; |
---|
| 3086 | rComplete(res, 1); |
---|
| 3087 | r->cf->ref=tmpref; |
---|
| 3088 | |
---|
| 3089 | #ifdef HAVE_PLURAL |
---|
| 3090 | if (rIsPluralRing(r)) |
---|
| 3091 | { |
---|
| 3092 | if ( nc_rComplete(r, res, false) ) // no qideal! |
---|
| 3093 | { |
---|
| 3094 | #ifndef NDEBUG |
---|
| 3095 | WarnS("error in nc_rComplete"); |
---|
| 3096 | #endif |
---|
| 3097 | // cleanup? |
---|
| 3098 | |
---|
| 3099 | // rDelete(res); |
---|
| 3100 | // return r; |
---|
| 3101 | |
---|
| 3102 | // just go on.. |
---|
| 3103 | } |
---|
| 3104 | } |
---|
| 3105 | #endif |
---|
| 3106 | |
---|
| 3107 | rOptimizeLDeg(res); |
---|
| 3108 | |
---|
| 3109 | return res; |
---|
| 3110 | } |
---|
| 3111 | return rModifyRing(r, ommit_degree, ommit_comp, exp_limit); |
---|
| 3112 | } |
---|
| 3113 | |
---|
| 3114 | void rKillModifiedRing_Simple(ring r) |
---|
| 3115 | { |
---|
| 3116 | rKillModifiedRing(r); |
---|
| 3117 | } |
---|
| 3118 | |
---|
| 3119 | |
---|
| 3120 | void rKillModifiedRing(ring r) |
---|
| 3121 | { |
---|
| 3122 | rUnComplete(r); |
---|
| 3123 | omFree(r->order); |
---|
| 3124 | omFree(r->block0); |
---|
| 3125 | omFree(r->block1); |
---|
| 3126 | omFree(r->wvhdl); |
---|
| 3127 | omFreeBin(r,sip_sring_bin); |
---|
| 3128 | } |
---|
| 3129 | |
---|
| 3130 | void rKillModified_Wp_Ring(ring r) |
---|
| 3131 | { |
---|
| 3132 | rUnComplete(r); |
---|
| 3133 | omFree(r->order); |
---|
| 3134 | omFree(r->block0); |
---|
| 3135 | omFree(r->block1); |
---|
| 3136 | omFree(r->wvhdl[0]); |
---|
| 3137 | omFree(r->wvhdl); |
---|
| 3138 | omFreeBin(r,sip_sring_bin); |
---|
| 3139 | } |
---|
| 3140 | |
---|
| 3141 | static void rSetOutParams(ring r) |
---|
| 3142 | { |
---|
| 3143 | r->VectorOut = (r->order[0] == ringorder_c); |
---|
| 3144 | r->ShortOut = TRUE; |
---|
| 3145 | { |
---|
| 3146 | int i; |
---|
[2fa2b4] | 3147 | if (r->parameter!=NULL) |
---|
[a6904c] | 3148 | { |
---|
| 3149 | for (i=0;i<rPar(r);i++) |
---|
| 3150 | { |
---|
| 3151 | if(strlen(r->parameter[i])>1) |
---|
| 3152 | { |
---|
| 3153 | r->ShortOut=FALSE; |
---|
| 3154 | break; |
---|
| 3155 | } |
---|
| 3156 | } |
---|
| 3157 | } |
---|
| 3158 | if (r->ShortOut) |
---|
| 3159 | { |
---|
| 3160 | // Hmm... sometimes (e.g., from maGetPreimage) new variables |
---|
[2fa2b4] | 3161 | // are introduced, but their names are never set |
---|
[a6904c] | 3162 | // hence, we do the following awkward trick |
---|
| 3163 | int N = omSizeWOfAddr(r->names); |
---|
| 3164 | if (r->N < N) N = r->N; |
---|
| 3165 | |
---|
| 3166 | for (i=(N-1);i>=0;i--) |
---|
| 3167 | { |
---|
| 3168 | if(r->names[i] != NULL && strlen(r->names[i])>1) |
---|
| 3169 | { |
---|
| 3170 | r->ShortOut=FALSE; |
---|
| 3171 | break; |
---|
| 3172 | } |
---|
| 3173 | } |
---|
| 3174 | } |
---|
| 3175 | } |
---|
| 3176 | r->CanShortOut = r->ShortOut; |
---|
| 3177 | } |
---|
| 3178 | |
---|
| 3179 | /*2 |
---|
[8047af8] | 3180 | * sets r->MixedOrder and r->ComponentOrder for orderings with more than one block |
---|
[a6904c] | 3181 | * block of variables (ip is the block number, o_r the number of the ordering) |
---|
| 3182 | * o is the position of the orderingering in r |
---|
| 3183 | */ |
---|
| 3184 | static void rHighSet(ring r, int o_r, int o) |
---|
| 3185 | { |
---|
| 3186 | switch(o_r) |
---|
| 3187 | { |
---|
| 3188 | case ringorder_lp: |
---|
| 3189 | case ringorder_dp: |
---|
| 3190 | case ringorder_Dp: |
---|
| 3191 | case ringorder_wp: |
---|
| 3192 | case ringorder_Wp: |
---|
| 3193 | case ringorder_rp: |
---|
| 3194 | case ringorder_a: |
---|
| 3195 | case ringorder_aa: |
---|
| 3196 | case ringorder_a64: |
---|
| 3197 | if (r->OrdSgn==-1) r->MixedOrder=TRUE; |
---|
| 3198 | break; |
---|
| 3199 | case ringorder_ls: |
---|
| 3200 | case ringorder_rs: |
---|
| 3201 | case ringorder_ds: |
---|
| 3202 | case ringorder_Ds: |
---|
| 3203 | case ringorder_s: |
---|
| 3204 | break; |
---|
| 3205 | case ringorder_ws: |
---|
| 3206 | case ringorder_Ws: |
---|
| 3207 | if (r->wvhdl[o]!=NULL) |
---|
| 3208 | { |
---|
| 3209 | int i; |
---|
| 3210 | for(i=r->block1[o]-r->block0[o];i>=0;i--) |
---|
| 3211 | if (r->wvhdl[o][i]<0) { r->MixedOrder=TRUE; break; } |
---|
| 3212 | } |
---|
| 3213 | break; |
---|
| 3214 | case ringorder_c: |
---|
| 3215 | r->ComponentOrder=1; |
---|
| 3216 | break; |
---|
| 3217 | case ringorder_C: |
---|
| 3218 | case ringorder_S: |
---|
| 3219 | r->ComponentOrder=-1; |
---|
| 3220 | break; |
---|
| 3221 | case ringorder_M: |
---|
[8047af8] | 3222 | r->LexOrder=TRUE; |
---|
[a6904c] | 3223 | break; |
---|
| 3224 | case ringorder_IS: |
---|
| 3225 | { // TODO: What is r->ComponentOrder??? |
---|
| 3226 | r->MixedOrder=TRUE; |
---|
| 3227 | /* |
---|
| 3228 | if( r->block0[o] != 0 ) // Suffix has the comonent |
---|
| 3229 | r->ComponentOrder = r->block0[o]; |
---|
| 3230 | else // Prefix has level... |
---|
| 3231 | r->ComponentOrder=-1; |
---|
| 3232 | */ |
---|
| 3233 | break; |
---|
| 3234 | } |
---|
| 3235 | |
---|
| 3236 | default: |
---|
| 3237 | dReportError("wrong internal ordering:%d at %s, l:%d\n",o_r,__FILE__,__LINE__); |
---|
| 3238 | } |
---|
| 3239 | } |
---|
| 3240 | |
---|
| 3241 | static void rSetFirstWv(ring r, int i, int* order, int* block1, int** wvhdl) |
---|
| 3242 | { |
---|
| 3243 | // cheat for ringorder_aa |
---|
| 3244 | if (order[i] == ringorder_aa) |
---|
| 3245 | i++; |
---|
| 3246 | if(block1[i]!=r->N) r->LexOrder=TRUE; |
---|
| 3247 | r->firstBlockEnds=block1[i]; |
---|
| 3248 | r->firstwv = wvhdl[i]; |
---|
| 3249 | if ((order[i]== ringorder_ws) |
---|
| 3250 | || (order[i]==ringorder_Ws) |
---|
| 3251 | || (order[i]== ringorder_wp) |
---|
| 3252 | || (order[i]==ringorder_Wp) |
---|
| 3253 | || (order[i]== ringorder_a) |
---|
| 3254 | /*|| (order[i]==ringorder_A)*/) |
---|
| 3255 | { |
---|
| 3256 | int j; |
---|
| 3257 | for(j=block1[i]-r->block0[i];j>=0;j--) |
---|
| 3258 | { |
---|
| 3259 | if (r->firstwv[j]<0) r->MixedOrder=TRUE; |
---|
| 3260 | if (r->firstwv[j]==0) r->LexOrder=TRUE; |
---|
| 3261 | } |
---|
| 3262 | } |
---|
| 3263 | else if (order[i]==ringorder_a64) |
---|
| 3264 | { |
---|
| 3265 | int j; |
---|
| 3266 | int64 *w=rGetWeightVec(r); |
---|
| 3267 | for(j=block1[i]-r->block0[i];j>=0;j--) |
---|
| 3268 | { |
---|
| 3269 | if (w[j]==0) r->LexOrder=TRUE; |
---|
| 3270 | } |
---|
| 3271 | } |
---|
| 3272 | } |
---|
| 3273 | |
---|
| 3274 | static void rOptimizeLDeg(ring r) |
---|
| 3275 | { |
---|
| 3276 | if (r->pFDeg == pDeg) |
---|
| 3277 | { |
---|
| 3278 | if (r->pLDeg == pLDeg1) |
---|
| 3279 | r->pLDeg = pLDeg1_Deg; |
---|
| 3280 | if (r->pLDeg == pLDeg1c) |
---|
| 3281 | r->pLDeg = pLDeg1c_Deg; |
---|
| 3282 | } |
---|
[99bdcf] | 3283 | else if (r->pFDeg == p_Totaldegree) |
---|
[a6904c] | 3284 | { |
---|
| 3285 | if (r->pLDeg == pLDeg1) |
---|
| 3286 | r->pLDeg = pLDeg1_Totaldegree; |
---|
| 3287 | if (r->pLDeg == pLDeg1c) |
---|
| 3288 | r->pLDeg = pLDeg1c_Totaldegree; |
---|
| 3289 | } |
---|
| 3290 | else if (r->pFDeg == pWFirstTotalDegree) |
---|
| 3291 | { |
---|
| 3292 | if (r->pLDeg == pLDeg1) |
---|
| 3293 | r->pLDeg = pLDeg1_WFirstTotalDegree; |
---|
| 3294 | if (r->pLDeg == pLDeg1c) |
---|
| 3295 | r->pLDeg = pLDeg1c_WFirstTotalDegree; |
---|
| 3296 | } |
---|
| 3297 | } |
---|
| 3298 | |
---|
| 3299 | // set pFDeg, pLDeg, MixOrder, ComponentOrder, etc |
---|
| 3300 | static void rSetDegStuff(ring r) |
---|
| 3301 | { |
---|
| 3302 | int* order = r->order; |
---|
| 3303 | int* block0 = r->block0; |
---|
| 3304 | int* block1 = r->block1; |
---|
| 3305 | int** wvhdl = r->wvhdl; |
---|
| 3306 | |
---|
| 3307 | if (order[0]==ringorder_S ||order[0]==ringorder_s || order[0]==ringorder_IS) |
---|
| 3308 | { |
---|
| 3309 | order++; |
---|
| 3310 | block0++; |
---|
| 3311 | block1++; |
---|
| 3312 | wvhdl++; |
---|
| 3313 | } |
---|
| 3314 | r->LexOrder = FALSE; |
---|
| 3315 | r->MixedOrder = FALSE; |
---|
| 3316 | r->ComponentOrder = 1; |
---|
[99bdcf] | 3317 | r->pFDeg = p_Totaldegree; |
---|
[a6904c] | 3318 | r->pLDeg = (r->OrdSgn == 1 ? pLDegb : pLDeg0); |
---|
| 3319 | |
---|
| 3320 | /*======== ordering type is (_,c) =========================*/ |
---|
| 3321 | if ((order[0]==ringorder_unspec) || (order[1] == 0) |
---|
| 3322 | ||( |
---|
| 3323 | ((order[1]==ringorder_c)||(order[1]==ringorder_C) |
---|
[273fed] | 3324 | ||(order[1]==ringorder_S) |
---|
[a6904c] | 3325 | ||(order[1]==ringorder_s)) |
---|
| 3326 | && (order[0]!=ringorder_M) |
---|
| 3327 | && (order[2]==0)) |
---|
| 3328 | ) |
---|
| 3329 | { |
---|
| 3330 | if ((order[0]!=ringorder_unspec) |
---|
[273fed] | 3331 | && ((order[1]==ringorder_C)||(order[1]==ringorder_S)|| |
---|
[a6904c] | 3332 | (order[1]==ringorder_s))) |
---|
| 3333 | r->ComponentOrder=-1; |
---|
| 3334 | if (r->OrdSgn == -1) r->pLDeg = pLDeg0c; |
---|
| 3335 | if ((order[0] == ringorder_lp) |
---|
| 3336 | || (order[0] == ringorder_ls) |
---|
| 3337 | || (order[0] == ringorder_rp) |
---|
| 3338 | || (order[0] == ringorder_rs)) |
---|
| 3339 | { |
---|
| 3340 | r->LexOrder=TRUE; |
---|
| 3341 | r->pLDeg = pLDeg1c; |
---|
[99bdcf] | 3342 | r->pFDeg = p_Totaldegree; |
---|
[a6904c] | 3343 | } |
---|
| 3344 | if ((order[0] == ringorder_a) |
---|
| 3345 | || (order[0] == ringorder_wp) |
---|
| 3346 | || (order[0] == ringorder_Wp) |
---|
| 3347 | || (order[0] == ringorder_ws) |
---|
| 3348 | || (order[0] == ringorder_Ws)) |
---|
| 3349 | r->pFDeg = pWFirstTotalDegree; |
---|
| 3350 | r->firstBlockEnds=block1[0]; |
---|
| 3351 | r->firstwv = wvhdl[0]; |
---|
| 3352 | } |
---|
| 3353 | /*======== ordering type is (c,_) =========================*/ |
---|
| 3354 | else if (((order[0]==ringorder_c) |
---|
| 3355 | ||(order[0]==ringorder_C) |
---|
[273fed] | 3356 | ||(order[0]==ringorder_S) |
---|
[a6904c] | 3357 | ||(order[0]==ringorder_s)) |
---|
| 3358 | && (order[1]!=ringorder_M) |
---|
| 3359 | && (order[2]==0)) |
---|
| 3360 | { |
---|
[273fed] | 3361 | if ((order[0]==ringorder_C)||(order[0]==ringorder_S)|| |
---|
[a6904c] | 3362 | order[0]==ringorder_s) |
---|
| 3363 | r->ComponentOrder=-1; |
---|
| 3364 | if ((order[1] == ringorder_lp) |
---|
| 3365 | || (order[1] == ringorder_ls) |
---|
| 3366 | || (order[1] == ringorder_rp) |
---|
| 3367 | || order[1] == ringorder_rs) |
---|
| 3368 | { |
---|
| 3369 | r->LexOrder=TRUE; |
---|
| 3370 | r->pLDeg = pLDeg1c; |
---|
[99bdcf] | 3371 | r->pFDeg = p_Totaldegree; |
---|
[a6904c] | 3372 | } |
---|
| 3373 | r->firstBlockEnds=block1[1]; |
---|
[f2de2e] | 3374 | if (wvhdl!=NULL) r->firstwv = wvhdl[1]; |
---|
[a6904c] | 3375 | if ((order[1] == ringorder_a) |
---|
| 3376 | || (order[1] == ringorder_wp) |
---|
| 3377 | || (order[1] == ringorder_Wp) |
---|
| 3378 | || (order[1] == ringorder_ws) |
---|
| 3379 | || (order[1] == ringorder_Ws)) |
---|
| 3380 | r->pFDeg = pWFirstTotalDegree; |
---|
| 3381 | } |
---|
| 3382 | /*------- more than one block ----------------------*/ |
---|
| 3383 | else |
---|
| 3384 | { |
---|
[273fed] | 3385 | if ((r->VectorOut)||(order[0]==ringorder_C)||(order[0]==ringorder_S)||(order[0]==ringorder_s)) |
---|
[a6904c] | 3386 | { |
---|
| 3387 | rSetFirstWv(r, 1, order, block1, wvhdl); |
---|
| 3388 | } |
---|
| 3389 | else |
---|
| 3390 | rSetFirstWv(r, 0, order, block1, wvhdl); |
---|
| 3391 | |
---|
| 3392 | /*the number of orderings:*/ |
---|
| 3393 | int i = 0; |
---|
| 3394 | while (order[++i] != 0); |
---|
| 3395 | do |
---|
| 3396 | { |
---|
| 3397 | i--; |
---|
| 3398 | rHighSet(r, order[i],i); |
---|
| 3399 | } |
---|
| 3400 | while (i != 0); |
---|
| 3401 | |
---|
| 3402 | if ((order[0]!=ringorder_c) |
---|
| 3403 | && (order[0]!=ringorder_C) |
---|
[273fed] | 3404 | && (order[0]!=ringorder_S) |
---|
[a6904c] | 3405 | && (order[0]!=ringorder_s)) |
---|
| 3406 | { |
---|
| 3407 | r->pLDeg = pLDeg1c; |
---|
| 3408 | } |
---|
| 3409 | else |
---|
| 3410 | { |
---|
| 3411 | r->pLDeg = pLDeg1; |
---|
| 3412 | } |
---|
[99bdcf] | 3413 | r->pFDeg = pWTotaldegree; // may be improved: p_Totaldegree for lp/dp/ls/.. blocks |
---|
[a6904c] | 3414 | } |
---|
[22579cf] | 3415 | |
---|
[a6904c] | 3416 | if (rOrd_is_Totaldegree_Ordering(r) || rOrd_is_WeightedDegree_Ordering(r)) |
---|
| 3417 | r->pFDeg = pDeg; |
---|
| 3418 | |
---|
| 3419 | r->pFDegOrig = r->pFDeg; |
---|
| 3420 | r->pLDegOrig = r->pLDeg; |
---|
| 3421 | rOptimizeLDeg(r); |
---|
| 3422 | } |
---|
| 3423 | |
---|
| 3424 | /*2 |
---|
| 3425 | * set NegWeightL_Size, NegWeightL_Offset |
---|
| 3426 | */ |
---|
| 3427 | static void rSetNegWeight(ring r) |
---|
| 3428 | { |
---|
| 3429 | int i,l; |
---|
| 3430 | if (r->typ!=NULL) |
---|
| 3431 | { |
---|
| 3432 | l=0; |
---|
| 3433 | for(i=0;i<r->OrdSize;i++) |
---|
| 3434 | { |
---|
| 3435 | if(r->typ[i].ord_typ==ro_wp_neg) l++; |
---|
| 3436 | } |
---|
| 3437 | if (l>0) |
---|
| 3438 | { |
---|
| 3439 | r->NegWeightL_Size=l; |
---|
| 3440 | r->NegWeightL_Offset=(int *) omAlloc(l*sizeof(int)); |
---|
| 3441 | l=0; |
---|
| 3442 | for(i=0;i<r->OrdSize;i++) |
---|
| 3443 | { |
---|
| 3444 | if(r->typ[i].ord_typ==ro_wp_neg) |
---|
| 3445 | { |
---|
| 3446 | r->NegWeightL_Offset[l]=r->typ[i].data.wp.place; |
---|
| 3447 | l++; |
---|
| 3448 | } |
---|
| 3449 | } |
---|
| 3450 | return; |
---|
| 3451 | } |
---|
| 3452 | } |
---|
| 3453 | r->NegWeightL_Size = 0; |
---|
| 3454 | r->NegWeightL_Offset = NULL; |
---|
| 3455 | } |
---|
| 3456 | |
---|
| 3457 | static void rSetOption(ring r) |
---|
| 3458 | { |
---|
| 3459 | // set redthrough |
---|
| 3460 | if (!TEST_OPT_OLDSTD && r->OrdSgn == 1 && ! r->LexOrder) |
---|
| 3461 | r->options |= Sy_bit(OPT_REDTHROUGH); |
---|
| 3462 | else |
---|
| 3463 | r->options &= ~Sy_bit(OPT_REDTHROUGH); |
---|
| 3464 | |
---|
| 3465 | // set intStrategy |
---|
| 3466 | #ifdef HAVE_RINGS |
---|
| 3467 | if (rField_is_Extension(r) || rField_is_Q(r) || rField_is_Ring(r)) |
---|
| 3468 | #else |
---|
| 3469 | if (rField_is_Extension(r) || rField_is_Q(r)) |
---|
| 3470 | #endif |
---|
| 3471 | r->options |= Sy_bit(OPT_INTSTRATEGY); |
---|
| 3472 | else |
---|
| 3473 | r->options &= ~Sy_bit(OPT_INTSTRATEGY); |
---|
| 3474 | |
---|
| 3475 | // set redTail |
---|
| 3476 | if (r->LexOrder || r->OrdSgn == -1 || rField_is_Extension(r)) |
---|
| 3477 | r->options &= ~Sy_bit(OPT_REDTAIL); |
---|
| 3478 | else |
---|
| 3479 | r->options |= Sy_bit(OPT_REDTAIL); |
---|
| 3480 | } |
---|
| 3481 | |
---|
[8261b2] | 3482 | static void rCheckOrdSgn(ring r,int i/*current block*/); |
---|
| 3483 | |
---|
[a6904c] | 3484 | BOOLEAN rComplete(ring r, int force) |
---|
| 3485 | { |
---|
| 3486 | if (r->VarOffset!=NULL && force == 0) return FALSE; |
---|
| 3487 | nInitChar(r); |
---|
| 3488 | rSetOutParams(r); |
---|
| 3489 | int n=rBlocks(r)-1; |
---|
| 3490 | int i; |
---|
| 3491 | int bits; |
---|
| 3492 | r->bitmask=rGetExpSize(r->bitmask,bits,r->N); |
---|
| 3493 | r->BitsPerExp = bits; |
---|
| 3494 | r->ExpPerLong = BIT_SIZEOF_LONG / bits; |
---|
| 3495 | r->divmask=rGetDivMask(bits); |
---|
| 3496 | |
---|
| 3497 | // will be used for ordsgn: |
---|
| 3498 | long *tmp_ordsgn=(long *)omAlloc0(3*(n+r->N)*sizeof(long)); |
---|
| 3499 | // will be used for VarOffset: |
---|
| 3500 | int *v=(int *)omAlloc((r->N+1)*sizeof(int)); |
---|
| 3501 | for(i=r->N; i>=0 ; i--) |
---|
| 3502 | { |
---|
| 3503 | v[i]=-1; |
---|
| 3504 | } |
---|
| 3505 | sro_ord *tmp_typ=(sro_ord *)omAlloc0(3*(n+r->N)*sizeof(sro_ord)); |
---|
| 3506 | int typ_i=0; |
---|
| 3507 | int prev_ordsgn=0; |
---|
| 3508 | |
---|
| 3509 | // fill in v, tmp_typ, tmp_ordsgn, determine typ_i (== ordSize) |
---|
| 3510 | int j=0; |
---|
| 3511 | int j_bits=BITS_PER_LONG; |
---|
| 3512 | |
---|
| 3513 | BOOLEAN need_to_add_comp=FALSE; // Only for ringorder_s and ringorder_S! |
---|
| 3514 | |
---|
| 3515 | for(i=0;i<n;i++) |
---|
| 3516 | { |
---|
| 3517 | tmp_typ[typ_i].order_index=i; |
---|
| 3518 | switch (r->order[i]) |
---|
| 3519 | { |
---|
| 3520 | case ringorder_a: |
---|
| 3521 | case ringorder_aa: |
---|
| 3522 | rO_WDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn,tmp_typ[typ_i], |
---|
| 3523 | r->wvhdl[i]); |
---|
| 3524 | typ_i++; |
---|
| 3525 | break; |
---|
| 3526 | |
---|
| 3527 | case ringorder_a64: |
---|
| 3528 | rO_WDegree64(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3529 | tmp_typ[typ_i], (int64 *)(r->wvhdl[i])); |
---|
| 3530 | typ_i++; |
---|
| 3531 | break; |
---|
| 3532 | |
---|
| 3533 | case ringorder_c: |
---|
| 3534 | rO_Align(j, j_bits); |
---|
| 3535 | rO_LexVars_neg(j, j_bits, 0,0, prev_ordsgn,tmp_ordsgn,v,BITS_PER_LONG, -1); |
---|
| 3536 | break; |
---|
| 3537 | |
---|
| 3538 | case ringorder_C: |
---|
| 3539 | rO_Align(j, j_bits); |
---|
| 3540 | rO_LexVars(j, j_bits, 0,0, prev_ordsgn,tmp_ordsgn,v,BITS_PER_LONG, -1); |
---|
| 3541 | break; |
---|
| 3542 | |
---|
| 3543 | case ringorder_M: |
---|
| 3544 | { |
---|
| 3545 | int k,l; |
---|
| 3546 | k=r->block1[i]-r->block0[i]+1; // number of vars |
---|
| 3547 | for(l=0;l<k;l++) |
---|
| 3548 | { |
---|
| 3549 | rO_WDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3550 | tmp_typ[typ_i], |
---|
| 3551 | r->wvhdl[i]+(r->block1[i]-r->block0[i]+1)*l); |
---|
| 3552 | typ_i++; |
---|
| 3553 | } |
---|
| 3554 | break; |
---|
| 3555 | } |
---|
| 3556 | |
---|
| 3557 | case ringorder_lp: |
---|
| 3558 | rO_LexVars(j, j_bits, r->block0[i],r->block1[i], prev_ordsgn, |
---|
| 3559 | tmp_ordsgn,v,bits, -1); |
---|
| 3560 | break; |
---|
| 3561 | |
---|
| 3562 | case ringorder_ls: |
---|
| 3563 | rO_LexVars_neg(j, j_bits, r->block0[i],r->block1[i], prev_ordsgn, |
---|
| 3564 | tmp_ordsgn,v, bits, -1); |
---|
[8261b2] | 3565 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3566 | break; |
---|
| 3567 | |
---|
| 3568 | case ringorder_rs: |
---|
| 3569 | rO_LexVars_neg(j, j_bits, r->block1[i],r->block0[i], prev_ordsgn, |
---|
| 3570 | tmp_ordsgn,v, bits, -1); |
---|
[8261b2] | 3571 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3572 | break; |
---|
| 3573 | |
---|
| 3574 | case ringorder_rp: |
---|
| 3575 | rO_LexVars(j, j_bits, r->block1[i],r->block0[i], prev_ordsgn, |
---|
| 3576 | tmp_ordsgn,v, bits, -1); |
---|
| 3577 | break; |
---|
| 3578 | |
---|
| 3579 | case ringorder_dp: |
---|
| 3580 | if (r->block0[i]==r->block1[i]) |
---|
| 3581 | { |
---|
| 3582 | rO_LexVars(j, j_bits, r->block0[i],r->block0[i], prev_ordsgn, |
---|
| 3583 | tmp_ordsgn,v, bits, -1); |
---|
| 3584 | } |
---|
| 3585 | else |
---|
| 3586 | { |
---|
| 3587 | rO_TDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3588 | tmp_typ[typ_i]); |
---|
| 3589 | typ_i++; |
---|
| 3590 | rO_LexVars_neg(j, j_bits, r->block1[i],r->block0[i]+1, |
---|
| 3591 | prev_ordsgn,tmp_ordsgn,v,bits, r->block0[i]); |
---|
| 3592 | } |
---|
| 3593 | break; |
---|
| 3594 | |
---|
| 3595 | case ringorder_Dp: |
---|
| 3596 | if (r->block0[i]==r->block1[i]) |
---|
| 3597 | { |
---|
| 3598 | rO_LexVars(j, j_bits, r->block0[i],r->block0[i], prev_ordsgn, |
---|
| 3599 | tmp_ordsgn,v, bits, -1); |
---|
| 3600 | } |
---|
| 3601 | else |
---|
| 3602 | { |
---|
| 3603 | rO_TDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3604 | tmp_typ[typ_i]); |
---|
| 3605 | typ_i++; |
---|
| 3606 | rO_LexVars(j, j_bits, r->block0[i],r->block1[i]-1, prev_ordsgn, |
---|
| 3607 | tmp_ordsgn,v, bits, r->block1[i]); |
---|
| 3608 | } |
---|
| 3609 | break; |
---|
| 3610 | |
---|
| 3611 | case ringorder_ds: |
---|
| 3612 | if (r->block0[i]==r->block1[i]) |
---|
| 3613 | { |
---|
| 3614 | rO_LexVars_neg(j, j_bits,r->block0[i],r->block1[i],prev_ordsgn, |
---|
| 3615 | tmp_ordsgn,v,bits, -1); |
---|
| 3616 | } |
---|
| 3617 | else |
---|
| 3618 | { |
---|
| 3619 | rO_TDegree_neg(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3620 | tmp_typ[typ_i]); |
---|
| 3621 | typ_i++; |
---|
| 3622 | rO_LexVars_neg(j, j_bits, r->block1[i],r->block0[i]+1, |
---|
| 3623 | prev_ordsgn,tmp_ordsgn,v,bits, r->block0[i]); |
---|
| 3624 | } |
---|
[8261b2] | 3625 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3626 | break; |
---|
| 3627 | |
---|
| 3628 | case ringorder_Ds: |
---|
| 3629 | if (r->block0[i]==r->block1[i]) |
---|
| 3630 | { |
---|
| 3631 | rO_LexVars_neg(j, j_bits, r->block0[i],r->block0[i],prev_ordsgn, |
---|
| 3632 | tmp_ordsgn,v, bits, -1); |
---|
| 3633 | } |
---|
| 3634 | else |
---|
| 3635 | { |
---|
| 3636 | rO_TDegree_neg(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3637 | tmp_typ[typ_i]); |
---|
| 3638 | typ_i++; |
---|
| 3639 | rO_LexVars(j, j_bits, r->block0[i],r->block1[i]-1, prev_ordsgn, |
---|
| 3640 | tmp_ordsgn,v, bits, r->block1[i]); |
---|
| 3641 | } |
---|
[8261b2] | 3642 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3643 | break; |
---|
| 3644 | |
---|
| 3645 | case ringorder_wp: |
---|
| 3646 | rO_WDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3647 | tmp_typ[typ_i], r->wvhdl[i]); |
---|
| 3648 | typ_i++; |
---|
| 3649 | { // check for weights <=0 |
---|
| 3650 | int jj; |
---|
| 3651 | BOOLEAN have_bad_weights=FALSE; |
---|
| 3652 | for(jj=r->block1[i]-r->block0[i];jj>=0; jj--) |
---|
| 3653 | { |
---|
| 3654 | if (r->wvhdl[i][jj]<=0) have_bad_weights=TRUE; |
---|
| 3655 | } |
---|
| 3656 | if (have_bad_weights) |
---|
| 3657 | { |
---|
| 3658 | rO_TDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3659 | tmp_typ[typ_i]); |
---|
| 3660 | typ_i++; |
---|
[84893c] | 3661 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3662 | } |
---|
| 3663 | } |
---|
| 3664 | if (r->block1[i]!=r->block0[i]) |
---|
| 3665 | { |
---|
| 3666 | rO_LexVars_neg(j, j_bits,r->block1[i],r->block0[i]+1, prev_ordsgn, |
---|
| 3667 | tmp_ordsgn, v,bits, r->block0[i]); |
---|
| 3668 | } |
---|
| 3669 | break; |
---|
| 3670 | |
---|
| 3671 | case ringorder_Wp: |
---|
| 3672 | rO_WDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3673 | tmp_typ[typ_i], r->wvhdl[i]); |
---|
| 3674 | typ_i++; |
---|
| 3675 | { // check for weights <=0 |
---|
[8261b2] | 3676 | int jj; |
---|
[a6904c] | 3677 | BOOLEAN have_bad_weights=FALSE; |
---|
[8261b2] | 3678 | for(jj=r->block1[i]-r->block0[i];jj>=0; jj--) |
---|
[a6904c] | 3679 | { |
---|
[8261b2] | 3680 | if (r->wvhdl[i][jj]<=0) have_bad_weights=TRUE; |
---|
[a6904c] | 3681 | } |
---|
| 3682 | if (have_bad_weights) |
---|
| 3683 | { |
---|
| 3684 | rO_TDegree(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3685 | tmp_typ[typ_i]); |
---|
| 3686 | typ_i++; |
---|
[84893c] | 3687 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3688 | } |
---|
| 3689 | } |
---|
| 3690 | if (r->block1[i]!=r->block0[i]) |
---|
| 3691 | { |
---|
| 3692 | rO_LexVars(j, j_bits,r->block0[i],r->block1[i]-1, prev_ordsgn, |
---|
| 3693 | tmp_ordsgn,v, bits, r->block1[i]); |
---|
| 3694 | } |
---|
| 3695 | break; |
---|
| 3696 | |
---|
| 3697 | case ringorder_ws: |
---|
| 3698 | rO_WDegree_neg(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3699 | tmp_typ[typ_i], r->wvhdl[i]); |
---|
| 3700 | typ_i++; |
---|
| 3701 | if (r->block1[i]!=r->block0[i]) |
---|
| 3702 | { |
---|
| 3703 | rO_LexVars_neg(j, j_bits,r->block1[i],r->block0[i]+1, prev_ordsgn, |
---|
| 3704 | tmp_ordsgn, v,bits, r->block0[i]); |
---|
| 3705 | } |
---|
[84893c] | 3706 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3707 | break; |
---|
| 3708 | |
---|
| 3709 | case ringorder_Ws: |
---|
| 3710 | rO_WDegree_neg(j,j_bits,r->block0[i],r->block1[i],tmp_ordsgn, |
---|
| 3711 | tmp_typ[typ_i], r->wvhdl[i]); |
---|
| 3712 | typ_i++; |
---|
| 3713 | if (r->block1[i]!=r->block0[i]) |
---|
| 3714 | { |
---|
| 3715 | rO_LexVars(j, j_bits,r->block0[i],r->block1[i]-1, prev_ordsgn, |
---|
| 3716 | tmp_ordsgn,v, bits, r->block1[i]); |
---|
| 3717 | } |
---|
[84893c] | 3718 | rCheckOrdSgn(r,i); |
---|
[a6904c] | 3719 | break; |
---|
| 3720 | |
---|
| 3721 | case ringorder_S: |
---|
[1ed346] | 3722 | assume(typ_i == 1); // For LaScala3 only: on the 2nd place ([1])! |
---|
| 3723 | // TODO: for K[x]: it is 0...?! |
---|
[a6904c] | 3724 | rO_Syzcomp(j, j_bits,prev_ordsgn, tmp_ordsgn,tmp_typ[typ_i]); |
---|
| 3725 | need_to_add_comp=TRUE; |
---|
| 3726 | typ_i++; |
---|
| 3727 | break; |
---|
| 3728 | |
---|
| 3729 | case ringorder_s: |
---|
| 3730 | assume(typ_i == 0 && j == 0); |
---|
[1ed346] | 3731 | rO_Syz(j, j_bits, prev_ordsgn, tmp_ordsgn, tmp_typ[typ_i]); // set syz-limit? |
---|
[a6904c] | 3732 | need_to_add_comp=TRUE; |
---|
| 3733 | typ_i++; |
---|
| 3734 | break; |
---|
| 3735 | |
---|
| 3736 | case ringorder_IS: |
---|
| 3737 | { |
---|
| 3738 | |
---|
| 3739 | assume( r->block0[i] == r->block1[i] ); |
---|
[273fed] | 3740 | const int s = r->block0[i]; |
---|
| 3741 | assume( -2 < s && s < 2); |
---|
[a6904c] | 3742 | |
---|
| 3743 | if(s == 0) // Prefix IS |
---|
| 3744 | rO_ISPrefix(j, j_bits, prev_ordsgn, tmp_ordsgn, r->N, v, tmp_typ[typ_i++]); // What about prev_ordsgn? |
---|
| 3745 | else // s = +1 or -1 // Note: typ_i might be incrimented here inside! |
---|
| 3746 | { |
---|
| 3747 | rO_ISSuffix(j, j_bits, prev_ordsgn, tmp_ordsgn, r->N, v, tmp_typ, typ_i, s); // Suffix. |
---|
| 3748 | need_to_add_comp=FALSE; |
---|
| 3749 | } |
---|
| 3750 | |
---|
| 3751 | break; |
---|
| 3752 | } |
---|
| 3753 | case ringorder_unspec: |
---|
| 3754 | case ringorder_no: |
---|
| 3755 | default: |
---|
| 3756 | dReportError("undef. ringorder used\n"); |
---|
| 3757 | break; |
---|
| 3758 | } |
---|
| 3759 | } |
---|
| 3760 | |
---|
| 3761 | int j0=j; // save j |
---|
| 3762 | int j_bits0=j_bits; // save jbits |
---|
| 3763 | rO_Align(j,j_bits); |
---|
| 3764 | r->CmpL_Size = j; |
---|
| 3765 | |
---|
| 3766 | j_bits=j_bits0; j=j0; |
---|
| 3767 | |
---|
| 3768 | // fill in some empty slots with variables not already covered |
---|
| 3769 | // v0 is special, is therefore normally already covered |
---|
| 3770 | // now we do have rings without comp... |
---|
| 3771 | if((need_to_add_comp) && (v[0]== -1)) |
---|
| 3772 | { |
---|
| 3773 | if (prev_ordsgn==1) |
---|
| 3774 | { |
---|
| 3775 | rO_Align(j, j_bits); |
---|
| 3776 | rO_LexVars(j, j_bits, 0,0, prev_ordsgn,tmp_ordsgn,v,BITS_PER_LONG, -1); |
---|
| 3777 | } |
---|
| 3778 | else |
---|
| 3779 | { |
---|
| 3780 | rO_Align(j, j_bits); |
---|
| 3781 | rO_LexVars_neg(j, j_bits, 0,0, prev_ordsgn,tmp_ordsgn,v,BITS_PER_LONG, -1); |
---|
| 3782 | } |
---|
| 3783 | } |
---|
| 3784 | // the variables |
---|
| 3785 | for(i=1 ; i<=r->N ; i++) |
---|
| 3786 | { |
---|
| 3787 | if(v[i]==(-1)) |
---|
| 3788 | { |
---|
| 3789 | if (prev_ordsgn==1) |
---|
| 3790 | { |
---|
| 3791 | rO_LexVars(j, j_bits, i,i, prev_ordsgn,tmp_ordsgn,v,bits, -1); |
---|
| 3792 | } |
---|
| 3793 | else |
---|
| 3794 | { |
---|
| 3795 | rO_LexVars_neg(j,j_bits,i,i, prev_ordsgn,tmp_ordsgn,v,bits, -1); |
---|
| 3796 | } |
---|
| 3797 | } |
---|
| 3798 | } |
---|
| 3799 | |
---|
| 3800 | rO_Align(j,j_bits); |
---|
| 3801 | // ---------------------------- |
---|
| 3802 | // finished with constructing the monomial, computing sizes: |
---|
| 3803 | |
---|
| 3804 | r->ExpL_Size=j; |
---|
| 3805 | r->PolyBin = omGetSpecBin(POLYSIZE + (r->ExpL_Size)*sizeof(long)); |
---|
| 3806 | assume(r->PolyBin != NULL); |
---|
| 3807 | |
---|
| 3808 | // ---------------------------- |
---|
| 3809 | // indices and ordsgn vector for comparison |
---|
| 3810 | // |
---|
| 3811 | // r->pCompHighIndex already set |
---|
| 3812 | r->ordsgn=(long *)omAlloc0(r->ExpL_Size*sizeof(long)); |
---|
| 3813 | |
---|
| 3814 | for(j=0;j<r->CmpL_Size;j++) |
---|
| 3815 | { |
---|
| 3816 | r->ordsgn[j] = tmp_ordsgn[j]; |
---|
| 3817 | } |
---|
| 3818 | |
---|
| 3819 | omFreeSize((ADDRESS)tmp_ordsgn,(3*(n+r->N)*sizeof(long))); |
---|
| 3820 | |
---|
| 3821 | // ---------------------------- |
---|
| 3822 | // description of orderings for setm: |
---|
| 3823 | // |
---|
| 3824 | r->OrdSize=typ_i; |
---|
| 3825 | if (typ_i==0) r->typ=NULL; |
---|
| 3826 | else |
---|
| 3827 | { |
---|
| 3828 | r->typ=(sro_ord*)omAlloc(typ_i*sizeof(sro_ord)); |
---|
| 3829 | memcpy(r->typ,tmp_typ,typ_i*sizeof(sro_ord)); |
---|
| 3830 | } |
---|
| 3831 | omFreeSize((ADDRESS)tmp_typ,(3*(n+r->N)*sizeof(sro_ord))); |
---|
| 3832 | |
---|
| 3833 | // ---------------------------- |
---|
| 3834 | // indices for (first copy of ) variable entries in exp.e vector (VarOffset): |
---|
| 3835 | r->VarOffset=v; |
---|
| 3836 | |
---|
| 3837 | // ---------------------------- |
---|
| 3838 | // other indicies |
---|
| 3839 | r->pCompIndex=(r->VarOffset[0] & 0xffff); //r->VarOffset[0]; |
---|
| 3840 | i=0; // position |
---|
| 3841 | j=0; // index in r->typ |
---|
| 3842 | if (i==r->pCompIndex) i++; // IS??? |
---|
| 3843 | while ((j < r->OrdSize) |
---|
| 3844 | && ((r->typ[j].ord_typ==ro_syzcomp) || |
---|
| 3845 | (r->typ[j].ord_typ==ro_syz) || (r->typ[j].ord_typ==ro_isTemp) || (r->typ[j].ord_typ==ro_is) || |
---|
| 3846 | (r->order[r->typ[j].order_index] == ringorder_aa))) |
---|
| 3847 | { |
---|
| 3848 | i++; j++; |
---|
| 3849 | } |
---|
| 3850 | // No use of j anymore!!!???? |
---|
| 3851 | |
---|
| 3852 | if (i==r->pCompIndex) i++; |
---|
| 3853 | r->pOrdIndex=i; // How came it is "i" here???!!!! exp[r->pOrdIndex] is order of a poly... This may be wrong!!! IS |
---|
| 3854 | |
---|
| 3855 | // ---------------------------- |
---|
| 3856 | rSetDegStuff(r); |
---|
| 3857 | rSetOption(r); |
---|
| 3858 | // ---------------------------- |
---|
| 3859 | // r->p_Setm |
---|
| 3860 | r->p_Setm = p_GetSetmProc(r); |
---|
| 3861 | |
---|
| 3862 | // ---------------------------- |
---|
| 3863 | // set VarL_* |
---|
| 3864 | rSetVarL(r); |
---|
| 3865 | |
---|
| 3866 | // ---------------------------- |
---|
| 3867 | // right-adjust VarOffset |
---|
| 3868 | rRightAdjustVarOffset(r); |
---|
| 3869 | |
---|
| 3870 | // ---------------------------- |
---|
| 3871 | // set NegWeightL* |
---|
| 3872 | rSetNegWeight(r); |
---|
| 3873 | |
---|
| 3874 | // ---------------------------- |
---|
| 3875 | // p_Procs: call AFTER NegWeightL |
---|
| 3876 | r->p_Procs = (p_Procs_s*)omAlloc(sizeof(p_Procs_s)); |
---|
| 3877 | p_ProcsSet(r, r->p_Procs); |
---|
| 3878 | return FALSE; |
---|
| 3879 | } |
---|
| 3880 | |
---|
[8261b2] | 3881 | static void rCheckOrdSgn(ring r,int i/*current block*/) |
---|
| 3882 | { // set r->OrdSgn |
---|
[99d8fd5] | 3883 | if ( r->OrdSgn==1) |
---|
| 3884 | { |
---|
| 3885 | int oo=-1; |
---|
| 3886 | int jj; |
---|
| 3887 | for(jj=i-1;jj>=0;jj--) |
---|
| 3888 | { |
---|
| 3889 | if(((r->order[jj]==ringorder_a) |
---|
| 3890 | ||(r->order[jj]==ringorder_aa) |
---|
| 3891 | ||(r->order[jj]==ringorder_a64)) |
---|
| 3892 | &&(r->block0[jj]<=r->block0[i]) |
---|
| 3893 | &&(r->block1[jj]>=r->block1[i])) |
---|
| 3894 | { oo=1; break;} |
---|
| 3895 | } |
---|
| 3896 | r->OrdSgn=oo; |
---|
| 3897 | } |
---|
[8261b2] | 3898 | } |
---|
| 3899 | |
---|
[84893c] | 3900 | |
---|
[a6904c] | 3901 | void rUnComplete(ring r) |
---|
| 3902 | { |
---|
| 3903 | if (r == NULL) return; |
---|
| 3904 | if (r->VarOffset != NULL) |
---|
| 3905 | { |
---|
| 3906 | if (r->OrdSize!=0 && r->typ != NULL) |
---|
| 3907 | { |
---|
| 3908 | for(int i = 0; i < r->OrdSize; i++) |
---|
| 3909 | if( r->typ[i].ord_typ == ro_is) // Search for suffixes! (prefix have the same VarOffset) |
---|
| 3910 | { |
---|
| 3911 | id_Delete(&r->typ[i].data.is.F, r); |
---|
| 3912 | r->typ[i].data.is.F = NULL; // ? |
---|
| 3913 | |
---|
| 3914 | if( r->typ[i].data.is.componentWeights != NULL ) |
---|
| 3915 | { |
---|
| 3916 | delete r->typ[i].data.is.componentWeights; |
---|
| 3917 | r->typ[i].data.is.componentWeights = NULL; // ? |
---|
| 3918 | } |
---|
| 3919 | |
---|
| 3920 | if( r->typ[i].data.is.pVarOffset != NULL ) |
---|
| 3921 | { |
---|
| 3922 | omFreeSize((ADDRESS)r->typ[i].data.is.pVarOffset, (r->N +1)*sizeof(int)); |
---|
| 3923 | r->typ[i].data.is.pVarOffset = NULL; // ? |
---|
| 3924 | } |
---|
| 3925 | } |
---|
| 3926 | else if (r->typ[i].ord_typ == ro_syz) |
---|
| 3927 | { |
---|
| 3928 | if(r->typ[i].data.syz.limit > 0) |
---|
| 3929 | omFreeSize(r->typ[i].data.syz.syz_index, ((r->typ[i].data.syz.limit) +1)*sizeof(int)); |
---|
| 3930 | r->typ[i].data.syz.syz_index = NULL; |
---|
| 3931 | } |
---|
| 3932 | else if (r->typ[i].ord_typ == ro_syzcomp) |
---|
| 3933 | { |
---|
[1ed346] | 3934 | assume( r->typ[i].data.syzcomp.ShiftedComponents == NULL ); |
---|
| 3935 | assume( r->typ[i].data.syzcomp.Components == NULL ); |
---|
| 3936 | // WarnS( "rUnComplete : ord_typ == ro_syzcomp was unhandled!!! Possibly memory leak!!!" ); |
---|
[a6904c] | 3937 | #ifndef NDEBUG |
---|
[1ed346] | 3938 | // assume(0); |
---|
[a6904c] | 3939 | #endif |
---|
| 3940 | } |
---|
| 3941 | |
---|
| 3942 | omFreeSize((ADDRESS)r->typ,r->OrdSize*sizeof(sro_ord)); r->typ = NULL; |
---|
| 3943 | } |
---|
| 3944 | |
---|
| 3945 | if (r->order != NULL) |
---|
| 3946 | { |
---|
| 3947 | // delete r->order!!!??? |
---|
| 3948 | } |
---|
| 3949 | |
---|
| 3950 | if (r->PolyBin != NULL) |
---|
| 3951 | omUnGetSpecBin(&(r->PolyBin)); |
---|
| 3952 | |
---|
| 3953 | omFreeSize((ADDRESS)r->VarOffset, (r->N +1)*sizeof(int)); |
---|
| 3954 | |
---|
| 3955 | if (r->ordsgn != NULL && r->CmpL_Size != 0) |
---|
| 3956 | omFreeSize((ADDRESS)r->ordsgn,r->ExpL_Size*sizeof(long)); |
---|
| 3957 | if (r->p_Procs != NULL) |
---|
| 3958 | omFreeSize(r->p_Procs, sizeof(p_Procs_s)); |
---|
| 3959 | omfreeSize(r->VarL_Offset, r->VarL_Size*sizeof(int)); |
---|
| 3960 | } |
---|
| 3961 | if (r->NegWeightL_Offset!=NULL) |
---|
| 3962 | { |
---|
| 3963 | omFreeSize(r->NegWeightL_Offset, r->NegWeightL_Size*sizeof(int)); |
---|
| 3964 | r->NegWeightL_Offset=NULL; |
---|
| 3965 | } |
---|
| 3966 | } |
---|
| 3967 | |
---|
| 3968 | // set r->VarL_Size, r->VarL_Offset, r->VarL_LowIndex |
---|
| 3969 | static void rSetVarL(ring r) |
---|
| 3970 | { |
---|
| 3971 | int min = INT_MAX, min_j = -1; |
---|
| 3972 | int* VarL_Number = (int*) omAlloc0(r->ExpL_Size*sizeof(int)); |
---|
| 3973 | |
---|
| 3974 | int i,j; |
---|
| 3975 | |
---|
| 3976 | // count how often a var long is occupied by an exponent |
---|
| 3977 | for (i=1; i<=r->N; i++) |
---|
| 3978 | { |
---|
| 3979 | VarL_Number[r->VarOffset[i] & 0xffffff]++; |
---|
| 3980 | } |
---|
| 3981 | |
---|
| 3982 | // determine how many and min |
---|
| 3983 | for (i=0, j=0; i<r->ExpL_Size; i++) |
---|
| 3984 | { |
---|
| 3985 | if (VarL_Number[i] != 0) |
---|
| 3986 | { |
---|
| 3987 | if (min > VarL_Number[i]) |
---|
| 3988 | { |
---|
| 3989 | min = VarL_Number[i]; |
---|
| 3990 | min_j = j; |
---|
| 3991 | } |
---|
| 3992 | j++; |
---|
| 3993 | } |
---|
| 3994 | } |
---|
| 3995 | |
---|
| 3996 | r->VarL_Size = j; // number of long with exp. entries in |
---|
| 3997 | // in p->exp |
---|
| 3998 | r->VarL_Offset = (int*) omAlloc(r->VarL_Size*sizeof(int)); |
---|
| 3999 | r->VarL_LowIndex = 0; |
---|
| 4000 | |
---|
| 4001 | // set VarL_Offset |
---|
| 4002 | for (i=0, j=0; i<r->ExpL_Size; i++) |
---|
| 4003 | { |
---|
| 4004 | if (VarL_Number[i] != 0) |
---|
| 4005 | { |
---|
| 4006 | r->VarL_Offset[j] = i; |
---|
| 4007 | if (j > 0 && r->VarL_Offset[j-1] != r->VarL_Offset[j] - 1) |
---|
| 4008 | r->VarL_LowIndex = -1; |
---|
| 4009 | j++; |
---|
| 4010 | } |
---|
| 4011 | } |
---|
| 4012 | if (r->VarL_LowIndex >= 0) |
---|
| 4013 | r->VarL_LowIndex = r->VarL_Offset[0]; |
---|
| 4014 | |
---|
| 4015 | r->MinExpPerLong = min; |
---|
| 4016 | if (min_j != 0) |
---|
| 4017 | { |
---|
| 4018 | j = r->VarL_Offset[min_j]; |
---|
| 4019 | r->VarL_Offset[min_j] = r->VarL_Offset[0]; |
---|
| 4020 | r->VarL_Offset[0] = j; |
---|
| 4021 | } |
---|
| 4022 | omFree(VarL_Number); |
---|
| 4023 | } |
---|
| 4024 | |
---|
| 4025 | static void rRightAdjustVarOffset(ring r) |
---|
| 4026 | { |
---|
| 4027 | int* shifts = (int*) omAlloc(r->ExpL_Size*sizeof(int)); |
---|
| 4028 | int i; |
---|
| 4029 | // initialize shifts |
---|
| 4030 | for (i=0;i<r->ExpL_Size;i++) |
---|
| 4031 | shifts[i] = BIT_SIZEOF_LONG; |
---|
| 4032 | |
---|
| 4033 | // find minimal bit shift in each long exp entry |
---|
| 4034 | for (i=1;i<=r->N;i++) |
---|
| 4035 | { |
---|
| 4036 | if (shifts[r->VarOffset[i] & 0xffffff] > r->VarOffset[i] >> 24) |
---|
| 4037 | shifts[r->VarOffset[i] & 0xffffff] = r->VarOffset[i] >> 24; |
---|
| 4038 | } |
---|
| 4039 | // reset r->VarOffset: set the minimal shift to 0 |
---|
| 4040 | for (i=1;i<=r->N;i++) |
---|
| 4041 | { |
---|
| 4042 | if (shifts[r->VarOffset[i] & 0xffffff] != 0) |
---|
| 4043 | r->VarOffset[i] |
---|
| 4044 | = (r->VarOffset[i] & 0xffffff) | |
---|
| 4045 | (((r->VarOffset[i] >> 24) - shifts[r->VarOffset[i] & 0xffffff]) << 24); |
---|
| 4046 | } |
---|
| 4047 | omFree(shifts); |
---|
| 4048 | } |
---|
| 4049 | |
---|
| 4050 | // get r->divmask depending on bits per exponent |
---|
| 4051 | static unsigned long rGetDivMask(int bits) |
---|
| 4052 | { |
---|
| 4053 | unsigned long divmask = 1; |
---|
| 4054 | int i = bits; |
---|
| 4055 | |
---|
| 4056 | while (i < BIT_SIZEOF_LONG) |
---|
| 4057 | { |
---|
| 4058 | divmask |= (((unsigned long) 1) << (unsigned long) i); |
---|
| 4059 | i += bits; |
---|
| 4060 | } |
---|
| 4061 | return divmask; |
---|
| 4062 | } |
---|
| 4063 | |
---|
| 4064 | #ifdef RDEBUG |
---|
| 4065 | void rDebugPrint(ring r) |
---|
| 4066 | { |
---|
| 4067 | if (r==NULL) |
---|
| 4068 | { |
---|
| 4069 | PrintS("NULL ?\n"); |
---|
| 4070 | return; |
---|
| 4071 | } |
---|
| 4072 | // corresponds to ro_typ from ring.h: |
---|
| 4073 | const char *TYP[]={"ro_dp","ro_wp","ro_wp64","ro_wp_neg","ro_cp", |
---|
| 4074 | "ro_syzcomp", "ro_syz", "ro_isTemp", "ro_is", "ro_none"}; |
---|
| 4075 | int i,j; |
---|
| 4076 | |
---|
| 4077 | Print("ExpL_Size:%d ",r->ExpL_Size); |
---|
| 4078 | Print("CmpL_Size:%d ",r->CmpL_Size); |
---|
| 4079 | Print("VarL_Size:%d\n",r->VarL_Size); |
---|
| 4080 | Print("bitmask=0x%lx (expbound=%ld) \n",r->bitmask, r->bitmask); |
---|
| 4081 | Print("BitsPerExp=%d ExpPerLong=%d MinExpPerLong=%d at L[%d]\n", r->BitsPerExp, r->ExpPerLong, r->MinExpPerLong, r->VarL_Offset[0]); |
---|
| 4082 | PrintS("varoffset:\n"); |
---|
| 4083 | if (r->VarOffset==NULL) PrintS(" NULL\n"); |
---|
| 4084 | else |
---|
| 4085 | for(j=0;j<=r->N;j++) |
---|
| 4086 | Print(" v%d at e-pos %d, bit %d\n", |
---|
| 4087 | j,r->VarOffset[j] & 0xffffff, r->VarOffset[j] >>24); |
---|
| 4088 | Print("divmask=%lx\n", r->divmask); |
---|
| 4089 | PrintS("ordsgn:\n"); |
---|
| 4090 | for(j=0;j<r->CmpL_Size;j++) |
---|
| 4091 | Print(" ordsgn %ld at pos %d\n",r->ordsgn[j],j); |
---|
| 4092 | Print("OrdSgn:%d\n",r->OrdSgn); |
---|
| 4093 | PrintS("ordrec:\n"); |
---|
| 4094 | for(j=0;j<r->OrdSize;j++) |
---|
| 4095 | { |
---|
| 4096 | Print(" typ %s", TYP[r->typ[j].ord_typ]); |
---|
| 4097 | |
---|
[273fed] | 4098 | |
---|
| 4099 | if (r->typ[j].ord_typ==ro_syz) |
---|
| 4100 | { |
---|
| 4101 | const short place = r->typ[j].data.syz.place; |
---|
| 4102 | const int limit = r->typ[j].data.syz.limit; |
---|
| 4103 | const int curr_index = r->typ[j].data.syz.curr_index; |
---|
| 4104 | const int* syz_index = r->typ[j].data.syz.syz_index; |
---|
| 4105 | |
---|
| 4106 | Print(" limit %d (place: %d, curr_index: %d), syz_index: ", limit, place, curr_index); |
---|
| 4107 | |
---|
| 4108 | if( syz_index == NULL ) |
---|
| 4109 | PrintS("(NULL)"); |
---|
| 4110 | else |
---|
| 4111 | { |
---|
| 4112 | Print("{"); |
---|
| 4113 | for( i=0; i <= limit; i++ ) |
---|
| 4114 | Print("%d ", syz_index[i]); |
---|
| 4115 | Print("}"); |
---|
| 4116 | } |
---|
| 4117 | |
---|
| 4118 | } |
---|
| 4119 | else if (r->typ[j].ord_typ==ro_isTemp) |
---|
[a6904c] | 4120 | { |
---|
| 4121 | Print(" start (level) %d, suffixpos: %d, VO: ",r->typ[j].data.isTemp.start, r->typ[j].data.isTemp.suffixpos); |
---|
| 4122 | |
---|
[2e4f788] | 4123 | #ifndef NDEBUG |
---|
[a6904c] | 4124 | for( int k = 0; k <= r->N; k++) |
---|
| 4125 | if (r->typ[j].data.isTemp.pVarOffset[k] != -1) |
---|
| 4126 | Print("[%2d]: %09x; ", k, r->typ[j].data.isTemp.pVarOffset[k]); |
---|
| 4127 | #endif |
---|
| 4128 | } |
---|
[273fed] | 4129 | else if (r->typ[j].ord_typ==ro_is) |
---|
[a6904c] | 4130 | { |
---|
| 4131 | Print(" start %d, end: %d: ",r->typ[j].data.is.start, r->typ[j].data.is.end); |
---|
| 4132 | |
---|
| 4133 | // for( int k = 0; k <= r->N; k++) if (r->typ[j].data.is.pVarOffset[k] != -1) Print("[%2d]: %04x; ", k, r->typ[j].data.is.pVarOffset[k]); |
---|
| 4134 | |
---|
| 4135 | Print(" limit %d\n",r->typ[j].data.is.limit); |
---|
| 4136 | #ifndef NDEBUG |
---|
| 4137 | PrintS(" F: ");idShow(r->typ[j].data.is.F, r, r, 1); |
---|
| 4138 | #endif |
---|
| 4139 | |
---|
| 4140 | PrintS("weights: "); |
---|
| 4141 | |
---|
| 4142 | if( r->typ[j].data.is.componentWeights == NULL ) |
---|
| 4143 | PrintS("NULL == [0,...0]\n"); |
---|
| 4144 | else |
---|
| 4145 | { |
---|
| 4146 | (r->typ[j].data.is.componentWeights)->show(); PrintLn(); |
---|
| 4147 | } |
---|
| 4148 | } |
---|
| 4149 | else |
---|
| 4150 | { |
---|
| 4151 | Print(" place %d",r->typ[j].data.dp.place); |
---|
| 4152 | |
---|
| 4153 | if (r->typ[j].ord_typ!=ro_syzcomp && r->typ[j].ord_typ!=ro_syz) |
---|
| 4154 | { |
---|
| 4155 | Print(" start %d",r->typ[j].data.dp.start); |
---|
| 4156 | Print(" end %d",r->typ[j].data.dp.end); |
---|
| 4157 | if ((r->typ[j].ord_typ==ro_wp) |
---|
| 4158 | || (r->typ[j].ord_typ==ro_wp_neg)) |
---|
| 4159 | { |
---|
| 4160 | PrintS(" w:"); |
---|
| 4161 | for(int l=r->typ[j].data.wp.start;l<=r->typ[j].data.wp.end;l++) |
---|
| 4162 | Print(" %d",r->typ[j].data.wp.weights[l-r->typ[j].data.wp.start]); |
---|
| 4163 | } |
---|
| 4164 | else if (r->typ[j].ord_typ==ro_wp64) |
---|
| 4165 | { |
---|
| 4166 | PrintS(" w64:"); |
---|
| 4167 | int l; |
---|
| 4168 | for(l=r->typ[j].data.wp64.start;l<=r->typ[j].data.wp64.end;l++) |
---|
| 4169 | Print(" %ld",(long)(((int64*)r->typ[j].data.wp64.weights64)+l-r->typ[j].data.wp64.start)); |
---|
| 4170 | } |
---|
| 4171 | } |
---|
| 4172 | } |
---|
| 4173 | PrintLn(); |
---|
| 4174 | } |
---|
| 4175 | Print("pOrdIndex:%d pCompIndex:%d\n", r->pOrdIndex, r->pCompIndex); |
---|
| 4176 | Print("OrdSize:%d\n",r->OrdSize); |
---|
| 4177 | PrintS("--------------------\n"); |
---|
| 4178 | for(j=0;j<r->ExpL_Size;j++) |
---|
| 4179 | { |
---|
| 4180 | Print("L[%d]: ",j); |
---|
| 4181 | if (j< r->CmpL_Size) |
---|
| 4182 | Print("ordsgn %ld ", r->ordsgn[j]); |
---|
| 4183 | else |
---|
| 4184 | PrintS("no comp "); |
---|
| 4185 | i=1; |
---|
| 4186 | for(;i<=r->N;i++) |
---|
| 4187 | { |
---|
| 4188 | if( (r->VarOffset[i] & 0xffffff) == j ) |
---|
| 4189 | { Print("v%d at e[%d], bit %d; ", i,r->VarOffset[i] & 0xffffff, |
---|
| 4190 | r->VarOffset[i] >>24 ); } |
---|
| 4191 | } |
---|
| 4192 | if( r->pCompIndex==j ) PrintS("v0; "); |
---|
| 4193 | for(i=0;i<r->OrdSize;i++) |
---|
| 4194 | { |
---|
| 4195 | if (r->typ[i].data.dp.place == j) |
---|
| 4196 | { |
---|
| 4197 | Print("ordrec:%s (start:%d, end:%d) ",TYP[r->typ[i].ord_typ], |
---|
| 4198 | r->typ[i].data.dp.start, r->typ[i].data.dp.end); |
---|
| 4199 | } |
---|
| 4200 | } |
---|
| 4201 | |
---|
| 4202 | if (j==r->pOrdIndex) |
---|
| 4203 | PrintS("pOrdIndex\n"); |
---|
| 4204 | else |
---|
| 4205 | PrintLn(); |
---|
| 4206 | } |
---|
[8047af8] | 4207 | Print("LexOrder:%d, MixedOrder:%d\n",r->LexOrder, r->MixedOrder); |
---|
[a6904c] | 4208 | |
---|
| 4209 | // p_Procs stuff |
---|
| 4210 | p_Procs_s proc_names; |
---|
| 4211 | const char* field; |
---|
| 4212 | const char* length; |
---|
| 4213 | const char* ord; |
---|
| 4214 | p_Debug_GetProcNames(r, &proc_names); // changes p_Procs!!! |
---|
| 4215 | p_Debug_GetSpecNames(r, field, length, ord); |
---|
| 4216 | |
---|
| 4217 | Print("p_Spec : %s, %s, %s\n", field, length, ord); |
---|
| 4218 | PrintS("p_Procs :\n"); |
---|
| 4219 | for (i=0; i<(int) (sizeof(p_Procs_s)/sizeof(void*)); i++) |
---|
| 4220 | { |
---|
| 4221 | Print(" %s,\n", ((char**) &proc_names)[i]); |
---|
| 4222 | } |
---|
[273fed] | 4223 | |
---|
| 4224 | { |
---|
| 4225 | #define pFDeg_CASE(A) if(r->pFDeg == A) PrintS( "" #A "" ) |
---|
| 4226 | Print("\npFDeg : "); |
---|
| 4227 | |
---|
| 4228 | pFDeg_CASE(p_Totaldegree); else |
---|
| 4229 | pFDeg_CASE(pWFirstTotalDegree); else |
---|
| 4230 | pFDeg_CASE(pWTotaldegree); else |
---|
| 4231 | pFDeg_CASE(pDeg); else |
---|
| 4232 | Print("(%p)", r->pFDeg); // default case |
---|
| 4233 | |
---|
| 4234 | PrintS("\n"); |
---|
| 4235 | #undef pFDeg_CASE |
---|
| 4236 | } |
---|
| 4237 | |
---|
[a6904c] | 4238 | } |
---|
| 4239 | |
---|
| 4240 | void p_DebugPrint(poly p, const ring r) |
---|
| 4241 | { |
---|
| 4242 | int i,j; |
---|
| 4243 | p_Write(p,r); |
---|
| 4244 | j=2; |
---|
| 4245 | while(p!=NULL) |
---|
| 4246 | { |
---|
| 4247 | Print("\nexp[0..%d]\n",r->ExpL_Size-1); |
---|
| 4248 | for(i=0;i<r->ExpL_Size;i++) |
---|
| 4249 | Print("%ld ",p->exp[i]); |
---|
| 4250 | PrintLn(); |
---|
| 4251 | Print("v0:%ld ",p_GetComp(p, r)); |
---|
[b1ff71] | 4252 | for(i=1;i<=r->N;i++) Print(" v%d:%ld",i,p_GetExp(p,i, r)); |
---|
[a6904c] | 4253 | PrintLn(); |
---|
| 4254 | pIter(p); |
---|
| 4255 | j--; |
---|
| 4256 | if (j==0) { PrintS("...\n"); break; } |
---|
| 4257 | } |
---|
| 4258 | } |
---|
| 4259 | |
---|
| 4260 | void pDebugPrint(poly p) |
---|
| 4261 | { |
---|
| 4262 | p_DebugPrint(p, currRing); |
---|
| 4263 | } |
---|
| 4264 | #endif // RDEBUG |
---|
| 4265 | |
---|
| 4266 | /// debug-print monomial poly/vector p, assuming that it lives in the ring R |
---|
| 4267 | static inline void m_DebugPrint(const poly p, const ring R) |
---|
| 4268 | { |
---|
| 4269 | Print("\nexp[0..%d]\n", R->ExpL_Size - 1); |
---|
| 4270 | for(int i = 0; i < R->ExpL_Size; i++) |
---|
| 4271 | Print("%09lx ", p->exp[i]); |
---|
| 4272 | PrintLn(); |
---|
| 4273 | Print("v0:%9ld ", p_GetComp(p, R)); |
---|
[b1ff71] | 4274 | for(int i = 1; i <= R->N; i++) Print(" v%d:%5ld",i, p_GetExp(p, i, R)); |
---|
[a6904c] | 4275 | PrintLn(); |
---|
| 4276 | } |
---|
| 4277 | |
---|
| 4278 | |
---|
| 4279 | #ifndef NDEBUG |
---|
| 4280 | /// debug-print at most nTerms (2 by default) terms from poly/vector p, |
---|
| 4281 | /// assuming that lt(p) lives in lmRing and tail(p) lives in tailRing. |
---|
| 4282 | void p_DebugPrint(const poly p, const ring lmRing, const ring tailRing, const int nTerms) |
---|
| 4283 | { |
---|
| 4284 | assume( nTerms >= 0 ); |
---|
| 4285 | if( p != NULL ) |
---|
| 4286 | { |
---|
| 4287 | assume( p != NULL ); |
---|
| 4288 | |
---|
| 4289 | p_Write(p, lmRing, tailRing); |
---|
| 4290 | |
---|
| 4291 | if( (p != NULL) && (nTerms > 0) ) |
---|
| 4292 | { |
---|
| 4293 | assume( p != NULL ); |
---|
| 4294 | assume( nTerms > 0 ); |
---|
| 4295 | |
---|
| 4296 | // debug pring leading term |
---|
| 4297 | m_DebugPrint(p, lmRing); |
---|
| 4298 | |
---|
| 4299 | poly q = pNext(p); // q = tail(p) |
---|
| 4300 | |
---|
| 4301 | // debug pring tail (at most nTerms-1 terms from it) |
---|
| 4302 | for(int j = nTerms - 1; (q !=NULL) && (j > 0); pIter(q), --j) |
---|
| 4303 | m_DebugPrint(q, tailRing); |
---|
| 4304 | |
---|
| 4305 | if (q != NULL) |
---|
| 4306 | PrintS("...\n"); |
---|
| 4307 | } |
---|
| 4308 | } |
---|
| 4309 | else |
---|
| 4310 | PrintS("0\n"); |
---|
| 4311 | } |
---|
| 4312 | #endif |
---|
| 4313 | |
---|
| 4314 | |
---|
| 4315 | // F = system("ISUpdateComponents", F, V, MIN ); |
---|
| 4316 | // // replace gen(i) -> gen(MIN + V[i-MIN]) for all i > MIN in all terms from F! |
---|
| 4317 | void pISUpdateComponents(ideal F, const intvec *const V, const int MIN, const ring r = currRing) |
---|
| 4318 | { |
---|
| 4319 | assume( V != NULL ); |
---|
| 4320 | assume( MIN >= 0 ); |
---|
| 4321 | |
---|
| 4322 | if( F == NULL ) |
---|
| 4323 | return; |
---|
| 4324 | |
---|
| 4325 | for( int j = (F->ncols*F->nrows) - 1; j >= 0; j-- ) |
---|
| 4326 | { |
---|
| 4327 | #ifdef PDEBUG |
---|
| 4328 | Print("F[%d]:", j); |
---|
| 4329 | p_DebugPrint(F->m[j], r, r, 0); |
---|
| 4330 | #endif |
---|
| 4331 | |
---|
| 4332 | for( poly p = F->m[j]; p != NULL; pIter(p) ) |
---|
| 4333 | { |
---|
| 4334 | int c = p_GetComp(p, r); |
---|
| 4335 | |
---|
| 4336 | if( c > MIN ) |
---|
| 4337 | { |
---|
| 4338 | #ifdef PDEBUG |
---|
| 4339 | Print("gen[%d] -> gen(%d)\n", c, MIN + (*V)[ c - MIN - 1 ]); |
---|
| 4340 | #endif |
---|
| 4341 | |
---|
| 4342 | p_SetComp( p, MIN + (*V)[ c - MIN - 1 ], r ); |
---|
| 4343 | } |
---|
| 4344 | } |
---|
| 4345 | #ifdef PDEBUG |
---|
| 4346 | Print("new F[%d]:", j); |
---|
| 4347 | p_Test(F->m[j], r); |
---|
| 4348 | p_DebugPrint(F->m[j], r, r, 0); |
---|
| 4349 | #endif |
---|
| 4350 | } |
---|
| 4351 | |
---|
| 4352 | } |
---|
| 4353 | |
---|
| 4354 | |
---|
| 4355 | |
---|
| 4356 | |
---|
| 4357 | /*2 |
---|
| 4358 | * asssume that rComplete was called with r |
---|
| 4359 | * assume that the first block ist ringorder_S |
---|
| 4360 | * change the block to reflect the sequence given by appending v |
---|
| 4361 | */ |
---|
| 4362 | |
---|
| 4363 | #ifdef PDEBUG |
---|
| 4364 | void rDBChangeSComps(int* currComponents, |
---|
| 4365 | long* currShiftedComponents, |
---|
| 4366 | int length, |
---|
| 4367 | ring r) |
---|
| 4368 | { |
---|
[1ed346] | 4369 | assume(r->typ[1].ord_typ == ro_syzcomp); |
---|
| 4370 | |
---|
[a6904c] | 4371 | r->typ[1].data.syzcomp.length = length; |
---|
| 4372 | rNChangeSComps( currComponents, currShiftedComponents, r); |
---|
| 4373 | } |
---|
| 4374 | void rDBGetSComps(int** currComponents, |
---|
| 4375 | long** currShiftedComponents, |
---|
| 4376 | int *length, |
---|
| 4377 | ring r) |
---|
| 4378 | { |
---|
[1ed346] | 4379 | assume(r->typ[1].ord_typ == ro_syzcomp); |
---|
| 4380 | |
---|
[a6904c] | 4381 | *length = r->typ[1].data.syzcomp.length; |
---|
| 4382 | rNGetSComps( currComponents, currShiftedComponents, r); |
---|
| 4383 | } |
---|
| 4384 | #endif |
---|
| 4385 | |
---|
| 4386 | void rNChangeSComps(int* currComponents, long* currShiftedComponents, ring r) |
---|
| 4387 | { |
---|
[1ed346] | 4388 | assume(r->typ[1].ord_typ == ro_syzcomp); |
---|
[a6904c] | 4389 | |
---|
| 4390 | r->typ[1].data.syzcomp.ShiftedComponents = currShiftedComponents; |
---|
| 4391 | r->typ[1].data.syzcomp.Components = currComponents; |
---|
| 4392 | } |
---|
| 4393 | |
---|
| 4394 | void rNGetSComps(int** currComponents, long** currShiftedComponents, ring r) |
---|
| 4395 | { |
---|
[1ed346] | 4396 | assume(r->typ[1].ord_typ == ro_syzcomp); |
---|
[a6904c] | 4397 | |
---|
| 4398 | *currShiftedComponents = r->typ[1].data.syzcomp.ShiftedComponents; |
---|
| 4399 | *currComponents = r->typ[1].data.syzcomp.Components; |
---|
| 4400 | } |
---|
| 4401 | |
---|
| 4402 | ///////////////////////////////////////////////////////////////////////////// |
---|
| 4403 | // |
---|
| 4404 | // The following routines all take as input a ring r, and return R |
---|
| 4405 | // where R has a certain property. R might be equal r in which case r |
---|
| 4406 | // had already this property |
---|
| 4407 | // |
---|
| 4408 | // Without argument, these functions work on currRing and change it, |
---|
| 4409 | // if necessary |
---|
| 4410 | |
---|
| 4411 | // for the time being, this is still here |
---|
| 4412 | static ring rAssure_SyzComp(const ring r, BOOLEAN complete = TRUE); |
---|
| 4413 | |
---|
| 4414 | ring rCurrRingAssure_SyzComp() |
---|
| 4415 | { |
---|
| 4416 | #if MYTEST |
---|
| 4417 | PrintS("rCurrRingAssure_SyzComp(), currRing: \n"); |
---|
| 4418 | rWrite(currRing); |
---|
| 4419 | #ifdef RDEBUG |
---|
| 4420 | rDebugPrint(currRing); |
---|
| 4421 | #endif |
---|
| 4422 | PrintLn(); |
---|
| 4423 | #endif |
---|
| 4424 | |
---|
| 4425 | ring r = rAssure_SyzComp(currRing, TRUE); |
---|
| 4426 | |
---|
| 4427 | if( r != currRing ) |
---|
| 4428 | { |
---|
| 4429 | rChangeCurrRing(r); |
---|
| 4430 | assume(currRing == r); |
---|
| 4431 | |
---|
| 4432 | #if MYTEST |
---|
| 4433 | PrintS("\nrCurrRingAssure_SyzComp(): new currRing: \n"); |
---|
| 4434 | rWrite(currRing); |
---|
| 4435 | #ifdef RDEBUG |
---|
| 4436 | rDebugPrint(currRing); |
---|
| 4437 | #endif |
---|
| 4438 | PrintLn(); |
---|
| 4439 | #endif |
---|
| 4440 | } |
---|
| 4441 | |
---|
| 4442 | return r; |
---|
| 4443 | } |
---|
| 4444 | |
---|
| 4445 | static ring rAssure_SyzComp(const ring r, BOOLEAN complete) |
---|
| 4446 | { |
---|
| 4447 | if ( (r->order[0] == ringorder_s) ) return r; |
---|
[273fed] | 4448 | |
---|
[a6904c] | 4449 | if ( (r->order[0] == ringorder_IS) ) |
---|
| 4450 | { |
---|
| 4451 | #ifndef NDEBUG |
---|
[273fed] | 4452 | WarnS("rAssure_SyzComp: input ring has an IS-ordering!"); |
---|
[a6904c] | 4453 | #endif |
---|
| 4454 | // return r; |
---|
| 4455 | } |
---|
| 4456 | ring res=rCopy0(r, FALSE, FALSE); |
---|
| 4457 | int i=rBlocks(r); |
---|
| 4458 | int j; |
---|
| 4459 | |
---|
| 4460 | res->order=(int *)omAlloc((i+1)*sizeof(int)); |
---|
| 4461 | res->block0=(int *)omAlloc0((i+1)*sizeof(int)); |
---|
| 4462 | res->block1=(int *)omAlloc0((i+1)*sizeof(int)); |
---|
| 4463 | int ** wvhdl =(int **)omAlloc0((i+1)*sizeof(int**)); |
---|
| 4464 | for(j=i;j>0;j--) |
---|
| 4465 | { |
---|
| 4466 | res->order[j]=r->order[j-1]; |
---|
| 4467 | res->block0[j]=r->block0[j-1]; |
---|
| 4468 | res->block1[j]=r->block1[j-1]; |
---|
| 4469 | if (r->wvhdl[j-1] != NULL) |
---|
| 4470 | { |
---|
| 4471 | wvhdl[j] = (int*) omMemDup(r->wvhdl[j-1]); |
---|
| 4472 | } |
---|
| 4473 | } |
---|
| 4474 | res->order[0]=ringorder_s; |
---|
| 4475 | |
---|
| 4476 | res->wvhdl = wvhdl; |
---|
| 4477 | |
---|
| 4478 | if (complete) |
---|
| 4479 | { |
---|
| 4480 | rComplete(res, 1); |
---|
| 4481 | |
---|
| 4482 | #ifdef HAVE_PLURAL |
---|
| 4483 | if (rIsPluralRing(r)) |
---|
| 4484 | { |
---|
| 4485 | if ( nc_rComplete(r, res, false) ) // no qideal! |
---|
| 4486 | { |
---|
| 4487 | #ifndef NDEBUG |
---|
| 4488 | WarnS("error in nc_rComplete"); // cleanup?// rDelete(res);// return r; // just go on.. |
---|
| 4489 | #endif |
---|
| 4490 | } |
---|
| 4491 | } |
---|
| 4492 | assume(rIsPluralRing(r) == rIsPluralRing(res)); |
---|
| 4493 | #endif |
---|
| 4494 | |
---|
| 4495 | |
---|
| 4496 | #ifdef HAVE_PLURAL |
---|
| 4497 | ring old_ring = r; |
---|
| 4498 | |
---|
| 4499 | #if MYTEST |
---|
| 4500 | PrintS("rCurrRingAssure_SyzComp(): temp r': "); |
---|
| 4501 | rWrite(r); |
---|
| 4502 | #ifdef RDEBUG |
---|
| 4503 | rDebugPrint(r); |
---|
| 4504 | #endif |
---|
| 4505 | PrintLn(); |
---|
| 4506 | #endif |
---|
| 4507 | #endif |
---|
| 4508 | |
---|
| 4509 | |
---|
| 4510 | if (r->qideal!=NULL) |
---|
| 4511 | { |
---|
| 4512 | res->qideal= idrCopyR_NoSort(r->qideal, r, res); |
---|
| 4513 | |
---|
| 4514 | assume(idRankFreeModule(res->qideal, res) == 0); |
---|
| 4515 | |
---|
| 4516 | #ifdef HAVE_PLURAL |
---|
| 4517 | if( rIsPluralRing(res) ) |
---|
| 4518 | if( nc_SetupQuotient(res, r, true) ) |
---|
| 4519 | { |
---|
| 4520 | // WarnS("error in nc_SetupQuotient"); // cleanup? rDelete(res); return r; // just go on...? |
---|
| 4521 | } |
---|
| 4522 | |
---|
| 4523 | #endif |
---|
| 4524 | assume(idRankFreeModule(res->qideal, res) == 0); |
---|
| 4525 | } |
---|
| 4526 | |
---|
| 4527 | #ifdef HAVE_PLURAL |
---|
| 4528 | assume((res->qideal==NULL) == (old_ring->qideal==NULL)); |
---|
| 4529 | assume(rIsPluralRing(res) == rIsPluralRing(old_ring)); |
---|
| 4530 | assume(rIsSCA(res) == rIsSCA(old_ring)); |
---|
| 4531 | assume(ncRingType(res) == ncRingType(old_ring)); |
---|
| 4532 | #endif |
---|
| 4533 | |
---|
| 4534 | #if MYTEST |
---|
| 4535 | PrintS("rCurrRingAssure_SyzComp(): res: "); |
---|
| 4536 | rWrite(r); |
---|
| 4537 | #ifdef RDEBUG |
---|
| 4538 | rDebugPrint(r); |
---|
| 4539 | #endif |
---|
| 4540 | PrintLn(); |
---|
| 4541 | #endif |
---|
| 4542 | |
---|
| 4543 | } |
---|
| 4544 | |
---|
| 4545 | return res; |
---|
| 4546 | } |
---|
| 4547 | |
---|
| 4548 | ring rAssure_TDeg(ring r, int start_var, int end_var, int &pos) |
---|
| 4549 | { |
---|
| 4550 | int i; |
---|
| 4551 | if (r->typ!=NULL) |
---|
| 4552 | { |
---|
| 4553 | for(i=r->OrdSize-1;i>=0;i--) |
---|
| 4554 | { |
---|
| 4555 | if ((r->typ[i].ord_typ==ro_dp) |
---|
| 4556 | && (r->typ[i].data.dp.start==start_var) |
---|
| 4557 | && (r->typ[i].data.dp.end==end_var)) |
---|
| 4558 | { |
---|
| 4559 | pos=r->typ[i].data.dp.place; |
---|
| 4560 | //printf("no change, pos=%d\n",pos); |
---|
| 4561 | return r; |
---|
| 4562 | } |
---|
| 4563 | } |
---|
| 4564 | } |
---|
| 4565 | |
---|
| 4566 | #ifdef HAVE_PLURAL |
---|
| 4567 | nc_struct* save=r->GetNC(); |
---|
| 4568 | r->GetNC()=NULL; |
---|
| 4569 | #endif |
---|
| 4570 | ring res=rCopy(r); |
---|
| 4571 | |
---|
| 4572 | i=rBlocks(r); |
---|
| 4573 | int j; |
---|
| 4574 | |
---|
| 4575 | res->ExpL_Size=r->ExpL_Size+1; // one word more in each monom |
---|
| 4576 | res->PolyBin=omGetSpecBin(POLYSIZE + (res->ExpL_Size)*sizeof(long)); |
---|
| 4577 | omFree((ADDRESS)res->ordsgn); |
---|
| 4578 | res->ordsgn=(long *)omAlloc0(res->ExpL_Size*sizeof(long)); |
---|
| 4579 | for(j=0;j<r->CmpL_Size;j++) |
---|
| 4580 | { |
---|
| 4581 | res->ordsgn[j] = r->ordsgn[j]; |
---|
| 4582 | } |
---|
| 4583 | res->OrdSize=r->OrdSize+1; // one block more for pSetm |
---|
| 4584 | if (r->typ!=NULL) |
---|
| 4585 | omFree((ADDRESS)res->typ); |
---|
| 4586 | res->typ=(sro_ord*)omAlloc0(res->OrdSize*sizeof(sro_ord)); |
---|
| 4587 | if (r->typ!=NULL) |
---|
| 4588 | memcpy(res->typ,r->typ,r->OrdSize*sizeof(sro_ord)); |
---|
| 4589 | // the additional block for pSetm: total degree at the last word |
---|
| 4590 | // but not included in the compare part |
---|
| 4591 | res->typ[res->OrdSize-1].ord_typ=ro_dp; |
---|
| 4592 | res->typ[res->OrdSize-1].data.dp.start=start_var; |
---|
| 4593 | res->typ[res->OrdSize-1].data.dp.end=end_var; |
---|
| 4594 | res->typ[res->OrdSize-1].data.dp.place=res->ExpL_Size-1; |
---|
| 4595 | pos=res->ExpL_Size-1; |
---|
| 4596 | //if ((start_var==1) && (end_var==res->N)) res->pOrdIndex=pos; |
---|
| 4597 | extern void p_Setm_General(poly p, ring r); |
---|
| 4598 | res->p_Setm=p_Setm_General; |
---|
| 4599 | // ---------------------------- |
---|
| 4600 | omFree((ADDRESS)res->p_Procs); |
---|
| 4601 | res->p_Procs = (p_Procs_s*)omAlloc(sizeof(p_Procs_s)); |
---|
| 4602 | |
---|
| 4603 | p_ProcsSet(res, res->p_Procs); |
---|
| 4604 | if (res->qideal!=NULL) id_Delete(&res->qideal,res); |
---|
| 4605 | #ifdef HAVE_PLURAL |
---|
| 4606 | r->GetNC()=save; |
---|
| 4607 | if (rIsPluralRing(r)) |
---|
| 4608 | { |
---|
| 4609 | if ( nc_rComplete(r, res, false) ) // no qideal! |
---|
| 4610 | { |
---|
| 4611 | #ifndef NDEBUG |
---|
| 4612 | WarnS("error in nc_rComplete"); |
---|
| 4613 | #endif |
---|
| 4614 | // just go on.. |
---|
| 4615 | } |
---|
| 4616 | } |
---|
| 4617 | #endif |
---|
| 4618 | if (r->qideal!=NULL) |
---|
| 4619 | { |
---|
| 4620 | res->qideal=idrCopyR_NoSort(r->qideal,r, res); |
---|
| 4621 | #ifdef HAVE_PLURAL |
---|
| 4622 | if (rIsPluralRing(res)) |
---|
| 4623 | { |
---|
| 4624 | nc_SetupQuotient(res, currRing); |
---|
| 4625 | } |
---|
| 4626 | assume((res->qideal==NULL) == (r->qideal==NULL)); |
---|
| 4627 | #endif |
---|
| 4628 | } |
---|
| 4629 | |
---|
| 4630 | #ifdef HAVE_PLURAL |
---|
| 4631 | assume(rIsPluralRing(res) == rIsPluralRing(r)); |
---|
| 4632 | assume(rIsSCA(res) == rIsSCA(r)); |
---|
| 4633 | assume(ncRingType(res) == ncRingType(r)); |
---|
| 4634 | #endif |
---|
| 4635 | |
---|
| 4636 | return res; |
---|
| 4637 | } |
---|
| 4638 | |
---|
| 4639 | ring rAssure_HasComp(ring r) |
---|
| 4640 | { |
---|
| 4641 | int last_block; |
---|
| 4642 | int i=0; |
---|
| 4643 | do |
---|
| 4644 | { |
---|
| 4645 | if (r->order[i] == ringorder_c || |
---|
| 4646 | r->order[i] == ringorder_C) return r; |
---|
| 4647 | if (r->order[i] == 0) |
---|
| 4648 | break; |
---|
| 4649 | i++; |
---|
| 4650 | } while (1); |
---|
| 4651 | //WarnS("re-creating ring with comps"); |
---|
| 4652 | last_block=i-1; |
---|
| 4653 | |
---|
| 4654 | ring new_r = rCopy0(r, FALSE, FALSE); |
---|
| 4655 | i+=2; |
---|
| 4656 | new_r->wvhdl=(int **)omAlloc0(i * sizeof(int_ptr)); |
---|
| 4657 | new_r->order = (int *) omAlloc0(i * sizeof(int)); |
---|
| 4658 | new_r->block0 = (int *) omAlloc0(i * sizeof(int)); |
---|
| 4659 | new_r->block1 = (int *) omAlloc0(i * sizeof(int)); |
---|
[611871] | 4660 | memcpy(new_r->order,r->order,(i-1) * sizeof(int)); |
---|
| 4661 | memcpy(new_r->block0,r->block0,(i-1) * sizeof(int)); |
---|
| 4662 | memcpy(new_r->block1,r->block1,(i-1) * sizeof(int)); |
---|
[a6904c] | 4663 | for (int j=0; j<=last_block; j++) |
---|
| 4664 | { |
---|
| 4665 | if (r->wvhdl[j]!=NULL) |
---|
| 4666 | { |
---|
| 4667 | new_r->wvhdl[j] = (int*) omMemDup(r->wvhdl[j]); |
---|
| 4668 | } |
---|
| 4669 | } |
---|
| 4670 | last_block++; |
---|
| 4671 | new_r->order[last_block]=ringorder_C; |
---|
| 4672 | //new_r->block0[last_block]=0; |
---|
| 4673 | //new_r->block1[last_block]=0; |
---|
| 4674 | //new_r->wvhdl[last_block]=NULL; |
---|
| 4675 | |
---|
| 4676 | rComplete(new_r, 1); |
---|
| 4677 | |
---|
| 4678 | #ifdef HAVE_PLURAL |
---|
| 4679 | if (rIsPluralRing(r)) |
---|
| 4680 | { |
---|
| 4681 | if ( nc_rComplete(r, new_r, false) ) // no qideal! |
---|
| 4682 | { |
---|
| 4683 | #ifndef NDEBUG |
---|
| 4684 | WarnS("error in nc_rComplete"); // cleanup?// rDelete(res);// return r; // just go on.. |
---|
| 4685 | #endif |
---|
| 4686 | } |
---|
| 4687 | } |
---|
| 4688 | assume(rIsPluralRing(r) == rIsPluralRing(new_r)); |
---|
| 4689 | #endif |
---|
| 4690 | |
---|
| 4691 | return new_r; |
---|
| 4692 | } |
---|
| 4693 | |
---|
| 4694 | static ring rAssure_CompLastBlock(ring r, BOOLEAN complete = TRUE) |
---|
| 4695 | { |
---|
| 4696 | int last_block = rBlocks(r) - 2; |
---|
| 4697 | if (r->order[last_block] != ringorder_c && |
---|
| 4698 | r->order[last_block] != ringorder_C) |
---|
| 4699 | { |
---|
| 4700 | int c_pos = 0; |
---|
| 4701 | int i; |
---|
| 4702 | |
---|
| 4703 | for (i=0; i< last_block; i++) |
---|
| 4704 | { |
---|
| 4705 | if (r->order[i] == ringorder_c || r->order[i] == ringorder_C) |
---|
| 4706 | { |
---|
| 4707 | c_pos = i; |
---|
| 4708 | break; |
---|
| 4709 | } |
---|
| 4710 | } |
---|
| 4711 | if (c_pos != -1) |
---|
| 4712 | { |
---|
| 4713 | ring new_r = rCopy0(r, FALSE, TRUE); |
---|
| 4714 | for (i=c_pos+1; i<=last_block; i++) |
---|
| 4715 | { |
---|
| 4716 | new_r->order[i-1] = new_r->order[i]; |
---|
| 4717 | new_r->block0[i-1] = new_r->block0[i]; |
---|
| 4718 | new_r->block1[i-1] = new_r->block1[i]; |
---|
| 4719 | new_r->wvhdl[i-1] = new_r->wvhdl[i]; |
---|
| 4720 | } |
---|
| 4721 | new_r->order[last_block] = r->order[c_pos]; |
---|
| 4722 | new_r->block0[last_block] = r->block0[c_pos]; |
---|
| 4723 | new_r->block1[last_block] = r->block1[c_pos]; |
---|
| 4724 | new_r->wvhdl[last_block] = r->wvhdl[c_pos]; |
---|
| 4725 | if (complete) |
---|
| 4726 | { |
---|
| 4727 | rComplete(new_r, 1); |
---|
| 4728 | |
---|
| 4729 | #ifdef HAVE_PLURAL |
---|
| 4730 | if (rIsPluralRing(r)) |
---|
| 4731 | { |
---|
| 4732 | if ( nc_rComplete(r, new_r, false) ) // no qideal! |
---|
| 4733 | { |
---|
| 4734 | #ifndef NDEBUG |
---|
| 4735 | WarnS("error in nc_rComplete"); // cleanup?// rDelete(res);// return r; // just go on.. |
---|
| 4736 | #endif |
---|
| 4737 | } |
---|
| 4738 | } |
---|
| 4739 | assume(rIsPluralRing(r) == rIsPluralRing(new_r)); |
---|
| 4740 | #endif |
---|
| 4741 | } |
---|
| 4742 | return new_r; |
---|
| 4743 | } |
---|
| 4744 | } |
---|
| 4745 | return r; |
---|
| 4746 | } |
---|
| 4747 | |
---|
| 4748 | ring rCurrRingAssure_CompLastBlock() |
---|
| 4749 | { |
---|
| 4750 | ring new_r = rAssure_CompLastBlock(currRing); |
---|
| 4751 | if (currRing != new_r) |
---|
| 4752 | { |
---|
| 4753 | ring old_r = currRing; |
---|
| 4754 | rChangeCurrRing(new_r); |
---|
| 4755 | if (old_r->qideal != NULL) |
---|
| 4756 | { |
---|
| 4757 | new_r->qideal = idrCopyR(old_r->qideal, old_r); |
---|
| 4758 | currQuotient = new_r->qideal; |
---|
| 4759 | #ifdef HAVE_PLURAL |
---|
| 4760 | if( rIsPluralRing(new_r) ) |
---|
| 4761 | if( nc_SetupQuotient(new_r, old_r, true) ) |
---|
| 4762 | { |
---|
| 4763 | #ifndef NDEBUG |
---|
| 4764 | WarnS("error in nc_SetupQuotient"); // cleanup? rDelete(res); return r; // just go on...? |
---|
| 4765 | #endif |
---|
| 4766 | } |
---|
| 4767 | #endif |
---|
| 4768 | } |
---|
| 4769 | |
---|
| 4770 | #ifdef HAVE_PLURAL |
---|
| 4771 | assume((new_r->qideal==NULL) == (old_r->qideal==NULL)); |
---|
| 4772 | assume(rIsPluralRing(new_r) == rIsPluralRing(old_r)); |
---|
| 4773 | assume(rIsSCA(new_r) == rIsSCA(old_r)); |
---|
| 4774 | assume(ncRingType(new_r) == ncRingType(old_r)); |
---|
| 4775 | #endif |
---|
| 4776 | |
---|
| 4777 | rTest(new_r); |
---|
| 4778 | rTest(old_r); |
---|
| 4779 | } |
---|
| 4780 | return new_r; |
---|
| 4781 | } |
---|
| 4782 | |
---|
| 4783 | // Moves _c or _C ordering to the last place AND adds _s on the 1st place |
---|
| 4784 | ring rCurrRingAssure_SyzComp_CompLastBlock() |
---|
| 4785 | { |
---|
| 4786 | ring new_r_1 = rAssure_CompLastBlock(currRing, FALSE); // due to this FALSE - no completion! |
---|
| 4787 | ring new_r = rAssure_SyzComp(new_r_1, FALSE); // new_r_1 is used only here!!! |
---|
| 4788 | |
---|
| 4789 | if (new_r != currRing) |
---|
| 4790 | { |
---|
| 4791 | ring old_r = currRing; |
---|
| 4792 | if (new_r_1 != new_r && new_r_1 != old_r) rDelete(new_r_1); |
---|
| 4793 | rComplete(new_r, 1); |
---|
| 4794 | #ifdef HAVE_PLURAL |
---|
| 4795 | if (rIsPluralRing(old_r)) |
---|
| 4796 | { |
---|
| 4797 | if ( nc_rComplete(old_r, new_r, false) ) // no qideal! |
---|
| 4798 | { |
---|
| 4799 | #ifndef NDEBUG |
---|
| 4800 | WarnS("error in nc_rComplete"); // cleanup? rDelete(res); return r; // just go on...? |
---|
| 4801 | #endif |
---|
| 4802 | } |
---|
| 4803 | } |
---|
| 4804 | assume(rIsPluralRing(new_r) == rIsPluralRing(old_r)); |
---|
| 4805 | #endif |
---|
| 4806 | rChangeCurrRing(new_r); |
---|
| 4807 | if (old_r->qideal != NULL) |
---|
| 4808 | { |
---|
| 4809 | new_r->qideal = idrCopyR(old_r->qideal, old_r); |
---|
| 4810 | currQuotient = new_r->qideal; |
---|
| 4811 | |
---|
| 4812 | #ifdef HAVE_PLURAL |
---|
| 4813 | if( rIsPluralRing(old_r) ) |
---|
| 4814 | if( nc_SetupQuotient(new_r, old_r, true) ) |
---|
| 4815 | { |
---|
| 4816 | #ifndef NDEBUG |
---|
| 4817 | WarnS("error in nc_SetupQuotient"); // cleanup? rDelete(res); return r; // just go on...? |
---|
| 4818 | #endif |
---|
| 4819 | } |
---|
| 4820 | #endif |
---|
| 4821 | } |
---|
| 4822 | |
---|
| 4823 | #ifdef HAVE_PLURAL |
---|
| 4824 | assume((new_r->qideal==NULL) == (old_r->qideal==NULL)); |
---|
| 4825 | assume(rIsPluralRing(new_r) == rIsPluralRing(old_r)); |
---|
| 4826 | assume(rIsSCA(new_r) == rIsSCA(old_r)); |
---|
| 4827 | assume(ncRingType(new_r) == ncRingType(old_r)); |
---|
| 4828 | #endif |
---|
| 4829 | |
---|
| 4830 | rTest(new_r); |
---|
| 4831 | rTest(old_r); |
---|
| 4832 | } |
---|
| 4833 | return new_r; |
---|
| 4834 | } |
---|
| 4835 | |
---|
| 4836 | // use this for global orderings consisting of two blocks |
---|
| 4837 | static ring rCurrRingAssure_Global(rRingOrder_t b1, rRingOrder_t b2) |
---|
| 4838 | { |
---|
| 4839 | int r_blocks = rBlocks(currRing); |
---|
| 4840 | |
---|
| 4841 | assume(b1 == ringorder_c || b1 == ringorder_C || |
---|
| 4842 | b2 == ringorder_c || b2 == ringorder_C || |
---|
| 4843 | b2 == ringorder_S); |
---|
| 4844 | if ((r_blocks == 3) && |
---|
| 4845 | (currRing->order[0] == b1) && |
---|
| 4846 | (currRing->order[1] == b2) && |
---|
| 4847 | (currRing->order[2] == 0)) |
---|
| 4848 | return currRing; |
---|
| 4849 | ring res = rCopy0(currRing, TRUE, FALSE); |
---|
| 4850 | res->order = (int*)omAlloc0(3*sizeof(int)); |
---|
| 4851 | res->block0 = (int*)omAlloc0(3*sizeof(int)); |
---|
| 4852 | res->block1 = (int*)omAlloc0(3*sizeof(int)); |
---|
| 4853 | res->wvhdl = (int**)omAlloc0(3*sizeof(int*)); |
---|
| 4854 | res->order[0] = b1; |
---|
| 4855 | res->order[1] = b2; |
---|
| 4856 | if (b1 == ringorder_c || b1 == ringorder_C) |
---|
| 4857 | { |
---|
| 4858 | res->block0[1] = 1; |
---|
| 4859 | res->block1[1] = currRing->N; |
---|
| 4860 | } |
---|
| 4861 | else |
---|
| 4862 | { |
---|
| 4863 | res->block0[0] = 1; |
---|
| 4864 | res->block1[0] = currRing->N; |
---|
| 4865 | } |
---|
| 4866 | // HANNES: This sould be set in rComplete |
---|
| 4867 | res->OrdSgn = 1; |
---|
| 4868 | rComplete(res, 1); |
---|
| 4869 | #ifdef HAVE_PLURAL |
---|
| 4870 | if (rIsPluralRing(currRing)) |
---|
| 4871 | { |
---|
| 4872 | if ( nc_rComplete(currRing, res, false) ) // no qideal! |
---|
| 4873 | { |
---|
| 4874 | #ifndef NDEBUG |
---|
| 4875 | WarnS("error in nc_rComplete"); |
---|
| 4876 | #endif |
---|
| 4877 | } |
---|
| 4878 | } |
---|
| 4879 | #endif |
---|
| 4880 | rChangeCurrRing(res); |
---|
| 4881 | return res; |
---|
| 4882 | } |
---|
| 4883 | |
---|
| 4884 | ring rAssure_InducedSchreyerOrdering(const ring r, BOOLEAN complete = TRUE, int sgn = 1) |
---|
| 4885 | { // TODO: ???? Add leading Syz-comp ordering here...???? |
---|
| 4886 | |
---|
| 4887 | #if MYTEST |
---|
| 4888 | Print("rAssure_InducedSchreyerOrdering(r, complete = %d, sgn = %d): r: \n", complete, sgn); |
---|
| 4889 | rWrite(r); |
---|
| 4890 | #ifdef RDEBUG |
---|
| 4891 | rDebugPrint(r); |
---|
| 4892 | #endif |
---|
| 4893 | PrintLn(); |
---|
| 4894 | #endif |
---|
[273fed] | 4895 | assume((sgn == 1) || (sgn == -1)); |
---|
[a6904c] | 4896 | |
---|
| 4897 | ring res=rCopy0(r, FALSE, FALSE); // No qideal & ordering copy. |
---|
| 4898 | |
---|
| 4899 | int n = rBlocks(r); // Including trailing zero! |
---|
| 4900 | |
---|
| 4901 | // Create 2 more blocks for prefix/suffix: |
---|
| 4902 | res->order=(int *)omAlloc0((n+2)*sizeof(int)); // 0 .. n+1 |
---|
| 4903 | res->block0=(int *)omAlloc0((n+2)*sizeof(int)); |
---|
| 4904 | res->block1=(int *)omAlloc0((n+2)*sizeof(int)); |
---|
| 4905 | int ** wvhdl =(int **)omAlloc0((n+2)*sizeof(int**)); |
---|
| 4906 | |
---|
| 4907 | // Encapsulate all existing blocks between induced Schreyer ordering markers: prefix and suffix! |
---|
| 4908 | // Note that prefix and suffix have the same ringorder marker and only differ in block[] parameters! |
---|
| 4909 | |
---|
| 4910 | // new 1st block |
---|
| 4911 | int j = 0; |
---|
| 4912 | res->order[j] = ringorder_IS; // Prefix |
---|
[273fed] | 4913 | res->block0[j] = res->block1[j] = 0; |
---|
[a6904c] | 4914 | // wvhdl[j] = NULL; |
---|
| 4915 | j++; |
---|
| 4916 | |
---|
| 4917 | for(int i = 0; (i <= n) && (r->order[i] != 0); i++, j++) // i = [0 .. n-1] <- non-zero old blocks |
---|
| 4918 | { |
---|
| 4919 | res->order [j] = r->order [i]; |
---|
| 4920 | res->block0[j] = r->block0[i]; |
---|
| 4921 | res->block1[j] = r->block1[i]; |
---|
| 4922 | |
---|
| 4923 | if (r->wvhdl[i] != NULL) |
---|
| 4924 | { |
---|
| 4925 | wvhdl[j] = (int*) omMemDup(r->wvhdl[i]); |
---|
| 4926 | } // else wvhdl[j] = NULL; |
---|
| 4927 | } |
---|
| 4928 | |
---|
| 4929 | // new last block |
---|
| 4930 | res->order [j] = ringorder_IS; // Suffix |
---|
| 4931 | res->block0[j] = res->block1[j] = sgn; // Sign of v[o]: 1 for C, -1 for c |
---|
| 4932 | // wvhdl[j] = NULL; |
---|
| 4933 | j++; |
---|
| 4934 | |
---|
| 4935 | // res->order [j] = 0; // The End! |
---|
| 4936 | res->wvhdl = wvhdl; |
---|
| 4937 | |
---|
| 4938 | // j == the last zero block now! |
---|
| 4939 | assume(j == (n+1)); |
---|
| 4940 | assume(res->order[0]==ringorder_IS); |
---|
| 4941 | assume(res->order[j-1]==ringorder_IS); |
---|
| 4942 | assume(res->order[j]==0); |
---|
| 4943 | |
---|
| 4944 | |
---|
| 4945 | if (complete) |
---|
| 4946 | { |
---|
| 4947 | rComplete(res, 1); |
---|
| 4948 | |
---|
| 4949 | #if MYTEST |
---|
| 4950 | PrintS("rAssure_InducedSchreyerOrdering(): temp res: "); |
---|
| 4951 | rWrite(res); |
---|
| 4952 | #ifdef RDEBUG |
---|
| 4953 | rDebugPrint(res); |
---|
| 4954 | #endif |
---|
| 4955 | PrintLn(); |
---|
| 4956 | #endif |
---|
| 4957 | |
---|
| 4958 | #ifdef HAVE_PLURAL |
---|
| 4959 | if (rIsPluralRing(r)) |
---|
| 4960 | { |
---|
| 4961 | if ( nc_rComplete(r, res, false) ) // no qideal! |
---|
| 4962 | { |
---|
| 4963 | #ifndef NDEBUG |
---|
| 4964 | WarnS("error in nc_rComplete"); // cleanup?// rDelete(res);// return r; // just go on.. |
---|
| 4965 | #endif |
---|
| 4966 | } |
---|
| 4967 | } |
---|
| 4968 | assume(rIsPluralRing(r) == rIsPluralRing(res)); |
---|
| 4969 | #endif |
---|
| 4970 | |
---|
| 4971 | |
---|
| 4972 | #ifdef HAVE_PLURAL |
---|
| 4973 | ring old_ring = r; |
---|
| 4974 | |
---|
| 4975 | #if MYTEST |
---|
| 4976 | PrintS("rAssure_InducedSchreyerOrdering(): temp nc res: "); |
---|
| 4977 | rWrite(res); |
---|
| 4978 | #ifdef RDEBUG |
---|
| 4979 | rDebugPrint(res); |
---|
| 4980 | #endif |
---|
| 4981 | PrintLn(); |
---|
| 4982 | #endif |
---|
| 4983 | #endif |
---|
| 4984 | |
---|
| 4985 | if (r->qideal!=NULL) |
---|
| 4986 | { |
---|
| 4987 | res->qideal= idrCopyR_NoSort(r->qideal, r, res); |
---|
| 4988 | |
---|
| 4989 | assume(idRankFreeModule(res->qideal, res) == 0); |
---|
| 4990 | |
---|
| 4991 | #ifdef HAVE_PLURAL |
---|
| 4992 | if( rIsPluralRing(res) ) |
---|
| 4993 | if( nc_SetupQuotient(res, r, true) ) |
---|
| 4994 | { |
---|
| 4995 | // WarnS("error in nc_SetupQuotient"); // cleanup? rDelete(res); return r; // just go on...? |
---|
| 4996 | } |
---|
| 4997 | |
---|
| 4998 | #endif |
---|
| 4999 | assume(idRankFreeModule(res->qideal, res) == 0); |
---|
| 5000 | } |
---|
| 5001 | |
---|
| 5002 | #ifdef HAVE_PLURAL |
---|
| 5003 | assume((res->qideal==NULL) == (old_ring->qideal==NULL)); |
---|
| 5004 | assume(rIsPluralRing(res) == rIsPluralRing(old_ring)); |
---|
| 5005 | assume(rIsSCA(res) == rIsSCA(old_ring)); |
---|
| 5006 | assume(ncRingType(res) == ncRingType(old_ring)); |
---|
| 5007 | #endif |
---|
| 5008 | } |
---|
| 5009 | |
---|
| 5010 | return res; |
---|
| 5011 | } |
---|
| 5012 | |
---|
| 5013 | ring rCurrRingAssure_dp_S() |
---|
| 5014 | { |
---|
| 5015 | return rCurrRingAssure_Global(ringorder_dp, ringorder_S); |
---|
| 5016 | } |
---|
| 5017 | |
---|
| 5018 | ring rCurrRingAssure_dp_C() |
---|
| 5019 | { |
---|
| 5020 | return rCurrRingAssure_Global(ringorder_dp, ringorder_C); |
---|
| 5021 | } |
---|
| 5022 | |
---|
| 5023 | ring rCurrRingAssure_C_dp() |
---|
| 5024 | { |
---|
| 5025 | return rCurrRingAssure_Global(ringorder_C, ringorder_dp); |
---|
| 5026 | } |
---|
| 5027 | |
---|
[273fed] | 5028 | |
---|
| 5029 | |
---|
| 5030 | /// Finds p^th IS ordering, and returns its position in r->typ[] |
---|
| 5031 | /// returns -1 if something went wrong! |
---|
| 5032 | int rGetISPos(const int p = 0, const ring r = currRing) |
---|
| 5033 | { |
---|
| 5034 | // Put the reference set F into the ring -ordering -recor |
---|
| 5035 | #if MYTEST |
---|
| 5036 | Print("rIsIS(p: %d)\nF:", p); |
---|
| 5037 | PrintLn(); |
---|
| 5038 | #endif |
---|
| 5039 | |
---|
| 5040 | if (r->typ==NULL) |
---|
| 5041 | { |
---|
| 5042 | dReportError("'rIsIS:' Error: wrong ring! (typ == NULL)"); |
---|
| 5043 | return -1; |
---|
| 5044 | } |
---|
| 5045 | |
---|
| 5046 | int j = p; // Which IS record to use... |
---|
| 5047 | for( int pos = 0; pos < r->OrdSize; pos++ ) |
---|
| 5048 | if( r->typ[pos].ord_typ == ro_is) |
---|
| 5049 | if( j-- == 0 ) |
---|
| 5050 | { |
---|
| 5051 | return pos; |
---|
| 5052 | } |
---|
| 5053 | |
---|
| 5054 | return -1; |
---|
| 5055 | } |
---|
| 5056 | |
---|
| 5057 | |
---|
| 5058 | |
---|
| 5059 | |
---|
| 5060 | |
---|
| 5061 | |
---|
[a6904c] | 5062 | /// Changes r by setting induced ordering parameters: limit and reference leading terms |
---|
| 5063 | /// F belong to r, we will DO a copy! (same to componentWeights) |
---|
| 5064 | /// We will use it AS IS! |
---|
| 5065 | /// returns true is everything was allright! |
---|
| 5066 | bool rSetISReference(const ideal F, const int i = 0, const int p = 0, const intvec * componentWeights = NULL, const ring r = currRing) |
---|
| 5067 | { |
---|
| 5068 | // Put the reference set F into the ring -ordering -recor |
---|
| 5069 | #if MYTEST |
---|
| 5070 | Print("rSetISReference(F, i: %d, p: %d, w)\nF:", i, p); |
---|
| 5071 | idShow(F, r, r, 1); // currRing! |
---|
| 5072 | PrintLn(); |
---|
| 5073 | PrintS("w: "); |
---|
| 5074 | if(componentWeights == NULL) |
---|
| 5075 | PrintS("NULL\n"); |
---|
| 5076 | else |
---|
| 5077 | componentWeights->show(); |
---|
| 5078 | #endif |
---|
| 5079 | |
---|
| 5080 | // TEST THAT THERE ARE DEGs!!! |
---|
| 5081 | // assume( componentWeights == NULL ); // ??? |
---|
| 5082 | if( componentWeights != NULL ) |
---|
| 5083 | { |
---|
| 5084 | // assure that the ring r has degrees!!! |
---|
| 5085 | // Add weights to degrees of F[i] |
---|
| 5086 | } |
---|
| 5087 | |
---|
| 5088 | if (r->typ==NULL) |
---|
| 5089 | { |
---|
| 5090 | dReportError("Error: WRONG USE of rSetISReference: wrong ring! (typ == NULL)"); |
---|
| 5091 | return false; |
---|
| 5092 | } |
---|
| 5093 | |
---|
[273fed] | 5094 | |
---|
| 5095 | int pos = rGetISPos(p, r); |
---|
| 5096 | |
---|
| 5097 | if( pos == -1 ) |
---|
| 5098 | { |
---|
| 5099 | dReportError("Error: WRONG USE of rSetISReference: specified ordering block was not found!!!" ); |
---|
| 5100 | return false; |
---|
| 5101 | } |
---|
| 5102 | |
---|
[a6904c] | 5103 | #if MYTEST |
---|
[273fed] | 5104 | if( i != r->typ[pos].data.is.limit ) |
---|
| 5105 | Print("Changing record on pos: %d\nOld limit: %d --->> New Limit: %d\n", pos, r->typ[pos].data.is.limit, i); |
---|
[a6904c] | 5106 | #endif |
---|
| 5107 | |
---|
[273fed] | 5108 | const ideal FF = id_Copy(F, r); // idrHeadR(F, r, r); |
---|
[a6904c] | 5109 | |
---|
| 5110 | |
---|
[273fed] | 5111 | if( r->typ[pos].data.is.F != NULL) |
---|
| 5112 | { |
---|
[a6904c] | 5113 | #if MYTEST |
---|
[273fed] | 5114 | PrintS("Deleting old reference set F... \n"); // idShow(r->typ[pos].data.is.F, r); PrintLn(); |
---|
[a6904c] | 5115 | #endif |
---|
[273fed] | 5116 | id_Delete(&r->typ[pos].data.is.F, r); |
---|
| 5117 | r->typ[pos].data.is.F = NULL; |
---|
| 5118 | } |
---|
[a6904c] | 5119 | |
---|
[273fed] | 5120 | assume(r->typ[pos].data.is.F == NULL); |
---|
[a6904c] | 5121 | |
---|
[273fed] | 5122 | r->typ[pos].data.is.F = FF; // F is owened by ring now! TODO: delete at the end! |
---|
[a6904c] | 5123 | |
---|
[273fed] | 5124 | if(r->typ[pos].data.is.componentWeights != NULL) |
---|
| 5125 | { |
---|
[a6904c] | 5126 | #if MYTEST |
---|
[273fed] | 5127 | PrintS("Deleting old componentWeights: "); r->typ[pos].data.is.componentWeights->show(); PrintLn(); |
---|
[a6904c] | 5128 | #endif |
---|
[273fed] | 5129 | delete r->typ[pos].data.is.componentWeights; |
---|
| 5130 | r->typ[pos].data.is.componentWeights = NULL; |
---|
| 5131 | } |
---|
[a6904c] | 5132 | |
---|
| 5133 | |
---|
[273fed] | 5134 | assume(r->typ[pos].data.is.componentWeights == NULL); |
---|
[a6904c] | 5135 | |
---|
[273fed] | 5136 | if( componentWeights != NULL ) |
---|
| 5137 | componentWeights = ivCopy(componentWeights); // componentWeights is owened by ring now! TODO: delete at the end! |
---|
[a6904c] | 5138 | |
---|
[273fed] | 5139 | r->typ[pos].data.is.componentWeights = componentWeights; |
---|
[a6904c] | 5140 | |
---|
[273fed] | 5141 | r->typ[pos].data.is.limit = i; // First induced component |
---|
[a6904c] | 5142 | |
---|
| 5143 | #if MYTEST |
---|
[273fed] | 5144 | PrintS("New reference set FF : \n"); idShow(FF, r, r, 1); PrintLn(); |
---|
[a6904c] | 5145 | #endif |
---|
| 5146 | |
---|
[273fed] | 5147 | return true; |
---|
[a6904c] | 5148 | } |
---|
| 5149 | |
---|
| 5150 | |
---|
| 5151 | void rSetSyzComp(int k) |
---|
| 5152 | { |
---|
[273fed] | 5153 | if(k < 0) |
---|
| 5154 | { |
---|
| 5155 | dReportError("rSetSyzComp with negative limit!"); |
---|
| 5156 | return; |
---|
| 5157 | } |
---|
| 5158 | |
---|
| 5159 | assume( k >= 0 ); |
---|
[a6904c] | 5160 | if (TEST_OPT_PROT) Print("{%d}", k); |
---|
| 5161 | if ((currRing->typ!=NULL) && (currRing->typ[0].ord_typ==ro_syz)) |
---|
| 5162 | { |
---|
[273fed] | 5163 | if( k == currRing->typ[0].data.syz.limit ) |
---|
| 5164 | return; // nothing to do |
---|
| 5165 | |
---|
[a6904c] | 5166 | int i; |
---|
| 5167 | if (currRing->typ[0].data.syz.limit == 0) |
---|
| 5168 | { |
---|
| 5169 | currRing->typ[0].data.syz.syz_index = (int*) omAlloc0((k+1)*sizeof(int)); |
---|
| 5170 | currRing->typ[0].data.syz.syz_index[0] = 0; |
---|
| 5171 | currRing->typ[0].data.syz.curr_index = 1; |
---|
| 5172 | } |
---|
| 5173 | else |
---|
| 5174 | { |
---|
| 5175 | currRing->typ[0].data.syz.syz_index = (int*) |
---|
| 5176 | omReallocSize(currRing->typ[0].data.syz.syz_index, |
---|
| 5177 | (currRing->typ[0].data.syz.limit+1)*sizeof(int), |
---|
| 5178 | (k+1)*sizeof(int)); |
---|
| 5179 | } |
---|
| 5180 | for (i=currRing->typ[0].data.syz.limit + 1; i<= k; i++) |
---|
| 5181 | { |
---|
| 5182 | currRing->typ[0].data.syz.syz_index[i] = |
---|
| 5183 | currRing->typ[0].data.syz.curr_index; |
---|
| 5184 | } |
---|
[273fed] | 5185 | if(k < currRing->typ[0].data.syz.limit) // ? |
---|
| 5186 | { |
---|
| 5187 | #ifndef NDEBUG |
---|
| 5188 | Warn("rSetSyzComp called with smaller limit (%d) as before (%d)", k, currRing->typ[0].data.syz.limit); |
---|
| 5189 | #endif |
---|
| 5190 | currRing->typ[0].data.syz.curr_index = 1 + currRing->typ[0].data.syz.syz_index[k]; |
---|
| 5191 | } |
---|
| 5192 | |
---|
| 5193 | |
---|
[a6904c] | 5194 | currRing->typ[0].data.syz.limit = k; |
---|
| 5195 | currRing->typ[0].data.syz.curr_index++; |
---|
| 5196 | } |
---|
| 5197 | else if( |
---|
| 5198 | (currRing->typ!=NULL) && |
---|
| 5199 | (currRing->typ[0].ord_typ==ro_isTemp) |
---|
| 5200 | ) |
---|
| 5201 | { |
---|
| 5202 | // (currRing->typ[currRing->typ[0].data.isTemp.suffixpos].data.is.limit == k) |
---|
| 5203 | #ifndef NDEBUG |
---|
| 5204 | Warn("rSetSyzComp(%d) in an IS ring! Be careful!", k); |
---|
| 5205 | #endif |
---|
| 5206 | } |
---|
| 5207 | else |
---|
| 5208 | if ((currRing->order[0]!=ringorder_c) && (k!=0)) // ??? |
---|
| 5209 | { |
---|
| 5210 | dReportError("syzcomp in incompatible ring"); |
---|
| 5211 | } |
---|
| 5212 | #ifdef PDEBUG |
---|
| 5213 | extern int pDBsyzComp; |
---|
| 5214 | pDBsyzComp=k; |
---|
| 5215 | #endif |
---|
| 5216 | } |
---|
| 5217 | |
---|
| 5218 | // return the max-comonent wchich has syzIndex i |
---|
| 5219 | int rGetMaxSyzComp(int i) |
---|
| 5220 | { |
---|
| 5221 | if ((currRing->typ!=NULL) && (currRing->typ[0].ord_typ==ro_syz) && |
---|
| 5222 | currRing->typ[0].data.syz.limit > 0 && i > 0) |
---|
| 5223 | { |
---|
| 5224 | assume(i <= currRing->typ[0].data.syz.limit); |
---|
| 5225 | int j; |
---|
| 5226 | for (j=0; j<currRing->typ[0].data.syz.limit; j++) |
---|
| 5227 | { |
---|
| 5228 | if (currRing->typ[0].data.syz.syz_index[j] == i && |
---|
| 5229 | currRing->typ[0].data.syz.syz_index[j+1] != i) |
---|
| 5230 | { |
---|
| 5231 | assume(currRing->typ[0].data.syz.syz_index[j+1] == i+1); |
---|
| 5232 | return j; |
---|
| 5233 | } |
---|
| 5234 | } |
---|
| 5235 | return currRing->typ[0].data.syz.limit; |
---|
| 5236 | } |
---|
| 5237 | else |
---|
| 5238 | { |
---|
| 5239 | return 0; |
---|
| 5240 | } |
---|
| 5241 | } |
---|
| 5242 | |
---|
| 5243 | BOOLEAN rRing_is_Homog(ring r) |
---|
| 5244 | { |
---|
| 5245 | if (r == NULL) return FALSE; |
---|
| 5246 | int i, j, nb = rBlocks(r); |
---|
| 5247 | for (i=0; i<nb; i++) |
---|
| 5248 | { |
---|
| 5249 | if (r->wvhdl[i] != NULL) |
---|
| 5250 | { |
---|
| 5251 | int length = r->block1[i] - r->block0[i]; |
---|
| 5252 | int* wvhdl = r->wvhdl[i]; |
---|
| 5253 | if (r->order[i] == ringorder_M) length *= length; |
---|
| 5254 | assume(omSizeOfAddr(wvhdl) >= length*sizeof(int)); |
---|
| 5255 | |
---|
| 5256 | for (j=0; j< length; j++) |
---|
| 5257 | { |
---|
| 5258 | if (wvhdl[j] != 0 && wvhdl[j] != 1) return FALSE; |
---|
| 5259 | } |
---|
| 5260 | } |
---|
| 5261 | } |
---|
| 5262 | return TRUE; |
---|
| 5263 | } |
---|
| 5264 | |
---|
| 5265 | BOOLEAN rRing_has_CompLastBlock(ring r) |
---|
| 5266 | { |
---|
| 5267 | assume(r != NULL); |
---|
| 5268 | int lb = rBlocks(r) - 2; |
---|
| 5269 | return (r->order[lb] == ringorder_c || r->order[lb] == ringorder_C); |
---|
| 5270 | } |
---|
| 5271 | |
---|
| 5272 | n_coeffType rFieldType(ring r) |
---|
| 5273 | { |
---|
| 5274 | if (rField_is_Zp(r)) return n_Zp; |
---|
| 5275 | if (rField_is_Q(r)) return n_Q; |
---|
| 5276 | if (rField_is_R(r)) return n_R; |
---|
| 5277 | if (rField_is_GF(r)) return n_GF; |
---|
| 5278 | if (rField_is_long_R(r)) return n_long_R; |
---|
| 5279 | if (rField_is_Zp_a(r)) return n_Zp_a; |
---|
| 5280 | if (rField_is_Q_a(r)) return n_Q_a; |
---|
| 5281 | if (rField_is_long_C(r)) return n_long_C; |
---|
| 5282 | #ifdef HAVE_RINGS |
---|
| 5283 | if (rField_is_Ring_Z(r)) return n_Z; |
---|
| 5284 | if (rField_is_Ring_ModN(r)) return n_Zm; |
---|
| 5285 | if (rField_is_Ring_PtoM(r)) return n_Zpn; |
---|
| 5286 | if (rField_is_Ring_2toM(r)) return n_Z2n; |
---|
| 5287 | #endif |
---|
| 5288 | |
---|
| 5289 | return n_unknown; |
---|
| 5290 | } |
---|
| 5291 | |
---|
| 5292 | int64 * rGetWeightVec(ring r) |
---|
| 5293 | { |
---|
| 5294 | assume(r!=NULL); |
---|
| 5295 | assume(r->OrdSize>0); |
---|
| 5296 | int i=0; |
---|
| 5297 | while((r->typ[i].ord_typ!=ro_wp64) && (r->typ[i].ord_typ>0)) i++; |
---|
| 5298 | assume(r->typ[i].ord_typ==ro_wp64); |
---|
| 5299 | return (int64*)(r->typ[i].data.wp64.weights64); |
---|
| 5300 | } |
---|
| 5301 | |
---|
| 5302 | void rSetWeightVec(ring r, int64 *wv) |
---|
| 5303 | { |
---|
| 5304 | assume(r!=NULL); |
---|
| 5305 | assume(r->OrdSize>0); |
---|
| 5306 | assume(r->typ[0].ord_typ==ro_wp64); |
---|
| 5307 | memcpy(r->typ[0].data.wp64.weights64,wv,r->N*sizeof(int64)); |
---|
| 5308 | } |
---|
| 5309 | |
---|
| 5310 | #include <ctype.h> |
---|
| 5311 | |
---|
[bbcf1d2] | 5312 | static int rRealloc1(ring r, int size, int pos) |
---|
[a6904c] | 5313 | { |
---|
| 5314 | r->order=(int*)omReallocSize(r->order, size*sizeof(int), (size+1)*sizeof(int)); |
---|
| 5315 | r->block0=(int*)omReallocSize(r->block0, size*sizeof(int), (size+1)*sizeof(int)); |
---|
| 5316 | r->block1=(int*)omReallocSize(r->block1, size*sizeof(int), (size+1)*sizeof(int)); |
---|
| 5317 | r->wvhdl=(int_ptr*)omReallocSize(r->wvhdl,size*sizeof(int_ptr), (size+1)*sizeof(int_ptr)); |
---|
| 5318 | for(int k=size; k>pos; k--) r->wvhdl[k]=r->wvhdl[k-1]; |
---|
| 5319 | r->order[size]=0; |
---|
| 5320 | size++; |
---|
| 5321 | return size; |
---|
| 5322 | } |
---|
[896561] | 5323 | //static int rReallocM1(ring r, ring src, int size, int pos) |
---|
| 5324 | //{ |
---|
| 5325 | // r->order=(int*)omReallocSize(r->order, size*sizeof(int), (size-1)*sizeof(int)); |
---|
| 5326 | // r->block0=(int*)omReallocSize(r->block0, size*sizeof(int), (size-1)*sizeof(int)); |
---|
| 5327 | // r->block1=(int*)omReallocSize(r->block1, size*sizeof(int), (size-1)*sizeof(int)); |
---|
| 5328 | // r->wvhdl=(int_ptr*)omReallocSize(r->wvhdl,size*sizeof(int_ptr), (size-1)*sizeof(int_ptr)); |
---|
| 5329 | // for(int k=pos+1; k<size; k++) r->wvhdl[k]=r->wvhdl[k+1]; |
---|
| 5330 | // size--; |
---|
| 5331 | // return size; |
---|
| 5332 | //} |
---|
[a6904c] | 5333 | static void rOppWeight(int *w, int l) |
---|
| 5334 | { |
---|
| 5335 | int i2=(l+1)/2; |
---|
| 5336 | for(int j=0; j<=i2; j++) |
---|
| 5337 | { |
---|
| 5338 | int t=w[j]; |
---|
| 5339 | w[j]=w[l-j]; |
---|
| 5340 | w[l-j]=t; |
---|
| 5341 | } |
---|
| 5342 | } |
---|
| 5343 | |
---|
| 5344 | #define rOppVar(R,I) (rVar(R)+1-I) |
---|
| 5345 | |
---|
| 5346 | ring rOpposite(ring src) |
---|
| 5347 | /* creates an opposite algebra of R */ |
---|
| 5348 | /* that is R^opp, where f (*^opp) g = g*f */ |
---|
| 5349 | /* treats the case of qring */ |
---|
| 5350 | { |
---|
| 5351 | if (src == NULL) return(NULL); |
---|
| 5352 | |
---|
| 5353 | #ifdef RDEBUG |
---|
| 5354 | rTest(src); |
---|
| 5355 | #endif |
---|
| 5356 | |
---|
| 5357 | ring save = currRing; |
---|
| 5358 | rChangeCurrRing(src); |
---|
| 5359 | |
---|
| 5360 | #ifdef RDEBUG |
---|
| 5361 | rTest(src); |
---|
| 5362 | // rWrite(src); |
---|
| 5363 | // rDebugPrint(src); |
---|
| 5364 | #endif |
---|
| 5365 | |
---|
| 5366 | |
---|
| 5367 | // ring r = rCopy0(src,TRUE); /* TRUE for copy the qideal: Why??? */ |
---|
| 5368 | ring r = rCopy0(src,FALSE); /* qideal will be deleted later on!!! */ |
---|
| 5369 | |
---|
| 5370 | /* rChangeCurrRing(r); */ |
---|
| 5371 | // change vars v1..vN -> vN..v1 |
---|
| 5372 | int i; |
---|
| 5373 | int i2 = (rVar(r)-1)/2; |
---|
| 5374 | for(i=i2; i>=0; i--) |
---|
| 5375 | { |
---|
| 5376 | // index: 0..N-1 |
---|
| 5377 | //Print("ex var names: %d <-> %d\n",i,rOppVar(r,i)); |
---|
| 5378 | // exchange names |
---|
| 5379 | char *p; |
---|
| 5380 | p = r->names[rVar(r)-1-i]; |
---|
| 5381 | r->names[rVar(r)-1-i] = r->names[i]; |
---|
| 5382 | r->names[i] = p; |
---|
| 5383 | } |
---|
| 5384 | // i2=(rVar(r)+1)/2; |
---|
| 5385 | // for(int i=i2; i>0; i--) |
---|
| 5386 | // { |
---|
| 5387 | // // index: 1..N |
---|
| 5388 | // //Print("ex var places: %d <-> %d\n",i,rVar(r)+1-i); |
---|
| 5389 | // // exchange VarOffset |
---|
| 5390 | // int t; |
---|
| 5391 | // t=r->VarOffset[i]; |
---|
| 5392 | // r->VarOffset[i]=r->VarOffset[rOppVar(r,i)]; |
---|
| 5393 | // r->VarOffset[rOppVar(r,i)]=t; |
---|
| 5394 | // } |
---|
| 5395 | // change names: |
---|
| 5396 | for (i=rVar(r)-1; i>=0; i--) |
---|
| 5397 | { |
---|
| 5398 | char *p=r->names[i]; |
---|
| 5399 | if(isupper(*p)) *p = tolower(*p); |
---|
| 5400 | else *p = toupper(*p); |
---|
| 5401 | } |
---|
| 5402 | // change ordering: listing |
---|
| 5403 | // change ordering: compare |
---|
| 5404 | // for(i=0; i<r->OrdSize; i++) |
---|
| 5405 | // { |
---|
| 5406 | // int t,tt; |
---|
| 5407 | // switch(r->typ[i].ord_typ) |
---|
| 5408 | // { |
---|
| 5409 | // case ro_dp: |
---|
| 5410 | // // |
---|
| 5411 | // t=r->typ[i].data.dp.start; |
---|
| 5412 | // r->typ[i].data.dp.start=rOppVar(r,r->typ[i].data.dp.end); |
---|
| 5413 | // r->typ[i].data.dp.end=rOppVar(r,t); |
---|
| 5414 | // break; |
---|
| 5415 | // case ro_wp: |
---|
| 5416 | // case ro_wp_neg: |
---|
| 5417 | // { |
---|
| 5418 | // t=r->typ[i].data.wp.start; |
---|
| 5419 | // r->typ[i].data.wp.start=rOppVar(r,r->typ[i].data.wp.end); |
---|
| 5420 | // r->typ[i].data.wp.end=rOppVar(r,t); |
---|
| 5421 | // // invert r->typ[i].data.wp.weights |
---|
| 5422 | // rOppWeight(r->typ[i].data.wp.weights, |
---|
| 5423 | // r->typ[i].data.wp.end-r->typ[i].data.wp.start); |
---|
| 5424 | // break; |
---|
| 5425 | // } |
---|
| 5426 | // //case ro_wp64: |
---|
| 5427 | // case ro_syzcomp: |
---|
| 5428 | // case ro_syz: |
---|
| 5429 | // WerrorS("not implemented in rOpposite"); |
---|
| 5430 | // // should not happen |
---|
| 5431 | // break; |
---|
| 5432 | // |
---|
| 5433 | // case ro_cp: |
---|
| 5434 | // t=r->typ[i].data.cp.start; |
---|
| 5435 | // r->typ[i].data.cp.start=rOppVar(r,r->typ[i].data.cp.end); |
---|
| 5436 | // r->typ[i].data.cp.end=rOppVar(r,t); |
---|
| 5437 | // break; |
---|
| 5438 | // case ro_none: |
---|
| 5439 | // default: |
---|
| 5440 | // Werror("unknown type in rOpposite(%d)",r->typ[i].ord_typ); |
---|
| 5441 | // break; |
---|
| 5442 | // } |
---|
| 5443 | // } |
---|
| 5444 | // Change order/block structures (needed for rPrint, rAdd etc.) |
---|
| 5445 | int j=0; |
---|
| 5446 | int l=rBlocks(src); |
---|
| 5447 | for(i=0; src->order[i]!=0; i++) |
---|
| 5448 | { |
---|
| 5449 | switch (src->order[i]) |
---|
| 5450 | { |
---|
| 5451 | case ringorder_c: /* c-> c */ |
---|
| 5452 | case ringorder_C: /* C-> C */ |
---|
| 5453 | case ringorder_no /*=0*/: /* end-of-block */ |
---|
| 5454 | r->order[j]=src->order[i]; |
---|
| 5455 | j++; break; |
---|
| 5456 | case ringorder_lp: /* lp -> rp */ |
---|
| 5457 | r->order[j]=ringorder_rp; |
---|
| 5458 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5459 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5460 | break; |
---|
| 5461 | case ringorder_rp: /* rp -> lp */ |
---|
| 5462 | r->order[j]=ringorder_lp; |
---|
| 5463 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5464 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5465 | break; |
---|
| 5466 | case ringorder_dp: /* dp -> a(1..1),ls */ |
---|
| 5467 | { |
---|
[bbcf1d2] | 5468 | l=rRealloc1(r,l,j); |
---|
[a6904c] | 5469 | r->order[j]=ringorder_a; |
---|
| 5470 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5471 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5472 | r->wvhdl[j]=(int*)omAlloc((r->block1[j]-r->block0[j]+1)*sizeof(int)); |
---|
| 5473 | for(int k=r->block0[j]; k<=r->block1[j]; k++) |
---|
| 5474 | r->wvhdl[j][k-r->block0[j]]=1; |
---|
| 5475 | j++; |
---|
| 5476 | r->order[j]=ringorder_ls; |
---|
| 5477 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5478 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5479 | j++; |
---|
| 5480 | break; |
---|
| 5481 | } |
---|
| 5482 | case ringorder_Dp: /* Dp -> a(1..1),rp */ |
---|
| 5483 | { |
---|
[bbcf1d2] | 5484 | l=rRealloc1(r,l,j); |
---|
[a6904c] | 5485 | r->order[j]=ringorder_a; |
---|
| 5486 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5487 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5488 | r->wvhdl[j]=(int*)omAlloc((r->block1[j]-r->block0[j]+1)*sizeof(int)); |
---|
| 5489 | for(int k=r->block0[j]; k<=r->block1[j]; k++) |
---|
| 5490 | r->wvhdl[j][k-r->block0[j]]=1; |
---|
| 5491 | j++; |
---|
| 5492 | r->order[j]=ringorder_rp; |
---|
| 5493 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5494 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5495 | j++; |
---|
| 5496 | break; |
---|
| 5497 | } |
---|
| 5498 | case ringorder_wp: /* wp -> a(...),ls */ |
---|
| 5499 | { |
---|
[bbcf1d2] | 5500 | l=rRealloc1(r,l,j); |
---|
[a6904c] | 5501 | r->order[j]=ringorder_a; |
---|
| 5502 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5503 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
[a41623] | 5504 | r->wvhdl[j]=r->wvhdl[j+1]; r->wvhdl[j+1]=NULL; |
---|
[a6904c] | 5505 | rOppWeight(r->wvhdl[j], r->block1[j]-r->block0[j]); |
---|
| 5506 | j++; |
---|
| 5507 | r->order[j]=ringorder_ls; |
---|
| 5508 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5509 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5510 | j++; |
---|
| 5511 | break; |
---|
| 5512 | } |
---|
| 5513 | case ringorder_Wp: /* Wp -> a(...),rp */ |
---|
| 5514 | { |
---|
[bbcf1d2] | 5515 | l=rRealloc1(r,l,j); |
---|
[a6904c] | 5516 | r->order[j]=ringorder_a; |
---|
| 5517 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5518 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
[896561] | 5519 | r->wvhdl[j]=r->wvhdl[j+1]; r->wvhdl[j+1]=NULL; |
---|
[a6904c] | 5520 | rOppWeight(r->wvhdl[j], r->block1[j]-r->block0[j]); |
---|
| 5521 | j++; |
---|
| 5522 | r->order[j]=ringorder_rp; |
---|
| 5523 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5524 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5525 | j++; |
---|
| 5526 | break; |
---|
| 5527 | } |
---|
| 5528 | case ringorder_M: /* M -> M */ |
---|
| 5529 | { |
---|
| 5530 | r->order[j]=ringorder_M; |
---|
| 5531 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5532 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5533 | int n=r->block1[j]-r->block0[j]; |
---|
| 5534 | /* M is a (n+1)x(n+1) matrix */ |
---|
| 5535 | for (int nn=0; nn<=n; nn++) |
---|
| 5536 | { |
---|
| 5537 | rOppWeight(&(r->wvhdl[j][nn*(n+1)]), n /*r->block1[j]-r->block0[j]*/); |
---|
| 5538 | } |
---|
| 5539 | j++; |
---|
| 5540 | break; |
---|
| 5541 | } |
---|
| 5542 | case ringorder_a: /* a(...),ls -> wp/dp */ |
---|
| 5543 | { |
---|
| 5544 | r->block0[j]=rOppVar(r, src->block1[i]); |
---|
| 5545 | r->block1[j]=rOppVar(r, src->block0[i]); |
---|
| 5546 | rOppWeight(r->wvhdl[j], r->block1[j]-r->block0[j]); |
---|
| 5547 | if (src->order[i+1]==ringorder_ls) |
---|
| 5548 | { |
---|
| 5549 | r->order[j]=ringorder_wp; |
---|
| 5550 | i++; |
---|
| 5551 | //l=rReallocM1(r,src,l,j); |
---|
| 5552 | } |
---|
| 5553 | else |
---|
| 5554 | { |
---|
| 5555 | r->order[j]=ringorder_a; |
---|
| 5556 | } |
---|
| 5557 | j++; |
---|
| 5558 | break; |
---|
| 5559 | } |
---|
| 5560 | // not yet done: |
---|
| 5561 | case ringorder_ls: |
---|
| 5562 | case ringorder_rs: |
---|
| 5563 | case ringorder_ds: |
---|
| 5564 | case ringorder_Ds: |
---|
| 5565 | case ringorder_ws: |
---|
| 5566 | case ringorder_Ws: |
---|
| 5567 | // should not occur: |
---|
| 5568 | case ringorder_S: |
---|
| 5569 | case ringorder_IS: |
---|
| 5570 | case ringorder_s: |
---|
| 5571 | case ringorder_aa: |
---|
| 5572 | case ringorder_L: |
---|
| 5573 | case ringorder_unspec: |
---|
| 5574 | Werror("order %s not (yet) supported", rSimpleOrdStr(src->order[i])); |
---|
| 5575 | break; |
---|
| 5576 | } |
---|
| 5577 | } |
---|
| 5578 | rComplete(r); |
---|
| 5579 | |
---|
| 5580 | |
---|
| 5581 | #ifdef RDEBUG |
---|
| 5582 | rTest(r); |
---|
| 5583 | #endif |
---|
| 5584 | |
---|
| 5585 | rChangeCurrRing(r); |
---|
| 5586 | |
---|
| 5587 | #ifdef RDEBUG |
---|
| 5588 | rTest(r); |
---|
| 5589 | // rWrite(r); |
---|
| 5590 | // rDebugPrint(r); |
---|
| 5591 | #endif |
---|
| 5592 | |
---|
| 5593 | |
---|
| 5594 | #ifdef HAVE_PLURAL |
---|
| 5595 | // now, we initialize a non-comm structure on r |
---|
| 5596 | if (rIsPluralRing(src)) |
---|
| 5597 | { |
---|
| 5598 | assume( currRing == r); |
---|
| 5599 | |
---|
| 5600 | int *perm = (int *)omAlloc0((rVar(r)+1)*sizeof(int)); |
---|
| 5601 | int *par_perm = NULL; |
---|
| 5602 | nMapFunc nMap = nSetMap(src); |
---|
| 5603 | int ni,nj; |
---|
| 5604 | for(i=1; i<=r->N; i++) |
---|
| 5605 | { |
---|
| 5606 | perm[i] = rOppVar(r,i); |
---|
| 5607 | } |
---|
| 5608 | |
---|
| 5609 | matrix C = mpNew(rVar(r),rVar(r)); |
---|
| 5610 | matrix D = mpNew(rVar(r),rVar(r)); |
---|
| 5611 | |
---|
| 5612 | for (i=1; i< rVar(r); i++) |
---|
| 5613 | { |
---|
| 5614 | for (j=i+1; j<=rVar(r); j++) |
---|
| 5615 | { |
---|
| 5616 | ni = r->N +1 - i; |
---|
| 5617 | nj = r->N +1 - j; /* i<j ==> nj < ni */ |
---|
| 5618 | |
---|
| 5619 | assume(MATELEM(src->GetNC()->C,i,j) != NULL); |
---|
| 5620 | MATELEM(C,nj,ni) = pPermPoly(MATELEM(src->GetNC()->C,i,j),perm,src,nMap,par_perm,src->P); |
---|
| 5621 | |
---|
| 5622 | if(MATELEM(src->GetNC()->D,i,j) != NULL) |
---|
| 5623 | MATELEM(D,nj,ni) = pPermPoly(MATELEM(src->GetNC()->D,i,j),perm,src,nMap,par_perm,src->P); |
---|
| 5624 | } |
---|
| 5625 | } |
---|
| 5626 | |
---|
| 5627 | idTest((ideal)C); |
---|
| 5628 | idTest((ideal)D); |
---|
| 5629 | |
---|
| 5630 | if (nc_CallPlural(C, D, NULL, NULL, r, false, false, true, r)) // no qring setup! |
---|
| 5631 | WarnS("Error initializing non-commutative multiplication!"); |
---|
| 5632 | |
---|
| 5633 | #ifdef RDEBUG |
---|
| 5634 | rTest(r); |
---|
| 5635 | // rWrite(r); |
---|
| 5636 | // rDebugPrint(r); |
---|
| 5637 | #endif |
---|
| 5638 | |
---|
| 5639 | assume( r->GetNC()->IsSkewConstant == src->GetNC()->IsSkewConstant); |
---|
| 5640 | |
---|
| 5641 | omFreeSize((ADDRESS)perm,(rVar(r)+1)*sizeof(int)); |
---|
| 5642 | } |
---|
| 5643 | #endif /* HAVE_PLURAL */ |
---|
| 5644 | |
---|
| 5645 | /* now oppose the qideal for qrings */ |
---|
| 5646 | if (src->qideal != NULL) |
---|
| 5647 | { |
---|
| 5648 | id_Delete(&(r->qideal), r); |
---|
| 5649 | |
---|
| 5650 | #ifdef HAVE_PLURAL |
---|
| 5651 | r->qideal = idOppose(src, src->qideal); // into the currRing: r |
---|
| 5652 | #else |
---|
| 5653 | r->qideal = id_Copy(src->qideal, currRing); // ? |
---|
| 5654 | #endif |
---|
| 5655 | |
---|
| 5656 | #ifdef HAVE_PLURAL |
---|
| 5657 | if( rIsPluralRing(r) ) |
---|
| 5658 | { |
---|
| 5659 | nc_SetupQuotient(r); |
---|
| 5660 | #ifdef RDEBUG |
---|
| 5661 | rTest(r); |
---|
| 5662 | // rWrite(r); |
---|
| 5663 | // rDebugPrint(r); |
---|
| 5664 | #endif |
---|
| 5665 | } |
---|
| 5666 | #endif |
---|
| 5667 | } |
---|
| 5668 | #ifdef HAVE_PLURAL |
---|
| 5669 | if( rIsPluralRing(r) ) |
---|
| 5670 | assume( ncRingType(r) == ncRingType(src) ); |
---|
| 5671 | #endif |
---|
| 5672 | rTest(r); |
---|
| 5673 | |
---|
| 5674 | rChangeCurrRing(save); |
---|
| 5675 | return r; |
---|
| 5676 | } |
---|
| 5677 | |
---|
| 5678 | ring rEnvelope(ring R) |
---|
| 5679 | /* creates an enveloping algebra of R */ |
---|
| 5680 | /* that is R^e = R \tensor_K R^opp */ |
---|
| 5681 | { |
---|
| 5682 | ring Ropp = rOpposite(R); |
---|
| 5683 | ring Renv = NULL; |
---|
| 5684 | int stat = rSum(R, Ropp, Renv); /* takes care of qideals */ |
---|
| 5685 | if ( stat <=0 ) |
---|
| 5686 | WarnS("Error in rEnvelope at rSum"); |
---|
| 5687 | rTest(Renv); |
---|
| 5688 | return Renv; |
---|
| 5689 | } |
---|
| 5690 | |
---|
| 5691 | #ifdef HAVE_PLURAL |
---|
| 5692 | BOOLEAN nc_rComplete(const ring src, ring dest, bool bSetupQuotient) |
---|
| 5693 | /* returns TRUE is there were errors */ |
---|
| 5694 | /* dest is actualy equals src with the different ordering */ |
---|
| 5695 | /* we map src->nc correctly to dest->src */ |
---|
| 5696 | /* to be executed after rComplete, before rChangeCurrRing */ |
---|
| 5697 | { |
---|
| 5698 | // NOTE: Originally used only by idElimination to transfer NC structure to dest |
---|
| 5699 | // ring created by dirty hack (without nc_CallPlural) |
---|
| 5700 | rTest(src); |
---|
| 5701 | |
---|
| 5702 | assume(!rIsPluralRing(dest)); // destination must be a newly constructed commutative ring |
---|
| 5703 | |
---|
| 5704 | if (!rIsPluralRing(src)) |
---|
| 5705 | { |
---|
| 5706 | return FALSE; |
---|
| 5707 | } |
---|
| 5708 | |
---|
| 5709 | const int N = dest->N; |
---|
| 5710 | |
---|
| 5711 | assume(src->N == N); |
---|
| 5712 | |
---|
| 5713 | ring save = currRing; |
---|
| 5714 | |
---|
| 5715 | if (dest != save) |
---|
| 5716 | rChangeCurrRing(dest); |
---|
| 5717 | |
---|
| 5718 | const ring srcBase = src; |
---|
| 5719 | |
---|
| 5720 | assume( nSetMap(srcBase) == nSetMap(currRing) ); // currRing is important here! |
---|
| 5721 | |
---|
| 5722 | matrix C = mpNew(N,N); // ring independent |
---|
| 5723 | matrix D = mpNew(N,N); |
---|
| 5724 | |
---|
| 5725 | matrix C0 = src->GetNC()->C; |
---|
| 5726 | matrix D0 = src->GetNC()->D; |
---|
| 5727 | |
---|
| 5728 | // map C and D into dest |
---|
| 5729 | for (int i = 1; i < N; i++) |
---|
| 5730 | { |
---|
| 5731 | for (int j = i + 1; j <= N; j++) |
---|
| 5732 | { |
---|
| 5733 | const number n = n_Copy(p_GetCoeff(MATELEM(C0,i,j), srcBase), srcBase); // src, mapping for coeffs into currRing = dest! |
---|
| 5734 | const poly p = p_NSet(n, dest); |
---|
| 5735 | MATELEM(C,i,j) = p; |
---|
| 5736 | if (MATELEM(D0,i,j) != NULL) |
---|
| 5737 | MATELEM(D,i,j) = prCopyR(MATELEM(D0,i,j), srcBase, dest); // ? |
---|
| 5738 | } |
---|
| 5739 | } |
---|
| 5740 | /* One must test C and D _only_ in r->GetNC()->basering!!! not in r!!! */ |
---|
| 5741 | |
---|
| 5742 | idTest((ideal)C); // in dest! |
---|
| 5743 | idTest((ideal)D); |
---|
| 5744 | |
---|
| 5745 | if (nc_CallPlural(C, D, NULL, NULL, dest, bSetupQuotient, false, true, dest)) // also takes care about quotient ideal |
---|
| 5746 | { |
---|
| 5747 | //WarnS("Error transferring non-commutative structure"); |
---|
| 5748 | // error message should be in the interpreter interface |
---|
| 5749 | |
---|
| 5750 | mpDelete(&C, dest); |
---|
| 5751 | mpDelete(&D, dest); |
---|
| 5752 | |
---|
| 5753 | if (currRing != save) |
---|
| 5754 | rChangeCurrRing(save); |
---|
| 5755 | |
---|
| 5756 | return TRUE; |
---|
| 5757 | } |
---|
| 5758 | |
---|
| 5759 | // mpDelete(&C, dest); // used by nc_CallPlural! |
---|
| 5760 | // mpDelete(&D, dest); |
---|
| 5761 | |
---|
| 5762 | if (dest != save) |
---|
| 5763 | rChangeCurrRing(save); |
---|
| 5764 | |
---|
| 5765 | assume(rIsPluralRing(dest)); |
---|
| 5766 | return FALSE; |
---|
| 5767 | } |
---|
| 5768 | #endif |
---|
| 5769 | |
---|
| 5770 | void rModify_a_to_A(ring r) |
---|
| 5771 | // to be called BEFORE rComplete: |
---|
| 5772 | // changes every Block with a(...) to A(...) |
---|
| 5773 | { |
---|
| 5774 | int i=0; |
---|
| 5775 | int j; |
---|
| 5776 | while(r->order[i]!=0) |
---|
| 5777 | { |
---|
| 5778 | if (r->order[i]==ringorder_a) |
---|
| 5779 | { |
---|
| 5780 | r->order[i]=ringorder_a64; |
---|
| 5781 | int *w=r->wvhdl[i]; |
---|
| 5782 | int64 *w64=(int64 *)omAlloc((r->block1[i]-r->block0[i]+1)*sizeof(int64)); |
---|
| 5783 | for(j=r->block1[i]-r->block0[i];j>=0;j--) |
---|
| 5784 | w64[j]=(int64)w[j]; |
---|
| 5785 | r->wvhdl[i]=(int*)w64; |
---|
| 5786 | omFreeSize(w,(r->block1[i]-r->block0[i]+1)*sizeof(int)); |
---|
| 5787 | } |
---|
| 5788 | i++; |
---|
| 5789 | } |
---|
| 5790 | } |
---|